diff --git a/SQCSim2021.sln b/SQCSim2021.sln index a4beb16..13eae87 100644 --- a/SQCSim2021.sln +++ b/SQCSim2021.sln @@ -1,31 +1,20 @@  -Microsoft Visual Studio Solution File, Format Version 12.00 -# Visual Studio Version 16 -VisualStudioVersion = 16.0.31624.102 -MinimumVisualStudioVersion = 10.0.40219.1 -Project("{8BC9CEB8-8B4A-11D0-8D11-00A0C91BC942}") = "SQCSim2021", "SQCSim2021\SQCSim2021.vcxproj", "{90AE3964-E572-47EC-A7FB-B550481DC822}" +Microsoft Visual Studio Solution File, Format Version 11.00 +# Visual Studio 2012 +Project("{8BC9CEB8-8B4A-11D0-8D11-00A0C91BC942}") = "mcclone", "mcclone\mcclone.vcxproj", "{A21FD938-1FEA-4687-AB86-0EABAC30877B}" EndProject Global GlobalSection(SolutionConfigurationPlatforms) = preSolution - Debug|x64 = Debug|x64 - Debug|x86 = Debug|x86 - Release|x64 = Release|x64 - Release|x86 = Release|x86 + Debug|Win32 = Debug|Win32 + Release|Win32 = Release|Win32 EndGlobalSection GlobalSection(ProjectConfigurationPlatforms) = postSolution - {90AE3964-E572-47EC-A7FB-B550481DC822}.Debug|x64.ActiveCfg = Debug|x64 - {90AE3964-E572-47EC-A7FB-B550481DC822}.Debug|x64.Build.0 = Debug|x64 - {90AE3964-E572-47EC-A7FB-B550481DC822}.Debug|x86.ActiveCfg = Debug|Win32 - {90AE3964-E572-47EC-A7FB-B550481DC822}.Debug|x86.Build.0 = Debug|Win32 - {90AE3964-E572-47EC-A7FB-B550481DC822}.Release|x64.ActiveCfg = Release|x64 - {90AE3964-E572-47EC-A7FB-B550481DC822}.Release|x64.Build.0 = Release|x64 - {90AE3964-E572-47EC-A7FB-B550481DC822}.Release|x86.ActiveCfg = Release|Win32 - {90AE3964-E572-47EC-A7FB-B550481DC822}.Release|x86.Build.0 = Release|Win32 + {A21FD938-1FEA-4687-AB86-0EABAC30877B}.Debug|Win32.ActiveCfg = Debug|Win32 + {A21FD938-1FEA-4687-AB86-0EABAC30877B}.Debug|Win32.Build.0 = Debug|Win32 + {A21FD938-1FEA-4687-AB86-0EABAC30877B}.Release|Win32.ActiveCfg = Release|Win32 + {A21FD938-1FEA-4687-AB86-0EABAC30877B}.Release|Win32.Build.0 = Release|Win32 EndGlobalSection GlobalSection(SolutionProperties) = preSolution HideSolutionNode = FALSE EndGlobalSection - GlobalSection(ExtensibilityGlobals) = postSolution - SolutionGuid = {422CB8A4-C8D4-44CC-9478-D867DE3AFFDA} - EndGlobalSection EndGlobal diff --git a/SQCSim2021/SQCSim2021.vcxproj b/SQCSim2021/SQCSim2021.vcxproj deleted file mode 100644 index 35d96b4..0000000 --- a/SQCSim2021/SQCSim2021.vcxproj +++ /dev/null @@ -1,160 +0,0 @@ - - - - - Debug - Win32 - - - Release - Win32 - - - Debug - x64 - - - Release - x64 - - - - 16.0 - Win32Proj - {90ae3964-e572-47ec-a7fb-b550481dc822} - SQCSim2021 - 10.0 - - - - Application - true - v142 - Unicode - - - Application - false - v142 - true - Unicode - - - Application - true - v142 - Unicode - - - Application - false - v142 - true - Unicode - - - - - - - - - - - - - - - - - - - - - true - - - false - - - true - - - false - - - - Level3 - true - WIN32;_DEBUG;_CONSOLE;%(PreprocessorDefinitions) - true - - - Console - true - - - - - Level3 - true - true - true - WIN32;NDEBUG;_CONSOLE;%(PreprocessorDefinitions) - true - - - Console - true - true - true - - - - - Level3 - true - _DEBUG;_CONSOLE;%(PreprocessorDefinitions) - true - - - Console - true - - - - - Level3 - true - true - true - NDEBUG;_CONSOLE;%(PreprocessorDefinitions) - true - - - Console - true - true - true - - - - - - - - - - - - - - - - - - - - - - \ No newline at end of file diff --git a/SQCSim2021/SQCSim2021.vcxproj.filters b/SQCSim2021/SQCSim2021.vcxproj.filters deleted file mode 100644 index f06cd67..0000000 --- a/SQCSim2021/SQCSim2021.vcxproj.filters +++ /dev/null @@ -1,51 +0,0 @@ - - - - - {4FC737F1-C7A5-4376-A066-2A32D752A2FF} - cpp;c;cc;cxx;c++;cppm;ixx;def;odl;idl;hpj;bat;asm;asmx - - - {93995380-89BD-4b04-88EB-625FBE52EBFB} - h;hh;hpp;hxx;h++;hm;inl;inc;ipp;xsd - - - {67DA6AB6-F800-4c08-8B7A-83BB121AAD01} - rc;ico;cur;bmp;dlg;rc2;rct;bin;rgs;gif;jpg;jpeg;jpe;resx;tiff;tif;png;wav;mfcribbon-ms - - - - - Header Files - - - Header Files - - - Header Files - - - Header Files - - - Header Files - - - - - Source Files - - - Source Files - - - Source Files - - - Source Files - - - - - - \ No newline at end of file diff --git a/SQCSim2021/blockarray3d.cpp b/SQCSim2021/blockarray3d.cpp deleted file mode 100644 index 78b866a..0000000 --- a/SQCSim2021/blockarray3d.cpp +++ /dev/null @@ -1,26 +0,0 @@ -#include "blockarray3d.h" - -BlockArray3d::BlockArray3d(int x, int y, int z) : m_x(x), m_y(y), m_z(z) { - m_blocks = new BlockType[x * y * z]; - Reset(BTYPE_AIR); -} - -BlockArray3d::BlockArray3d(BlockArray3d& ba) : m_x(ba.m_x), m_y(ba.m_y), m_z(ba.m_z) { - m_blocks = new BlockType[ba.m_x*ba.m_y*ba.m_z]; - - for (int index = 0; index < (m_x * m_y * m_z); ++index) - m_blocks[index] = ba.m_blocks[index]; -} - -BlockArray3d::~BlockArray3d() { delete[] m_blocks; } - -void BlockArray3d::Set(int x, int y, int z, BlockType type) { m_blocks[GetPosition(x, y, z)] = type; } - -BlockType BlockArray3d::Get(int x, int y, int z) const { return m_blocks[GetPosition(x, y, z)]; } - -void BlockArray3d::Reset(BlockType type) { - for (int index = 0; index < (m_x * m_y * m_z); ++index) - m_blocks[index] = type; -} - -int BlockArray3d::GetPosition(int x, int y, int z) const { return x + (z * m_x) + (y * m_z * m_x); } diff --git a/SQCSim2021/blockarray3d.h b/SQCSim2021/blockarray3d.h deleted file mode 100644 index f169cf2..0000000 --- a/SQCSim2021/blockarray3d.h +++ /dev/null @@ -1,24 +0,0 @@ -#ifndef BLOCKARRAY3D_H__ -#define BLOCKARRAY3D_H__ - -#include "define.h" - -class BlockArray3d { -public: - BlockArray3d(int x, int y, int z); - BlockArray3d(BlockArray3d& ba); - virtual ~BlockArray3d(); - - void Set(int x, int y, int z, BlockType type); - BlockType Get(int x, int y, int z) const; - void Reset(BlockType type); - -private: - BlockType* m_blocks; - int m_x; - int m_y; - int m_z; - - int GetPosition(int x, int y, int z) const; -}; -#endif \ No newline at end of file diff --git a/SQCSim2021/blockinfo.cpp b/SQCSim2021/blockinfo.cpp deleted file mode 100644 index 9205100..0000000 --- a/SQCSim2021/blockinfo.cpp +++ /dev/null @@ -1,13 +0,0 @@ -#include "blockinfo.h" - -BlockInfo::BlockInfo(BlockType type, const std::string& name): m_name(name), m_type(type) { m_durability = 0; } - -BlockInfo::~BlockInfo() { } - -BlockType BlockInfo::GetType() const { return m_type; } - -void BlockInfo::SetDurability(int durability) { m_durability = durability; } - -int BlockInfo::GetDurability() const { return m_durability; } - -void BlockInfo::Show() const { std::cout << "Name: " << m_name << "; Type " << m_type << "; Durability: " << m_durability << std::endl; } diff --git a/SQCSim2021/blockinfo.h b/SQCSim2021/blockinfo.h deleted file mode 100644 index 9ef279f..0000000 --- a/SQCSim2021/blockinfo.h +++ /dev/null @@ -1,23 +0,0 @@ -#ifndef BLOCKINFO_H__ -#define BLOCKINFO_H__ - -#include "define.h" - -class BlockInfo { -public: - BlockInfo(BlockType type, const std::string& name); - ~BlockInfo(); - - BlockType GetType() const; - - void SetDurability(int durability); - int GetDurability() const; - void Show() const; - -private: - std::string m_name; - int m_durability; - BlockType m_type; -}; -#endif - diff --git a/SQCSim2021/chunk.cpp b/SQCSim2021/chunk.cpp deleted file mode 100644 index 579e355..0000000 --- a/SQCSim2021/chunk.cpp +++ /dev/null @@ -1,13 +0,0 @@ -#include "chunk.h" - -Chunk::Chunk(): BlockArray3d(CHUNK_SIZE_X, CHUNK_SIZE_Y, CHUNK_SIZE_Z) {} - -Chunk::Chunk(Chunk& chk) : BlockArray3d(chk) {} - -Chunk::~Chunk() {} - -void Chunk::RemoveBlock(int x, int y, int z) { Set(x, y, z, BTYPE_AIR); } - -void Chunk::SetBlock(int x, int y, int z, BlockType type) { Set(x, y, z, type); } - -BlockType Chunk::GetBlock(int x, int y, int z) const { return Get(x, y, z); } diff --git a/SQCSim2021/chunk.h b/SQCSim2021/chunk.h deleted file mode 100644 index 4045b1a..0000000 --- a/SQCSim2021/chunk.h +++ /dev/null @@ -1,20 +0,0 @@ -#ifndef CHUNK_H__ -#define CHUNK_H__ - -#include "define.h" -#include "blockarray3d.h" - -class Chunk : public BlockArray3d { -public: - Chunk(); - Chunk(Chunk& chk); - virtual ~Chunk(); - - void RemoveBlock(int x, int y, int z); - void SetBlock(int x, int y, int z, BlockType type); - BlockType GetBlock(int x, int y, int z) const; - -}; - -#endif - diff --git a/SQCSim2021/define.h b/SQCSim2021/define.h deleted file mode 100644 index d4413d5..0000000 --- a/SQCSim2021/define.h +++ /dev/null @@ -1,17 +0,0 @@ -#ifndef DEFINE_H__ -#define DEFINE_H__ - -#include -#include - -#define CHUNK_SIZE_X 16 -#define CHUNK_SIZE_Y 128 -#define CHUNK_SIZE_Z 16 - -enum BlockType { - BTYPE_AIR, - BTYPE_DIRT, - BTYPE_GRASS -}; - -#endif diff --git a/SQCSim2021/main.cpp b/SQCSim2021/main.cpp deleted file mode 100644 index 920ebbf..0000000 --- a/SQCSim2021/main.cpp +++ /dev/null @@ -1,64 +0,0 @@ -#include "main.h" - -int main() { - - Chunk* testchunk = new Chunk(); - std::vector testblock; - - std::cout << "-Test 1-------BlockInfo------------------" << std::endl; - - testblock.push_back(new BlockInfo(BTYPE_AIR, "The air in the sky")); - testblock.push_back(new BlockInfo(BTYPE_DIRT, "The dirt on the ground")); - testblock.push_back(new BlockInfo(BTYPE_GRASS, "The grass on the dirt")); - - testblock[1]->SetDurability(5); - testblock[2]->SetDurability(6); - - for (int index = 0; index < testblock.size(); ++index) - testblock[index]->Show(); - - std::cout << "GetDurability: " << testblock[0]->GetDurability() << " and " << testblock[1]->GetDurability() << " and " << testblock[2]->GetDurability() << std::endl; - std::cout << "GetType: " << testblock[0]->GetType() << " and " << testblock[1]->GetType() << " and " << testblock[2]->GetType() << std::endl; - - std::cout << std::endl; - std::cout << "-Test 2--------Chunk/BlockArray3D---------" << std::endl; - testchunk->SetBlock(1, 0, 0, BTYPE_DIRT); - testchunk->SetBlock(2, 0, 0, BTYPE_GRASS); - testblock.push_back(new BlockInfo(testchunk->GetBlock(0, 0, 0), "A new block in the chunk")); - testblock.push_back(new BlockInfo(testchunk->GetBlock(1, 0, 0), "A dirty block in the chunk")); - testblock.push_back(new BlockInfo(testchunk->GetBlock(2, 0, 0), "A grassy block in the chunk")); - - for (int index = 3; index < testblock.size(); ++index) - testblock[index]->Show(); - - std::cout << std::endl; - std::cout << "-Test 3--------Chunk Copy------------------" << std::endl; - Chunk testchunkcopy(*testchunk); - - delete testchunk; - - testblock.push_back(new BlockInfo(testchunkcopy.GetBlock(0, 0, 0), "A block in a copied chunk")); - testblock.push_back(new BlockInfo(testchunkcopy.GetBlock(1, 0, 0), "A dirty block in a copied chunk")); - testblock.push_back(new BlockInfo(testchunkcopy.GetBlock(1, 0, 0), "A grassy block in a copied chunk")); - - for (int index = 6; index < testblock.size(); ++index) - testblock[index]->Show(); - - std::cout << std::endl; - std::cout << "-Test 3--------Chunk Reset/Remove Block-----" << std::endl; - testchunkcopy.Reset(BTYPE_GRASS); - testchunkcopy.RemoveBlock(3, 0, 0); - testchunkcopy.SetBlock(4, 0, 0, BTYPE_DIRT); - - testblock.clear(); - - for (int index = 0; index < 10; ++index) - testblock.push_back(new BlockInfo(testchunkcopy.GetBlock(index, 0, 0), "A block in a reset chunk containing lots of grass")); - - for (int index = 0; index < testblock.size(); ++index) - testblock[index]->Show(); - - testblock.clear(); - - return 0; -} diff --git a/SQCSim2021/main.h b/SQCSim2021/main.h deleted file mode 100644 index e124f29..0000000 --- a/SQCSim2021/main.h +++ /dev/null @@ -1,11 +0,0 @@ -#ifndef MAIN_H__ -#define MAIN_H__ - -#include - -#include "define.h" -#include "chunk.h" -#include "blockinfo.h" - -#endif - diff --git a/mcclone/Makefile b/mcclone/Makefile new file mode 100644 index 0000000..5d1cc75 --- /dev/null +++ b/mcclone/Makefile @@ -0,0 +1,64 @@ +SRCS = $(wildcard *.cpp) +OBJS = $(SRCS:.cpp=.o) +BINFILE = ./mcclone +CC = g++ + +COMPILER_FLAGS = -I/usr/X11R6/include -I/usr/local/include -I./external/noise/include -I./external/enet-1.3.1/include -finline-functions -std=c++11 +LINKER_FLAGS = -lm -L/usr/X11R6/lib -L/usr/local/lib -lGL -lGLU -lpthread -lsfml-graphics -lsfml-window -lsfml-system -lsndfile -lopenal -lsfml-audio -lXrandr -lIL -lILU -lX11 -ldl -lGLEW + +# Release: +#CFLAGS = -O3 -fomit-frame-pointer -ffast-math -w $(COMPILER_FLAGS) +#LFLAGS = $(LINKER_FLAGS) + +# Debug: +CFLAGS = -g -W -Wall $(COMPILER_FLAGS) -Wno-write-strings -Wno-unused-parameter -Wno-switch -Wno-reorder -DDEBUGMODE -DDEBUG +LFLAGS = $(LINKER_FLAGS) + +# Profiling: +#CFLAGS = -pg -W -Wall $(COMPILER_FLAGS) -Wno-write-strings +#LFLAGS = -pg $(LINKER_FLAGS) + +all : $(BINFILE) + +$(BINFILE) : $(OBJS) + @echo Linking to $(BINFILE)... + @$(CC) $(OBJS) -o $(BINFILE) $(LFLAGS) + +%.o : %.cpp + @echo CC $@ + @$(CC) $(CFLAGS) -c $< -o $@ + +%.o : %.cc + @echo CC $@ + @$(CC) $(CFLAGS) -c $< -o $@ + +%.o : %.C + @echo CC $@ + @$(CC) $(CFLAGS) -c $< -o $@ + +%.o : %.cxx + @echo CC $@ + @$(CC) $(CFLAGS) -c $< -o $@ + +strip: + @strip $(BINFILE) + +clean: + @rm -f Makefile.bak + @rm -f $(OBJS) + @rm -f gmon.out + @rm -f profiler_output.txt + @rm -f $(BINFILE) + +depend: + @$(CC) -MM $(CFLAGS) $(SRCS) > Makefile.dep + @make -s clean + +info: + @echo SRCS: $(SRCS) + @echo OBJS: $(OBJS) + @echo $(BINFILE) + + +include Makefile.dep + diff --git a/mcclone/blockarray3d.cpp b/mcclone/blockarray3d.cpp new file mode 100644 index 0000000..fe12b35 --- /dev/null +++ b/mcclone/blockarray3d.cpp @@ -0,0 +1,41 @@ +#include "blockarray3d.h" + +BlockArray3d::BlockArray3d(int x, int y, int z) : m_x(x), m_y(y), m_z(z) +{ + m_blocks = new BlockType[m_x * m_y * m_z]; + + Reset(BTYPE_AIR); +} + +BlockArray3d::~BlockArray3d() +{ + delete [] m_blocks; +} + +BlockArray3d::BlockArray3d(const BlockArray3d& array) : m_x(array.m_x), m_y(array.m_y), m_z(array.m_z) +{ + m_blocks = new BlockType[m_x * m_y * m_z]; + for(int i = 0; i < m_x * m_y * m_z; ++i) + m_blocks[i] = array.m_blocks[i]; +} + +void BlockArray3d::Set(int x, int y, int z, BlockType type) +{ + m_blocks[To1dIndex(x, y, z)] = type; +} + +BlockType BlockArray3d::Get(int x, int y, int z) const +{ + return m_blocks[To1dIndex(x, y, z)]; +} + +void BlockArray3d::Reset(BlockType type) +{ + for(int i = 0; i < m_x * m_y * m_z; ++i) + m_blocks[i] = type; +} + +int BlockArray3d::To1dIndex(int x, int y, int z) const +{ + return x + (z * m_x) + (y * m_z * m_x); +} diff --git a/mcclone/blockarray3d.h b/mcclone/blockarray3d.h new file mode 100644 index 0000000..818eef3 --- /dev/null +++ b/mcclone/blockarray3d.h @@ -0,0 +1,26 @@ +#ifndef BLOCKARRAY3D_H__ +#define BLOCKARRAY3D_H__ + +#include "define.h" + +class BlockArray3d +{ + public: + BlockArray3d(int x, int y, int z); + ~BlockArray3d(); + BlockArray3d(const BlockArray3d& array); + + void Set(int x, int y, int z, BlockType type); + BlockType Get(int x, int y, int z) const; + + void Reset(BlockType type); + + private: + int To1dIndex(int x, int y, int z) const; + + private: + int m_x, m_y, m_z; + BlockType* m_blocks; +}; + +#endif // BLOCKARRAY3D_H__ diff --git a/mcclone/blockinfo.cpp b/mcclone/blockinfo.cpp new file mode 100644 index 0000000..e4670b7 --- /dev/null +++ b/mcclone/blockinfo.cpp @@ -0,0 +1,34 @@ +#include "blockinfo.h" +#include + +BlockInfo::BlockInfo(BlockType type, const std::string& name) : m_type(type), m_name(name), m_durability(1) +{ +} + +BlockInfo::~BlockInfo() +{ +} + +BlockType BlockInfo::GetType() const +{ + return m_type; +} + +void BlockInfo::SetDurability(int durability) +{ + m_durability = durability; +} + +int BlockInfo::GetDurability() const +{ + return m_durability; +} + +void BlockInfo::Show() const +{ + std::cout << "Type: " << m_type << std::endl; + std::cout << "Nom: " << m_name << std::endl; + std::cout << "Durabilite: " << m_durability << std::endl; +} + + diff --git a/mcclone/blockinfo.h b/mcclone/blockinfo.h new file mode 100644 index 0000000..3b6c880 --- /dev/null +++ b/mcclone/blockinfo.h @@ -0,0 +1,27 @@ +#ifndef BLOCKINFO_H__ +#define BLOCKINFO_H__ + +#include +#include "define.h" + +class BlockInfo +{ + public: + BlockInfo(BlockType type, const std::string& name); + ~BlockInfo(); + + BlockType GetType() const; + + void SetDurability(int durability); + int GetDurability() const; + + void Show() const; + + private: + BlockType m_type; + std::string m_name; + int m_durability; + +}; + +#endif // BLOCKINFO_H__ diff --git a/mcclone/chunk.cpp b/mcclone/chunk.cpp new file mode 100644 index 0000000..32b8fcb --- /dev/null +++ b/mcclone/chunk.cpp @@ -0,0 +1,25 @@ +#include "chunk.h" + +Chunk::Chunk() : BlockArray3d(CHUNK_SIZE_X, CHUNK_SIZE_Y, CHUNK_SIZE_Z) +{ +} + +Chunk::~Chunk() +{ +} + +void Chunk::RemoveBlock(int x, int y, int z) +{ + Set(x, y, z, BTYPE_AIR); +} + +void Chunk::SetBlock(int x, int y, int z, BlockType type) +{ + Set(x, y, z, type); +} + +BlockType Chunk::GetBlock(int x, int y, int z) +{ + return Get(x, y, z); +} + diff --git a/mcclone/chunk.h b/mcclone/chunk.h new file mode 100644 index 0000000..46030e5 --- /dev/null +++ b/mcclone/chunk.h @@ -0,0 +1,16 @@ +#ifndef CHUNK_H__ +#define CHUNK_H__ +#include "blockarray3d.h" + +class Chunk : public BlockArray3d +{ + public: + Chunk(); + ~Chunk(); + + void RemoveBlock(int x, int y, int z); + void SetBlock(int x, int y, int z, BlockType type); + BlockType GetBlock(int x, int y, int z); +}; + +#endif // CHUNK_H__ diff --git a/mcclone/define.h b/mcclone/define.h new file mode 100644 index 0000000..1b1f83c --- /dev/null +++ b/mcclone/define.h @@ -0,0 +1,25 @@ +#ifndef DEFINE_H__ +#define DEFINE_H__ + +#include +#include + +#ifdef _WIN32 +#include +#include +#include +#else +#include +#endif + +#define CHUNK_SIZE_X 16 +#define CHUNK_SIZE_Y 128 +#define CHUNK_SIZE_Z 16 + +enum BlockType {BTYPE_AIR, BTYPE_DIRT, BTYPE_GRASS}; + + +#define TEXTURE_PATH "../mcclone/media/textures/" +#define VIEW_DISTANCE 128 + +#endif // DEFINE_H__ diff --git a/mcclone/engine.cpp b/mcclone/engine.cpp new file mode 100644 index 0000000..74aa6b5 --- /dev/null +++ b/mcclone/engine.cpp @@ -0,0 +1,189 @@ +#include "engine.h" +#include +#include +#include + +Engine::Engine() +{ +} + +Engine::~Engine() +{ +} + +void Engine::Init() +{ + glClearColor(0.0f, 0.0f, 0.0f, 1.0f); + glEnable(GL_TEXTURE_2D); + + glMatrixMode(GL_PROJECTION); + glLoadIdentity(); + gluPerspective(45.0f, (float)Width() / (float)Height(), 0.0001f, 1000.0f); + glEnable(GL_DEPTH_TEST); + glHint(GL_PERSPECTIVE_CORRECTION_HINT, GL_NICEST); + glShadeModel(GL_SMOOTH); + glEnable(GL_LIGHTING); + glEnable(GL_LINE_SMOOTH); + + // Light + GLfloat light0Pos[4] = { 0.0f, CHUNK_SIZE_Y, 0.0f, 1.0f }; + GLfloat light0Amb[4] = { 0.9f, 0.9f, 0.9f, 1.0f }; + GLfloat light0Diff[4] = { 1.0f, 1.0f, 1.0f, 1.0f }; + GLfloat light0Spec[4] = { 0.2f, 0.2f, 0.2f, 1.0f }; + + glEnable(GL_LIGHT0); + glLightfv(GL_LIGHT0, GL_POSITION, light0Pos); + glLightfv(GL_LIGHT0, GL_AMBIENT, light0Amb); + glLightfv(GL_LIGHT0, GL_DIFFUSE, light0Diff); + glLightfv(GL_LIGHT0, GL_SPECULAR, light0Spec); + + CenterMouse(); + HideCursor(); +} + +void Engine::DeInit() +{ +} + +void Engine::LoadResource() +{ + LoadTexture(m_textureFloor, TEXTURE_PATH "checker.png"); +} + +void Engine::UnloadResource() +{ +} + +void Engine::Render(float elapsedTime) +{ + static float gameTime = elapsedTime; + + gameTime += elapsedTime; + + glClear(GL_COLOR_BUFFER_BIT | GL_DEPTH_BUFFER_BIT); + + // Transformations initiales + glMatrixMode(GL_MODELVIEW); + glLoadIdentity(); + + // Plancher + // Les vertex doivent etre affiches dans le sens anti-horaire (CCW) + m_textureFloor.Bind(); + float nbRep = 50.f; + glBegin(GL_QUADS); + glNormal3f(0, 1, 0); // Normal vector + glTexCoord2f(0, 0); + glVertex3f(-100.f, -2.f, 100.f); + glTexCoord2f(nbRep, 0); + glVertex3f(100.f, -2.f, 100.f); + glTexCoord2f(nbRep, nbRep); + glVertex3f(100.f, -2.f, -100.f); + glTexCoord2f(0, nbRep); + glVertex3f(-100.f, -2.f, -100.f); + glEnd(); +} + +void Engine::KeyPressEvent(unsigned char key) +{ + switch(key) + { + case 36: // ESC + Stop(); + break; + case 94: // F10 + SetFullscreen(!IsFullscreen()); + break; + case 22: // W + if (!m_keyW) { + std::cout << "W " << (int)key << std::endl; + m_keyW = true; + } + break; + case 0: // A + if (!m_keyA) { + std::cout << "A " << (int)key << std::endl; + m_keyA = true; + } + break; + case 18: // S + if (!m_keyS) { + std::cout << "S " << (int)key << std::endl; + m_keyS = true; + } + break; + case 3: // D + if (!m_keyD) { + std::cout << "D " << (int)key << std::endl; + m_keyD = true; + } + break; + default: + std::cout << "Unhandled key: " << (int)key << std::endl; + } +} + +void Engine::KeyReleaseEvent(unsigned char key) +{ + switch(key) + { + case 24: // Y + m_wireframe = !m_wireframe; + if(m_wireframe) + glPolygonMode(GL_FRONT_AND_BACK, GL_LINE); + else + glPolygonMode(GL_FRONT_AND_BACK, GL_FILL); + break; + case 22: // W + std::cout << "rW " << (int)key << std::endl; + m_keyW = false; + break; + case 0: // A + std::cout << "rA " << (int)key << std::endl; + m_keyA = false; + break; + case 18: // S + std::cout << "rS " << (int)key << std::endl; + m_keyS = false; + break; + case 3: // D + std::cout << "rD " << (int)key << std::endl; + m_keyD = false; + break; + } +} + +void Engine::MouseMoveEvent(int x, int y) +{ + // Centrer la souris seulement si elle n'est pas déjà centrée + // Il est nécessaire de faire la vérification pour éviter de tomber + // dans une boucle infinie où l'appel à CenterMouse génère un + // MouseMoveEvent, qui rapelle CenterMouse qui rapelle un autre + // MouseMoveEvent, etc + if(x == (Width() / 2) && y == (Height() / 2)) + return; + + CenterMouse(); +} + +void Engine::MousePressEvent(const MOUSE_BUTTON& button, int x, int y) +{ +} + +void Engine::MouseReleaseEvent(const MOUSE_BUTTON& button, int x, int y) +{ +} + +bool Engine::LoadTexture(Texture& texture, const std::string& filename, bool stopOnError) +{ + texture.Load(filename); + if(!texture.IsValid()) + { + std::cerr << "Unable to load texture (" << filename << ")" << std::endl; + if(stopOnError) + Stop(); + + return false; + } + + return true; +} diff --git a/mcclone/engine.h b/mcclone/engine.h new file mode 100644 index 0000000..43b8d2b --- /dev/null +++ b/mcclone/engine.h @@ -0,0 +1,37 @@ +#ifndef ENGINE_H__ +#define ENGINE_H__ +#include "define.h" +#include "openglcontext.h" +#include "texture.h" + +class Engine : public OpenglContext +{ +public: + Engine(); + virtual ~Engine(); + virtual void Init(); + virtual void DeInit(); + virtual void LoadResource(); + virtual void UnloadResource(); + virtual void Render(float elapsedTime); + virtual void KeyPressEvent(unsigned char key); + virtual void KeyReleaseEvent(unsigned char key); + virtual void MouseMoveEvent(int x, int y); + virtual void MousePressEvent(const MOUSE_BUTTON &button, int x, int y); + virtual void MouseReleaseEvent(const MOUSE_BUTTON &button, int x, int y); + +private: + bool LoadTexture(Texture& texture, const std::string& filename, bool stopOnError = true); + +private: + bool m_wireframe = false; + + Texture m_textureFloor; + + bool m_keyW = false; + bool m_keyA = false; + bool m_keyS = false; + bool m_keyD = false; +}; + +#endif // ENGINE_H__ diff --git a/mcclone/external/devil178/include/IL/config.h b/mcclone/external/devil178/include/IL/config.h new file mode 100644 index 0000000..b9fe5dc --- /dev/null +++ b/mcclone/external/devil178/include/IL/config.h @@ -0,0 +1,140 @@ +/* include/IL/config.h. Generated by configure. */ +/* include/IL/config.h.in. Generated from configure.in by autoheader. */ +#ifndef __CONFIG_H__ +#define __CONFIG_H__ + +#define IL_USE_PRAGMA_LIBS + +// Supported image formats (IL) + +// #define IL_NO_BLP +// #define IL_NO_BMP +// #define IL_NO_CUT +// #define IL_NO_CHEAD +// #define IL_NO_DCX +// #define IL_NO_DDS +// #define IL_NO_DICOM +// #define IL_NO_DOOM +// #define IL_NO_EXR +// #define IL_NO_FITS +// #define IL_NO_FTX +// #define IL_NO_GIF +// #define IL_NO_HDR +// #define IL_NO_ICO +// #define IL_NO_ICNS +// #define IL_NO_IWI +// #define IL_NO_JP2 +// #define IL_NO_JPG +// #define IL_NO_LCMS +// #define IL_NO_LIF +// #define IL_NO_MDL +// #define IL_NO_MNG +// #define IL_NO_PCD +// #define IL_NO_PCX +// #define IL_NO_PIC +// #define IL_NO_PIX +// #define IL_NO_PNG +// #define IL_NO_PNM +// #define IL_NO_PSD +// #define IL_NO_PSP +// #define IL_NO_PXR +// #define IL_NO_RAW +// #define IL_NO_ROT +// #define IL_NO_SGI +// #define IL_NO_SUN +// #define IL_NO_TGA +// #define IL_NO_TIF +// #define IL_NO_TPL +// #define IL_NO_WAL +// #define IL_NO_WDP +// #define IL_NO_XPM +#define IL_USE_JPEGLIB_UNMODIFIED 1 +//#define IL_USE_DXTC_NVIDIA +#define IL_USE_DXTC_SQUISH + +/* Supported api (ilut) */ + + +// +// sorry just +// cant get this one to work under windows +// have disabled for the now +// +// will look at it some more later +// +// Kriss +// +#undef ILUT_USE_ALLEGRO + +#undef ILUT_USE_DIRECTX8 +//#define ILUT_USE_DIRECTX9 +//#define ILUT_USE_DIRECTX10 +//#define ILUT_USE_OPENGL +//#define ILUT_USE_SDL +//#define ILUT_USE_WIN32 + + +/* Define to 1 if you have the header file. */ +//#define HAVE_DLFCN_H 1 + +/* Define to 1 if you have the header file. */ +//#define HAVE_INTTYPES_H 1 + +/* Define to 1 if you have the header file. */ +//#define HAVE_MEMORY_H 1 + +/* Define to 1 if you have the header file. */ +//#define HAVE_STDINT_H 1 + +/* Define to 1 if you have the header file. */ +//#define HAVE_STDLIB_H 1 + +/* Define to 1 if you have the header file. */ +//#define HAVE_STRINGS_H 1 + +/* Define to 1 if you have the header file. */ +//#define HAVE_STRING_H 1 + +/* Define to 1 if you have the header file. */ +//#define HAVE_SYS_STAT_H 1 + +/* Define to 1 if you have the header file. */ +//#define HAVE_SYS_TYPES_H 1 + +/* Define to 1 if you have the header file. */ +//#define HAVE_UNISTD_H 1 + +/* Name of package */ +#define IL_PACKAGE "DevIL" + +/* Define to the address where bug reports for this package should be sent. */ +#define PACKAGE_BUGREPORT "" + +/* Define to the full name of this package. */ +#define IL_PACKAGE_NAME "" + +/* Define to the full name and version of this package. */ +#define IL_PACKAGE_STRING "" + +/* Define to the one symbol short name of this package. */ +#define IL_PACKAGE_TARNAME "" + +/* Define to the version of this package. */ +#define IL_PACKAGE_VERSION "" + +/* Define to 1 if you have the ANSI C header files. */ +#define STDC_HEADERS 1 + +/* Version number of package */ +//#define IL_VERSION "1.7.3" + +/* Define to 1 if your processor stores words with the most significant byte + first (like Motorola and SPARC, unlike Intel and VAX). */ +/* #undef WORDS_BIGENDIAN */ + +/* If using Mac OS X uncomment this line */ +/* #include "macconfig.h" */ + +/* Define to 1 if the X Window System is missing or not being used. */ +/* #undef X_DISPLAY_MISSING */ +#endif /* __CONFIG_H__ */ diff --git a/mcclone/external/devil178/include/IL/config.h.win b/mcclone/external/devil178/include/IL/config.h.win new file mode 100644 index 0000000..659f4ca --- /dev/null +++ b/mcclone/external/devil178/include/IL/config.h.win @@ -0,0 +1,79 @@ +#ifndef __CONFIG_H__ +#define __CONFIG_H__ + +#define IL_USE_PRAGMA_LIBS // Links to only the libraries that are requested. +#define IL_INLINE_ASM 1 // Define if you can support at least some ASM + +// Supported images formats (IL) + +// #define IL_NO_BLP +// #define IL_NO_BMP +// #define IL_NO_CUT +// #define IL_NO_CHEAD +// #define IL_NO_DCX +// #define IL_NO_DDS +// #define IL_NO_DICOM +// #define IL_NO_DOOM +// #define IL_NO_EXR +// #define IL_NO_FITS +// #define IL_NO_FTX +// #define IL_NO_GIF +// #define IL_NO_HDR +// #define IL_NO_ICO +// #define IL_NO_ICNS +// #define IL_NO_IWI +// #define IL_NO_JP2 +// #define IL_NO_JPG +// #define IL_NO_LCMS +// #define IL_NO_LIF +// #define IL_NO_MDL +// #define IL_NO_MNG +// #define IL_NO_PCD +// #define IL_NO_PCX +// #define IL_NO_PIC +// #define IL_NO_PIX +// #define IL_NO_PNG +// #define IL_NO_PNM +// #define IL_NO_PSD +// #define IL_NO_PSP +// #define IL_NO_PXR +// #define IL_NO_RAW +// #define IL_NO_ROT +// #define IL_NO_SGI +// #define IL_NO_SUN +// #define IL_NO_TGA +// #define IL_NO_TIF +// #define IL_NO_TPL +// #define IL_NO_WAL +// #define IL_NO_WDP +// #define IL_NO_XPM + +#define IL_USE_JPEGLIB_UNMODIFIED 1 +#define IL_USE_DXTC_NVIDIA +#define IL_USE_DXTC_SQUISH + +//#define IL_NO_GAMES + +/* Supported api (ilut) */ + + +// +// sorry just +// cant get this one to work under windows +// have disabled for the now +// +// will look at it some more later +// +// Kriss +// +#undef ILUT_USE_ALLEGRO + +#undef ILUT_USE_DIRECTX8 +#define ILUT_USE_DIRECTX9 +#define ILUT_USE_DIRECTX10 +#define ILUT_USE_OPENGL +#define ILUT_USE_SDL +#define ILUT_USE_WIN32 + + +#endif /* __CONFIG_H__ */ diff --git a/mcclone/external/devil178/include/IL/devil_internal_exports.h b/mcclone/external/devil178/include/IL/devil_internal_exports.h new file mode 100644 index 0000000..30b7aaa --- /dev/null +++ b/mcclone/external/devil178/include/IL/devil_internal_exports.h @@ -0,0 +1,161 @@ +//----------------------------------------------------------------------------- +// +// ImageLib Sources +// Copyright (C) 2000-2009 by Denton Woods +// Last modified: 01/06/2009 +// +// Filename: IL/devil_internal_exports.h +// +// Description: Internal stuff for DevIL (IL, ILU and ILUT) +// +//----------------------------------------------------------------------------- + +#ifndef IL_EXPORTS_H +#define IL_EXPORTS_H + +#include "IL/il.h" + +#ifdef DEBUG + #include +#else + #define assert(x) +#endif + +//#ifndef NOINLINE +#ifndef INLINE +#if defined(__GNUC__) + #define INLINE extern inline +#elif defined(_MSC_VER) //@TODO: Get this working in MSVC++. + // http://www.greenend.org.uk/rjk/2003/03/inline.html + #define NOINLINE + //#define INLINE + /*#ifndef _WIN64 // Cannot use inline assembly in x64 target platform. + #define USE_WIN32_ASM + #endif//_WIN64*/ + #define INLINE __inline +#else + #define INLINE inline +#endif +#endif +//#else +//#define INLINE +//#endif //NOINLINE + +#ifdef __cplusplus +extern "C" { +#endif + +#define IL_MAX(a,b) (((a) > (b)) ? (a) : (b)) +#define IL_MIN(a,b) (((a) < (b)) ? (a) : (b)) + + +//! Basic Palette struct +typedef struct ILpal +{ + ILubyte* Palette; //!< the image palette (if any) + ILuint PalSize; //!< size of the palette (in bytes) + ILenum PalType; //!< the palette types in il.h (0x0500 range) +} ILpal; + + +//! The Fundamental Image structure +/*! Every bit of information about an image is stored in this internal structure.*/ +typedef struct ILimage +{ + ILuint Width; //!< the image's width + ILuint Height; //!< the image's height + ILuint Depth; //!< the image's depth + ILubyte Bpp; //!< bytes per pixel (now number of channels) + ILubyte Bpc; //!< bytes per channel + ILuint Bps; //!< bytes per scanline (components for IL) + ILubyte* Data; //!< the image data + ILuint SizeOfData; //!< the total size of the data (in bytes) + ILuint SizeOfPlane; //!< SizeOfData in a 2d image, size of each plane slice in a 3d image (in bytes) + ILenum Format; //!< image format (in IL enum style) + ILenum Type; //!< image type (in IL enum style) + ILenum Origin; //!< origin of the image + ILpal Pal; //!< palette details + ILuint Duration; //!< length of the time to display this "frame" + ILenum CubeFlags; //!< cube map flags for sides present in chain + struct ILimage* Mipmaps; //!< mipmapped versions of this image terminated by a NULL - usu. NULL + struct ILimage* Next; //!< next image in the chain - usu. NULL + struct ILimage* Faces; //!< next cubemap face in the chain - usu. NULL + struct ILimage* Layers; //!< subsequent layers in the chain - usu. NULL + ILuint* AnimList; //!< animation list + ILuint AnimSize; //!< animation list size + void* Profile; //!< colour profile + ILuint ProfileSize; //!< colour profile size + ILuint OffX; //!< x-offset of the image + ILuint OffY; //!< y-offset of the image + ILubyte* DxtcData; //!< compressed data + ILenum DxtcFormat; //!< compressed data format + ILuint DxtcSize; //!< compressed data size +} ILimage; + + +// Memory functions +ILAPI void* ILAPIENTRY ialloc(const ILsizei Size); +ILAPI void ILAPIENTRY ifree(const void *Ptr); +ILAPI void* ILAPIENTRY icalloc(const ILsizei Size, const ILsizei Num); +#ifdef ALTIVEC_GCC +ILAPI void* ILAPIENTRY ivec_align_buffer(void *buffer, const ILuint size); +#endif + +// Internal library functions in IL +ILAPI ILimage* ILAPIENTRY ilGetCurImage(void); +ILAPI void ILAPIENTRY ilSetCurImage(ILimage *Image); +ILAPI void ILAPIENTRY ilSetError(ILenum Error); +ILAPI void ILAPIENTRY ilSetPal(ILpal *Pal); + +// +// Utility functions +// +ILAPI ILubyte ILAPIENTRY ilGetBppFormat(ILenum Format); +ILAPI ILenum ILAPIENTRY ilGetFormatBpp(ILubyte Bpp); +ILAPI ILubyte ILAPIENTRY ilGetBpcType(ILenum Type); +ILAPI ILenum ILAPIENTRY ilGetTypeBpc(ILubyte Bpc); +ILAPI ILubyte ILAPIENTRY ilGetBppPal(ILenum PalType); +ILAPI ILenum ILAPIENTRY ilGetPalBaseType(ILenum PalType); +ILAPI ILuint ILAPIENTRY ilNextPower2(ILuint Num); +ILAPI ILenum ILAPIENTRY ilTypeFromExt(ILconst_string FileName); +ILAPI void ILAPIENTRY ilReplaceCurImage(ILimage *Image); +ILAPI void ILAPIENTRY iMemSwap(ILubyte *, ILubyte *, const ILuint); + +// +// Image functions +// +ILAPI void ILAPIENTRY iBindImageTemp (void); +ILAPI ILboolean ILAPIENTRY ilClearImage_ (ILimage *Image); +ILAPI void ILAPIENTRY ilCloseImage (ILimage *Image); +ILAPI void ILAPIENTRY ilClosePal (ILpal *Palette); +ILAPI ILpal* ILAPIENTRY iCopyPal (void); +ILAPI ILboolean ILAPIENTRY ilCopyImageAttr (ILimage *Dest, ILimage *Src); +ILAPI ILimage* ILAPIENTRY ilCopyImage_ (ILimage *Src); +ILAPI void ILAPIENTRY ilGetClear (void *Colours, ILenum Format, ILenum Type); +ILAPI ILuint ILAPIENTRY ilGetCurName (void); +ILAPI ILboolean ILAPIENTRY ilIsValidPal (ILpal *Palette); +ILAPI ILimage* ILAPIENTRY ilNewImage (ILuint Width, ILuint Height, ILuint Depth, ILubyte Bpp, ILubyte Bpc); +ILAPI ILimage* ILAPIENTRY ilNewImageFull (ILuint Width, ILuint Height, ILuint Depth, ILubyte Bpp, ILenum Format, ILenum Type, void *Data); +ILAPI ILboolean ILAPIENTRY ilInitImage (ILimage *Image, ILuint Width, ILuint Height, ILuint Depth, ILubyte Bpp, ILenum Format, ILenum Type, void *Data); +ILAPI ILboolean ILAPIENTRY ilResizeImage (ILimage *Image, ILuint Width, ILuint Height, ILuint Depth, ILubyte Bpp, ILubyte Bpc); +ILAPI ILboolean ILAPIENTRY ilTexImage_ (ILimage *Image, ILuint Width, ILuint Height, ILuint Depth, ILubyte Bpp, ILenum Format, ILenum Type, void *Data); +ILAPI ILboolean ILAPIENTRY ilTexSubImage_ (ILimage *Image, void *Data); +ILAPI void* ILAPIENTRY ilConvertBuffer (ILuint SizeOfData, ILenum SrcFormat, ILenum DestFormat, ILenum SrcType, ILenum DestType, ILpal *SrcPal, void *Buffer); +ILAPI ILimage* ILAPIENTRY iConvertImage (ILimage *Image, ILenum DestFormat, ILenum DestType); +ILAPI ILpal* ILAPIENTRY iConvertPal (ILpal *Pal, ILenum DestFormat); +ILAPI ILubyte* ILAPIENTRY iGetFlipped (ILimage *Image); +ILAPI ILboolean ILAPIENTRY iMirror(); +ILAPI void ILAPIENTRY iFlipBuffer(ILubyte *buff, ILuint depth, ILuint line_size, ILuint line_num); +ILubyte* iFlipNewBuffer(ILubyte *buff, ILuint depth, ILuint line_size, ILuint line_num); +ILAPI void ILAPIENTRY iGetIntegervImage(ILimage *Image, ILenum Mode, ILint *Param); + +// Internal library functions in ILU +ILAPI ILimage* ILAPIENTRY iluRotate_(ILimage *Image, ILfloat Angle); +ILAPI ILimage* ILAPIENTRY iluRotate3D_(ILimage *Image, ILfloat x, ILfloat y, ILfloat z, ILfloat Angle); +ILAPI ILimage* ILAPIENTRY iluScale_(ILimage *Image, ILuint Width, ILuint Height, ILuint Depth); + +#ifdef __cplusplus +} +#endif + +#endif//IL_EXPORTS_H diff --git a/mcclone/external/devil178/include/IL/il.h b/mcclone/external/devil178/include/IL/il.h new file mode 100644 index 0000000..540a56e --- /dev/null +++ b/mcclone/external/devil178/include/IL/il.h @@ -0,0 +1,644 @@ +//----------------------------------------------------------------------------- +// +// ImageLib Sources +// Copyright (C) 2000-2009 by Denton Woods +// Last modified: 03/07/2009 +// +// Filename: IL/il.h +// +// Description: The main include file for DevIL +// +//----------------------------------------------------------------------------- + +// Doxygen comment +/*! \file il.h + The main include file for DevIL +*/ + +#ifndef __il_h_ +#ifndef __IL_H__ + +#define __il_h_ +#define __IL_H__ + +#ifdef __cplusplus +extern "C" { +#endif + +//this define controls if floats and doubles are clampled to [0..1] +//during conversion. It takes a little more time, but it is the correct +//way of doing this. If you are sure your floats are always valid, +//you can undefine this value... +#define CLAMP_HALF 1 +#define CLAMP_FLOATS 1 +#define CLAMP_DOUBLES 1 + +/*#ifdef _WIN32_WCE + #define IL_NO_EXR + #define IL_NO_GIF + #define IL_NO_JP2 + #define IL_NO_JPG + #define IL_NO_MNG + #define IL_NO_PNG + #define IL_NO_TIF + #define IL_NO_LCMS +#endif //_WIN32_WCE + +#ifdef DJGPP + #define IL_NO_EXR + #define IL_NO_GIF + #define IL_NO_JP2 + #define IL_NO_JPG + #define IL_NO_MNG + #define IL_NO_PNG + #define IL_NO_TIF + #define IL_NO_LCMS +#endif //DJGPP*/ + +#ifdef _WIN32 + #if (defined(IL_USE_PRAGMA_LIBS)) && (!defined(_IL_BUILD_LIBRARY)) + #if defined(_MSC_VER) || defined(__BORLANDC__) + #pragma comment(lib, "DevIL.lib") + #endif + #endif +#endif + +#ifdef RESTRICT_KEYWORD +#define RESTRICT restrict +#define CONST_RESTRICT const restrict +#else +#define RESTRICT +#define CONST_RESTRICT const +#endif + +#include + +typedef unsigned int ILenum; +typedef unsigned char ILboolean; +typedef unsigned int ILbitfield; +typedef signed char ILbyte; +typedef signed short ILshort; +typedef int ILint; +typedef size_t ILsizei; +typedef unsigned char ILubyte; +typedef unsigned short ILushort; +typedef unsigned int ILuint; +typedef float ILfloat; +typedef float ILclampf; +typedef double ILdouble; +typedef double ILclampd; + +#ifdef _MSC_VER +typedef __int64 ILint64; +typedef unsigned __int64 ILuint64; +#else +typedef long long int ILint64; +typedef long long unsigned int ILuint64; +#endif + + +#include +#ifdef _UNICODE + #ifndef _WIN32_WCE + #include + #endif + //if we use a define instead of a typedef, + //ILconst_string works as intended + #define ILchar wchar_t + #define ILstring wchar_t* + #define ILconst_string wchar_t const * +#else + //if we use a define instead of a typedef, + //ILconst_string works as intended + #define ILchar char + #define ILstring char* + #define ILconst_string char const * +#endif //_UNICODE + +#define IL_FALSE 0 +#define IL_TRUE 1 + +// Matches OpenGL's right now. +//! Data formats \link Formats Formats\endlink +#define IL_COLOUR_INDEX 0x1900 +#define IL_COLOR_INDEX 0x1900 +#define IL_ALPHA 0x1906 +#define IL_RGB 0x1907 +#define IL_RGBA 0x1908 +#define IL_BGR 0x80E0 +#define IL_BGRA 0x80E1 +#define IL_LUMINANCE 0x1909 +#define IL_LUMINANCE_ALPHA 0x190A + +//! Data types \link Types Types\endlink +#define IL_BYTE 0x1400 +#define IL_UNSIGNED_BYTE 0x1401 +#define IL_SHORT 0x1402 +#define IL_UNSIGNED_SHORT 0x1403 +#define IL_INT 0x1404 +#define IL_UNSIGNED_INT 0x1405 +#define IL_FLOAT 0x1406 +#define IL_DOUBLE 0x140A +#define IL_HALF 0x140B + + +#define IL_MAX_BYTE SCHAR_MAX +#define IL_MAX_UNSIGNED_BYTE UCHAR_MAX +#define IL_MAX_SHORT SHRT_MAX +#define IL_MAX_UNSIGNED_SHORT USHRT_MAX +#define IL_MAX_INT INT_MAX +#define IL_MAX_UNSIGNED_INT UINT_MAX + +#define IL_LIMIT(x,m,M) (xM?M:x)) +#define IL_CLAMP(x) IL_LIMIT(x,0,1) + +#define IL_VENDOR 0x1F00 +#define IL_LOAD_EXT 0x1F01 +#define IL_SAVE_EXT 0x1F02 + + +// +// IL-specific #define's +// + +#define IL_VERSION_1_7_8 1 +#define IL_VERSION 178 + + +// Attribute Bits +#define IL_ORIGIN_BIT 0x00000001 +#define IL_FILE_BIT 0x00000002 +#define IL_PAL_BIT 0x00000004 +#define IL_FORMAT_BIT 0x00000008 +#define IL_TYPE_BIT 0x00000010 +#define IL_COMPRESS_BIT 0x00000020 +#define IL_LOADFAIL_BIT 0x00000040 +#define IL_FORMAT_SPECIFIC_BIT 0x00000080 +#define IL_ALL_ATTRIB_BITS 0x000FFFFF + + +// Palette types +#define IL_PAL_NONE 0x0400 +#define IL_PAL_RGB24 0x0401 +#define IL_PAL_RGB32 0x0402 +#define IL_PAL_RGBA32 0x0403 +#define IL_PAL_BGR24 0x0404 +#define IL_PAL_BGR32 0x0405 +#define IL_PAL_BGRA32 0x0406 + + +// Image types +#define IL_TYPE_UNKNOWN 0x0000 +#define IL_BMP 0x0420 //!< Microsoft Windows Bitmap - .bmp extension +#define IL_CUT 0x0421 //!< Dr. Halo - .cut extension +#define IL_DOOM 0x0422 //!< DooM walls - no specific extension +#define IL_DOOM_FLAT 0x0423 //!< DooM flats - no specific extension +#define IL_ICO 0x0424 //!< Microsoft Windows Icons and Cursors - .ico and .cur extensions +#define IL_JPG 0x0425 //!< JPEG - .jpg, .jpe and .jpeg extensions +#define IL_JFIF 0x0425 //!< +#define IL_ILBM 0x0426 //!< Amiga IFF (FORM ILBM) - .iff, .ilbm, .lbm extensions +#define IL_PCD 0x0427 //!< Kodak PhotoCD - .pcd extension +#define IL_PCX 0x0428 //!< ZSoft PCX - .pcx extension +#define IL_PIC 0x0429 //!< PIC - .pic extension +#define IL_PNG 0x042A //!< Portable Network Graphics - .png extension +#define IL_PNM 0x042B //!< Portable Any Map - .pbm, .pgm, .ppm and .pnm extensions +#define IL_SGI 0x042C //!< Silicon Graphics - .sgi, .bw, .rgb and .rgba extensions +#define IL_TGA 0x042D //!< TrueVision Targa File - .tga, .vda, .icb and .vst extensions +#define IL_TIF 0x042E //!< Tagged Image File Format - .tif and .tiff extensions +#define IL_CHEAD 0x042F //!< C-Style Header - .h extension +#define IL_RAW 0x0430 //!< Raw Image Data - any extension +#define IL_MDL 0x0431 //!< Half-Life Model Texture - .mdl extension +#define IL_WAL 0x0432 //!< Quake 2 Texture - .wal extension +#define IL_LIF 0x0434 //!< Homeworld Texture - .lif extension +#define IL_MNG 0x0435 //!< Multiple-image Network Graphics - .mng extension +#define IL_JNG 0x0435 //!< +#define IL_GIF 0x0436 //!< Graphics Interchange Format - .gif extension +#define IL_DDS 0x0437 //!< DirectDraw Surface - .dds extension +#define IL_DCX 0x0438 //!< ZSoft Multi-PCX - .dcx extension +#define IL_PSD 0x0439 //!< Adobe PhotoShop - .psd extension +#define IL_EXIF 0x043A //!< +#define IL_PSP 0x043B //!< PaintShop Pro - .psp extension +#define IL_PIX 0x043C //!< PIX - .pix extension +#define IL_PXR 0x043D //!< Pixar - .pxr extension +#define IL_XPM 0x043E //!< X Pixel Map - .xpm extension +#define IL_HDR 0x043F //!< Radiance High Dynamic Range - .hdr extension +#define IL_ICNS 0x0440 //!< Macintosh Icon - .icns extension +#define IL_JP2 0x0441 //!< Jpeg 2000 - .jp2 extension +#define IL_EXR 0x0442 //!< OpenEXR - .exr extension +#define IL_WDP 0x0443 //!< Microsoft HD Photo - .wdp and .hdp extension +#define IL_VTF 0x0444 //!< Valve Texture Format - .vtf extension +#define IL_WBMP 0x0445 //!< Wireless Bitmap - .wbmp extension +#define IL_SUN 0x0446 //!< Sun Raster - .sun, .ras, .rs, .im1, .im8, .im24 and .im32 extensions +#define IL_IFF 0x0447 //!< Interchange File Format - .iff extension +#define IL_TPL 0x0448 //!< Gamecube Texture - .tpl extension +#define IL_FITS 0x0449 //!< Flexible Image Transport System - .fit and .fits extensions +#define IL_DICOM 0x044A //!< Digital Imaging and Communications in Medicine (DICOM) - .dcm and .dicom extensions +#define IL_IWI 0x044B //!< Call of Duty Infinity Ward Image - .iwi extension +#define IL_BLP 0x044C //!< Blizzard Texture Format - .blp extension +#define IL_FTX 0x044D //!< Heavy Metal: FAKK2 Texture - .ftx extension +#define IL_ROT 0x044E //!< Homeworld 2 - Relic Texture - .rot extension +#define IL_TEXTURE 0x044F //!< Medieval II: Total War Texture - .texture extension +#define IL_DPX 0x0450 //!< Digital Picture Exchange - .dpx extension +#define IL_UTX 0x0451 //!< Unreal (and Unreal Tournament) Texture - .utx extension +#define IL_MP3 0x0452 //!< MPEG-1 Audio Layer 3 - .mp3 extension + + +#define IL_JASC_PAL 0x0475 //!< PaintShop Pro Palette + + +// Error Types +#define IL_NO_ERROR 0x0000 +#define IL_INVALID_ENUM 0x0501 +#define IL_OUT_OF_MEMORY 0x0502 +#define IL_FORMAT_NOT_SUPPORTED 0x0503 +#define IL_INTERNAL_ERROR 0x0504 +#define IL_INVALID_VALUE 0x0505 +#define IL_ILLEGAL_OPERATION 0x0506 +#define IL_ILLEGAL_FILE_VALUE 0x0507 +#define IL_INVALID_FILE_HEADER 0x0508 +#define IL_INVALID_PARAM 0x0509 +#define IL_COULD_NOT_OPEN_FILE 0x050A +#define IL_INVALID_EXTENSION 0x050B +#define IL_FILE_ALREADY_EXISTS 0x050C +#define IL_OUT_FORMAT_SAME 0x050D +#define IL_STACK_OVERFLOW 0x050E +#define IL_STACK_UNDERFLOW 0x050F +#define IL_INVALID_CONVERSION 0x0510 +#define IL_BAD_DIMENSIONS 0x0511 +#define IL_FILE_READ_ERROR 0x0512 // 05/12/2002: Addition by Sam. +#define IL_FILE_WRITE_ERROR 0x0512 + +#define IL_LIB_GIF_ERROR 0x05E1 +#define IL_LIB_JPEG_ERROR 0x05E2 +#define IL_LIB_PNG_ERROR 0x05E3 +#define IL_LIB_TIFF_ERROR 0x05E4 +#define IL_LIB_MNG_ERROR 0x05E5 +#define IL_LIB_JP2_ERROR 0x05E6 +#define IL_LIB_EXR_ERROR 0x05E7 +#define IL_UNKNOWN_ERROR 0x05FF + + +// Origin Definitions +#define IL_ORIGIN_SET 0x0600 +#define IL_ORIGIN_LOWER_LEFT 0x0601 +#define IL_ORIGIN_UPPER_LEFT 0x0602 +#define IL_ORIGIN_MODE 0x0603 + + +// Format and Type Mode Definitions +#define IL_FORMAT_SET 0x0610 +#define IL_FORMAT_MODE 0x0611 +#define IL_TYPE_SET 0x0612 +#define IL_TYPE_MODE 0x0613 + + +// File definitions +#define IL_FILE_OVERWRITE 0x0620 +#define IL_FILE_MODE 0x0621 + + +// Palette definitions +#define IL_CONV_PAL 0x0630 + + +// Load fail definitions +#define IL_DEFAULT_ON_FAIL 0x0632 + + +// Key colour and alpha definitions +#define IL_USE_KEY_COLOUR 0x0635 +#define IL_USE_KEY_COLOR 0x0635 +#define IL_BLIT_BLEND 0x0636 + + +// Interlace definitions +#define IL_SAVE_INTERLACED 0x0639 +#define IL_INTERLACE_MODE 0x063A + + +// Quantization definitions +#define IL_QUANTIZATION_MODE 0x0640 +#define IL_WU_QUANT 0x0641 +#define IL_NEU_QUANT 0x0642 +#define IL_NEU_QUANT_SAMPLE 0x0643 +#define IL_MAX_QUANT_INDEXS 0x0644 //XIX : ILint : Maximum number of colors to reduce to, default of 256. and has a range of 2-256 +#define IL_MAX_QUANT_INDICES 0x0644 // Redefined, since the above #define is misspelled + + +// Hints +#define IL_FASTEST 0x0660 +#define IL_LESS_MEM 0x0661 +#define IL_DONT_CARE 0x0662 +#define IL_MEM_SPEED_HINT 0x0665 +#define IL_USE_COMPRESSION 0x0666 +#define IL_NO_COMPRESSION 0x0667 +#define IL_COMPRESSION_HINT 0x0668 + + +// Compression +#define IL_NVIDIA_COMPRESS 0x0670 +#define IL_SQUISH_COMPRESS 0x0671 + + +// Subimage types +#define IL_SUB_NEXT 0x0680 +#define IL_SUB_MIPMAP 0x0681 +#define IL_SUB_LAYER 0x0682 + + +// Compression definitions +#define IL_COMPRESS_MODE 0x0700 +#define IL_COMPRESS_NONE 0x0701 +#define IL_COMPRESS_RLE 0x0702 +#define IL_COMPRESS_LZO 0x0703 +#define IL_COMPRESS_ZLIB 0x0704 + + +// File format-specific values +#define IL_TGA_CREATE_STAMP 0x0710 +#define IL_JPG_QUALITY 0x0711 +#define IL_PNG_INTERLACE 0x0712 +#define IL_TGA_RLE 0x0713 +#define IL_BMP_RLE 0x0714 +#define IL_SGI_RLE 0x0715 +#define IL_TGA_ID_STRING 0x0717 +#define IL_TGA_AUTHNAME_STRING 0x0718 +#define IL_TGA_AUTHCOMMENT_STRING 0x0719 +#define IL_PNG_AUTHNAME_STRING 0x071A +#define IL_PNG_TITLE_STRING 0x071B +#define IL_PNG_DESCRIPTION_STRING 0x071C +#define IL_TIF_DESCRIPTION_STRING 0x071D +#define IL_TIF_HOSTCOMPUTER_STRING 0x071E +#define IL_TIF_DOCUMENTNAME_STRING 0x071F +#define IL_TIF_AUTHNAME_STRING 0x0720 +#define IL_JPG_SAVE_FORMAT 0x0721 +#define IL_CHEAD_HEADER_STRING 0x0722 +#define IL_PCD_PICNUM 0x0723 +#define IL_PNG_ALPHA_INDEX 0x0724 //XIX : ILint : the color in the palette at this index value (0-255) is considered transparent, -1 for no trasparent color +#define IL_JPG_PROGRESSIVE 0x0725 +#define IL_VTF_COMP 0x0726 + + +// DXTC definitions +#define IL_DXTC_FORMAT 0x0705 +#define IL_DXT1 0x0706 +#define IL_DXT2 0x0707 +#define IL_DXT3 0x0708 +#define IL_DXT4 0x0709 +#define IL_DXT5 0x070A +#define IL_DXT_NO_COMP 0x070B +#define IL_KEEP_DXTC_DATA 0x070C +#define IL_DXTC_DATA_FORMAT 0x070D +#define IL_3DC 0x070E +#define IL_RXGB 0x070F +#define IL_ATI1N 0x0710 +#define IL_DXT1A 0x0711 // Normally the same as IL_DXT1, except for nVidia Texture Tools. + +// Environment map definitions +#define IL_CUBEMAP_POSITIVEX 0x00000400 +#define IL_CUBEMAP_NEGATIVEX 0x00000800 +#define IL_CUBEMAP_POSITIVEY 0x00001000 +#define IL_CUBEMAP_NEGATIVEY 0x00002000 +#define IL_CUBEMAP_POSITIVEZ 0x00004000 +#define IL_CUBEMAP_NEGATIVEZ 0x00008000 +#define IL_SPHEREMAP 0x00010000 + + +// Values +#define IL_VERSION_NUM 0x0DE2 +#define IL_IMAGE_WIDTH 0x0DE4 +#define IL_IMAGE_HEIGHT 0x0DE5 +#define IL_IMAGE_DEPTH 0x0DE6 +#define IL_IMAGE_SIZE_OF_DATA 0x0DE7 +#define IL_IMAGE_BPP 0x0DE8 +#define IL_IMAGE_BYTES_PER_PIXEL 0x0DE8 +#define IL_IMAGE_BPP 0x0DE8 +#define IL_IMAGE_BITS_PER_PIXEL 0x0DE9 +#define IL_IMAGE_FORMAT 0x0DEA +#define IL_IMAGE_TYPE 0x0DEB +#define IL_PALETTE_TYPE 0x0DEC +#define IL_PALETTE_SIZE 0x0DED +#define IL_PALETTE_BPP 0x0DEE +#define IL_PALETTE_NUM_COLS 0x0DEF +#define IL_PALETTE_BASE_TYPE 0x0DF0 +#define IL_NUM_FACES 0x0DE1 +#define IL_NUM_IMAGES 0x0DF1 +#define IL_NUM_MIPMAPS 0x0DF2 +#define IL_NUM_LAYERS 0x0DF3 +#define IL_ACTIVE_IMAGE 0x0DF4 +#define IL_ACTIVE_MIPMAP 0x0DF5 +#define IL_ACTIVE_LAYER 0x0DF6 +#define IL_ACTIVE_FACE 0x0E00 +#define IL_CUR_IMAGE 0x0DF7 +#define IL_IMAGE_DURATION 0x0DF8 +#define IL_IMAGE_PLANESIZE 0x0DF9 +#define IL_IMAGE_BPC 0x0DFA +#define IL_IMAGE_OFFX 0x0DFB +#define IL_IMAGE_OFFY 0x0DFC +#define IL_IMAGE_CUBEFLAGS 0x0DFD +#define IL_IMAGE_ORIGIN 0x0DFE +#define IL_IMAGE_CHANNELS 0x0DFF + +# if defined __GNUC__ && (__GNUC__ > 3 || (__GNUC__ == 3 && __GNUC_MINOR__ > 0)) +// __attribute__((deprecated)) is supported by GCC 3.1 and later. +# define DEPRECATED(D) D __attribute__((deprecated)) +# elif defined _MSC_VER && _MSC_VER >= 1300 +// __declspec(deprecated) is supported by MSVC 7.0 and later. +# define DEPRECATED(D) __declspec(deprecated) D +# else +# define DEPRECATED (D) D +# endif + +// +// Section shamelessly modified from the glut header. +// + +// This is from Win32's +#if (_MSC_VER >= 800) || defined(_STDCALL_SUPPORTED) || defined(__BORLANDC__) || defined(__LCC__) + #define ILAPIENTRY __stdcall + #define IL_PACKSTRUCT +//#elif defined(linux) || defined(MACOSX) || defined(__CYGWIN__) //fix bug 840364 +#elif defined( __GNUC__ ) + // this should work for any of the above commented platforms + // plus any platform using GCC + #ifdef __MINGW32__ + #define ILAPIENTRY __stdcall + #else + #define ILAPIENTRY + #endif + #define IL_PACKSTRUCT __attribute__ ((packed)) +#else + #define ILAPIENTRY + #define IL_PACKSTRUCT +#endif + +// This is from Win32's and +#if defined(__LCC__) + #define ILAPI __stdcall +#elif defined(_WIN32) //changed 20031221 to fix bug 840421 + #ifdef IL_STATIC_LIB + #define ILAPI + #else + #ifdef _IL_BUILD_LIBRARY + #define ILAPI __declspec(dllexport) + #else + #define ILAPI __declspec(dllimport) + #endif + #endif +#elif __APPLE__ + #define ILAPI extern +#else + #define ILAPI +#endif + + +#define IL_SEEK_SET 0 +#define IL_SEEK_CUR 1 +#define IL_SEEK_END 2 +#define IL_EOF -1 + + +// Callback functions for file reading +typedef void* ILHANDLE; +typedef void (ILAPIENTRY *fCloseRProc)(ILHANDLE); +typedef ILboolean (ILAPIENTRY *fEofProc) (ILHANDLE); +typedef ILint (ILAPIENTRY *fGetcProc) (ILHANDLE); +typedef ILHANDLE (ILAPIENTRY *fOpenRProc) (ILconst_string); +typedef ILint (ILAPIENTRY *fReadProc) (void*, ILuint, ILuint, ILHANDLE); +typedef ILint (ILAPIENTRY *fSeekRProc) (ILHANDLE, ILint, ILint); +typedef ILint (ILAPIENTRY *fTellRProc) (ILHANDLE); + +// Callback functions for file writing +typedef void (ILAPIENTRY *fCloseWProc)(ILHANDLE); +typedef ILHANDLE (ILAPIENTRY *fOpenWProc) (ILconst_string); +typedef ILint (ILAPIENTRY *fPutcProc) (ILubyte, ILHANDLE); +typedef ILint (ILAPIENTRY *fSeekWProc) (ILHANDLE, ILint, ILint); +typedef ILint (ILAPIENTRY *fTellWProc) (ILHANDLE); +typedef ILint (ILAPIENTRY *fWriteProc) (const void*, ILuint, ILuint, ILHANDLE); + +// Callback functions for allocation and deallocation +typedef void* (ILAPIENTRY *mAlloc)(const ILsizei); +typedef void (ILAPIENTRY *mFree) (const void* CONST_RESTRICT); + +// Registered format procedures +typedef ILenum (ILAPIENTRY *IL_LOADPROC)(ILconst_string); +typedef ILenum (ILAPIENTRY *IL_SAVEPROC)(ILconst_string); + + +// ImageLib Functions +ILAPI ILboolean ILAPIENTRY ilActiveFace(ILuint Number); +ILAPI ILboolean ILAPIENTRY ilActiveImage(ILuint Number); +ILAPI ILboolean ILAPIENTRY ilActiveLayer(ILuint Number); +ILAPI ILboolean ILAPIENTRY ilActiveMipmap(ILuint Number); +ILAPI ILboolean ILAPIENTRY ilApplyPal(ILconst_string FileName); +ILAPI ILboolean ILAPIENTRY ilApplyProfile(ILstring InProfile, ILstring OutProfile); +ILAPI void ILAPIENTRY ilBindImage(ILuint Image); +ILAPI ILboolean ILAPIENTRY ilBlit(ILuint Source, ILint DestX, ILint DestY, ILint DestZ, ILuint SrcX, ILuint SrcY, ILuint SrcZ, ILuint Width, ILuint Height, ILuint Depth); +ILAPI ILboolean ILAPIENTRY ilClampNTSC(void); +ILAPI void ILAPIENTRY ilClearColour(ILclampf Red, ILclampf Green, ILclampf Blue, ILclampf Alpha); +ILAPI ILboolean ILAPIENTRY ilClearImage(void); +ILAPI ILuint ILAPIENTRY ilCloneCurImage(void); +ILAPI ILubyte* ILAPIENTRY ilCompressDXT(ILubyte *Data, ILuint Width, ILuint Height, ILuint Depth, ILenum DXTCFormat, ILuint *DXTCSize); +ILAPI ILboolean ILAPIENTRY ilCompressFunc(ILenum Mode); +ILAPI ILboolean ILAPIENTRY ilConvertImage(ILenum DestFormat, ILenum DestType); +ILAPI ILboolean ILAPIENTRY ilConvertPal(ILenum DestFormat); +ILAPI ILboolean ILAPIENTRY ilCopyImage(ILuint Src); +ILAPI ILuint ILAPIENTRY ilCopyPixels(ILuint XOff, ILuint YOff, ILuint ZOff, ILuint Width, ILuint Height, ILuint Depth, ILenum Format, ILenum Type, void *Data); +ILAPI ILuint ILAPIENTRY ilCreateSubImage(ILenum Type, ILuint Num); +ILAPI ILboolean ILAPIENTRY ilDefaultImage(void); +ILAPI void ILAPIENTRY ilDeleteImage(const ILuint Num); +ILAPI void ILAPIENTRY ilDeleteImages(ILsizei Num, const ILuint *Images); +ILAPI ILenum ILAPIENTRY ilDetermineType(ILconst_string FileName); +ILAPI ILenum ILAPIENTRY ilDetermineTypeF(ILHANDLE File); +ILAPI ILenum ILAPIENTRY ilDetermineTypeL(const void *Lump, ILuint Size); +ILAPI ILboolean ILAPIENTRY ilDisable(ILenum Mode); +ILAPI ILboolean ILAPIENTRY ilDxtcDataToImage(void); +ILAPI ILboolean ILAPIENTRY ilDxtcDataToSurface(void); +ILAPI ILboolean ILAPIENTRY ilEnable(ILenum Mode); +ILAPI void ILAPIENTRY ilFlipSurfaceDxtcData(void); +ILAPI ILboolean ILAPIENTRY ilFormatFunc(ILenum Mode); +ILAPI void ILAPIENTRY ilGenImages(ILsizei Num, ILuint *Images); +ILAPI ILuint ILAPIENTRY ilGenImage(void); +ILAPI ILubyte* ILAPIENTRY ilGetAlpha(ILenum Type); +ILAPI ILboolean ILAPIENTRY ilGetBoolean(ILenum Mode); +ILAPI void ILAPIENTRY ilGetBooleanv(ILenum Mode, ILboolean *Param); +ILAPI ILubyte* ILAPIENTRY ilGetData(void); +ILAPI ILuint ILAPIENTRY ilGetDXTCData(void *Buffer, ILuint BufferSize, ILenum DXTCFormat); +ILAPI ILenum ILAPIENTRY ilGetError(void); +ILAPI ILint ILAPIENTRY ilGetInteger(ILenum Mode); +ILAPI void ILAPIENTRY ilGetIntegerv(ILenum Mode, ILint *Param); +ILAPI ILuint ILAPIENTRY ilGetLumpPos(void); +ILAPI ILubyte* ILAPIENTRY ilGetPalette(void); +ILAPI ILconst_string ILAPIENTRY ilGetString(ILenum StringName); +ILAPI void ILAPIENTRY ilHint(ILenum Target, ILenum Mode); +ILAPI ILboolean ILAPIENTRY ilInvertSurfaceDxtcDataAlpha(void); +ILAPI void ILAPIENTRY ilInit(void); +ILAPI ILboolean ILAPIENTRY ilImageToDxtcData(ILenum Format); +ILAPI ILboolean ILAPIENTRY ilIsDisabled(ILenum Mode); +ILAPI ILboolean ILAPIENTRY ilIsEnabled(ILenum Mode); +ILAPI ILboolean ILAPIENTRY ilIsImage(ILuint Image); +ILAPI ILboolean ILAPIENTRY ilIsValid(ILenum Type, ILconst_string FileName); +ILAPI ILboolean ILAPIENTRY ilIsValidF(ILenum Type, ILHANDLE File); +ILAPI ILboolean ILAPIENTRY ilIsValidL(ILenum Type, void *Lump, ILuint Size); +ILAPI void ILAPIENTRY ilKeyColour(ILclampf Red, ILclampf Green, ILclampf Blue, ILclampf Alpha); +ILAPI ILboolean ILAPIENTRY ilLoad(ILenum Type, ILconst_string FileName); +ILAPI ILboolean ILAPIENTRY ilLoadF(ILenum Type, ILHANDLE File); +ILAPI ILboolean ILAPIENTRY ilLoadImage(ILconst_string FileName); +ILAPI ILboolean ILAPIENTRY ilLoadL(ILenum Type, const void *Lump, ILuint Size); +ILAPI ILboolean ILAPIENTRY ilLoadPal(ILconst_string FileName); +ILAPI void ILAPIENTRY ilModAlpha(ILdouble AlphaValue); +ILAPI ILboolean ILAPIENTRY ilOriginFunc(ILenum Mode); +ILAPI ILboolean ILAPIENTRY ilOverlayImage(ILuint Source, ILint XCoord, ILint YCoord, ILint ZCoord); +ILAPI void ILAPIENTRY ilPopAttrib(void); +ILAPI void ILAPIENTRY ilPushAttrib(ILuint Bits); +ILAPI void ILAPIENTRY ilRegisterFormat(ILenum Format); +ILAPI ILboolean ILAPIENTRY ilRegisterLoad(ILconst_string Ext, IL_LOADPROC Load); +ILAPI ILboolean ILAPIENTRY ilRegisterMipNum(ILuint Num); +ILAPI ILboolean ILAPIENTRY ilRegisterNumFaces(ILuint Num); +ILAPI ILboolean ILAPIENTRY ilRegisterNumImages(ILuint Num); +ILAPI void ILAPIENTRY ilRegisterOrigin(ILenum Origin); +ILAPI void ILAPIENTRY ilRegisterPal(void *Pal, ILuint Size, ILenum Type); +ILAPI ILboolean ILAPIENTRY ilRegisterSave(ILconst_string Ext, IL_SAVEPROC Save); +ILAPI void ILAPIENTRY ilRegisterType(ILenum Type); +ILAPI ILboolean ILAPIENTRY ilRemoveLoad(ILconst_string Ext); +ILAPI ILboolean ILAPIENTRY ilRemoveSave(ILconst_string Ext); +ILAPI void ILAPIENTRY ilResetMemory(void); // Deprecated +ILAPI void ILAPIENTRY ilResetRead(void); +ILAPI void ILAPIENTRY ilResetWrite(void); +ILAPI ILboolean ILAPIENTRY ilSave(ILenum Type, ILconst_string FileName); +ILAPI ILuint ILAPIENTRY ilSaveF(ILenum Type, ILHANDLE File); +ILAPI ILboolean ILAPIENTRY ilSaveImage(ILconst_string FileName); +ILAPI ILuint ILAPIENTRY ilSaveL(ILenum Type, void *Lump, ILuint Size); +ILAPI ILboolean ILAPIENTRY ilSavePal(ILconst_string FileName); +ILAPI ILboolean ILAPIENTRY ilSetAlpha(ILdouble AlphaValue); +ILAPI ILboolean ILAPIENTRY ilSetData(void *Data); +ILAPI ILboolean ILAPIENTRY ilSetDuration(ILuint Duration); +ILAPI void ILAPIENTRY ilSetInteger(ILenum Mode, ILint Param); +ILAPI void ILAPIENTRY ilSetMemory(mAlloc, mFree); +ILAPI void ILAPIENTRY ilSetPixels(ILint XOff, ILint YOff, ILint ZOff, ILuint Width, ILuint Height, ILuint Depth, ILenum Format, ILenum Type, void *Data); +ILAPI void ILAPIENTRY ilSetRead(fOpenRProc, fCloseRProc, fEofProc, fGetcProc, fReadProc, fSeekRProc, fTellRProc); +ILAPI void ILAPIENTRY ilSetString(ILenum Mode, const char *String); +ILAPI void ILAPIENTRY ilSetWrite(fOpenWProc, fCloseWProc, fPutcProc, fSeekWProc, fTellWProc, fWriteProc); +ILAPI void ILAPIENTRY ilShutDown(void); +ILAPI ILboolean ILAPIENTRY ilSurfaceToDxtcData(ILenum Format); +ILAPI ILboolean ILAPIENTRY ilTexImage(ILuint Width, ILuint Height, ILuint Depth, ILubyte NumChannels, ILenum Format, ILenum Type, void *Data); +ILAPI ILboolean ILAPIENTRY ilTexImageDxtc(ILint w, ILint h, ILint d, ILenum DxtFormat, const ILubyte* data); +ILAPI ILenum ILAPIENTRY ilTypeFromExt(ILconst_string FileName); +ILAPI ILboolean ILAPIENTRY ilTypeFunc(ILenum Mode); +ILAPI ILboolean ILAPIENTRY ilLoadData(ILconst_string FileName, ILuint Width, ILuint Height, ILuint Depth, ILubyte Bpp); +ILAPI ILboolean ILAPIENTRY ilLoadDataF(ILHANDLE File, ILuint Width, ILuint Height, ILuint Depth, ILubyte Bpp); +ILAPI ILboolean ILAPIENTRY ilLoadDataL(void *Lump, ILuint Size, ILuint Width, ILuint Height, ILuint Depth, ILubyte Bpp); +ILAPI ILboolean ILAPIENTRY ilSaveData(ILconst_string FileName); + +// For all those weirdos that spell "colour" without the 'u'. +#define ilClearColor ilClearColour +#define ilKeyColor ilKeyColour + +#define imemclear(x,y) memset(x,0,y); + +#ifdef __cplusplus +} +#endif + +#endif // __IL_H__ +#endif // __il_h__ diff --git a/mcclone/external/devil178/include/IL/il_wrap.h b/mcclone/external/devil178/include/IL/il_wrap.h new file mode 100644 index 0000000..5cf9b0e --- /dev/null +++ b/mcclone/external/devil178/include/IL/il_wrap.h @@ -0,0 +1,205 @@ +#ifndef WRAPPER_H +#define WRAPPER_H + +/*#include +#include */ +#include // Probably only have to #include this one + +#ifdef _MSC_VER + #ifndef _IL_WRAP_BUILD_LIB + #pragma comment(lib, "il_wrap.lib") + #endif +#endif + +class ilImage +{ +public: + ilImage(); + ilImage(char *); + ilImage(const ilImage &); + virtual ~ilImage(); + + ILboolean Load(char *); + ILboolean Load(char *, ILenum); + ILboolean Save(char *); + ILboolean Save(char *, ILenum); + + + // ImageLib functions + ILboolean ActiveImage(ILuint); + ILboolean ActiveLayer(ILuint); + ILboolean ActiveMipmap(ILuint); + ILboolean Clear(void); + ILvoid ClearColour(ILclampf, ILclampf, ILclampf, ILclampf); + ILboolean Convert(ILenum); + ILboolean Copy(ILuint); + ILboolean Default(void); + ILboolean Flip(void); + ILboolean SwapColours(void); + ILboolean Resize(ILuint, ILuint, ILuint); + ILboolean TexImage(ILuint, ILuint, ILuint, ILubyte, ILenum, ILenum, ILvoid*); + + + // Image handling + ILvoid Bind(void) const; + ILvoid Bind(ILuint); + ILvoid Close(void) { this->Delete(); } + ILvoid Delete(void); + ILvoid iGenBind(); + ILenum PaletteAlphaIndex(); + + // Image characteristics + ILuint Width(void); + ILuint Height(void); + ILuint Depth(void); + ILubyte Bpp(void); + ILubyte Bitpp(void); + ILenum PaletteType(void); + ILenum Format(void); + ILenum Type(void); + ILuint NumImages(void); + ILuint NumMipmaps(void); + ILuint GetId(void) const; + ILenum GetOrigin(void); + ILubyte *GetData(void); + ILubyte *GetPalette(void); + + + // Rendering + ILuint BindImage(void); + ILuint BindImage(ILenum); + + + // Operators + ilImage& operator = (ILuint); + ilImage& operator = (const ilImage &); + + +protected: + ILuint Id; + +private: + ILvoid iStartUp(); + + +}; + + +class ilFilters +{ +public: + static ILboolean Alienify(ilImage &); + static ILboolean BlurAvg(ilImage &, ILuint Iter); + static ILboolean BlurGaussian(ilImage &, ILuint Iter); + static ILboolean Contrast(ilImage &, ILfloat Contrast); + static ILboolean EdgeDetectE(ilImage &); + static ILboolean EdgeDetectP(ilImage &); + static ILboolean EdgeDetectS(ilImage &); + static ILboolean Emboss(ilImage &); + static ILboolean Gamma(ilImage &, ILfloat Gamma); + static ILboolean Negative(ilImage &); + static ILboolean Noisify(ilImage &, ILubyte Factor); + static ILboolean Pixelize(ilImage &, ILuint PixSize); + static ILboolean Saturate(ilImage &, ILfloat Saturation); + static ILboolean Saturate(ilImage &, ILfloat r, ILfloat g, ILfloat b, ILfloat Saturation); + static ILboolean ScaleColours(ilImage &, ILfloat r, ILfloat g, ILfloat b); + static ILboolean Sharpen(ilImage &, ILfloat Factor, ILuint Iter); +}; + + +#ifdef ILUT_USE_OPENGL +class ilOgl +{ +public: + static ILvoid Init(void); + static GLuint BindTex(ilImage &); + static ILboolean Upload(ilImage &, ILuint); + static GLuint Mipmap(ilImage &); + static ILboolean Screen(void); + static ILboolean Screenie(void); +}; +#endif//ILUT_USE_OPENGL + + +#ifdef ILUT_USE_ALLEGRO +class ilAlleg +{ +public: + static ILvoid Init(void); + static BITMAP *Convert(ilImage &); +}; +#endif//ILUT_USE_ALLEGRO + + +#ifdef ILUT_USE_WIN32 +class ilWin32 +{ +public: + static ILvoid Init(void); + static HBITMAP Convert(ilImage &); + static ILboolean GetClipboard(ilImage &); + static ILvoid GetInfo(ilImage &, BITMAPINFO *Info); + static ILubyte *GetPadData(ilImage &); + static HPALETTE GetPal(ilImage &); + static ILboolean GetResource(ilImage &, HINSTANCE hInst, ILint ID, char *ResourceType); + static ILboolean GetResource(ilImage &, HINSTANCE hInst, ILint ID, char *ResourceType, ILenum Type); + static ILboolean SetClipboard(ilImage &); +}; +#endif//ILUT_USE_WIN32 + + +class ilValidate +{ +public: + static ILboolean Valid(ILenum, char *); + static ILboolean Valid(ILenum, FILE *); + static ILboolean Valid(ILenum, ILvoid *, ILuint); + +protected: + +private: + +}; + + +class ilState +{ +public: + static ILboolean Disable(ILenum); + static ILboolean Enable(ILenum); + static ILvoid Get(ILenum, ILboolean &); + static ILvoid Get(ILenum, ILint &); + static ILboolean GetBool(ILenum); + static ILint GetInt(ILenum); + static const char *GetString(ILenum); + static ILboolean IsDisabled(ILenum); + static ILboolean IsEnabled(ILenum); + static ILboolean Origin(ILenum); + static ILvoid Pop(void); + static ILvoid Push(ILuint); + + +protected: + +private: + +}; + + +class ilError +{ +public: + static ILvoid Check(ILvoid (*Callback)(const char*)); + static ILvoid Check(ILvoid (*Callback)(ILenum)); + static ILenum Get(void); + static const char *String(void); + static const char *String(ILenum); + +protected: + +private: + +}; + + +#endif//WRAPPER_H diff --git a/mcclone/external/devil178/include/IL/ilu.h b/mcclone/external/devil178/include/IL/ilu.h new file mode 100644 index 0000000..49871d7 --- /dev/null +++ b/mcclone/external/devil178/include/IL/ilu.h @@ -0,0 +1,195 @@ +//----------------------------------------------------------------------------- +// +// ImageLib Utility Sources +// Copyright (C) 2000-2009 by Denton Woods +// Last modified: 03/07/2009 +// +// Filename: IL/ilu.h +// +// Description: The main include file for ILU +// +//----------------------------------------------------------------------------- + +// Doxygen comment +/*! \file ilu.h + The main include file for ILU +*/ + +#ifndef __ilu_h_ +#ifndef __ILU_H__ + +#define __ilu_h_ +#define __ILU_H__ + +#include + +#ifdef __cplusplus +extern "C" { +#endif + + +#ifdef _WIN32 + #if (defined(IL_USE_PRAGMA_LIBS)) && (!defined(_IL_BUILD_LIBRARY)) + #if defined(_MSC_VER) || defined(__BORLANDC__) + #pragma comment(lib, "ILU.lib") + #endif + #endif +#endif + + +#define ILU_VERSION_1_7_8 1 +#define ILU_VERSION 178 + + +#define ILU_FILTER 0x2600 +#define ILU_NEAREST 0x2601 +#define ILU_LINEAR 0x2602 +#define ILU_BILINEAR 0x2603 +#define ILU_SCALE_BOX 0x2604 +#define ILU_SCALE_TRIANGLE 0x2605 +#define ILU_SCALE_BELL 0x2606 +#define ILU_SCALE_BSPLINE 0x2607 +#define ILU_SCALE_LANCZOS3 0x2608 +#define ILU_SCALE_MITCHELL 0x2609 + + +// Error types +#define ILU_INVALID_ENUM 0x0501 +#define ILU_OUT_OF_MEMORY 0x0502 +#define ILU_INTERNAL_ERROR 0x0504 +#define ILU_INVALID_VALUE 0x0505 +#define ILU_ILLEGAL_OPERATION 0x0506 +#define ILU_INVALID_PARAM 0x0509 + + +// Values +#define ILU_PLACEMENT 0x0700 +#define ILU_LOWER_LEFT 0x0701 +#define ILU_LOWER_RIGHT 0x0702 +#define ILU_UPPER_LEFT 0x0703 +#define ILU_UPPER_RIGHT 0x0704 +#define ILU_CENTER 0x0705 +#define ILU_CONVOLUTION_MATRIX 0x0710 + +#define ILU_VERSION_NUM IL_VERSION_NUM +#define ILU_VENDOR IL_VENDOR + + +// Languages +#define ILU_ENGLISH 0x0800 +#define ILU_ARABIC 0x0801 +#define ILU_DUTCH 0x0802 +#define ILU_JAPANESE 0x0803 +#define ILU_SPANISH 0x0804 +#define ILU_GERMAN 0x0805 +#define ILU_FRENCH 0x0806 + + +// Filters +/* +#define ILU_FILTER_BLUR 0x0803 +#define ILU_FILTER_GAUSSIAN_3x3 0x0804 +#define ILU_FILTER_GAUSSIAN_5X5 0x0805 +#define ILU_FILTER_EMBOSS1 0x0807 +#define ILU_FILTER_EMBOSS2 0x0808 +#define ILU_FILTER_LAPLACIAN1 0x080A +#define ILU_FILTER_LAPLACIAN2 0x080B +#define ILU_FILTER_LAPLACIAN3 0x080C +#define ILU_FILTER_LAPLACIAN4 0x080D +#define ILU_FILTER_SHARPEN1 0x080E +#define ILU_FILTER_SHARPEN2 0x080F +#define ILU_FILTER_SHARPEN3 0x0810 +*/ + + +typedef struct ILinfo +{ + ILuint Id; // the image's id + ILubyte *Data; // the image's data + ILuint Width; // the image's width + ILuint Height; // the image's height + ILuint Depth; // the image's depth + ILubyte Bpp; // bytes per pixel (not bits) of the image + ILuint SizeOfData; // the total size of the data (in bytes) + ILenum Format; // image format (in IL enum style) + ILenum Type; // image type (in IL enum style) + ILenum Origin; // origin of the image + ILubyte *Palette; // the image's palette + ILenum PalType; // palette type + ILuint PalSize; // palette size + ILenum CubeFlags; // flags for what cube map sides are present + ILuint NumNext; // number of images following + ILuint NumMips; // number of mipmaps + ILuint NumLayers; // number of layers +} ILinfo; + + +typedef struct ILpointf { + ILfloat x; + ILfloat y; +} ILpointf; + +typedef struct ILpointi { + ILint x; + ILint y; +} ILpointi; + +ILAPI ILboolean ILAPIENTRY iluAlienify(void); +ILAPI ILboolean ILAPIENTRY iluBlurAvg(ILuint Iter); +ILAPI ILboolean ILAPIENTRY iluBlurGaussian(ILuint Iter); +ILAPI ILboolean ILAPIENTRY iluBuildMipmaps(void); +ILAPI ILuint ILAPIENTRY iluColoursUsed(void); +ILAPI ILboolean ILAPIENTRY iluCompareImage(ILuint Comp); +ILAPI ILboolean ILAPIENTRY iluContrast(ILfloat Contrast); +ILAPI ILboolean ILAPIENTRY iluCrop(ILuint XOff, ILuint YOff, ILuint ZOff, ILuint Width, ILuint Height, ILuint Depth); +ILAPI void ILAPIENTRY iluDeleteImage(ILuint Id); // Deprecated +ILAPI ILboolean ILAPIENTRY iluEdgeDetectE(void); +ILAPI ILboolean ILAPIENTRY iluEdgeDetectP(void); +ILAPI ILboolean ILAPIENTRY iluEdgeDetectS(void); +ILAPI ILboolean ILAPIENTRY iluEmboss(void); +ILAPI ILboolean ILAPIENTRY iluEnlargeCanvas(ILuint Width, ILuint Height, ILuint Depth); +ILAPI ILboolean ILAPIENTRY iluEnlargeImage(ILfloat XDim, ILfloat YDim, ILfloat ZDim); +ILAPI ILboolean ILAPIENTRY iluEqualize(void); +ILAPI ILconst_string ILAPIENTRY iluErrorString(ILenum Error); +ILAPI ILboolean ILAPIENTRY iluConvolution(ILint *matrix, ILint scale, ILint bias); +ILAPI ILboolean ILAPIENTRY iluFlipImage(void); +ILAPI ILboolean ILAPIENTRY iluGammaCorrect(ILfloat Gamma); +ILAPI ILuint ILAPIENTRY iluGenImage(void); // Deprecated +ILAPI void ILAPIENTRY iluGetImageInfo(ILinfo *Info); +ILAPI ILint ILAPIENTRY iluGetInteger(ILenum Mode); +ILAPI void ILAPIENTRY iluGetIntegerv(ILenum Mode, ILint *Param); +ILAPI ILstring ILAPIENTRY iluGetString(ILenum StringName); +ILAPI void ILAPIENTRY iluImageParameter(ILenum PName, ILenum Param); +ILAPI void ILAPIENTRY iluInit(void); +ILAPI ILboolean ILAPIENTRY iluInvertAlpha(void); +ILAPI ILuint ILAPIENTRY iluLoadImage(ILconst_string FileName); +ILAPI ILboolean ILAPIENTRY iluMirror(void); +ILAPI ILboolean ILAPIENTRY iluNegative(void); +ILAPI ILboolean ILAPIENTRY iluNoisify(ILclampf Tolerance); +ILAPI ILboolean ILAPIENTRY iluPixelize(ILuint PixSize); +ILAPI void ILAPIENTRY iluRegionfv(ILpointf *Points, ILuint n); +ILAPI void ILAPIENTRY iluRegioniv(ILpointi *Points, ILuint n); +ILAPI ILboolean ILAPIENTRY iluReplaceColour(ILubyte Red, ILubyte Green, ILubyte Blue, ILfloat Tolerance); +ILAPI ILboolean ILAPIENTRY iluRotate(ILfloat Angle); +ILAPI ILboolean ILAPIENTRY iluRotate3D(ILfloat x, ILfloat y, ILfloat z, ILfloat Angle); +ILAPI ILboolean ILAPIENTRY iluSaturate1f(ILfloat Saturation); +ILAPI ILboolean ILAPIENTRY iluSaturate4f(ILfloat r, ILfloat g, ILfloat b, ILfloat Saturation); +ILAPI ILboolean ILAPIENTRY iluScale(ILuint Width, ILuint Height, ILuint Depth); +ILAPI ILboolean ILAPIENTRY iluScaleAlpha(ILfloat scale); +ILAPI ILboolean ILAPIENTRY iluScaleColours(ILfloat r, ILfloat g, ILfloat b); +ILAPI ILboolean ILAPIENTRY iluSetLanguage(ILenum Language); +ILAPI ILboolean ILAPIENTRY iluSharpen(ILfloat Factor, ILuint Iter); +ILAPI ILboolean ILAPIENTRY iluSwapColours(void); +ILAPI ILboolean ILAPIENTRY iluWave(ILfloat Angle); + +#define iluColorsUsed iluColoursUsed +#define iluSwapColors iluSwapColours +#define iluReplaceColor iluReplaceColour +#define iluScaleColor iluScaleColour + +#ifdef __cplusplus +} +#endif + +#endif // __ILU_H__ +#endif // __ilu_h_ diff --git a/mcclone/external/devil178/include/IL/ilu_region.h b/mcclone/external/devil178/include/IL/ilu_region.h new file mode 100644 index 0000000..b5b3adc --- /dev/null +++ b/mcclone/external/devil178/include/IL/ilu_region.h @@ -0,0 +1,25 @@ +//----------------------------------------------------------------------------- +// +// ImageLib Utility Sources +// Copyright (C) 2000-2002 by Denton Woods +// Last modified: 07/09/2002 <--Y2K Compliant! =] +// +// Filename: src-ILU/src/ilu_region.h +// +// Description: Creates an image region. +// +//----------------------------------------------------------------------------- + +#ifndef ILU_REGION_H +#define ILU_REGION_H + +typedef struct Edge +{ + ILint yUpper; + ILfloat xIntersect, dxPerScan; + struct Edge *next; +} Edge; + + +#endif//ILU_REGION_H + diff --git a/mcclone/external/devil178/include/IL/ilut.h b/mcclone/external/devil178/include/IL/ilut.h new file mode 100644 index 0000000..4a84b84 --- /dev/null +++ b/mcclone/external/devil178/include/IL/ilut.h @@ -0,0 +1,390 @@ +//----------------------------------------------------------------------------- +// +// ImageLib Utility Toolkit Sources +// Copyright (C) 2000-2009 by Denton Woods +// Last modified: 03/07/2009 +// +// Filename: IL/ilut.h +// +// Description: The main include file for ILUT +// +//----------------------------------------------------------------------------- + +// Doxygen comment +/*! \file ilut.h + The main include file for ILUT +*/ + +#ifndef __ilut_h_ +#ifndef __ILUT_H__ + +#define __ilut_h_ +#define __ILUT_H__ + +#include +#include + + +//----------------------------------------------------------------------------- +// Defines +//----------------------------------------------------------------------------- + +#define ILUT_VERSION_1_7_8 1 +#define ILUT_VERSION 178 + + +// Attribute Bits +#define ILUT_OPENGL_BIT 0x00000001 +#define ILUT_D3D_BIT 0x00000002 +#define ILUT_ALL_ATTRIB_BITS 0x000FFFFF + + +// Error Types +#define ILUT_INVALID_ENUM 0x0501 +#define ILUT_OUT_OF_MEMORY 0x0502 +#define ILUT_INVALID_VALUE 0x0505 +#define ILUT_ILLEGAL_OPERATION 0x0506 +#define ILUT_INVALID_PARAM 0x0509 +#define ILUT_COULD_NOT_OPEN_FILE 0x050A +#define ILUT_STACK_OVERFLOW 0x050E +#define ILUT_STACK_UNDERFLOW 0x050F +#define ILUT_BAD_DIMENSIONS 0x0511 +#define ILUT_NOT_SUPPORTED 0x0550 + + +// State Definitions +#define ILUT_PALETTE_MODE 0x0600 +#define ILUT_OPENGL_CONV 0x0610 +#define ILUT_D3D_MIPLEVELS 0x0620 +#define ILUT_MAXTEX_WIDTH 0x0630 +#define ILUT_MAXTEX_HEIGHT 0x0631 +#define ILUT_MAXTEX_DEPTH 0x0632 +#define ILUT_GL_USE_S3TC 0x0634 +#define ILUT_D3D_USE_DXTC 0x0634 +#define ILUT_GL_GEN_S3TC 0x0635 +#define ILUT_D3D_GEN_DXTC 0x0635 +#define ILUT_S3TC_FORMAT 0x0705 +#define ILUT_DXTC_FORMAT 0x0705 +#define ILUT_D3D_POOL 0x0706 +#define ILUT_D3D_ALPHA_KEY_COLOR 0x0707 +#define ILUT_D3D_ALPHA_KEY_COLOUR 0x0707 +#define ILUT_FORCE_INTEGER_FORMAT 0x0636 + +//This new state does automatic texture target detection +//if enabled. Currently, only cubemap detection is supported. +//if the current image is no cubemap, the 2d texture is chosen. +#define ILUT_GL_AUTODETECT_TEXTURE_TARGET 0x0807 + + +// Values +#define ILUT_VERSION_NUM IL_VERSION_NUM +#define ILUT_VENDOR IL_VENDOR + +// The different rendering api's...more to be added later? +#define ILUT_OPENGL 0 +#define ILUT_ALLEGRO 1 +#define ILUT_WIN32 2 +#define ILUT_DIRECT3D8 3 +#define ILUT_DIRECT3D9 4 +#define ILUT_X11 5 +#define ILUT_DIRECT3D10 6 + +/* +// Includes specific config +#ifdef DJGPP + #define ILUT_USE_ALLEGRO +#elif _WIN32_WCE + #define ILUT_USE_WIN32 +#elif _WIN32 + //#ifdef __GNUC__ //__CYGWIN32__ (Cygwin seems to not define this with DevIL builds) + #define ILUT_USE_WIN32 + #include "IL/config.h" + + // Temporary fix for the SDL main() linker bug. + //#ifdef ILUT_USE_SDL + //#undef ILUT_USE_SDL + //#endif//ILUT_USE_SDL + + //#else + // #define ILUT_USE_WIN32 + // #define ILUT_USE_OPENGL + // #define ILUT_USE_SDL + // #define ILUT_USE_DIRECTX8 + //#endif +#elif BEOS // Don't know the #define + #define ILUT_USE_BEOS + #define ILUT_USE_OPENGL +#elif MACOSX + #define ILUT_USE_OPENGL +#else + + // We are surely using a *nix so the configure script + // may have written the configured config.h header + #include "IL/config.h" +#endif +*/ + +#if (defined(_WIN32) || defined(_WIN64)) + #if (defined(IL_USE_PRAGMA_LIBS)) && (!defined(_IL_BUILD_LIBRARY)) + #if defined(_MSC_VER) || defined(__BORLANDC__) + #pragma comment(lib, "ILUT.lib") + #endif + #endif + + #include +#endif + + + +//this should remain private and hidden +//#include "IL/config.h" + +////////////// +// OpenGL +////////////// + +#ifdef ILUT_USE_OPENGL + #if defined(_MSC_VER) || defined(_WIN32) + //#define WIN32_LEAN_AND_MEAN + #include + #endif//_MSC_VER + + #ifdef __APPLE__ + #include + #include + #else + #include + #include + #endif//__APPLE__ +#endif + + +#ifdef ILUT_USE_WIN32 + //#define WIN32_LEAN_AND_MEAN + #ifdef _DEBUG + #define _CRTDBG_MAP_ALLOC + #include + #ifndef _WIN32_WCE + #include + #endif + #endif + #include +#endif + + +// +// If we can avoid including these in all cases thing tend to break less +// and we can keep all of them defined as available +// +// Kriss +// + +// ImageLib Utility Toolkit's Allegro Functions +#ifdef ILUT_USE_ALLEGRO +// #include +#endif//ILUT_USE_ALLEGRO + +#ifdef ILUT_USE_SDL +// #include +#endif + +#ifdef ILUT_USE_DIRECTX8 + #include +#endif//ILUT_USE_DIRECTX9 + +#ifdef ILUT_USE_DIRECTX9 + #include +#endif//ILUT_USE_DIRECTX9 + +#ifdef ILUT_USE_DIRECTX10 + #pragma warning(push) + #pragma warning(disable : 4201) // Disables 'nonstandard extension used : nameless struct/union' warning + #include + #include + #include + #pragma warning(pop) +#endif//ILUT_USE_DIRECTX10 + +#ifdef ILUT_USE_X11 + #include + #include +#ifdef ILUT_USE_XSHM + #include + #include + #include +#endif//ILUT_USE_XSHM +#endif//ILUT_USE_X11 + + + +//----------------------------------------------------------------------------- +// Functions +//----------------------------------------------------------------------------- + +#ifdef __cplusplus +extern "C" { +#endif + +// ImageLib Utility Toolkit Functions +ILAPI ILboolean ILAPIENTRY ilutDisable(ILenum Mode); +ILAPI ILboolean ILAPIENTRY ilutEnable(ILenum Mode); +ILAPI ILboolean ILAPIENTRY ilutGetBoolean(ILenum Mode); +ILAPI void ILAPIENTRY ilutGetBooleanv(ILenum Mode, ILboolean *Param); +ILAPI ILint ILAPIENTRY ilutGetInteger(ILenum Mode); +ILAPI void ILAPIENTRY ilutGetIntegerv(ILenum Mode, ILint *Param); +ILAPI ILstring ILAPIENTRY ilutGetString(ILenum StringName); +ILAPI void ILAPIENTRY ilutInit(void); +ILAPI ILboolean ILAPIENTRY ilutIsDisabled(ILenum Mode); +ILAPI ILboolean ILAPIENTRY ilutIsEnabled(ILenum Mode); +ILAPI void ILAPIENTRY ilutPopAttrib(void); +ILAPI void ILAPIENTRY ilutPushAttrib(ILuint Bits); +ILAPI void ILAPIENTRY ilutSetInteger(ILenum Mode, ILint Param); + +ILAPI ILboolean ILAPIENTRY ilutRenderer(ILenum Renderer); + + +// ImageLib Utility Toolkit's OpenGL Functions +#ifdef ILUT_USE_OPENGL + ILAPI GLuint ILAPIENTRY ilutGLBindTexImage(); + ILAPI GLuint ILAPIENTRY ilutGLBindMipmaps(void); + ILAPI ILboolean ILAPIENTRY ilutGLBuildMipmaps(void); + ILAPI GLuint ILAPIENTRY ilutGLLoadImage(ILstring FileName); + ILAPI ILboolean ILAPIENTRY ilutGLScreen(void); + ILAPI ILboolean ILAPIENTRY ilutGLScreenie(void); + ILAPI ILboolean ILAPIENTRY ilutGLSaveImage(ILstring FileName, GLuint TexID); + ILAPI ILboolean ILAPIENTRY ilutGLSubTex2D(GLuint TexID, ILuint XOff, ILuint YOff); + ILAPI ILboolean ILAPIENTRY ilutGLSubTex3D(GLuint TexID, ILuint XOff, ILuint YOff, ILuint ZOff); + ILAPI ILboolean ILAPIENTRY ilutGLSetTex2D(GLuint TexID); + ILAPI ILboolean ILAPIENTRY ilutGLSetTex3D(GLuint TexID); + ILAPI ILboolean ILAPIENTRY ilutGLTexImage(GLuint Level); + ILAPI ILboolean ILAPIENTRY ilutGLSubTex(GLuint TexID, ILuint XOff, ILuint YOff); + + ILAPI ILboolean ILAPIENTRY ilutGLSetTex(GLuint TexID); // Deprecated - use ilutGLSetTex2D. + ILAPI ILboolean ILAPIENTRY ilutGLSubTex(GLuint TexID, ILuint XOff, ILuint YOff); // Use ilutGLSubTex2D. +#endif//ILUT_USE_OPENGL + + +// ImageLib Utility Toolkit's Allegro Functions +#ifdef ILUT_USE_ALLEGRO + #ifdef __cplusplus + extern "C" { + #endif + #include + #ifdef __cplusplus + } + #endif + + ILAPI BITMAP* ILAPIENTRY ilutAllegLoadImage(ILstring FileName); + ILAPI BITMAP* ILAPIENTRY ilutConvertToAlleg(PALETTE Pal); +#endif//ILUT_USE_ALLEGRO + + +// ImageLib Utility Toolkit's SDL Functions +#ifdef ILUT_USE_SDL + ILAPI struct SDL_Surface* ILAPIENTRY ilutConvertToSDLSurface(unsigned int flags); + ILAPI struct SDL_Surface* ILAPIENTRY ilutSDLSurfaceLoadImage(ILstring FileName); + ILAPI ILboolean ILAPIENTRY ilutSDLSurfaceFromBitmap(struct SDL_Surface *Bitmap); +#endif//ILUT_USE_SDL + + +// ImageLib Utility Toolkit's BeOS Functions +#ifdef ILUT_USE_BEOS + ILAPI BBitmap ILAPIENTRY ilutConvertToBBitmap(void); +#endif//ILUT_USE_BEOS + + +// ImageLib Utility Toolkit's Win32 GDI Functions +#ifdef ILUT_USE_WIN32 + ILAPI HBITMAP ILAPIENTRY ilutConvertToHBitmap(HDC hDC); + ILAPI HBITMAP ILAPIENTRY ilutConvertSliceToHBitmap(HDC hDC, ILuint slice); + ILAPI void ILAPIENTRY ilutFreePaddedData(ILubyte *Data); + ILAPI void ILAPIENTRY ilutGetBmpInfo(BITMAPINFO *Info); + ILAPI HPALETTE ILAPIENTRY ilutGetHPal(void); + ILAPI ILubyte* ILAPIENTRY ilutGetPaddedData(void); + ILAPI ILboolean ILAPIENTRY ilutGetWinClipboard(void); + ILAPI ILboolean ILAPIENTRY ilutLoadResource(HINSTANCE hInst, ILint ID, ILstring ResourceType, ILenum Type); + ILAPI ILboolean ILAPIENTRY ilutSetHBitmap(HBITMAP Bitmap); + ILAPI ILboolean ILAPIENTRY ilutSetHPal(HPALETTE Pal); + ILAPI ILboolean ILAPIENTRY ilutSetWinClipboard(void); + ILAPI HBITMAP ILAPIENTRY ilutWinLoadImage(ILstring FileName, HDC hDC); + ILAPI ILboolean ILAPIENTRY ilutWinLoadUrl(ILstring Url); + ILAPI ILboolean ILAPIENTRY ilutWinPrint(ILuint XPos, ILuint YPos, ILuint Width, ILuint Height, HDC hDC); + ILAPI ILboolean ILAPIENTRY ilutWinSaveImage(ILstring FileName, HBITMAP Bitmap); +#endif//ILUT_USE_WIN32 + +// ImageLib Utility Toolkit's DirectX 8 Functions +#ifdef ILUT_USE_DIRECTX8 +// ILAPI void ILAPIENTRY ilutD3D8MipFunc(ILuint NumLevels); + ILAPI struct IDirect3DTexture8* ILAPIENTRY ilutD3D8Texture(struct IDirect3DDevice8 *Device); + ILAPI struct IDirect3DVolumeTexture8* ILAPIENTRY ilutD3D8VolumeTexture(struct IDirect3DDevice8 *Device); + ILAPI ILboolean ILAPIENTRY ilutD3D8TexFromFile(struct IDirect3DDevice8 *Device, char *FileName, struct IDirect3DTexture8 **Texture); + ILAPI ILboolean ILAPIENTRY ilutD3D8VolTexFromFile(struct IDirect3DDevice8 *Device, char *FileName, struct IDirect3DVolumeTexture8 **Texture); + ILAPI ILboolean ILAPIENTRY ilutD3D8TexFromFileInMemory(struct IDirect3DDevice8 *Device, void *Lump, ILuint Size, struct IDirect3DTexture8 **Texture); + ILAPI ILboolean ILAPIENTRY ilutD3D8VolTexFromFileInMemory(struct IDirect3DDevice8 *Device, void *Lump, ILuint Size, struct IDirect3DVolumeTexture8 **Texture); + ILAPI ILboolean ILAPIENTRY ilutD3D8TexFromFileHandle(struct IDirect3DDevice8 *Device, ILHANDLE File, struct IDirect3DTexture8 **Texture); + ILAPI ILboolean ILAPIENTRY ilutD3D8VolTexFromFileHandle(struct IDirect3DDevice8 *Device, ILHANDLE File, struct IDirect3DVolumeTexture8 **Texture); + // These two are not tested yet. + ILAPI ILboolean ILAPIENTRY ilutD3D8TexFromResource(struct IDirect3DDevice8 *Device, HMODULE SrcModule, char *SrcResource, struct IDirect3DTexture8 **Texture); + ILAPI ILboolean ILAPIENTRY ilutD3D8VolTexFromResource(struct IDirect3DDevice8 *Device, HMODULE SrcModule, char *SrcResource, struct IDirect3DVolumeTexture8 **Texture); + ILAPI ILboolean ILAPIENTRY ilutD3D8LoadSurface(struct IDirect3DDevice8 *Device, struct IDirect3DSurface8 *Surface); +#endif//ILUT_USE_DIRECTX8 + +#ifdef ILUT_USE_DIRECTX9 + #pragma warning(push) + #pragma warning(disable : 4115) // Disables 'named type definition in parentheses' warning +// ILAPI void ILAPIENTRY ilutD3D9MipFunc(ILuint NumLevels); + ILAPI struct IDirect3DTexture9* ILAPIENTRY ilutD3D9Texture (struct IDirect3DDevice9* Device); + ILAPI struct IDirect3DVolumeTexture9* ILAPIENTRY ilutD3D9VolumeTexture (struct IDirect3DDevice9* Device); + ILAPI struct IDirect3DCubeTexture9* ILAPIENTRY ilutD3D9CubeTexture (struct IDirect3DDevice9* Device); + + ILAPI ILboolean ILAPIENTRY ilutD3D9CubeTexFromFile(struct IDirect3DDevice9 *Device, ILconst_string FileName, struct IDirect3DCubeTexture9 **Texture); + ILAPI ILboolean ILAPIENTRY ilutD3D9CubeTexFromFileInMemory(struct IDirect3DDevice9 *Device, void *Lump, ILuint Size, struct IDirect3DCubeTexture9 **Texture); + ILAPI ILboolean ILAPIENTRY ilutD3D9CubeTexFromFileHandle(struct IDirect3DDevice9 *Device, ILHANDLE File, struct IDirect3DCubeTexture9 **Texture); + ILAPI ILboolean ILAPIENTRY ilutD3D9CubeTexFromResource(struct IDirect3DDevice9 *Device, HMODULE SrcModule, ILconst_string SrcResource, struct IDirect3DCubeTexture9 **Texture); + + ILAPI ILboolean ILAPIENTRY ilutD3D9TexFromFile(struct IDirect3DDevice9 *Device, ILconst_string FileName, struct IDirect3DTexture9 **Texture); + ILAPI ILboolean ILAPIENTRY ilutD3D9VolTexFromFile(struct IDirect3DDevice9 *Device, ILconst_string FileName, struct IDirect3DVolumeTexture9 **Texture); + ILAPI ILboolean ILAPIENTRY ilutD3D9TexFromFileInMemory(struct IDirect3DDevice9 *Device, void *Lump, ILuint Size, struct IDirect3DTexture9 **Texture); + ILAPI ILboolean ILAPIENTRY ilutD3D9VolTexFromFileInMemory(struct IDirect3DDevice9 *Device, void *Lump, ILuint Size, struct IDirect3DVolumeTexture9 **Texture); + ILAPI ILboolean ILAPIENTRY ilutD3D9TexFromFileHandle(struct IDirect3DDevice9 *Device, ILHANDLE File, struct IDirect3DTexture9 **Texture); + ILAPI ILboolean ILAPIENTRY ilutD3D9VolTexFromFileHandle(struct IDirect3DDevice9 *Device, ILHANDLE File, struct IDirect3DVolumeTexture9 **Texture); + + // These three are not tested yet. + ILAPI ILboolean ILAPIENTRY ilutD3D9TexFromResource(struct IDirect3DDevice9 *Device, HMODULE SrcModule, ILconst_string SrcResource, struct IDirect3DTexture9 **Texture); + ILAPI ILboolean ILAPIENTRY ilutD3D9VolTexFromResource(struct IDirect3DDevice9 *Device, HMODULE SrcModule, ILconst_string SrcResource, struct IDirect3DVolumeTexture9 **Texture); + ILAPI ILboolean ILAPIENTRY ilutD3D9LoadSurface(struct IDirect3DDevice9 *Device, struct IDirect3DSurface9 *Surface); + #pragma warning(pop) +#endif//ILUT_USE_DIRECTX9 + +#ifdef ILUT_USE_DIRECTX10 + ILAPI ID3D10Texture2D* ILAPIENTRY ilutD3D10Texture(ID3D10Device *Device); + ILAPI ILboolean ILAPIENTRY ilutD3D10TexFromFile(ID3D10Device *Device, ILconst_string FileName, ID3D10Texture2D **Texture); + ILAPI ILboolean ILAPIENTRY ilutD3D10TexFromFileInMemory(ID3D10Device *Device, void *Lump, ILuint Size, ID3D10Texture2D **Texture); + ILAPI ILboolean ILAPIENTRY ilutD3D10TexFromResource(ID3D10Device *Device, HMODULE SrcModule, ILconst_string SrcResource, ID3D10Texture2D **Texture); + ILAPI ILboolean ILAPIENTRY ilutD3D10TexFromFileHandle(ID3D10Device *Device, ILHANDLE File, ID3D10Texture2D **Texture); +#endif//ILUT_USE_DIRECTX10 + + + +#ifdef ILUT_USE_X11 + ILAPI XImage * ILAPIENTRY ilutXCreateImage( Display* ); + ILAPI Pixmap ILAPIENTRY ilutXCreatePixmap( Display*,Drawable ); + ILAPI XImage * ILAPIENTRY ilutXLoadImage( Display*,char* ); + ILAPI Pixmap ILAPIENTRY ilutXLoadPixmap( Display*,Drawable,char* ); +#ifdef ILUT_USE_XSHM + ILAPI XImage * ILAPIENTRY ilutXShmCreateImage( Display*,XShmSegmentInfo* ); + ILAPI void ILAPIENTRY ilutXShmDestroyImage( Display*,XImage*,XShmSegmentInfo* ); + ILAPI Pixmap ILAPIENTRY ilutXShmCreatePixmap( Display*,Drawable,XShmSegmentInfo* ); + ILAPI void ILAPIENTRY ilutXShmFreePixmap( Display*,Pixmap,XShmSegmentInfo* ); + ILAPI XImage * ILAPIENTRY ilutXShmLoadImage( Display*,char*,XShmSegmentInfo* ); + ILAPI Pixmap ILAPIENTRY ilutXShmLoadPixmap( Display*,Drawable,char*,XShmSegmentInfo* ); +#endif//ILUT_USE_XSHM +#endif//ILUT_USE_X11 + + +#ifdef __cplusplus +} +#endif + +#endif // __ILUT_H__ +#endif // __ilut_h_ diff --git a/mcclone/external/devil178/include/IL/ilut_config.h b/mcclone/external/devil178/include/IL/ilut_config.h new file mode 100644 index 0000000..2b3625b --- /dev/null +++ b/mcclone/external/devil178/include/IL/ilut_config.h @@ -0,0 +1,26 @@ +#ifndef __ILUT_CONFIG_H__ +#define __ILUT_CONFIG_H__ + +#define IL_USE_PRAGMA_LIBS + +// Supported APIs (ILUT) + +// +// sorry just +// cant get this one to work under windows +// have disabled for the now +// +// will look at it some more later +// +// Kriss +// +#undef ILUT_USE_ALLEGRO + +#undef ILUT_USE_DIRECTX8 +//#define ILUT_USE_DIRECTX9 +//#define ILUT_USE_DIRECTX10 +#define ILUT_USE_OPENGL +//#define ILUT_USE_SDL +#define ILUT_USE_WIN32 + +#endif//__ILUT_CONFIG_H__ diff --git a/mcclone/external/devil178/lib/DevIL.dll b/mcclone/external/devil178/lib/DevIL.dll new file mode 100644 index 0000000..b7a4c09 Binary files /dev/null and b/mcclone/external/devil178/lib/DevIL.dll differ diff --git a/mcclone/external/devil178/lib/DevIL.lib b/mcclone/external/devil178/lib/DevIL.lib new file mode 100644 index 0000000..1aa82d0 Binary files /dev/null and b/mcclone/external/devil178/lib/DevIL.lib differ diff --git a/mcclone/external/devil178/lib/ILU.dll b/mcclone/external/devil178/lib/ILU.dll new file mode 100644 index 0000000..b5f6561 Binary files /dev/null and b/mcclone/external/devil178/lib/ILU.dll differ diff --git a/mcclone/external/devil178/lib/ILU.lib b/mcclone/external/devil178/lib/ILU.lib new file mode 100644 index 0000000..5124172 Binary files /dev/null and b/mcclone/external/devil178/lib/ILU.lib differ diff --git a/mcclone/external/devil178/lib/ILUT.dll b/mcclone/external/devil178/lib/ILUT.dll new file mode 100644 index 0000000..3317889 Binary files /dev/null and b/mcclone/external/devil178/lib/ILUT.dll differ diff --git a/mcclone/external/devil178/lib/ILUT.lib b/mcclone/external/devil178/lib/ILUT.lib new file mode 100644 index 0000000..99bfb61 Binary files /dev/null and b/mcclone/external/devil178/lib/ILUT.lib differ diff --git a/mcclone/external/devil178/lib/unicode/DevIL.dll b/mcclone/external/devil178/lib/unicode/DevIL.dll new file mode 100644 index 0000000..1b8ed4b Binary files /dev/null and b/mcclone/external/devil178/lib/unicode/DevIL.dll differ diff --git a/mcclone/external/devil178/lib/unicode/DevIL.lib b/mcclone/external/devil178/lib/unicode/DevIL.lib new file mode 100644 index 0000000..40b60a9 Binary files /dev/null and b/mcclone/external/devil178/lib/unicode/DevIL.lib differ diff --git a/mcclone/external/devil178/lib/unicode/ILU.dll b/mcclone/external/devil178/lib/unicode/ILU.dll new file mode 100644 index 0000000..8d38082 Binary files /dev/null and b/mcclone/external/devil178/lib/unicode/ILU.dll differ diff --git a/mcclone/external/devil178/lib/unicode/ILU.lib b/mcclone/external/devil178/lib/unicode/ILU.lib new file mode 100644 index 0000000..d8daf83 Binary files /dev/null and b/mcclone/external/devil178/lib/unicode/ILU.lib differ diff --git a/mcclone/external/devil178/lib/unicode/ILUT.dll b/mcclone/external/devil178/lib/unicode/ILUT.dll new file mode 100644 index 0000000..e6cc19d Binary files /dev/null and b/mcclone/external/devil178/lib/unicode/ILUT.dll differ diff --git a/mcclone/external/devil178/lib/unicode/ILUT.lib b/mcclone/external/devil178/lib/unicode/ILUT.lib new file mode 100644 index 0000000..89bc4ee Binary files /dev/null and b/mcclone/external/devil178/lib/unicode/ILUT.lib differ diff --git a/mcclone/external/sfml23/include/SFML/Audio.hpp b/mcclone/external/sfml23/include/SFML/Audio.hpp new file mode 100644 index 0000000..41737cf --- /dev/null +++ b/mcclone/external/sfml23/include/SFML/Audio.hpp @@ -0,0 +1,56 @@ +//////////////////////////////////////////////////////////// +// +// SFML - Simple and Fast Multimedia Library +// Copyright (C) 2007-2015 Laurent Gomila (laurent@sfml-dev.org) +// +// This software is provided 'as-is', without any express or implied warranty. +// In no event will the authors be held liable for any damages arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it freely, +// subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; +// you must not claim that you wrote the original software. +// If you use this software in a product, an acknowledgment +// in the product documentation would be appreciated but is not required. +// +// 2. Altered source versions must be plainly marked as such, +// and must not be misrepresented as being the original software. +// +// 3. This notice may not be removed or altered from any source distribution. +// +//////////////////////////////////////////////////////////// + +#ifndef SFML_AUDIO_HPP +#define SFML_AUDIO_HPP + +//////////////////////////////////////////////////////////// +// Headers +//////////////////////////////////////////////////////////// + +#include +#include +#include +#include +#include +#include +#include +#include +#include +#include +#include +#include +#include +#include + + +#endif // SFML_AUDIO_HPP + +//////////////////////////////////////////////////////////// +/// \defgroup audio Audio module +/// +/// Sounds, streaming (musics or custom sources), recording, +/// spatialization. +/// +//////////////////////////////////////////////////////////// diff --git a/mcclone/external/sfml23/include/SFML/Audio/AlResource.hpp b/mcclone/external/sfml23/include/SFML/Audio/AlResource.hpp new file mode 100644 index 0000000..ca5d2c0 --- /dev/null +++ b/mcclone/external/sfml23/include/SFML/Audio/AlResource.hpp @@ -0,0 +1,70 @@ +//////////////////////////////////////////////////////////// +// +// SFML - Simple and Fast Multimedia Library +// Copyright (C) 2007-2015 Laurent Gomila (laurent@sfml-dev.org) +// +// This software is provided 'as-is', without any express or implied warranty. +// In no event will the authors be held liable for any damages arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it freely, +// subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; +// you must not claim that you wrote the original software. +// If you use this software in a product, an acknowledgment +// in the product documentation would be appreciated but is not required. +// +// 2. Altered source versions must be plainly marked as such, +// and must not be misrepresented as being the original software. +// +// 3. This notice may not be removed or altered from any source distribution. +// +//////////////////////////////////////////////////////////// + +#ifndef SFML_ALRESOURCE_HPP +#define SFML_ALRESOURCE_HPP + +//////////////////////////////////////////////////////////// +// Headers +//////////////////////////////////////////////////////////// +#include + + +namespace sf +{ +//////////////////////////////////////////////////////////// +/// \brief Base class for classes that require an OpenAL context +/// +//////////////////////////////////////////////////////////// +class SFML_AUDIO_API AlResource +{ +protected: + + //////////////////////////////////////////////////////////// + /// \brief Default constructor + /// + //////////////////////////////////////////////////////////// + AlResource(); + + //////////////////////////////////////////////////////////// + /// \brief Destructor + /// + //////////////////////////////////////////////////////////// + ~AlResource(); +}; + +} // namespace sf + + +#endif // SFML_ALRESOURCE_HPP + +//////////////////////////////////////////////////////////// +/// \class sf::AlResource +/// \ingroup audio +/// +/// This class is for internal use only, it must be the base +/// of every class that requires a valid OpenAL context in +/// order to work. +/// +//////////////////////////////////////////////////////////// diff --git a/mcclone/external/sfml23/include/SFML/Audio/Export.hpp b/mcclone/external/sfml23/include/SFML/Audio/Export.hpp new file mode 100644 index 0000000..1ea6f42 --- /dev/null +++ b/mcclone/external/sfml23/include/SFML/Audio/Export.hpp @@ -0,0 +1,48 @@ +//////////////////////////////////////////////////////////// +// +// SFML - Simple and Fast Multimedia Library +// Copyright (C) 2007-2015 Laurent Gomila (laurent@sfml-dev.org) +// +// This software is provided 'as-is', without any express or implied warranty. +// In no event will the authors be held liable for any damages arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it freely, +// subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; +// you must not claim that you wrote the original software. +// If you use this software in a product, an acknowledgment +// in the product documentation would be appreciated but is not required. +// +// 2. Altered source versions must be plainly marked as such, +// and must not be misrepresented as being the original software. +// +// 3. This notice may not be removed or altered from any source distribution. +// +//////////////////////////////////////////////////////////// + +#ifndef SFML_AUDIO_EXPORT_HPP +#define SFML_AUDIO_EXPORT_HPP + +//////////////////////////////////////////////////////////// +// Headers +//////////////////////////////////////////////////////////// +#include + + +//////////////////////////////////////////////////////////// +// Define portable import / export macros +//////////////////////////////////////////////////////////// +#if defined(SFML_AUDIO_EXPORTS) + + #define SFML_AUDIO_API SFML_API_EXPORT + +#else + + #define SFML_AUDIO_API SFML_API_IMPORT + +#endif + + +#endif // SFML_AUDIO_EXPORT_HPP diff --git a/mcclone/external/sfml23/include/SFML/Audio/InputSoundFile.hpp b/mcclone/external/sfml23/include/SFML/Audio/InputSoundFile.hpp new file mode 100644 index 0000000..5e306ae --- /dev/null +++ b/mcclone/external/sfml23/include/SFML/Audio/InputSoundFile.hpp @@ -0,0 +1,250 @@ +//////////////////////////////////////////////////////////// +// +// SFML - Simple and Fast Multimedia Library +// Copyright (C) 2007-2015 Laurent Gomila (laurent@sfml-dev.org) +// +// This software is provided 'as-is', without any express or implied warranty. +// In no event will the authors be held liable for any damages arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it freely, +// subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; +// you must not claim that you wrote the original software. +// If you use this software in a product, an acknowledgment +// in the product documentation would be appreciated but is not required. +// +// 2. Altered source versions must be plainly marked as such, +// and must not be misrepresented as being the original software. +// +// 3. This notice may not be removed or altered from any source distribution. +// +//////////////////////////////////////////////////////////// + +#ifndef SFML_INPUTSOUNDFILE_HPP +#define SFML_INPUTSOUNDFILE_HPP + +//////////////////////////////////////////////////////////// +// Headers +//////////////////////////////////////////////////////////// +#include +#include +#include +#include + + +namespace sf +{ +class InputStream; +class SoundFileReader; + +//////////////////////////////////////////////////////////// +/// \brief Provide read access to sound files +/// +//////////////////////////////////////////////////////////// +class SFML_AUDIO_API InputSoundFile : NonCopyable +{ +public: + + //////////////////////////////////////////////////////////// + /// \brief Default constructor + /// + //////////////////////////////////////////////////////////// + InputSoundFile(); + + //////////////////////////////////////////////////////////// + /// \brief Destructor + /// + //////////////////////////////////////////////////////////// + ~InputSoundFile(); + + //////////////////////////////////////////////////////////// + /// \brief Open a sound file from the disk for reading + /// + /// The supported audio formats are: WAV, OGG/Vorbis, FLAC. + /// + /// \param filename Path of the sound file to load + /// + /// \return True if the file was successfully opened + /// + //////////////////////////////////////////////////////////// + bool openFromFile(const std::string& filename); + + //////////////////////////////////////////////////////////// + /// \brief Open a sound file in memory for reading + /// + /// The supported audio formats are: WAV, OGG/Vorbis, FLAC. + /// + /// \param data Pointer to the file data in memory + /// \param sizeInBytes Size of the data to load, in bytes + /// + /// \return True if the file was successfully opened + /// + //////////////////////////////////////////////////////////// + bool openFromMemory(const void* data, std::size_t sizeInBytes); + + //////////////////////////////////////////////////////////// + /// \brief Open a sound file from a custom stream for reading + /// + /// The supported audio formats are: WAV, OGG/Vorbis, FLAC. + /// + /// \param stream Source stream to read from + /// + /// \return True if the file was successfully opened + /// + //////////////////////////////////////////////////////////// + bool openFromStream(InputStream& stream); + + //////////////////////////////////////////////////////////// + /// \brief Open the sound file from the disk for writing + /// + /// \param filename Path of the sound file to write + /// \param channelCount Number of channels in the sound + /// \param sampleRate Sample rate of the sound + /// + /// \return True if the file was successfully opened + /// + //////////////////////////////////////////////////////////// + bool openForWriting(const std::string& filename, unsigned int channelCount, unsigned int sampleRate); + + //////////////////////////////////////////////////////////// + /// \brief Get the total number of audio samples in the file + /// + /// \return Number of samples + /// + //////////////////////////////////////////////////////////// + Uint64 getSampleCount() const; + + //////////////////////////////////////////////////////////// + /// \brief Get the number of channels used by the sound + /// + /// \return Number of channels (1 = mono, 2 = stereo) + /// + //////////////////////////////////////////////////////////// + unsigned int getChannelCount() const; + + //////////////////////////////////////////////////////////// + /// \brief Get the sample rate of the sound + /// + /// \return Sample rate, in samples per second + /// + //////////////////////////////////////////////////////////// + unsigned int getSampleRate() const; + + //////////////////////////////////////////////////////////// + /// \brief Get the total duration of the sound file + /// + /// This function is provided for convenience, the duration is + /// deduced from the other sound file attributes. + /// + /// \return Duration of the sound file + /// + //////////////////////////////////////////////////////////// + Time getDuration() const; + + //////////////////////////////////////////////////////////// + /// \brief Change the current read position to the given sample offset + /// + /// This function takes a sample offset to provide maximum + /// precision. If you need to jump to a given time, use the + /// other overload. + /// + /// If the given offset exceeds to total number of samples, + /// this function jumps to the end of the sound file. + /// + /// \param sampleOffset Index of the sample to jump to, relative to the beginning + /// + //////////////////////////////////////////////////////////// + void seek(Uint64 sampleOffset); + + //////////////////////////////////////////////////////////// + /// \brief Change the current read position to the given time offset + /// + /// Using a time offset is handy but imprecise. If you need an accurate + /// result, consider using the overload which takes a sample offset. + /// + /// If the given time exceeds to total duration, this function jumps + /// to the end of the sound file. + /// + /// \param timeOffset Time to jump to, relative to the beginning + /// + //////////////////////////////////////////////////////////// + void seek(Time timeOffset); + + //////////////////////////////////////////////////////////// + /// \brief Read audio samples from the open file + /// + /// \param samples Pointer to the sample array to fill + /// \param maxCount Maximum number of samples to read + /// + /// \return Number of samples actually read (may be less than \a maxCount) + /// + //////////////////////////////////////////////////////////// + Uint64 read(Int16* samples, Uint64 maxCount); + +private: + + //////////////////////////////////////////////////////////// + /// \brief Close the current file + /// + //////////////////////////////////////////////////////////// + void close(); + + //////////////////////////////////////////////////////////// + // Member data + //////////////////////////////////////////////////////////// + SoundFileReader* m_reader; ///< Reader that handles I/O on the file's format + InputStream* m_stream; ///< Input stream used to access the file's data + bool m_streamOwned; ///< Is the stream internal or external? + Uint64 m_sampleCount; ///< Total number of samples in the file + unsigned int m_channelCount; ///< Number of channels of the sound + unsigned int m_sampleRate; ///< Number of samples per second +}; + +} // namespace sf + + +#endif // SFML_INPUTSOUNDFILE_HPP + + +//////////////////////////////////////////////////////////// +/// \class sf::InputSoundFile +/// \ingroup audio +/// +/// This class decodes audio samples from a sound file. It is +/// used internally by higher-level classes such as sf::SoundBuffer +/// and sf::Music, but can also be useful if you want to process +/// or analyze audio files without playing them, or if you want to +/// implement your own version of sf::Music with more specific +/// features. +/// +/// Usage example: +/// \code +/// // Open a sound file +/// sf::InputSoundFile file; +/// if (!file.openFromFile("music.ogg")) +/// /* error */; +/// +/// // Print the sound attributes +/// std::cout << "duration: " << file.getDuration().asSeconds() << std::endl; +/// std::cout << "channels: " << file.getChannelCount() << std::endl; +/// std::cout << "sample rate: " << file.getSampleRate() << std::endl; +/// std::cout << "sample count: " << file.getSampleCount() << std::endl; +/// +/// // Read and process batches of samples until the end of file is reached +/// sf::Int16 samples[1024]; +/// sf::Uint64 count; +/// do +/// { +/// count = file.read(samples, 1024); +/// +/// // process, analyze, play, convert, or whatever +/// // you want to do with the samples... +/// } +/// while (count > 0); +/// \endcode +/// +/// \see sf::SoundFileReader, sf::OutputSoundFile +/// +//////////////////////////////////////////////////////////// diff --git a/mcclone/external/sfml23/include/SFML/Audio/Listener.hpp b/mcclone/external/sfml23/include/SFML/Audio/Listener.hpp new file mode 100644 index 0000000..04e4af3 --- /dev/null +++ b/mcclone/external/sfml23/include/SFML/Audio/Listener.hpp @@ -0,0 +1,234 @@ +//////////////////////////////////////////////////////////// +// +// SFML - Simple and Fast Multimedia Library +// Copyright (C) 2007-2015 Laurent Gomila (laurent@sfml-dev.org) +// +// This software is provided 'as-is', without any express or implied warranty. +// In no event will the authors be held liable for any damages arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it freely, +// subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; +// you must not claim that you wrote the original software. +// If you use this software in a product, an acknowledgment +// in the product documentation would be appreciated but is not required. +// +// 2. Altered source versions must be plainly marked as such, +// and must not be misrepresented as being the original software. +// +// 3. This notice may not be removed or altered from any source distribution. +// +//////////////////////////////////////////////////////////// + +#ifndef SFML_LISTENER_HPP +#define SFML_LISTENER_HPP + +//////////////////////////////////////////////////////////// +// Headers +//////////////////////////////////////////////////////////// +#include +#include + + +namespace sf +{ +//////////////////////////////////////////////////////////// +/// \brief The audio listener is the point in the scene +/// from where all the sounds are heard +/// +//////////////////////////////////////////////////////////// +class SFML_AUDIO_API Listener +{ +public: + + //////////////////////////////////////////////////////////// + /// \brief Change the global volume of all the sounds and musics + /// + /// The volume is a number between 0 and 100; it is combined with + /// the individual volume of each sound / music. + /// The default value for the volume is 100 (maximum). + /// + /// \param volume New global volume, in the range [0, 100] + /// + /// \see getGlobalVolume + /// + //////////////////////////////////////////////////////////// + static void setGlobalVolume(float volume); + + //////////////////////////////////////////////////////////// + /// \brief Get the current value of the global volume + /// + /// \return Current global volume, in the range [0, 100] + /// + /// \see setGlobalVolume + /// + //////////////////////////////////////////////////////////// + static float getGlobalVolume(); + + //////////////////////////////////////////////////////////// + /// \brief Set the position of the listener in the scene + /// + /// The default listener's position is (0, 0, 0). + /// + /// \param x X coordinate of the listener's position + /// \param y Y coordinate of the listener's position + /// \param z Z coordinate of the listener's position + /// + /// \see getPosition, setDirection + /// + //////////////////////////////////////////////////////////// + static void setPosition(float x, float y, float z); + + //////////////////////////////////////////////////////////// + /// \brief Set the position of the listener in the scene + /// + /// The default listener's position is (0, 0, 0). + /// + /// \param position New listener's position + /// + /// \see getPosition, setDirection + /// + //////////////////////////////////////////////////////////// + static void setPosition(const Vector3f& position); + + //////////////////////////////////////////////////////////// + /// \brief Get the current position of the listener in the scene + /// + /// \return Listener's position + /// + /// \see setPosition + /// + //////////////////////////////////////////////////////////// + static Vector3f getPosition(); + + //////////////////////////////////////////////////////////// + /// \brief Set the forward vector of the listener in the scene + /// + /// The direction (also called "at vector") is the vector + /// pointing forward from the listener's perspective. Together + /// with the up vector, it defines the 3D orientation of the + /// listener in the scene. The direction vector doesn't + /// have to be normalized. + /// The default listener's direction is (0, 0, -1). + /// + /// \param x X coordinate of the listener's direction + /// \param y Y coordinate of the listener's direction + /// \param z Z coordinate of the listener's direction + /// + /// \see getDirection, setUpVector, setPosition + /// + //////////////////////////////////////////////////////////// + static void setDirection(float x, float y, float z); + + //////////////////////////////////////////////////////////// + /// \brief Set the forward vector of the listener in the scene + /// + /// The direction (also called "at vector") is the vector + /// pointing forward from the listener's perspective. Together + /// with the up vector, it defines the 3D orientation of the + /// listener in the scene. The direction vector doesn't + /// have to be normalized. + /// The default listener's direction is (0, 0, -1). + /// + /// \param direction New listener's direction + /// + /// \see getDirection, setUpVector, setPosition + /// + //////////////////////////////////////////////////////////// + static void setDirection(const Vector3f& direction); + + //////////////////////////////////////////////////////////// + /// \brief Get the current forward vector of the listener in the scene + /// + /// \return Listener's forward vector (not normalized) + /// + /// \see setDirection + /// + //////////////////////////////////////////////////////////// + static Vector3f getDirection(); + + //////////////////////////////////////////////////////////// + /// \brief Set the upward vector of the listener in the scene + /// + /// The up vector is the vector that points upward from the + /// listener's perspective. Together with the direction, it + /// defines the 3D orientation of the listener in the scene. + /// The up vector doesn't have to be normalized. + /// The default listener's up vector is (0, 1, 0). It is usually + /// not necessary to change it, especially in 2D scenarios. + /// + /// \param x X coordinate of the listener's up vector + /// \param y Y coordinate of the listener's up vector + /// \param z Z coordinate of the listener's up vector + /// + /// \see getUpVector, setDirection, setPosition + /// + //////////////////////////////////////////////////////////// + static void setUpVector(float x, float y, float z); + + //////////////////////////////////////////////////////////// + /// \brief Set the upward vector of the listener in the scene + /// + /// The up vector is the vector that points upward from the + /// listener's perspective. Together with the direction, it + /// defines the 3D orientation of the listener in the scene. + /// The up vector doesn't have to be normalized. + /// The default listener's up vector is (0, 1, 0). It is usually + /// not necessary to change it, especially in 2D scenarios. + /// + /// \param upVector New listener's up vector + /// + /// \see getUpVector, setDirection, setPosition + /// + //////////////////////////////////////////////////////////// + static void setUpVector(const Vector3f& upVector); + + //////////////////////////////////////////////////////////// + /// \brief Get the current upward vector of the listener in the scene + /// + /// \return Listener's upward vector (not normalized) + /// + /// \see setUpVector + /// + //////////////////////////////////////////////////////////// + static Vector3f getUpVector(); +}; + +} // namespace sf + + +#endif // SFML_LISTENER_HPP + + +//////////////////////////////////////////////////////////// +/// \class sf::Listener +/// \ingroup audio +/// +/// The audio listener defines the global properties of the +/// audio environment, it defines where and how sounds and musics +/// are heard. If sf::View is the eyes of the user, then sf::Listener +/// is his ears (by the way, they are often linked together -- +/// same position, orientation, etc.). +/// +/// sf::Listener is a simple interface, which allows to setup the +/// listener in the 3D audio environment (position, direction and +/// up vector), and to adjust the global volume. +/// +/// Because the listener is unique in the scene, sf::Listener only +/// contains static functions and doesn't have to be instantiated. +/// +/// Usage example: +/// \code +/// // Move the listener to the position (1, 0, -5) +/// sf::Listener::setPosition(1, 0, -5); +/// +/// // Make it face the right axis (1, 0, 0) +/// sf::Listener::setDirection(1, 0, 0); +/// +/// // Reduce the global volume +/// sf::Listener::setGlobalVolume(50); +/// \endcode +/// +//////////////////////////////////////////////////////////// diff --git a/mcclone/external/sfml23/include/SFML/Audio/Music.hpp b/mcclone/external/sfml23/include/SFML/Audio/Music.hpp new file mode 100644 index 0000000..76b4254 --- /dev/null +++ b/mcclone/external/sfml23/include/SFML/Audio/Music.hpp @@ -0,0 +1,229 @@ +//////////////////////////////////////////////////////////// +// +// SFML - Simple and Fast Multimedia Library +// Copyright (C) 2007-2015 Laurent Gomila (laurent@sfml-dev.org) +// +// This software is provided 'as-is', without any express or implied warranty. +// In no event will the authors be held liable for any damages arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it freely, +// subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; +// you must not claim that you wrote the original software. +// If you use this software in a product, an acknowledgment +// in the product documentation would be appreciated but is not required. +// +// 2. Altered source versions must be plainly marked as such, +// and must not be misrepresented as being the original software. +// +// 3. This notice may not be removed or altered from any source distribution. +// +//////////////////////////////////////////////////////////// + +#ifndef SFML_MUSIC_HPP +#define SFML_MUSIC_HPP + +//////////////////////////////////////////////////////////// +// Headers +//////////////////////////////////////////////////////////// +#include +#include +#include +#include +#include +#include +#include + + +namespace sf +{ +class InputStream; + +//////////////////////////////////////////////////////////// +/// \brief Streamed music played from an audio file +/// +//////////////////////////////////////////////////////////// +class SFML_AUDIO_API Music : public SoundStream +{ +public: + + //////////////////////////////////////////////////////////// + /// \brief Default constructor + /// + //////////////////////////////////////////////////////////// + Music(); + + //////////////////////////////////////////////////////////// + /// \brief Destructor + /// + //////////////////////////////////////////////////////////// + ~Music(); + + //////////////////////////////////////////////////////////// + /// \brief Open a music from an audio file + /// + /// This function doesn't start playing the music (call play() + /// to do so). + /// See the documentation of sf::InputSoundFile for the list + /// of supported formats. + /// + /// \warning Since the music is not loaded at once but rather + /// streamed continuously, the file must remain accessible until + /// the sf::Music object loads a new music or is destroyed. + /// + /// \param filename Path of the music file to open + /// + /// \return True if loading succeeded, false if it failed + /// + /// \see openFromMemory, openFromStream + /// + //////////////////////////////////////////////////////////// + bool openFromFile(const std::string& filename); + + //////////////////////////////////////////////////////////// + /// \brief Open a music from an audio file in memory + /// + /// This function doesn't start playing the music (call play() + /// to do so). + /// See the documentation of sf::InputSoundFile for the list + /// of supported formats. + /// + /// \warning Since the music is not loaded at once but rather streamed + /// continuously, the \a data buffer must remain accessible until + /// the sf::Music object loads a new music or is destroyed. That is, + /// you can't deallocate the buffer right after calling this function. + /// + /// \param data Pointer to the file data in memory + /// \param sizeInBytes Size of the data to load, in bytes + /// + /// \return True if loading succeeded, false if it failed + /// + /// \see openFromFile, openFromStream + /// + //////////////////////////////////////////////////////////// + bool openFromMemory(const void* data, std::size_t sizeInBytes); + + //////////////////////////////////////////////////////////// + /// \brief Open a music from an audio file in a custom stream + /// + /// This function doesn't start playing the music (call play() + /// to do so). + /// See the documentation of sf::InputSoundFile for the list + /// of supported formats. + /// + /// \warning Since the music is not loaded at once but rather + /// streamed continuously, the \a stream must remain accessible + /// until the sf::Music object loads a new music or is destroyed. + /// + /// \param stream Source stream to read from + /// + /// \return True if loading succeeded, false if it failed + /// + /// \see openFromFile, openFromMemory + /// + //////////////////////////////////////////////////////////// + bool openFromStream(InputStream& stream); + + //////////////////////////////////////////////////////////// + /// \brief Get the total duration of the music + /// + /// \return Music duration + /// + //////////////////////////////////////////////////////////// + Time getDuration() const; + +protected: + + //////////////////////////////////////////////////////////// + /// \brief Request a new chunk of audio samples from the stream source + /// + /// This function fills the chunk from the next samples + /// to read from the audio file. + /// + /// \param data Chunk of data to fill + /// + /// \return True to continue playback, false to stop + /// + //////////////////////////////////////////////////////////// + virtual bool onGetData(Chunk& data); + + //////////////////////////////////////////////////////////// + /// \brief Change the current playing position in the stream source + /// + /// \param timeOffset New playing position, from the beginning of the music + /// + //////////////////////////////////////////////////////////// + virtual void onSeek(Time timeOffset); + +private: + + //////////////////////////////////////////////////////////// + /// \brief Initialize the internal state after loading a new music + /// + //////////////////////////////////////////////////////////// + void initialize(); + + //////////////////////////////////////////////////////////// + // Member data + //////////////////////////////////////////////////////////// + InputSoundFile m_file; ///< The streamed music file + Time m_duration; ///< Music duration + std::vector m_samples; ///< Temporary buffer of samples + Mutex m_mutex; ///< Mutex protecting the data +}; + +} // namespace sf + + +#endif // SFML_MUSIC_HPP + + +//////////////////////////////////////////////////////////// +/// \class sf::Music +/// \ingroup audio +/// +/// Musics are sounds that are streamed rather than completely +/// loaded in memory. This is especially useful for compressed +/// musics that usually take hundreds of MB when they are +/// uncompressed: by streaming it instead of loading it entirely, +/// you avoid saturating the memory and have almost no loading delay. +/// This implies that the underlying resource (file, stream or +/// memory buffer) must remain valid for the lifetime of the +/// sf::Music object. +/// +/// Apart from that, a sf::Music has almost the same features as +/// the sf::SoundBuffer / sf::Sound pair: you can play/pause/stop +/// it, request its parameters (channels, sample rate), change +/// the way it is played (pitch, volume, 3D position, ...), etc. +/// +/// As a sound stream, a music is played in its own thread in order +/// not to block the rest of the program. This means that you can +/// leave the music alone after calling play(), it will manage itself +/// very well. +/// +/// Usage example: +/// \code +/// // Declare a new music +/// sf::Music music; +/// +/// // Open it from an audio file +/// if (!music.openFromFile("music.ogg")) +/// { +/// // error... +/// } +/// +/// // Change some parameters +/// music.setPosition(0, 1, 10); // change its 3D position +/// music.setPitch(2); // increase the pitch +/// music.setVolume(50); // reduce the volume +/// music.setLoop(true); // make it loop +/// +/// // Play it +/// music.play(); +/// \endcode +/// +/// \see sf::Sound, sf::SoundStream +/// +//////////////////////////////////////////////////////////// diff --git a/mcclone/external/sfml23/include/SFML/Audio/OutputSoundFile.hpp b/mcclone/external/sfml23/include/SFML/Audio/OutputSoundFile.hpp new file mode 100644 index 0000000..8f60498 --- /dev/null +++ b/mcclone/external/sfml23/include/SFML/Audio/OutputSoundFile.hpp @@ -0,0 +1,133 @@ +//////////////////////////////////////////////////////////// +// +// SFML - Simple and Fast Multimedia Library +// Copyright (C) 2007-2015 Laurent Gomila (laurent@sfml-dev.org) +// +// This software is provided 'as-is', without any express or implied warranty. +// In no event will the authors be held liable for any damages arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it freely, +// subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; +// you must not claim that you wrote the original software. +// If you use this software in a product, an acknowledgment +// in the product documentation would be appreciated but is not required. +// +// 2. Altered source versions must be plainly marked as such, +// and must not be misrepresented as being the original software. +// +// 3. This notice may not be removed or altered from any source distribution. +// +//////////////////////////////////////////////////////////// + +#ifndef SFML_OUTPUTSOUNDFILE_HPP +#define SFML_OUTPUTSOUNDFILE_HPP + +//////////////////////////////////////////////////////////// +// Headers +//////////////////////////////////////////////////////////// +#include +#include +#include + + +namespace sf +{ +class SoundFileWriter; + +//////////////////////////////////////////////////////////// +/// \brief Provide write access to sound files +/// +//////////////////////////////////////////////////////////// +class SFML_AUDIO_API OutputSoundFile : NonCopyable +{ +public: + + //////////////////////////////////////////////////////////// + /// \brief Default constructor + /// + //////////////////////////////////////////////////////////// + OutputSoundFile(); + + //////////////////////////////////////////////////////////// + /// \brief Destructor + /// + /// Closes the file if it was still open. + /// + //////////////////////////////////////////////////////////// + ~OutputSoundFile(); + + //////////////////////////////////////////////////////////// + /// \brief Open the sound file from the disk for writing + /// + /// The supported audio formats are: WAV, OGG/Vorbis, FLAC. + /// + /// \param filename Path of the sound file to write + /// \param sampleRate Sample rate of the sound + /// \param channelCount Number of channels in the sound + /// + /// \return True if the file was successfully opened + /// + //////////////////////////////////////////////////////////// + bool openFromFile(const std::string& filename, unsigned int sampleRate, unsigned int channelCount); + + //////////////////////////////////////////////////////////// + /// \brief Write audio samples to the file + /// + /// \param samples Pointer to the sample array to write + /// \param count Number of samples to write + /// + //////////////////////////////////////////////////////////// + void write(const Int16* samples, Uint64 count); + +private: + + //////////////////////////////////////////////////////////// + /// \brief Close the current file + /// + //////////////////////////////////////////////////////////// + void close(); + + //////////////////////////////////////////////////////////// + // Member data + //////////////////////////////////////////////////////////// + SoundFileWriter* m_writer; ///< Writer that handles I/O on the file's format +}; + +} // namespace sf + + +#endif // SFML_OUTPUTSOUNDFILE_HPP + + +//////////////////////////////////////////////////////////// +/// \class sf::OutputSoundFile +/// \ingroup audio +/// +/// This class encodes audio samples to a sound file. It is +/// used internally by higher-level classes such as sf::SoundBuffer, +/// but can also be useful if you want to create audio files from +/// custom data sources, like generated audio samples. +/// +/// Usage example: +/// \code +/// // Create a sound file, ogg/vorbis format, 44100 Hz, stereo +/// sf::OutputSoundFile file; +/// if (!file.openFromFile("music.ogg", 44100, 2)) +/// /* error */; +/// +/// while (...) +/// { +/// // Read or generate audio samples from your custom source +/// std::vector samples = ...; +/// +/// // Write them to the file +/// file.write(samples.data(), samples.size()); +/// } +/// \endcode +/// +/// \see sf::SoundFileWriter, sf::InputSoundFile +/// +//////////////////////////////////////////////////////////// diff --git a/mcclone/external/sfml23/include/SFML/Audio/Sound.hpp b/mcclone/external/sfml23/include/SFML/Audio/Sound.hpp new file mode 100644 index 0000000..8b0771d --- /dev/null +++ b/mcclone/external/sfml23/include/SFML/Audio/Sound.hpp @@ -0,0 +1,264 @@ +//////////////////////////////////////////////////////////// +// +// SFML - Simple and Fast Multimedia Library +// Copyright (C) 2007-2015 Laurent Gomila (laurent@sfml-dev.org) +// +// This software is provided 'as-is', without any express or implied warranty. +// In no event will the authors be held liable for any damages arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it freely, +// subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; +// you must not claim that you wrote the original software. +// If you use this software in a product, an acknowledgment +// in the product documentation would be appreciated but is not required. +// +// 2. Altered source versions must be plainly marked as such, +// and must not be misrepresented as being the original software. +// +// 3. This notice may not be removed or altered from any source distribution. +// +//////////////////////////////////////////////////////////// + +#ifndef SFML_SOUND_HPP +#define SFML_SOUND_HPP + +//////////////////////////////////////////////////////////// +// Headers +//////////////////////////////////////////////////////////// +#include +#include +#include +#include + + +namespace sf +{ +class SoundBuffer; + +//////////////////////////////////////////////////////////// +/// \brief Regular sound that can be played in the audio environment +/// +//////////////////////////////////////////////////////////// +class SFML_AUDIO_API Sound : public SoundSource +{ +public: + + //////////////////////////////////////////////////////////// + /// \brief Default constructor + /// + //////////////////////////////////////////////////////////// + Sound(); + + //////////////////////////////////////////////////////////// + /// \brief Construct the sound with a buffer + /// + /// \param buffer Sound buffer containing the audio data to play with the sound + /// + //////////////////////////////////////////////////////////// + explicit Sound(const SoundBuffer& buffer); + + //////////////////////////////////////////////////////////// + /// \brief Copy constructor + /// + /// \param copy Instance to copy + /// + //////////////////////////////////////////////////////////// + Sound(const Sound& copy); + + //////////////////////////////////////////////////////////// + /// \brief Destructor + /// + //////////////////////////////////////////////////////////// + ~Sound(); + + //////////////////////////////////////////////////////////// + /// \brief Start or resume playing the sound + /// + /// This function starts the stream if it was stopped, resumes + /// it if it was paused, and restarts it from beginning if it + /// was it already playing. + /// This function uses its own thread so that it doesn't block + /// the rest of the program while the sound is played. + /// + /// \see pause, stop + /// + //////////////////////////////////////////////////////////// + void play(); + + //////////////////////////////////////////////////////////// + /// \brief Pause the sound + /// + /// This function pauses the sound if it was playing, + /// otherwise (sound already paused or stopped) it has no effect. + /// + /// \see play, stop + /// + //////////////////////////////////////////////////////////// + void pause(); + + //////////////////////////////////////////////////////////// + /// \brief stop playing the sound + /// + /// This function stops the sound if it was playing or paused, + /// and does nothing if it was already stopped. + /// It also resets the playing position (unlike pause()). + /// + /// \see play, pause + /// + //////////////////////////////////////////////////////////// + void stop(); + + //////////////////////////////////////////////////////////// + /// \brief Set the source buffer containing the audio data to play + /// + /// It is important to note that the sound buffer is not copied, + /// thus the sf::SoundBuffer instance must remain alive as long + /// as it is attached to the sound. + /// + /// \param buffer Sound buffer to attach to the sound + /// + /// \see getBuffer + /// + //////////////////////////////////////////////////////////// + void setBuffer(const SoundBuffer& buffer); + + //////////////////////////////////////////////////////////// + /// \brief Set whether or not the sound should loop after reaching the end + /// + /// If set, the sound will restart from beginning after + /// reaching the end and so on, until it is stopped or + /// setLoop(false) is called. + /// The default looping state for sound is false. + /// + /// \param loop True to play in loop, false to play once + /// + /// \see getLoop + /// + //////////////////////////////////////////////////////////// + void setLoop(bool loop); + + //////////////////////////////////////////////////////////// + /// \brief Change the current playing position of the sound + /// + /// The playing position can be changed when the sound is + /// either paused or playing. Changing the playing position + /// when the sound is stopped has no effect, since playing + /// the sound will reset its position. + /// + /// \param timeOffset New playing position, from the beginning of the sound + /// + /// \see getPlayingOffset + /// + //////////////////////////////////////////////////////////// + void setPlayingOffset(Time timeOffset); + + //////////////////////////////////////////////////////////// + /// \brief Get the audio buffer attached to the sound + /// + /// \return Sound buffer attached to the sound (can be NULL) + /// + //////////////////////////////////////////////////////////// + const SoundBuffer* getBuffer() const; + + //////////////////////////////////////////////////////////// + /// \brief Tell whether or not the sound is in loop mode + /// + /// \return True if the sound is looping, false otherwise + /// + /// \see setLoop + /// + //////////////////////////////////////////////////////////// + bool getLoop() const; + + //////////////////////////////////////////////////////////// + /// \brief Get the current playing position of the sound + /// + /// \return Current playing position, from the beginning of the sound + /// + /// \see setPlayingOffset + /// + //////////////////////////////////////////////////////////// + Time getPlayingOffset() const; + + //////////////////////////////////////////////////////////// + /// \brief Get the current status of the sound (stopped, paused, playing) + /// + /// \return Current status of the sound + /// + //////////////////////////////////////////////////////////// + Status getStatus() const; + + //////////////////////////////////////////////////////////// + /// \brief Overload of assignment operator + /// + /// \param right Instance to assign + /// + /// \return Reference to self + /// + //////////////////////////////////////////////////////////// + Sound& operator =(const Sound& right); + + //////////////////////////////////////////////////////////// + /// \brief Reset the internal buffer of the sound + /// + /// This function is for internal use only, you don't have + /// to use it. It is called by the sf::SoundBuffer that + /// this sound uses, when it is destroyed in order to prevent + /// the sound from using a dead buffer. + /// + //////////////////////////////////////////////////////////// + void resetBuffer(); + +private: + + //////////////////////////////////////////////////////////// + // Member data + //////////////////////////////////////////////////////////// + const SoundBuffer* m_buffer; ///< Sound buffer bound to the source +}; + +} // namespace sf + + +#endif // SFML_SOUND_HPP + + +//////////////////////////////////////////////////////////// +/// \class sf::Sound +/// \ingroup audio +/// +/// sf::Sound is the class to use to play sounds. +/// It provides: +/// \li Control (play, pause, stop) +/// \li Ability to modify output parameters in real-time (pitch, volume, ...) +/// \li 3D spatial features (position, attenuation, ...). +/// +/// sf::Sound is perfect for playing short sounds that can +/// fit in memory and require no latency, like foot steps or +/// gun shots. For longer sounds, like background musics +/// or long speeches, rather see sf::Music (which is based +/// on streaming). +/// +/// In order to work, a sound must be given a buffer of audio +/// data to play. Audio data (samples) is stored in sf::SoundBuffer, +/// and attached to a sound with the setBuffer() function. +/// The buffer object attached to a sound must remain alive +/// as long as the sound uses it. Note that multiple sounds +/// can use the same sound buffer at the same time. +/// +/// Usage example: +/// \code +/// sf::SoundBuffer buffer; +/// buffer.loadFromFile("sound.wav"); +/// +/// sf::Sound sound; +/// sound.setBuffer(buffer); +/// sound.play(); +/// \endcode +/// +/// \see sf::SoundBuffer, sf::Music +/// +//////////////////////////////////////////////////////////// diff --git a/mcclone/external/sfml23/include/SFML/Audio/SoundBuffer.hpp b/mcclone/external/sfml23/include/SFML/Audio/SoundBuffer.hpp new file mode 100644 index 0000000..42eda6f --- /dev/null +++ b/mcclone/external/sfml23/include/SFML/Audio/SoundBuffer.hpp @@ -0,0 +1,352 @@ +//////////////////////////////////////////////////////////// +// +// SFML - Simple and Fast Multimedia Library +// Copyright (C) 2007-2015 Laurent Gomila (laurent@sfml-dev.org) +// +// This software is provided 'as-is', without any express or implied warranty. +// In no event will the authors be held liable for any damages arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it freely, +// subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; +// you must not claim that you wrote the original software. +// If you use this software in a product, an acknowledgment +// in the product documentation would be appreciated but is not required. +// +// 2. Altered source versions must be plainly marked as such, +// and must not be misrepresented as being the original software. +// +// 3. This notice may not be removed or altered from any source distribution. +// +//////////////////////////////////////////////////////////// + +#ifndef SFML_SOUNDBUFFER_HPP +#define SFML_SOUNDBUFFER_HPP + +//////////////////////////////////////////////////////////// +// Headers +//////////////////////////////////////////////////////////// +#include +#include +#include +#include +#include +#include + + +namespace sf +{ +class Sound; +class InputSoundFile; +class InputStream; + +//////////////////////////////////////////////////////////// +/// \brief Storage for audio samples defining a sound +/// +//////////////////////////////////////////////////////////// +class SFML_AUDIO_API SoundBuffer : AlResource +{ +public: + + //////////////////////////////////////////////////////////// + /// \brief Default constructor + /// + //////////////////////////////////////////////////////////// + SoundBuffer(); + + //////////////////////////////////////////////////////////// + /// \brief Copy constructor + /// + /// \param copy Instance to copy + /// + //////////////////////////////////////////////////////////// + SoundBuffer(const SoundBuffer& copy); + + //////////////////////////////////////////////////////////// + /// \brief Destructor + /// + //////////////////////////////////////////////////////////// + ~SoundBuffer(); + + //////////////////////////////////////////////////////////// + /// \brief Load the sound buffer from a file + /// + /// See the documentation of sf::InputSoundFile for the list + /// of supported formats. + /// + /// \param filename Path of the sound file to load + /// + /// \return True if loading succeeded, false if it failed + /// + /// \see loadFromMemory, loadFromStream, loadFromSamples, saveToFile + /// + //////////////////////////////////////////////////////////// + bool loadFromFile(const std::string& filename); + + //////////////////////////////////////////////////////////// + /// \brief Load the sound buffer from a file in memory + /// + /// See the documentation of sf::InputSoundFile for the list + /// of supported formats. + /// + /// \param data Pointer to the file data in memory + /// \param sizeInBytes Size of the data to load, in bytes + /// + /// \return True if loading succeeded, false if it failed + /// + /// \see loadFromFile, loadFromStream, loadFromSamples + /// + //////////////////////////////////////////////////////////// + bool loadFromMemory(const void* data, std::size_t sizeInBytes); + + //////////////////////////////////////////////////////////// + /// \brief Load the sound buffer from a custom stream + /// + /// See the documentation of sf::InputSoundFile for the list + /// of supported formats. + /// + /// \param stream Source stream to read from + /// + /// \return True if loading succeeded, false if it failed + /// + /// \see loadFromFile, loadFromMemory, loadFromSamples + /// + //////////////////////////////////////////////////////////// + bool loadFromStream(InputStream& stream); + + //////////////////////////////////////////////////////////// + /// \brief Load the sound buffer from an array of audio samples + /// + /// The assumed format of the audio samples is 16 bits signed integer + /// (sf::Int16). + /// + /// \param samples Pointer to the array of samples in memory + /// \param sampleCount Number of samples in the array + /// \param channelCount Number of channels (1 = mono, 2 = stereo, ...) + /// \param sampleRate Sample rate (number of samples to play per second) + /// + /// \return True if loading succeeded, false if it failed + /// + /// \see loadFromFile, loadFromMemory, saveToFile + /// + //////////////////////////////////////////////////////////// + bool loadFromSamples(const Int16* samples, Uint64 sampleCount, unsigned int channelCount, unsigned int sampleRate); + + //////////////////////////////////////////////////////////// + /// \brief Save the sound buffer to an audio file + /// + /// See the documentation of sf::OutputSoundFile for the list + /// of supported formats. + /// + /// \param filename Path of the sound file to write + /// + /// \return True if saving succeeded, false if it failed + /// + /// \see loadFromFile, loadFromMemory, loadFromSamples + /// + //////////////////////////////////////////////////////////// + bool saveToFile(const std::string& filename) const; + + //////////////////////////////////////////////////////////// + /// \brief Get the array of audio samples stored in the buffer + /// + /// The format of the returned samples is 16 bits signed integer + /// (sf::Int16). The total number of samples in this array + /// is given by the getSampleCount() function. + /// + /// \return Read-only pointer to the array of sound samples + /// + /// \see getSampleCount + /// + //////////////////////////////////////////////////////////// + const Int16* getSamples() const; + + //////////////////////////////////////////////////////////// + /// \brief Get the number of samples stored in the buffer + /// + /// The array of samples can be accessed with the getSamples() + /// function. + /// + /// \return Number of samples + /// + /// \see getSamples + /// + //////////////////////////////////////////////////////////// + Uint64 getSampleCount() const; + + //////////////////////////////////////////////////////////// + /// \brief Get the sample rate of the sound + /// + /// The sample rate is the number of samples played per second. + /// The higher, the better the quality (for example, 44100 + /// samples/s is CD quality). + /// + /// \return Sample rate (number of samples per second) + /// + /// \see getChannelCount, getDuration + /// + //////////////////////////////////////////////////////////// + unsigned int getSampleRate() const; + + //////////////////////////////////////////////////////////// + /// \brief Get the number of channels used by the sound + /// + /// If the sound is mono then the number of channels will + /// be 1, 2 for stereo, etc. + /// + /// \return Number of channels + /// + /// \see getSampleRate, getDuration + /// + //////////////////////////////////////////////////////////// + unsigned int getChannelCount() const; + + //////////////////////////////////////////////////////////// + /// \brief Get the total duration of the sound + /// + /// \return Sound duration + /// + /// \see getSampleRate, getChannelCount + /// + //////////////////////////////////////////////////////////// + Time getDuration() const; + + //////////////////////////////////////////////////////////// + /// \brief Overload of assignment operator + /// + /// \param right Instance to assign + /// + /// \return Reference to self + /// + //////////////////////////////////////////////////////////// + SoundBuffer& operator =(const SoundBuffer& right); + +private: + + friend class Sound; + + //////////////////////////////////////////////////////////// + /// \brief Initialize the internal state after loading a new sound + /// + /// \param file Sound file providing access to the new loaded sound + /// + /// \return True on successful initialization, false on failure + /// + //////////////////////////////////////////////////////////// + bool initialize(InputSoundFile& file); + + //////////////////////////////////////////////////////////// + /// \brief Update the internal buffer with the cached audio samples + /// + /// \param channelCount Number of channels + /// \param sampleRate Sample rate (number of samples per second) + /// + /// \return True on success, false if any error happened + /// + //////////////////////////////////////////////////////////// + bool update(unsigned int channelCount, unsigned int sampleRate); + + //////////////////////////////////////////////////////////// + /// \brief Add a sound to the list of sounds that use this buffer + /// + /// \param sound Sound instance to attach + /// + //////////////////////////////////////////////////////////// + void attachSound(Sound* sound) const; + + //////////////////////////////////////////////////////////// + /// \brief Remove a sound from the list of sounds that use this buffer + /// + /// \param sound Sound instance to detach + /// + //////////////////////////////////////////////////////////// + void detachSound(Sound* sound) const; + + //////////////////////////////////////////////////////////// + // Types + //////////////////////////////////////////////////////////// + typedef std::set SoundList; ///< Set of unique sound instances + + //////////////////////////////////////////////////////////// + // Member data + //////////////////////////////////////////////////////////// + unsigned int m_buffer; ///< OpenAL buffer identifier + std::vector m_samples; ///< Samples buffer + Time m_duration; ///< Sound duration + mutable SoundList m_sounds; ///< List of sounds that are using this buffer +}; + +} // namespace sf + + +#endif // SFML_SOUNDBUFFER_HPP + + +//////////////////////////////////////////////////////////// +/// \class sf::SoundBuffer +/// \ingroup audio +/// +/// A sound buffer holds the data of a sound, which is +/// an array of audio samples. A sample is a 16 bits signed integer +/// that defines the amplitude of the sound at a given time. +/// The sound is then reconstituted by playing these samples at +/// a high rate (for example, 44100 samples per second is the +/// standard rate used for playing CDs). In short, audio samples +/// are like texture pixels, and a sf::SoundBuffer is similar to +/// a sf::Texture. +/// +/// A sound buffer can be loaded from a file (see loadFromFile() +/// for the complete list of supported formats), from memory, from +/// a custom stream (see sf::InputStream) or directly from an array +/// of samples. It can also be saved back to a file. +/// +/// Sound buffers alone are not very useful: they hold the audio data +/// but cannot be played. To do so, you need to use the sf::Sound class, +/// which provides functions to play/pause/stop the sound as well as +/// changing the way it is outputted (volume, pitch, 3D position, ...). +/// This separation allows more flexibility and better performances: +/// indeed a sf::SoundBuffer is a heavy resource, and any operation on it +/// is slow (often too slow for real-time applications). On the other +/// side, a sf::Sound is a lightweight object, which can use the audio data +/// of a sound buffer and change the way it is played without actually +/// modifying that data. Note that it is also possible to bind +/// several sf::Sound instances to the same sf::SoundBuffer. +/// +/// It is important to note that the sf::Sound instance doesn't +/// copy the buffer that it uses, it only keeps a reference to it. +/// Thus, a sf::SoundBuffer must not be destructed while it is +/// used by a sf::Sound (i.e. never write a function that +/// uses a local sf::SoundBuffer instance for loading a sound). +/// +/// Usage example: +/// \code +/// // Declare a new sound buffer +/// sf::SoundBuffer buffer; +/// +/// // Load it from a file +/// if (!buffer.loadFromFile("sound.wav")) +/// { +/// // error... +/// } +/// +/// // Create a sound source and bind it to the buffer +/// sf::Sound sound1; +/// sound1.setBuffer(buffer); +/// +/// // Play the sound +/// sound1.play(); +/// +/// // Create another sound source bound to the same buffer +/// sf::Sound sound2; +/// sound2.setBuffer(buffer); +/// +/// // Play it with a higher pitch -- the first sound remains unchanged +/// sound2.setPitch(2); +/// sound2.play(); +/// \endcode +/// +/// \see sf::Sound, sf::SoundBufferRecorder +/// +//////////////////////////////////////////////////////////// diff --git a/mcclone/external/sfml23/include/SFML/Audio/SoundBufferRecorder.hpp b/mcclone/external/sfml23/include/SFML/Audio/SoundBufferRecorder.hpp new file mode 100644 index 0000000..7715ac5 --- /dev/null +++ b/mcclone/external/sfml23/include/SFML/Audio/SoundBufferRecorder.hpp @@ -0,0 +1,138 @@ +//////////////////////////////////////////////////////////// +// +// SFML - Simple and Fast Multimedia Library +// Copyright (C) 2007-2015 Laurent Gomila (laurent@sfml-dev.org) +// +// This software is provided 'as-is', without any express or implied warranty. +// In no event will the authors be held liable for any damages arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it freely, +// subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; +// you must not claim that you wrote the original software. +// If you use this software in a product, an acknowledgment +// in the product documentation would be appreciated but is not required. +// +// 2. Altered source versions must be plainly marked as such, +// and must not be misrepresented as being the original software. +// +// 3. This notice may not be removed or altered from any source distribution. +// +//////////////////////////////////////////////////////////// + +#ifndef SFML_SOUNDBUFFERRECORDER_HPP +#define SFML_SOUNDBUFFERRECORDER_HPP + +//////////////////////////////////////////////////////////// +// Headers +//////////////////////////////////////////////////////////// +#include +#include +#include +#include + + +namespace sf +{ +//////////////////////////////////////////////////////////// +/// \brief Specialized SoundRecorder which stores the captured +/// audio data into a sound buffer +/// +//////////////////////////////////////////////////////////// +class SFML_AUDIO_API SoundBufferRecorder : public SoundRecorder +{ +public: + + //////////////////////////////////////////////////////////// + /// \brief Get the sound buffer containing the captured audio data + /// + /// The sound buffer is valid only after the capture has ended. + /// This function provides a read-only access to the internal + /// sound buffer, but it can be copied if you need to + /// make any modification to it. + /// + /// \return Read-only access to the sound buffer + /// + //////////////////////////////////////////////////////////// + const SoundBuffer& getBuffer() const; + +protected: + + //////////////////////////////////////////////////////////// + /// \brief Start capturing audio data + /// + /// \return True to start the capture, or false to abort it + /// + //////////////////////////////////////////////////////////// + virtual bool onStart(); + + //////////////////////////////////////////////////////////// + /// \brief Process a new chunk of recorded samples + /// + /// \param samples Pointer to the new chunk of recorded samples + /// \param sampleCount Number of samples pointed by \a samples + /// + /// \return True to continue the capture, or false to stop it + /// + //////////////////////////////////////////////////////////// + virtual bool onProcessSamples(const Int16* samples, std::size_t sampleCount); + + //////////////////////////////////////////////////////////// + /// \brief Stop capturing audio data + /// + //////////////////////////////////////////////////////////// + virtual void onStop(); + +private: + + //////////////////////////////////////////////////////////// + // Member data + //////////////////////////////////////////////////////////// + std::vector m_samples; ///< Temporary sample buffer to hold the recorded data + SoundBuffer m_buffer; ///< Sound buffer that will contain the recorded data +}; + +} // namespace sf + +#endif // SFML_SOUNDBUFFERRECORDER_HPP + + +//////////////////////////////////////////////////////////// +/// \class sf::SoundBufferRecorder +/// \ingroup audio +/// +/// sf::SoundBufferRecorder allows to access a recorded sound +/// through a sf::SoundBuffer, so that it can be played, saved +/// to a file, etc. +/// +/// It has the same simple interface as its base class (start(), stop()) +/// and adds a function to retrieve the recorded sound buffer +/// (getBuffer()). +/// +/// As usual, don't forget to call the isAvailable() function +/// before using this class (see sf::SoundRecorder for more details +/// about this). +/// +/// Usage example: +/// \code +/// if (sf::SoundBufferRecorder::isAvailable()) +/// { +/// // Record some audio data +/// sf::SoundBufferRecorder recorder; +/// recorder.start(); +/// ... +/// recorder.stop(); +/// +/// // Get the buffer containing the captured audio data +/// const sf::SoundBuffer& buffer = recorder.getBuffer(); +/// +/// // Save it to a file (for example...) +/// buffer.saveToFile("my_record.ogg"); +/// } +/// \endcode +/// +/// \see sf::SoundRecorder +/// +//////////////////////////////////////////////////////////// diff --git a/mcclone/external/sfml23/include/SFML/Audio/SoundFileFactory.hpp b/mcclone/external/sfml23/include/SFML/Audio/SoundFileFactory.hpp new file mode 100644 index 0000000..bd346cc --- /dev/null +++ b/mcclone/external/sfml23/include/SFML/Audio/SoundFileFactory.hpp @@ -0,0 +1,197 @@ +//////////////////////////////////////////////////////////// +// +// SFML - Simple and Fast Multimedia Library +// Copyright (C) 2007-2015 Laurent Gomila (laurent@sfml-dev.org) +// +// This software is provided 'as-is', without any express or implied warranty. +// In no event will the authors be held liable for any damages arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it freely, +// subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; +// you must not claim that you wrote the original software. +// If you use this software in a product, an acknowledgment +// in the product documentation would be appreciated but is not required. +// +// 2. Altered source versions must be plainly marked as such, +// and must not be misrepresented as being the original software. +// +// 3. This notice may not be removed or altered from any source distribution. +// +//////////////////////////////////////////////////////////// + +#ifndef SFML_SOUNDFILEFACTORY_HPP +#define SFML_SOUNDFILEFACTORY_HPP + +//////////////////////////////////////////////////////////// +// Headers +//////////////////////////////////////////////////////////// +#include +#include +#include + + +namespace sf +{ +class InputStream; +class SoundFileReader; +class SoundFileWriter; + +//////////////////////////////////////////////////////////// +/// \brief Manages and instantiates sound file readers and writers +/// +//////////////////////////////////////////////////////////// +class SFML_AUDIO_API SoundFileFactory +{ +public: + + //////////////////////////////////////////////////////////// + /// \brief Register a new reader + /// + /// \see unregisterReader + /// + //////////////////////////////////////////////////////////// + template + static void registerReader(); + + //////////////////////////////////////////////////////////// + /// \brief Unregister a reader + /// + /// \see registerReader + /// + //////////////////////////////////////////////////////////// + template + static void unregisterReader(); + + //////////////////////////////////////////////////////////// + /// \brief Register a new writer + /// + /// \see unregisterWriter + /// + //////////////////////////////////////////////////////////// + template + static void registerWriter(); + + //////////////////////////////////////////////////////////// + /// \brief Unregister a writer + /// + /// \see registerWriter + /// + //////////////////////////////////////////////////////////// + template + static void unregisterWriter(); + + //////////////////////////////////////////////////////////// + /// \brief Instantiate the right reader for the given file on disk + /// + /// It's up to the caller to release the returned reader + /// + /// \param filename Path of the sound file + /// + /// \return A new sound file reader that can read the given file, or null if no reader can handle it + /// + /// \see createReaderFromMemory, createReaderFromStream + /// + //////////////////////////////////////////////////////////// + static SoundFileReader* createReaderFromFilename(const std::string& filename); + + //////////////////////////////////////////////////////////// + /// \brief Instantiate the right codec for the given file in memory + /// + /// It's up to the caller to release the returned reader + /// + /// \param data Pointer to the file data in memory + /// \param sizeInBytes Total size of the file data, in bytes + /// + /// \return A new sound file codec that can read the given file, or null if no codec can handle it + /// + /// \see createReaderFromFilename, createReaderFromStream + /// + //////////////////////////////////////////////////////////// + static SoundFileReader* createReaderFromMemory(const void* data, std::size_t sizeInBytes); + + //////////////////////////////////////////////////////////// + /// \brief Instantiate the right codec for the given file in stream + /// + /// It's up to the caller to release the returned reader + /// + /// \param stream Source stream to read from + /// + /// \return A new sound file codec that can read the given file, or null if no codec can handle it + /// + /// \see createReaderFromFilename, createReaderFromMemory + /// + //////////////////////////////////////////////////////////// + static SoundFileReader* createReaderFromStream(InputStream& stream); + + //////////////////////////////////////////////////////////// + /// \brief Instantiate the right writer for the given file on disk + /// + /// It's up to the caller to release the returned writer + /// + /// \param filename Path of the sound file + /// + /// \return A new sound file writer that can write given file, or null if no writer can handle it + /// + //////////////////////////////////////////////////////////// + static SoundFileWriter* createWriterFromFilename(const std::string& filename); + +private: + + //////////////////////////////////////////////////////////// + // Types + //////////////////////////////////////////////////////////// + struct ReaderFactory + { + bool (*check)(InputStream&); + SoundFileReader* (*create)(); + }; + typedef std::vector ReaderFactoryArray; + + struct WriterFactory + { + bool (*check)(const std::string&); + SoundFileWriter* (*create)(); + }; + typedef std::vector WriterFactoryArray; + + //////////////////////////////////////////////////////////// + // Static member data + //////////////////////////////////////////////////////////// + static ReaderFactoryArray s_readers; ///< List of all registered readers + static WriterFactoryArray s_writers; ///< List of all registered writers +}; + +} // namespace sf + +#include + +#endif // SFML_SOUNDFILEFACTORY_HPP + + +//////////////////////////////////////////////////////////// +/// \class sf::SoundFileFactory +/// \ingroup audio +/// +/// This class is where all the sound file readers and writers are +/// registered. You should normally only need to use its registration +/// and unregistration functions; readers/writers creation and manipulation +/// are wrapped into the higher-level classes sf::InputSoundFile and +/// sf::OutputSoundFile. +/// +/// To register a new reader (writer) use the sf::SoundFileFactory::registerReader +/// (registerWriter) static function. You don't have to call the unregisterReader +/// (unregisterWriter) function, unless you want to unregister a format before your +/// application ends (typically, when a plugin is unloaded). +/// +/// Usage example: +/// \code +/// sf::SoundFileFactory::registerReader(); +/// sf::SoundFileFactory::registerWriter(); +/// \endcode +/// +/// \see sf::InputSoundFile, sf::OutputSoundFile, sf::SoundFileReader, sf::SoundFileWriter +/// +//////////////////////////////////////////////////////////// diff --git a/mcclone/external/sfml23/include/SFML/Audio/SoundFileFactory.inl b/mcclone/external/sfml23/include/SFML/Audio/SoundFileFactory.inl new file mode 100644 index 0000000..19d334b --- /dev/null +++ b/mcclone/external/sfml23/include/SFML/Audio/SoundFileFactory.inl @@ -0,0 +1,100 @@ +//////////////////////////////////////////////////////////// +// +// SFML - Simple and Fast Multimedia Library +// Copyright (C) 2007-2015 Laurent Gomila (laurent@sfml-dev.org) +// +// This software is provided 'as-is', without any express or implied warranty. +// In no event will the authors be held liable for any damages arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it freely, +// subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; +// you must not claim that you wrote the original software. +// If you use this software in a product, an acknowledgment +// in the product documentation would be appreciated but is not required. +// +// 2. Altered source versions must be plainly marked as such, +// and must not be misrepresented as being the original software. +// +// 3. This notice may not be removed or altered from any source distribution. +// +//////////////////////////////////////////////////////////// + +//////////////////////////////////////////////////////////// +// Headers +//////////////////////////////////////////////////////////// + + +namespace sf +{ +namespace priv +{ + template SoundFileReader* createReader() {return new T;} + template SoundFileWriter* createWriter() {return new T;} +} + +//////////////////////////////////////////////////////////// +template +void SoundFileFactory::registerReader() +{ + // Make sure the same class won't be registered twice + unregisterReader(); + + // Create a new factory with the functions provided by the class + ReaderFactory factory; + factory.check = &T::check; + factory.create = &priv::createReader; + + // Add it + s_readers.push_back(factory); +} + + +//////////////////////////////////////////////////////////// +template +void SoundFileFactory::unregisterReader() +{ + // Remove the instance(s) of the reader from the array of factories + for (ReaderFactoryArray::iterator it = s_readers.begin(); it != s_readers.end(); ) + { + if (it->create == &priv::createReader) + it = s_readers.erase(it); + else + ++it; + } +} + +//////////////////////////////////////////////////////////// +template +void SoundFileFactory::registerWriter() +{ + // Make sure the same class won't be registered twice + unregisterWriter(); + + // Create a new factory with the functions provided by the class + WriterFactory factory; + factory.check = &T::check; + factory.create = &priv::createWriter; + + // Add it + s_writers.push_back(factory); +} + + +//////////////////////////////////////////////////////////// +template +void SoundFileFactory::unregisterWriter() +{ + // Remove the instance(s) of the writer from the array of factories + for (WriterFactoryArray::iterator it = s_writers.begin(); it != s_writers.end(); ) + { + if (it->create == &priv::createWriter) + it = s_writers.erase(it); + else + ++it; + } +} + +} // namespace sf diff --git a/mcclone/external/sfml23/include/SFML/Audio/SoundFileReader.hpp b/mcclone/external/sfml23/include/SFML/Audio/SoundFileReader.hpp new file mode 100644 index 0000000..549f50b --- /dev/null +++ b/mcclone/external/sfml23/include/SFML/Audio/SoundFileReader.hpp @@ -0,0 +1,161 @@ +//////////////////////////////////////////////////////////// +// +// SFML - Simple and Fast Multimedia Library +// Copyright (C) 2007-2015 Laurent Gomila (laurent@sfml-dev.org) +// +// This software is provided 'as-is', without any express or implied warranty. +// In no event will the authors be held liable for any damages arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it freely, +// subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; +// you must not claim that you wrote the original software. +// If you use this software in a product, an acknowledgment +// in the product documentation would be appreciated but is not required. +// +// 2. Altered source versions must be plainly marked as such, +// and must not be misrepresented as being the original software. +// +// 3. This notice may not be removed or altered from any source distribution. +// +//////////////////////////////////////////////////////////// + +#ifndef SFML_SOUNDFILEREADER_HPP +#define SFML_SOUNDFILEREADER_HPP + +//////////////////////////////////////////////////////////// +// Headers +//////////////////////////////////////////////////////////// +#include +#include + + +namespace sf +{ +class InputStream; + +//////////////////////////////////////////////////////////// +/// \brief Abstract base class for sound file decoding +/// +//////////////////////////////////////////////////////////// +class SFML_AUDIO_API SoundFileReader +{ +public: + + //////////////////////////////////////////////////////////// + /// \brief Structure holding the audio properties of a sound file + /// + //////////////////////////////////////////////////////////// + struct Info + { + Uint64 sampleCount; ///< Total number of samples in the file + unsigned int channelCount; ///< Number of channels of the sound + unsigned int sampleRate; ///< Samples rate of the sound, in samples per second + }; + + //////////////////////////////////////////////////////////// + /// \brief Virtual destructor + /// + //////////////////////////////////////////////////////////// + virtual ~SoundFileReader() {} + + //////////////////////////////////////////////////////////// + /// \brief Open a sound file for reading + /// + /// The provided stream reference is valid as long as the + /// SoundFileReader is alive, so it is safe to use/store it + /// during the whole lifetime of the reader. + /// + /// \param stream Source stream to read from + /// \param info Structure to fill with the properties of the loaded sound + /// + /// \return True if the file was successfully opened + /// + //////////////////////////////////////////////////////////// + virtual bool open(InputStream& stream, Info& info) = 0; + + //////////////////////////////////////////////////////////// + /// \brief Change the current read position to the given sample offset + /// + /// If the given offset exceeds to total number of samples, + /// this function must jump to the end of the file. + /// + /// \param sampleOffset Index of the sample to jump to, relative to the beginning + /// + //////////////////////////////////////////////////////////// + virtual void seek(Uint64 sampleOffset) = 0; + + //////////////////////////////////////////////////////////// + /// \brief Read audio samples from the open file + /// + /// \param samples Pointer to the sample array to fill + /// \param maxCount Maximum number of samples to read + /// + /// \return Number of samples actually read (may be less than \a maxCount) + /// + //////////////////////////////////////////////////////////// + virtual Uint64 read(Int16* samples, Uint64 maxCount) = 0; +}; + +} // namespace sf + + +#endif // SFML_SOUNDFILEREADER_HPP + + +//////////////////////////////////////////////////////////// +/// \class sf::SoundFileReader +/// \ingroup audio +/// +/// This class allows users to read audio file formats not natively +/// supported by SFML, and thus extend the set of supported readable +/// audio formats. +/// +/// A valid sound file reader must override the open, seek and write functions, +/// as well as providing a static check function; the latter is used by +/// SFML to find a suitable writer for a given input file. +/// +/// To register a new reader, use the sf::SoundFileFactory::registerReader +/// template function. +/// +/// Usage example: +/// \code +/// class MySoundFileReader : public sf::SoundFileReader +/// { +/// public: +/// +/// static bool check(sf::InputStream& stream) +/// { +/// // typically, read the first few header bytes and check fields that identify the format +/// // return true if the reader can handle the format +/// } +/// +/// virtual bool open(sf::InputStream& stream, Info& info) +/// { +/// // read the sound file header and fill the sound attributes +/// // (channel count, sample count and sample rate) +/// // return true on success +/// } +/// +/// virtual void seek(sf::Uint64 sampleOffset) +/// { +/// // advance to the sampleOffset-th sample from the beginning of the sound +/// } +/// +/// virtual sf::Uint64 read(sf::Int16* samples, sf::Uint64 maxCount) +/// { +/// // read up to 'maxCount' samples into the 'samples' array, +/// // convert them (for example from normalized float) if they are not stored +/// // as 16-bits signed integers in the file +/// // return the actual number of samples read +/// } +/// }; +/// +/// sf::SoundFileFactory::registerReader(); +/// \endcode +/// +/// \see sf::InputSoundFile, sf::SoundFileFactory, sf::SoundFileWriter +/// +//////////////////////////////////////////////////////////// diff --git a/mcclone/external/sfml23/include/SFML/Audio/SoundFileWriter.hpp b/mcclone/external/sfml23/include/SFML/Audio/SoundFileWriter.hpp new file mode 100644 index 0000000..36a2678 --- /dev/null +++ b/mcclone/external/sfml23/include/SFML/Audio/SoundFileWriter.hpp @@ -0,0 +1,125 @@ +//////////////////////////////////////////////////////////// +// +// SFML - Simple and Fast Multimedia Library +// Copyright (C) 2007-2015 Laurent Gomila (laurent@sfml-dev.org) +// +// This software is provided 'as-is', without any express or implied warranty. +// In no event will the authors be held liable for any damages arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it freely, +// subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; +// you must not claim that you wrote the original software. +// If you use this software in a product, an acknowledgment +// in the product documentation would be appreciated but is not required. +// +// 2. Altered source versions must be plainly marked as such, +// and must not be misrepresented as being the original software. +// +// 3. This notice may not be removed or altered from any source distribution. +// +//////////////////////////////////////////////////////////// + +#ifndef SFML_SOUNDFILEWRITER_HPP +#define SFML_SOUNDFILEWRITER_HPP + +//////////////////////////////////////////////////////////// +// Headers +//////////////////////////////////////////////////////////// +#include +#include + + +namespace sf +{ +//////////////////////////////////////////////////////////// +/// \brief Abstract base class for sound file encoding +/// +//////////////////////////////////////////////////////////// +class SFML_AUDIO_API SoundFileWriter +{ +public: + + //////////////////////////////////////////////////////////// + /// \brief Virtual destructor + /// + //////////////////////////////////////////////////////////// + virtual ~SoundFileWriter() {} + + //////////////////////////////////////////////////////////// + /// \brief Open a sound file for writing + /// + /// \param filename Path of the file to open + /// \param sampleRate Sample rate of the sound + /// \param channelCount Number of channels of the sound + /// + /// \return True if the file was successfully opened + /// + //////////////////////////////////////////////////////////// + virtual bool open(const std::string& filename, unsigned int sampleRate, unsigned int channelCount) = 0; + + //////////////////////////////////////////////////////////// + /// \brief Write audio samples to the open file + /// + /// \param samples Pointer to the sample array to write + /// \param count Number of samples to write + /// + //////////////////////////////////////////////////////////// + virtual void write(const Int16* samples, Uint64 count) = 0; +}; + +} // namespace sf + + +#endif // SFML_SOUNDFILEWRITER_HPP + + +//////////////////////////////////////////////////////////// +/// \class sf::SoundFileWriter +/// \ingroup audio +/// +/// This class allows users to write audio file formats not natively +/// supported by SFML, and thus extend the set of supported writable +/// audio formats. +/// +/// A valid sound file writer must override the open and write functions, +/// as well as providing a static check function; the latter is used by +/// SFML to find a suitable writer for a given filename. +/// +/// To register a new writer, use the sf::SoundFileFactory::registerWriter +/// template function. +/// +/// Usage example: +/// \code +/// class MySoundFileWriter : public sf::SoundFileWriter +/// { +/// public: +/// +/// static bool check(const std::string& filename) +/// { +/// // typically, check the extension +/// // return true if the writer can handle the format +/// } +/// +/// virtual bool open(const std::string& filename, unsigned int sampleRate, unsigned int channelCount) +/// { +/// // open the file 'filename' for writing, +/// // write the given sample rate and channel count to the file header +/// // return true on success +/// } +/// +/// virtual void write(const sf::Int16* samples, sf::Uint64 count) +/// { +/// // write 'count' samples stored at address 'samples', +/// // convert them (for example to normalized float) if the format requires it +/// } +/// }; +/// +/// sf::SoundFileFactory::registerWriter(); +/// \endcode +/// +/// \see sf::OutputSoundFile, sf::SoundFileFactory, sf::SoundFileReader +/// +//////////////////////////////////////////////////////////// diff --git a/mcclone/external/sfml23/include/SFML/Audio/SoundRecorder.hpp b/mcclone/external/sfml23/include/SFML/Audio/SoundRecorder.hpp new file mode 100644 index 0000000..964e4f3 --- /dev/null +++ b/mcclone/external/sfml23/include/SFML/Audio/SoundRecorder.hpp @@ -0,0 +1,364 @@ +//////////////////////////////////////////////////////////// +// +// SFML - Simple and Fast Multimedia Library +// Copyright (C) 2007-2015 Laurent Gomila (laurent@sfml-dev.org) +// +// This software is provided 'as-is', without any express or implied warranty. +// In no event will the authors be held liable for any damages arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it freely, +// subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; +// you must not claim that you wrote the original software. +// If you use this software in a product, an acknowledgment +// in the product documentation would be appreciated but is not required. +// +// 2. Altered source versions must be plainly marked as such, +// and must not be misrepresented as being the original software. +// +// 3. This notice may not be removed or altered from any source distribution. +// +//////////////////////////////////////////////////////////// + +#ifndef SFML_SOUNDRECORDER_HPP +#define SFML_SOUNDRECORDER_HPP + +//////////////////////////////////////////////////////////// +// Headers +//////////////////////////////////////////////////////////// +#include +#include +#include +#include +#include +#include + + +namespace sf +{ +//////////////////////////////////////////////////////////// +/// \brief Abstract base class for capturing sound data +/// +//////////////////////////////////////////////////////////// +class SFML_AUDIO_API SoundRecorder : AlResource +{ +public: + + //////////////////////////////////////////////////////////// + /// \brief destructor + /// + //////////////////////////////////////////////////////////// + virtual ~SoundRecorder(); + + //////////////////////////////////////////////////////////// + /// \brief Start the capture + /// + /// The \a sampleRate parameter defines the number of audio samples + /// captured per second. The higher, the better the quality + /// (for example, 44100 samples/sec is CD quality). + /// This function uses its own thread so that it doesn't block + /// the rest of the program while the capture runs. + /// Please note that only one capture can happen at the same time. + /// You can select which capture device will be used, by passing + /// the name to the setDevice() method. If none was selected + /// before, the default capture device will be used. You can get a + /// list of the names of all available capture devices by calling + /// getAvailableDevices(). + /// + /// \param sampleRate Desired capture rate, in number of samples per second + /// + /// \return True, if start of capture was successful + /// + /// \see stop, getAvailableDevices + /// + //////////////////////////////////////////////////////////// + bool start(unsigned int sampleRate = 44100); + + //////////////////////////////////////////////////////////// + /// \brief Stop the capture + /// + /// \see start + /// + //////////////////////////////////////////////////////////// + void stop(); + + //////////////////////////////////////////////////////////// + /// \brief Get the sample rate + /// + /// The sample rate defines the number of audio samples + /// captured per second. The higher, the better the quality + /// (for example, 44100 samples/sec is CD quality). + /// + /// \return Sample rate, in samples per second + /// + //////////////////////////////////////////////////////////// + unsigned int getSampleRate() const; + + //////////////////////////////////////////////////////////// + /// \brief Get a list of the names of all available audio capture devices + /// + /// This function returns a vector of strings, containing + /// the names of all available audio capture devices. + /// + /// \return A vector of strings containing the names + /// + //////////////////////////////////////////////////////////// + static std::vector getAvailableDevices(); + + //////////////////////////////////////////////////////////// + /// \brief Get the name of the default audio capture device + /// + /// This function returns the name of the default audio + /// capture device. If none is available, an empty string + /// is returned. + /// + /// \return The name of the default audio capture device + /// + //////////////////////////////////////////////////////////// + static std::string getDefaultDevice(); + + //////////////////////////////////////////////////////////// + /// \brief Set the audio capture device + /// + /// This function sets the audio capture device to the device + /// with the given \a name. It can be called on the fly (i.e: + /// while recording). If you do so while recording and + /// opening the device fails, it stops the recording. + /// + /// \param name The name of the audio capture device + /// + /// \return True, if it was able to set the requested device + /// + /// \see getAvailableDevices, getDefaultDevice + /// + //////////////////////////////////////////////////////////// + bool setDevice(const std::string& name); + + //////////////////////////////////////////////////////////// + /// \brief Get the name of the current audio capture device + /// + /// \return The name of the current audio capture device + /// + //////////////////////////////////////////////////////////// + const std::string& getDevice() const; + + //////////////////////////////////////////////////////////// + /// \brief Check if the system supports audio capture + /// + /// This function should always be called before using + /// the audio capture features. If it returns false, then + /// any attempt to use sf::SoundRecorder or one of its derived + /// classes will fail. + /// + /// \return True if audio capture is supported, false otherwise + /// + //////////////////////////////////////////////////////////// + static bool isAvailable(); + +protected: + + //////////////////////////////////////////////////////////// + /// \brief Default constructor + /// + /// This constructor is only meant to be called by derived classes. + /// + //////////////////////////////////////////////////////////// + SoundRecorder(); + + //////////////////////////////////////////////////////////// + /// \brief Set the processing interval + /// + /// The processing interval controls the period + /// between calls to the onProcessSamples function. You may + /// want to use a small interval if you want to process the + /// recorded data in real time, for example. + /// + /// Note: this is only a hint, the actual period may vary. + /// So don't rely on this parameter to implement precise timing. + /// + /// The default processing interval is 100 ms. + /// + /// \param interval Processing interval + /// + //////////////////////////////////////////////////////////// + void setProcessingInterval(Time interval); + + //////////////////////////////////////////////////////////// + /// \brief Start capturing audio data + /// + /// This virtual function may be overridden by a derived class + /// if something has to be done every time a new capture + /// starts. If not, this function can be ignored; the default + /// implementation does nothing. + /// + /// \return True to start the capture, or false to abort it + /// + //////////////////////////////////////////////////////////// + virtual bool onStart(); + + //////////////////////////////////////////////////////////// + /// \brief Process a new chunk of recorded samples + /// + /// This virtual function is called every time a new chunk of + /// recorded data is available. The derived class can then do + /// whatever it wants with it (storing it, playing it, sending + /// it over the network, etc.). + /// + /// \param samples Pointer to the new chunk of recorded samples + /// \param sampleCount Number of samples pointed by \a samples + /// + /// \return True to continue the capture, or false to stop it + /// + //////////////////////////////////////////////////////////// + virtual bool onProcessSamples(const Int16* samples, std::size_t sampleCount) = 0; + + //////////////////////////////////////////////////////////// + /// \brief Stop capturing audio data + /// + /// This virtual function may be overridden by a derived class + /// if something has to be done every time the capture + /// ends. If not, this function can be ignored; the default + /// implementation does nothing. + /// + //////////////////////////////////////////////////////////// + virtual void onStop(); + +private: + + //////////////////////////////////////////////////////////// + /// \brief Function called as the entry point of the thread + /// + /// This function starts the recording loop, and returns + /// only when the capture is stopped. + /// + //////////////////////////////////////////////////////////// + void record(); + + //////////////////////////////////////////////////////////// + /// \brief Get the new available audio samples and process them + /// + /// This function is called continuously during the + /// capture loop. It retrieves the captured samples and + /// forwards them to the derived class. + /// + //////////////////////////////////////////////////////////// + void processCapturedSamples(); + + //////////////////////////////////////////////////////////// + /// \brief Clean up the recorder's internal resources + /// + /// This function is called when the capture stops. + /// + //////////////////////////////////////////////////////////// + void cleanup(); + + //////////////////////////////////////////////////////////// + // Member data + //////////////////////////////////////////////////////////// + Thread m_thread; ///< Thread running the background recording task + std::vector m_samples; ///< Buffer to store captured samples + unsigned int m_sampleRate; ///< Sample rate + Time m_processingInterval; ///< Time period between calls to onProcessSamples + bool m_isCapturing; ///< Capturing state + std::string m_deviceName; ///< Name of the audio capture device +}; + +} // namespace sf + + +#endif // SFML_SOUNDRECORDER_HPP + + +//////////////////////////////////////////////////////////// +/// \class sf::SoundRecorder +/// \ingroup audio +/// +/// sf::SoundBuffer provides a simple interface to access +/// the audio recording capabilities of the computer +/// (the microphone). As an abstract base class, it only cares +/// about capturing sound samples, the task of making something +/// useful with them is left to the derived class. Note that +/// SFML provides a built-in specialization for saving the +/// captured data to a sound buffer (see sf::SoundBufferRecorder). +/// +/// A derived class has only one virtual function to override: +/// \li onProcessSamples provides the new chunks of audio samples while the capture happens +/// +/// Moreover, two additional virtual functions can be overridden +/// as well if necessary: +/// \li onStart is called before the capture happens, to perform custom initializations +/// \li onStop is called after the capture ends, to perform custom cleanup +/// +/// A derived class can also control the frequency of the onProcessSamples +/// calls, with the setProcessingInterval protected function. The default +/// interval is chosen so that recording thread doesn't consume too much +/// CPU, but it can be changed to a smaller value if you need to process +/// the recorded data in real time, for example. +/// +/// The audio capture feature may not be supported or activated +/// on every platform, thus it is recommended to check its +/// availability with the isAvailable() function. If it returns +/// false, then any attempt to use an audio recorder will fail. +/// +/// If you have multiple sound input devices connected to your +/// computer (for example: microphone, external soundcard, webcam mic, ...) +/// you can get a list of all available devices through the +/// getAvailableDevices() function. You can then select a device +/// by calling setDevice() with the appropriate device. Otherwise +/// the default capturing device will be used. +/// +/// It is important to note that the audio capture happens in a +/// separate thread, so that it doesn't block the rest of the +/// program. In particular, the onProcessSamples virtual function +/// (but not onStart and not onStop) will be called +/// from this separate thread. It is important to keep this in +/// mind, because you may have to take care of synchronization +/// issues if you share data between threads. +/// +/// Usage example: +/// \code +/// class CustomRecorder : public sf::SoundRecorder +/// { +/// virtual bool onStart() // optional +/// { +/// // Initialize whatever has to be done before the capture starts +/// ... +/// +/// // Return true to start playing +/// return true; +/// } +/// +/// virtual bool onProcessSamples(const Int16* samples, std::size_t sampleCount) +/// { +/// // Do something with the new chunk of samples (store them, send them, ...) +/// ... +/// +/// // Return true to continue playing +/// return true; +/// } +/// +/// virtual void onStop() // optional +/// { +/// // Clean up whatever has to be done after the capture ends +/// ... +/// } +/// } +/// +/// // Usage +/// if (CustomRecorder::isAvailable()) +/// { +/// CustomRecorder recorder; +/// +/// if (!recorder.start()) +/// return -1; +/// +/// ... +/// recorder.stop(); +/// } +/// \endcode +/// +/// \see sf::SoundBufferRecorder +/// +//////////////////////////////////////////////////////////// diff --git a/mcclone/external/sfml23/include/SFML/Audio/SoundSource.hpp b/mcclone/external/sfml23/include/SFML/Audio/SoundSource.hpp new file mode 100644 index 0000000..cde0a3b --- /dev/null +++ b/mcclone/external/sfml23/include/SFML/Audio/SoundSource.hpp @@ -0,0 +1,287 @@ +//////////////////////////////////////////////////////////// +// +// SFML - Simple and Fast Multimedia Library +// Copyright (C) 2007-2015 Laurent Gomila (laurent@sfml-dev.org) +// +// This software is provided 'as-is', without any express or implied warranty. +// In no event will the authors be held liable for any damages arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it freely, +// subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; +// you must not claim that you wrote the original software. +// If you use this software in a product, an acknowledgment +// in the product documentation would be appreciated but is not required. +// +// 2. Altered source versions must be plainly marked as such, +// and must not be misrepresented as being the original software. +// +// 3. This notice may not be removed or altered from any source distribution. +// +//////////////////////////////////////////////////////////// + +#ifndef SFML_SOUNDSOURCE_HPP +#define SFML_SOUNDSOURCE_HPP + +//////////////////////////////////////////////////////////// +// Headers +//////////////////////////////////////////////////////////// +#include +#include +#include + + +namespace sf +{ +//////////////////////////////////////////////////////////// +/// \brief Base class defining a sound's properties +/// +//////////////////////////////////////////////////////////// +class SFML_AUDIO_API SoundSource : AlResource +{ +public: + + //////////////////////////////////////////////////////////// + /// \brief Enumeration of the sound source states + /// + //////////////////////////////////////////////////////////// + enum Status + { + Stopped, ///< Sound is not playing + Paused, ///< Sound is paused + Playing ///< Sound is playing + }; + + //////////////////////////////////////////////////////////// + /// \brief Copy constructor + /// + /// \param copy Instance to copy + /// + //////////////////////////////////////////////////////////// + SoundSource(const SoundSource& copy); + + //////////////////////////////////////////////////////////// + /// \brief Destructor + /// + //////////////////////////////////////////////////////////// + virtual ~SoundSource(); + + //////////////////////////////////////////////////////////// + /// \brief Set the pitch of the sound + /// + /// The pitch represents the perceived fundamental frequency + /// of a sound; thus you can make a sound more acute or grave + /// by changing its pitch. A side effect of changing the pitch + /// is to modify the playing speed of the sound as well. + /// The default value for the pitch is 1. + /// + /// \param pitch New pitch to apply to the sound + /// + /// \see getPitch + /// + //////////////////////////////////////////////////////////// + void setPitch(float pitch); + + //////////////////////////////////////////////////////////// + /// \brief Set the volume of the sound + /// + /// The volume is a value between 0 (mute) and 100 (full volume). + /// The default value for the volume is 100. + /// + /// \param volume Volume of the sound + /// + /// \see getVolume + /// + //////////////////////////////////////////////////////////// + void setVolume(float volume); + + //////////////////////////////////////////////////////////// + /// \brief Set the 3D position of the sound in the audio scene + /// + /// Only sounds with one channel (mono sounds) can be + /// spatialized. + /// The default position of a sound is (0, 0, 0). + /// + /// \param x X coordinate of the position of the sound in the scene + /// \param y Y coordinate of the position of the sound in the scene + /// \param z Z coordinate of the position of the sound in the scene + /// + /// \see getPosition + /// + //////////////////////////////////////////////////////////// + void setPosition(float x, float y, float z); + + //////////////////////////////////////////////////////////// + /// \brief Set the 3D position of the sound in the audio scene + /// + /// Only sounds with one channel (mono sounds) can be + /// spatialized. + /// The default position of a sound is (0, 0, 0). + /// + /// \param position Position of the sound in the scene + /// + /// \see getPosition + /// + //////////////////////////////////////////////////////////// + void setPosition(const Vector3f& position); + + //////////////////////////////////////////////////////////// + /// \brief Make the sound's position relative to the listener or absolute + /// + /// Making a sound relative to the listener will ensure that it will always + /// be played the same way regardless of the position of the listener. + /// This can be useful for non-spatialized sounds, sounds that are + /// produced by the listener, or sounds attached to it. + /// The default value is false (position is absolute). + /// + /// \param relative True to set the position relative, false to set it absolute + /// + /// \see isRelativeToListener + /// + //////////////////////////////////////////////////////////// + void setRelativeToListener(bool relative); + + //////////////////////////////////////////////////////////// + /// \brief Set the minimum distance of the sound + /// + /// The "minimum distance" of a sound is the maximum + /// distance at which it is heard at its maximum volume. Further + /// than the minimum distance, it will start to fade out according + /// to its attenuation factor. A value of 0 ("inside the head + /// of the listener") is an invalid value and is forbidden. + /// The default value of the minimum distance is 1. + /// + /// \param distance New minimum distance of the sound + /// + /// \see getMinDistance, setAttenuation + /// + //////////////////////////////////////////////////////////// + void setMinDistance(float distance); + + //////////////////////////////////////////////////////////// + /// \brief Set the attenuation factor of the sound + /// + /// The attenuation is a multiplicative factor which makes + /// the sound more or less loud according to its distance + /// from the listener. An attenuation of 0 will produce a + /// non-attenuated sound, i.e. its volume will always be the same + /// whether it is heard from near or from far. On the other hand, + /// an attenuation value such as 100 will make the sound fade out + /// very quickly as it gets further from the listener. + /// The default value of the attenuation is 1. + /// + /// \param attenuation New attenuation factor of the sound + /// + /// \see getAttenuation, setMinDistance + /// + //////////////////////////////////////////////////////////// + void setAttenuation(float attenuation); + + //////////////////////////////////////////////////////////// + /// \brief Get the pitch of the sound + /// + /// \return Pitch of the sound + /// + /// \see setPitch + /// + //////////////////////////////////////////////////////////// + float getPitch() const; + + //////////////////////////////////////////////////////////// + /// \brief Get the volume of the sound + /// + /// \return Volume of the sound, in the range [0, 100] + /// + /// \see setVolume + /// + //////////////////////////////////////////////////////////// + float getVolume() const; + + //////////////////////////////////////////////////////////// + /// \brief Get the 3D position of the sound in the audio scene + /// + /// \return Position of the sound + /// + /// \see setPosition + /// + //////////////////////////////////////////////////////////// + Vector3f getPosition() const; + + //////////////////////////////////////////////////////////// + /// \brief Tell whether the sound's position is relative to the + /// listener or is absolute + /// + /// \return True if the position is relative, false if it's absolute + /// + /// \see setRelativeToListener + /// + //////////////////////////////////////////////////////////// + bool isRelativeToListener() const; + + //////////////////////////////////////////////////////////// + /// \brief Get the minimum distance of the sound + /// + /// \return Minimum distance of the sound + /// + /// \see setMinDistance, getAttenuation + /// + //////////////////////////////////////////////////////////// + float getMinDistance() const; + + //////////////////////////////////////////////////////////// + /// \brief Get the attenuation factor of the sound + /// + /// \return Attenuation factor of the sound + /// + /// \see setAttenuation, getMinDistance + /// + //////////////////////////////////////////////////////////// + float getAttenuation() const; + +protected: + + //////////////////////////////////////////////////////////// + /// \brief Default constructor + /// + /// This constructor is meant to be called by derived classes only. + /// + //////////////////////////////////////////////////////////// + SoundSource(); + + //////////////////////////////////////////////////////////// + /// \brief Get the current status of the sound (stopped, paused, playing) + /// + /// \return Current status of the sound + /// + //////////////////////////////////////////////////////////// + Status getStatus() const; + + //////////////////////////////////////////////////////////// + // Member data + //////////////////////////////////////////////////////////// + unsigned int m_source; ///< OpenAL source identifier +}; + +} // namespace sf + + +#endif // SFML_SOUNDSOURCE_HPP + + +//////////////////////////////////////////////////////////// +/// \class sf::SoundSource +/// \ingroup audio +/// +/// sf::SoundSource is not meant to be used directly, it +/// only serves as a common base for all audio objects +/// that can live in the audio environment. +/// +/// It defines several properties for the sound: pitch, +/// volume, position, attenuation, etc. All of them can be +/// changed at any time with no impact on performances. +/// +/// \see sf::Sound, sf::SoundStream +/// +//////////////////////////////////////////////////////////// diff --git a/mcclone/external/sfml23/include/SFML/Audio/SoundStream.hpp b/mcclone/external/sfml23/include/SFML/Audio/SoundStream.hpp new file mode 100644 index 0000000..22ae8cd --- /dev/null +++ b/mcclone/external/sfml23/include/SFML/Audio/SoundStream.hpp @@ -0,0 +1,386 @@ +//////////////////////////////////////////////////////////// +// +// SFML - Simple and Fast Multimedia Library +// Copyright (C) 2007-2015 Laurent Gomila (laurent@sfml-dev.org) +// +// This software is provided 'as-is', without any express or implied warranty. +// In no event will the authors be held liable for any damages arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it freely, +// subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; +// you must not claim that you wrote the original software. +// If you use this software in a product, an acknowledgment +// in the product documentation would be appreciated but is not required. +// +// 2. Altered source versions must be plainly marked as such, +// and must not be misrepresented as being the original software. +// +// 3. This notice may not be removed or altered from any source distribution. +// +//////////////////////////////////////////////////////////// + +#ifndef SFML_SOUNDSTREAM_HPP +#define SFML_SOUNDSTREAM_HPP + +//////////////////////////////////////////////////////////// +// Headers +//////////////////////////////////////////////////////////// +#include +#include +#include +#include +#include +#include + + +namespace sf +{ +//////////////////////////////////////////////////////////// +/// \brief Abstract base class for streamed audio sources +/// +//////////////////////////////////////////////////////////// +class SFML_AUDIO_API SoundStream : public SoundSource +{ +public: + + //////////////////////////////////////////////////////////// + /// \brief Structure defining a chunk of audio data to stream + /// + //////////////////////////////////////////////////////////// + struct Chunk + { + const Int16* samples; ///< Pointer to the audio samples + std::size_t sampleCount; ///< Number of samples pointed by Samples + }; + + //////////////////////////////////////////////////////////// + /// \brief Destructor + /// + //////////////////////////////////////////////////////////// + virtual ~SoundStream(); + + //////////////////////////////////////////////////////////// + /// \brief Start or resume playing the audio stream + /// + /// This function starts the stream if it was stopped, resumes + /// it if it was paused, and restarts it from the beginning if + /// it was already playing. + /// This function uses its own thread so that it doesn't block + /// the rest of the program while the stream is played. + /// + /// \see pause, stop + /// + //////////////////////////////////////////////////////////// + void play(); + + //////////////////////////////////////////////////////////// + /// \brief Pause the audio stream + /// + /// This function pauses the stream if it was playing, + /// otherwise (stream already paused or stopped) it has no effect. + /// + /// \see play, stop + /// + //////////////////////////////////////////////////////////// + void pause(); + + //////////////////////////////////////////////////////////// + /// \brief Stop playing the audio stream + /// + /// This function stops the stream if it was playing or paused, + /// and does nothing if it was already stopped. + /// It also resets the playing position (unlike pause()). + /// + /// \see play, pause + /// + //////////////////////////////////////////////////////////// + void stop(); + + //////////////////////////////////////////////////////////// + /// \brief Return the number of channels of the stream + /// + /// 1 channel means a mono sound, 2 means stereo, etc. + /// + /// \return Number of channels + /// + //////////////////////////////////////////////////////////// + unsigned int getChannelCount() const; + + //////////////////////////////////////////////////////////// + /// \brief Get the stream sample rate of the stream + /// + /// The sample rate is the number of audio samples played per + /// second. The higher, the better the quality. + /// + /// \return Sample rate, in number of samples per second + /// + //////////////////////////////////////////////////////////// + unsigned int getSampleRate() const; + + //////////////////////////////////////////////////////////// + /// \brief Get the current status of the stream (stopped, paused, playing) + /// + /// \return Current status + /// + //////////////////////////////////////////////////////////// + Status getStatus() const; + + //////////////////////////////////////////////////////////// + /// \brief Change the current playing position of the stream + /// + /// The playing position can be changed when the stream is + /// either paused or playing. Changing the playing position + /// when the stream is stopped has no effect, since playing + /// the stream would reset its position. + /// + /// \param timeOffset New playing position, from the beginning of the stream + /// + /// \see getPlayingOffset + /// + //////////////////////////////////////////////////////////// + void setPlayingOffset(Time timeOffset); + + //////////////////////////////////////////////////////////// + /// \brief Get the current playing position of the stream + /// + /// \return Current playing position, from the beginning of the stream + /// + /// \see setPlayingOffset + /// + //////////////////////////////////////////////////////////// + Time getPlayingOffset() const; + + //////////////////////////////////////////////////////////// + /// \brief Set whether or not the stream should loop after reaching the end + /// + /// If set, the stream will restart from beginning after + /// reaching the end and so on, until it is stopped or + /// setLoop(false) is called. + /// The default looping state for streams is false. + /// + /// \param loop True to play in loop, false to play once + /// + /// \see getLoop + /// + //////////////////////////////////////////////////////////// + void setLoop(bool loop); + + //////////////////////////////////////////////////////////// + /// \brief Tell whether or not the stream is in loop mode + /// + /// \return True if the stream is looping, false otherwise + /// + /// \see setLoop + /// + //////////////////////////////////////////////////////////// + bool getLoop() const; + +protected: + + //////////////////////////////////////////////////////////// + /// \brief Default constructor + /// + /// This constructor is only meant to be called by derived classes. + /// + //////////////////////////////////////////////////////////// + SoundStream(); + + //////////////////////////////////////////////////////////// + /// \brief Define the audio stream parameters + /// + /// This function must be called by derived classes as soon + /// as they know the audio settings of the stream to play. + /// Any attempt to manipulate the stream (play(), ...) before + /// calling this function will fail. + /// It can be called multiple times if the settings of the + /// audio stream change, but only when the stream is stopped. + /// + /// \param channelCount Number of channels of the stream + /// \param sampleRate Sample rate, in samples per second + /// + //////////////////////////////////////////////////////////// + void initialize(unsigned int channelCount, unsigned int sampleRate); + + //////////////////////////////////////////////////////////// + /// \brief Request a new chunk of audio samples from the stream source + /// + /// This function must be overridden by derived classes to provide + /// the audio samples to play. It is called continuously by the + /// streaming loop, in a separate thread. + /// The source can choose to stop the streaming loop at any time, by + /// returning false to the caller. + /// If you return true (i.e. continue streaming) it is important that + /// the returned array of samples is not empty; this would stop the stream + /// due to an internal limitation. + /// + /// \param data Chunk of data to fill + /// + /// \return True to continue playback, false to stop + /// + //////////////////////////////////////////////////////////// + virtual bool onGetData(Chunk& data) = 0; + + //////////////////////////////////////////////////////////// + /// \brief Change the current playing position in the stream source + /// + /// This function must be overridden by derived classes to + /// allow random seeking into the stream source. + /// + /// \param timeOffset New playing position, relative to the beginning of the stream + /// + //////////////////////////////////////////////////////////// + virtual void onSeek(Time timeOffset) = 0; + +private: + + //////////////////////////////////////////////////////////// + /// \brief Function called as the entry point of the thread + /// + /// This function starts the streaming loop, and returns + /// only when the sound is stopped. + /// + //////////////////////////////////////////////////////////// + void streamData(); + + //////////////////////////////////////////////////////////// + /// \brief Fill a new buffer with audio samples, and append + /// it to the playing queue + /// + /// This function is called as soon as a buffer has been fully + /// consumed; it fills it again and inserts it back into the + /// playing queue. + /// + /// \param bufferNum Number of the buffer to fill (in [0, BufferCount]) + /// + /// \return True if the stream source has requested to stop, false otherwise + /// + //////////////////////////////////////////////////////////// + bool fillAndPushBuffer(unsigned int bufferNum); + + //////////////////////////////////////////////////////////// + /// \brief Fill the audio buffers and put them all into the playing queue + /// + /// This function is called when playing starts and the + /// playing queue is empty. + /// + /// \return True if the derived class has requested to stop, false otherwise + /// + //////////////////////////////////////////////////////////// + bool fillQueue(); + + //////////////////////////////////////////////////////////// + /// \brief Clear all the audio buffers and empty the playing queue + /// + /// This function is called when the stream is stopped. + /// + //////////////////////////////////////////////////////////// + void clearQueue(); + + enum + { + BufferCount = 3 ///< Number of audio buffers used by the streaming loop + }; + + //////////////////////////////////////////////////////////// + // Member data + //////////////////////////////////////////////////////////// + Thread m_thread; ///< Thread running the background tasks + mutable Mutex m_threadMutex; ///< Thread mutex + Status m_threadStartState; ///< State the thread starts in (Playing, Paused, Stopped) + bool m_isStreaming; ///< Streaming state (true = playing, false = stopped) + unsigned int m_buffers[BufferCount]; ///< Sound buffers used to store temporary audio data + unsigned int m_channelCount; ///< Number of channels (1 = mono, 2 = stereo, ...) + unsigned int m_sampleRate; ///< Frequency (samples / second) + Uint32 m_format; ///< Format of the internal sound buffers + bool m_loop; ///< Loop flag (true to loop, false to play once) + Uint64 m_samplesProcessed; ///< Number of buffers processed since beginning of the stream + bool m_endBuffers[BufferCount]; ///< Each buffer is marked as "end buffer" or not, for proper duration calculation +}; + +} // namespace sf + + +#endif // SFML_SOUNDSTREAM_HPP + + +//////////////////////////////////////////////////////////// +/// \class sf::SoundStream +/// \ingroup audio +/// +/// Unlike audio buffers (see sf::SoundBuffer), audio streams +/// are never completely loaded in memory. Instead, the audio +/// data is acquired continuously while the stream is playing. +/// This behavior allows to play a sound with no loading delay, +/// and keeps the memory consumption very low. +/// +/// Sound sources that need to be streamed are usually big files +/// (compressed audio musics that would eat hundreds of MB in memory) +/// or files that would take a lot of time to be received +/// (sounds played over the network). +/// +/// sf::SoundStream is a base class that doesn't care about the +/// stream source, which is left to the derived class. SFML provides +/// a built-in specialization for big files (see sf::Music). +/// No network stream source is provided, but you can write your own +/// by combining this class with the network module. +/// +/// A derived class has to override two virtual functions: +/// \li onGetData fills a new chunk of audio data to be played +/// \li onSeek changes the current playing position in the source +/// +/// It is important to note that each SoundStream is played in its +/// own separate thread, so that the streaming loop doesn't block the +/// rest of the program. In particular, the OnGetData and OnSeek +/// virtual functions may sometimes be called from this separate thread. +/// It is important to keep this in mind, because you may have to take +/// care of synchronization issues if you share data between threads. +/// +/// Usage example: +/// \code +/// class CustomStream : public sf::SoundStream +/// { +/// public: +/// +/// bool open(const std::string& location) +/// { +/// // Open the source and get audio settings +/// ... +/// unsigned int channelCount = ...; +/// unsigned int sampleRate = ...; +/// +/// // Initialize the stream -- important! +/// initialize(channelCount, sampleRate); +/// } +/// +/// private: +/// +/// virtual bool onGetData(Chunk& data) +/// { +/// // Fill the chunk with audio data from the stream source +/// // (note: must not be empty if you want to continue playing) +/// data.samples = ...; +/// data.sampleCount = ...; +/// +/// // Return true to continue playing +/// return true; +/// } +/// +/// virtual void onSeek(Uint32 timeOffset) +/// { +/// // Change the current position in the stream source +/// ... +/// } +/// } +/// +/// // Usage +/// CustomStream stream; +/// stream.open("path/to/stream"); +/// stream.play(); +/// \endcode +/// +/// \see sf::Music +/// +//////////////////////////////////////////////////////////// diff --git a/mcclone/external/sfml23/include/SFML/Config.hpp b/mcclone/external/sfml23/include/SFML/Config.hpp new file mode 100644 index 0000000..05c7719 --- /dev/null +++ b/mcclone/external/sfml23/include/SFML/Config.hpp @@ -0,0 +1,193 @@ +//////////////////////////////////////////////////////////// +// +// SFML - Simple and Fast Multimedia Library +// Copyright (C) 2007-2015 Laurent Gomila (laurent@sfml-dev.org) +// +// This software is provided 'as-is', without any express or implied warranty. +// In no event will the authors be held liable for any damages arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it freely, +// subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; +// you must not claim that you wrote the original software. +// If you use this software in a product, an acknowledgment +// in the product documentation would be appreciated but is not required. +// +// 2. Altered source versions must be plainly marked as such, +// and must not be misrepresented as being the original software. +// +// 3. This notice may not be removed or altered from any source distribution. +// +//////////////////////////////////////////////////////////// + +#ifndef SFML_CONFIG_HPP +#define SFML_CONFIG_HPP + + +//////////////////////////////////////////////////////////// +// Define the SFML version +//////////////////////////////////////////////////////////// +#define SFML_VERSION_MAJOR 2 +#define SFML_VERSION_MINOR 3 +#define SFML_VERSION_PATCH 2 + + +//////////////////////////////////////////////////////////// +// Identify the operating system +// see http://nadeausoftware.com/articles/2012/01/c_c_tip_how_use_compiler_predefined_macros_detect_operating_system +//////////////////////////////////////////////////////////// +#if defined(_WIN32) + + // Windows + #define SFML_SYSTEM_WINDOWS + #ifndef NOMINMAX + #define NOMINMAX + #endif + +#elif defined(__APPLE__) && defined(__MACH__) + + // Apple platform, see which one it is + #include "TargetConditionals.h" + + #if TARGET_OS_IPHONE || TARGET_IPHONE_SIMULATOR + + // iOS + #define SFML_SYSTEM_IOS + + #elif TARGET_OS_MAC + + // MacOS + #define SFML_SYSTEM_MACOS + + #else + + // Unsupported Apple system + #error This Apple operating system is not supported by SFML library + + #endif + +#elif defined(__unix__) + + // UNIX system, see which one it is + #if defined(__ANDROID__) + + // Android + #define SFML_SYSTEM_ANDROID + + #elif defined(__linux__) + + // Linux + #define SFML_SYSTEM_LINUX + + #elif defined(__FreeBSD__) || defined(__FreeBSD_kernel__) + + // FreeBSD + #define SFML_SYSTEM_FREEBSD + + #else + + // Unsupported UNIX system + #error This UNIX operating system is not supported by SFML library + + #endif + +#else + + // Unsupported system + #error This operating system is not supported by SFML library + +#endif + + +//////////////////////////////////////////////////////////// +// Define a portable debug macro +//////////////////////////////////////////////////////////// +#if !defined(NDEBUG) + + #define SFML_DEBUG + +#endif + + +//////////////////////////////////////////////////////////// +// Define helpers to create portable import / export macros for each module +//////////////////////////////////////////////////////////// +#if !defined(SFML_STATIC) + + #if defined(SFML_SYSTEM_WINDOWS) + + // Windows compilers need specific (and different) keywords for export and import + #define SFML_API_EXPORT __declspec(dllexport) + #define SFML_API_IMPORT __declspec(dllimport) + + // For Visual C++ compilers, we also need to turn off this annoying C4251 warning + #ifdef _MSC_VER + + #pragma warning(disable: 4251) + + #endif + + #else // Linux, FreeBSD, Mac OS X + + #if __GNUC__ >= 4 + + // GCC 4 has special keywords for showing/hidding symbols, + // the same keyword is used for both importing and exporting + #define SFML_API_EXPORT __attribute__ ((__visibility__ ("default"))) + #define SFML_API_IMPORT __attribute__ ((__visibility__ ("default"))) + + #else + + // GCC < 4 has no mechanism to explicitely hide symbols, everything's exported + #define SFML_API_EXPORT + #define SFML_API_IMPORT + + #endif + + #endif + +#else + + // Static build doesn't need import/export macros + #define SFML_API_EXPORT + #define SFML_API_IMPORT + +#endif + + +//////////////////////////////////////////////////////////// +// Define portable fixed-size types +//////////////////////////////////////////////////////////// +namespace sf +{ + // All "common" platforms use the same size for char, short and int + // (basically there are 3 types for 3 sizes, so no other match is possible), + // we can use them without doing any kind of check + + // 8 bits integer types + typedef signed char Int8; + typedef unsigned char Uint8; + + // 16 bits integer types + typedef signed short Int16; + typedef unsigned short Uint16; + + // 32 bits integer types + typedef signed int Int32; + typedef unsigned int Uint32; + + // 64 bits integer types + #if defined(_MSC_VER) + typedef signed __int64 Int64; + typedef unsigned __int64 Uint64; + #else + typedef signed long long Int64; + typedef unsigned long long Uint64; + #endif + +} // namespace sf + + +#endif // SFML_CONFIG_HPP diff --git a/mcclone/external/sfml23/include/SFML/Graphics.hpp b/mcclone/external/sfml23/include/SFML/Graphics.hpp new file mode 100644 index 0000000..7a7f4da --- /dev/null +++ b/mcclone/external/sfml23/include/SFML/Graphics.hpp @@ -0,0 +1,67 @@ +//////////////////////////////////////////////////////////// +// +// SFML - Simple and Fast Multimedia Library +// Copyright (C) 2007-2015 Laurent Gomila (laurent@sfml-dev.org) +// +// This software is provided 'as-is', without any express or implied warranty. +// In no event will the authors be held liable for any damages arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it freely, +// subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; +// you must not claim that you wrote the original software. +// If you use this software in a product, an acknowledgment +// in the product documentation would be appreciated but is not required. +// +// 2. Altered source versions must be plainly marked as such, +// and must not be misrepresented as being the original software. +// +// 3. This notice may not be removed or altered from any source distribution. +// +//////////////////////////////////////////////////////////// + +#ifndef SFML_GRAPHICS_HPP +#define SFML_GRAPHICS_HPP + +//////////////////////////////////////////////////////////// +// Headers +//////////////////////////////////////////////////////////// + +#include +#include +#include +#include +#include +#include +#include +#include +#include +#include +#include +#include +#include +#include +#include +#include +#include +#include +#include +#include +#include +#include +#include +#include +#include +#include + + +#endif // SFML_GRAPHICS_HPP + +//////////////////////////////////////////////////////////// +/// \defgroup graphics Graphics module +/// +/// 2D graphics module: sprites, text, shapes, ... +/// +//////////////////////////////////////////////////////////// diff --git a/mcclone/external/sfml23/include/SFML/Graphics/BlendMode.hpp b/mcclone/external/sfml23/include/SFML/Graphics/BlendMode.hpp new file mode 100644 index 0000000..7f5803b --- /dev/null +++ b/mcclone/external/sfml23/include/SFML/Graphics/BlendMode.hpp @@ -0,0 +1,214 @@ +//////////////////////////////////////////////////////////// +// +// SFML - Simple and Fast Multimedia Library +// Copyright (C) 2007-2015 Laurent Gomila (laurent@sfml-dev.org) +// +// This software is provided 'as-is', without any express or implied warranty. +// In no event will the authors be held liable for any damages arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it freely, +// subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; +// you must not claim that you wrote the original software. +// If you use this software in a product, an acknowledgment +// in the product documentation would be appreciated but is not required. +// +// 2. Altered source versions must be plainly marked as such, +// and must not be misrepresented as being the original software. +// +// 3. This notice may not be removed or altered from any source distribution. +// +//////////////////////////////////////////////////////////// + +#ifndef SFML_BLENDMODE_HPP +#define SFML_BLENDMODE_HPP + +//////////////////////////////////////////////////////////// +// Headers +//////////////////////////////////////////////////////////// +#include + + +namespace sf +{ + +//////////////////////////////////////////////////////////// +/// \brief Blending modes for drawing +/// +//////////////////////////////////////////////////////////// +struct SFML_GRAPHICS_API BlendMode +{ + //////////////////////////////////////////////////////// + /// \brief Enumeration of the blending factors + /// + /// The factors are mapped directly to their OpenGL equivalents, + /// specified by glBlendFunc() or glBlendFuncSeparate(). + //////////////////////////////////////////////////////// + enum Factor + { + Zero, ///< (0, 0, 0, 0) + One, ///< (1, 1, 1, 1) + SrcColor, ///< (src.r, src.g, src.b, src.a) + OneMinusSrcColor, ///< (1, 1, 1, 1) - (src.r, src.g, src.b, src.a) + DstColor, ///< (dst.r, dst.g, dst.b, dst.a) + OneMinusDstColor, ///< (1, 1, 1, 1) - (dst.r, dst.g, dst.b, dst.a) + SrcAlpha, ///< (src.a, src.a, src.a, src.a) + OneMinusSrcAlpha, ///< (1, 1, 1, 1) - (src.a, src.a, src.a, src.a) + DstAlpha, ///< (dst.a, dst.a, dst.a, dst.a) + OneMinusDstAlpha ///< (1, 1, 1, 1) - (dst.a, dst.a, dst.a, dst.a) + }; + + //////////////////////////////////////////////////////// + /// \brief Enumeration of the blending equations + /// + /// The equations are mapped directly to their OpenGL equivalents, + /// specified by glBlendEquation() or glBlendEquationSeparate(). + //////////////////////////////////////////////////////// + enum Equation + { + Add, ///< Pixel = Src * SrcFactor + Dst * DstFactor + Subtract ///< Pixel = Src * SrcFactor - Dst * DstFactor + }; + + //////////////////////////////////////////////////////////// + /// \brief Default constructor + /// + /// Constructs a blending mode that does alpha blending. + /// + //////////////////////////////////////////////////////////// + BlendMode(); + + //////////////////////////////////////////////////////////// + /// \brief Construct the blend mode given the factors and equation. + /// + /// This constructor uses the same factors and equation for both + /// color and alpha components. It also defaults to the Add equation. + /// + /// \param sourceFactor Specifies how to compute the source factor for the color and alpha channels. + /// \param destinationFactor Specifies how to compute the destination factor for the color and alpha channels. + /// \param blendEquation Specifies how to combine the source and destination colors and alpha. + /// + //////////////////////////////////////////////////////////// + BlendMode(Factor sourceFactor, Factor destinationFactor, Equation blendEquation = Add); + + //////////////////////////////////////////////////////////// + /// \brief Construct the blend mode given the factors and equation. + /// + /// \param colorSourceFactor Specifies how to compute the source factor for the color channels. + /// \param colorDestinationFactor Specifies how to compute the destination factor for the color channels. + /// \param colorBlendEquation Specifies how to combine the source and destination colors. + /// \param alphaSourceFactor Specifies how to compute the source factor. + /// \param alphaDestinationFactor Specifies how to compute the destination factor. + /// \param alphaBlendEquation Specifies how to combine the source and destination alphas. + /// + //////////////////////////////////////////////////////////// + BlendMode(Factor colorSourceFactor, Factor colorDestinationFactor, + Equation colorBlendEquation, Factor alphaSourceFactor, + Factor alphaDestinationFactor, Equation alphaBlendEquation); + + //////////////////////////////////////////////////////////// + // Member Data + //////////////////////////////////////////////////////////// + Factor colorSrcFactor; ///< Source blending factor for the color channels + Factor colorDstFactor; ///< Destination blending factor for the color channels + Equation colorEquation; ///< Blending equation for the color channels + Factor alphaSrcFactor; ///< Source blending factor for the alpha channel + Factor alphaDstFactor; ///< Destination blending factor for the alpha channel + Equation alphaEquation; ///< Blending equation for the alpha channel +}; + +//////////////////////////////////////////////////////////// +/// \relates BlendMode +/// \brief Overload of the == operator +/// +/// \param left Left operand +/// \param right Right operand +/// +/// \return True if blending modes are equal, false if they are different +/// +//////////////////////////////////////////////////////////// +SFML_GRAPHICS_API bool operator ==(const BlendMode& left, const BlendMode& right); + +//////////////////////////////////////////////////////////// +/// \relates BlendMode +/// \brief Overload of the != operator +/// +/// \param left Left operand +/// \param right Right operand +/// +/// \return True if blending modes are different, false if they are equal +/// +//////////////////////////////////////////////////////////// +SFML_GRAPHICS_API bool operator !=(const BlendMode& left, const BlendMode& right); + +//////////////////////////////////////////////////////////// +// Commonly used blending modes +//////////////////////////////////////////////////////////// +SFML_GRAPHICS_API extern const BlendMode BlendAlpha; ///< Blend source and dest according to dest alpha +SFML_GRAPHICS_API extern const BlendMode BlendAdd; ///< Add source to dest +SFML_GRAPHICS_API extern const BlendMode BlendMultiply; ///< Multiply source and dest +SFML_GRAPHICS_API extern const BlendMode BlendNone; ///< Overwrite dest with source + +} // namespace sf + + +#endif // SFML_BLENDMODE_HPP + + +//////////////////////////////////////////////////////////// +/// \class sf::BlendMode +/// \ingroup graphics +/// +/// sf::BlendMode is a class that represents a blend mode. A blend +/// mode determines how the colors of an object you draw are +/// mixed with the colors that are already in the buffer. +/// +/// The class is composed of 6 components, each of which has its +/// own public member variable: +/// \li %Color Source Factor (@ref colorSrcFactor) +/// \li %Color Destination Factor (@ref colorDstFactor) +/// \li %Color Blend Equation (@ref colorEquation) +/// \li Alpha Source Factor (@ref alphaSrcFactor) +/// \li Alpha Destination Factor (@ref alphaDstFactor) +/// \li Alpha Blend Equation (@ref alphaEquation) +/// +/// The source factor specifies how the pixel you are drawing contributes +/// to the final color. The destination factor specifies how the pixel +/// already drawn in the buffer contributes to the final color. +/// +/// The color channels RGB (red, green, blue; simply referred to as +/// color) and A (alpha; the transparency) can be treated separately. This +/// separation can be useful for specific blend modes, but most often you +/// won't need it and will simply treat the color as a single unit. +/// +/// The blend factors and equations correspond to their OpenGL equivalents. +/// In general, the color of the resulting pixel is calculated according +/// to the following formula (\a src is the color of the source pixel, \a dst +/// the color of the destination pixel, the other variables correspond to the +/// public members, with the equations being + or - operators): +/// \code +/// dst.rgb = colorSrcFactor * src.rgb (colorEquation) colorDstFactor * dst.rgb +/// dst.a = alphaSrcFactor * src.a (alphaEquation) alphaDstFactor * dst.a +/// \endcode +/// All factors and colors are represented as floating point numbers between +/// 0 and 1. Where necessary, the result is clamped to fit in that range. +/// +/// The most common blending modes are defined as constants +/// in the sf namespace: +/// +/// \code +/// sf::BlendMode alphaBlending = sf::BlendAlpha; +/// sf::BlendMode additiveBlending = sf::BlendAdd; +/// sf::BlendMode multiplicativeBlending = sf::BlendMultipy; +/// sf::BlendMode noBlending = sf::BlendNone; +/// \endcode +/// +/// In SFML, a blend mode can be specified every time you draw a sf::Drawable +/// object to a render target. It is part of the sf::RenderStates compound +/// that is passed to the member function sf::RenderTarget::draw(). +/// +/// \see sf::RenderStates, sf::RenderTarget +/// +//////////////////////////////////////////////////////////// diff --git a/mcclone/external/sfml23/include/SFML/Graphics/CircleShape.hpp b/mcclone/external/sfml23/include/SFML/Graphics/CircleShape.hpp new file mode 100644 index 0000000..2d5ac00 --- /dev/null +++ b/mcclone/external/sfml23/include/SFML/Graphics/CircleShape.hpp @@ -0,0 +1,154 @@ +//////////////////////////////////////////////////////////// +// +// SFML - Simple and Fast Multimedia Library +// Copyright (C) 2007-2015 Laurent Gomila (laurent@sfml-dev.org) +// +// This software is provided 'as-is', without any express or implied warranty. +// In no event will the authors be held liable for any damages arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it freely, +// subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; +// you must not claim that you wrote the original software. +// If you use this software in a product, an acknowledgment +// in the product documentation would be appreciated but is not required. +// +// 2. Altered source versions must be plainly marked as such, +// and must not be misrepresented as being the original software. +// +// 3. This notice may not be removed or altered from any source distribution. +// +//////////////////////////////////////////////////////////// + +#ifndef SFML_CIRCLESHAPE_HPP +#define SFML_CIRCLESHAPE_HPP + +//////////////////////////////////////////////////////////// +// Headers +//////////////////////////////////////////////////////////// +#include +#include + + +namespace sf +{ +//////////////////////////////////////////////////////////// +/// \brief Specialized shape representing a circle +/// +//////////////////////////////////////////////////////////// +class SFML_GRAPHICS_API CircleShape : public Shape +{ +public: + + //////////////////////////////////////////////////////////// + /// \brief Default constructor + /// + /// \param radius Radius of the circle + /// \param pointCount Number of points composing the circle + /// + //////////////////////////////////////////////////////////// + explicit CircleShape(float radius = 0, std::size_t pointCount = 30); + + //////////////////////////////////////////////////////////// + /// \brief Set the radius of the circle + /// + /// \param radius New radius of the circle + /// + /// \see getRadius + /// + //////////////////////////////////////////////////////////// + void setRadius(float radius); + + //////////////////////////////////////////////////////////// + /// \brief Get the radius of the circle + /// + /// \return Radius of the circle + /// + /// \see setRadius + /// + //////////////////////////////////////////////////////////// + float getRadius() const; + + //////////////////////////////////////////////////////////// + /// \brief Set the number of points of the circle + /// + /// \param count New number of points of the circle + /// + /// \see getPointCount + /// + //////////////////////////////////////////////////////////// + void setPointCount(std::size_t count); + + //////////////////////////////////////////////////////////// + /// \brief Get the number of points of the circle + /// + /// \return Number of points of the circle + /// + /// \see setPointCount + /// + //////////////////////////////////////////////////////////// + virtual std::size_t getPointCount() const; + + //////////////////////////////////////////////////////////// + /// \brief Get a point of the circle + /// + /// The returned point is in local coordinates, that is, + /// the shape's transforms (position, rotation, scale) are + /// not taken into account. + /// The result is undefined if \a index is out of the valid range. + /// + /// \param index Index of the point to get, in range [0 .. getPointCount() - 1] + /// + /// \return index-th point of the shape + /// + //////////////////////////////////////////////////////////// + virtual Vector2f getPoint(std::size_t index) const; + +private: + + //////////////////////////////////////////////////////////// + // Member data + //////////////////////////////////////////////////////////// + float m_radius; ///< Radius of the circle + std::size_t m_pointCount; ///< Number of points composing the circle +}; + +} // namespace sf + + +#endif // SFML_CIRCLESHAPE_HPP + + +//////////////////////////////////////////////////////////// +/// \class sf::CircleShape +/// \ingroup graphics +/// +/// This class inherits all the functions of sf::Transformable +/// (position, rotation, scale, bounds, ...) as well as the +/// functions of sf::Shape (outline, color, texture, ...). +/// +/// Usage example: +/// \code +/// sf::CircleShape circle; +/// circle.setRadius(150); +/// circle.setOutlineColor(sf::Color::Red); +/// circle.setOutlineThickness(5); +/// circle.setPosition(10, 20); +/// ... +/// window.draw(circle); +/// \endcode +/// +/// Since the graphics card can't draw perfect circles, we have to +/// fake them with multiple triangles connected to each other. The +/// "points count" property of sf::CircleShape defines how many of these +/// triangles to use, and therefore defines the quality of the circle. +/// +/// The number of points can also be used for another purpose; with +/// small numbers you can create any regular polygon shape: +/// equilateral triangle, square, pentagon, hexagon, ... +/// +/// \see sf::Shape, sf::RectangleShape, sf::ConvexShape +/// +//////////////////////////////////////////////////////////// diff --git a/mcclone/external/sfml23/include/SFML/Graphics/Color.hpp b/mcclone/external/sfml23/include/SFML/Graphics/Color.hpp new file mode 100644 index 0000000..87a1598 --- /dev/null +++ b/mcclone/external/sfml23/include/SFML/Graphics/Color.hpp @@ -0,0 +1,275 @@ +//////////////////////////////////////////////////////////// +// +// SFML - Simple and Fast Multimedia Library +// Copyright (C) 2007-2015 Laurent Gomila (laurent@sfml-dev.org) +// +// This software is provided 'as-is', without any express or implied warranty. +// In no event will the authors be held liable for any damages arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it freely, +// subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; +// you must not claim that you wrote the original software. +// If you use this software in a product, an acknowledgment +// in the product documentation would be appreciated but is not required. +// +// 2. Altered source versions must be plainly marked as such, +// and must not be misrepresented as being the original software. +// +// 3. This notice may not be removed or altered from any source distribution. +// +//////////////////////////////////////////////////////////// + +#ifndef SFML_COLOR_HPP +#define SFML_COLOR_HPP + +//////////////////////////////////////////////////////////// +// Headers +//////////////////////////////////////////////////////////// +#include + + +namespace sf +{ +//////////////////////////////////////////////////////////// +/// \brief Utility class for manipulating RGBA colors +/// +//////////////////////////////////////////////////////////// +class SFML_GRAPHICS_API Color +{ +public: + + //////////////////////////////////////////////////////////// + /// \brief Default constructor + /// + /// Constructs an opaque black color. It is equivalent to + /// sf::Color(0, 0, 0, 255). + /// + //////////////////////////////////////////////////////////// + Color(); + + //////////////////////////////////////////////////////////// + /// \brief Construct the color from its 4 RGBA components + /// + /// \param red Red component (in the range [0, 255]) + /// \param green Green component (in the range [0, 255]) + /// \param blue Blue component (in the range [0, 255]) + /// \param alpha Alpha (opacity) component (in the range [0, 255]) + /// + //////////////////////////////////////////////////////////// + Color(Uint8 red, Uint8 green, Uint8 blue, Uint8 alpha = 255); + + //////////////////////////////////////////////////////////// + /// \brief Construct the color from 32-bit unsigned integer + /// + /// \param color Number containing the RGBA components (in that order) + /// + //////////////////////////////////////////////////////////// + explicit Color(Uint32 color); + + //////////////////////////////////////////////////////////// + /// \brief Retrieve the color as a 32-bit unsigned integer + /// + /// \return Color represented as a 32-bit unsigned integer + /// + //////////////////////////////////////////////////////////// + Uint32 toInteger() const; + + //////////////////////////////////////////////////////////// + // Static member data + //////////////////////////////////////////////////////////// + static const Color Black; ///< Black predefined color + static const Color White; ///< White predefined color + static const Color Red; ///< Red predefined color + static const Color Green; ///< Green predefined color + static const Color Blue; ///< Blue predefined color + static const Color Yellow; ///< Yellow predefined color + static const Color Magenta; ///< Magenta predefined color + static const Color Cyan; ///< Cyan predefined color + static const Color Transparent; ///< Transparent (black) predefined color + + //////////////////////////////////////////////////////////// + // Member data + //////////////////////////////////////////////////////////// + Uint8 r; ///< Red component + Uint8 g; ///< Green component + Uint8 b; ///< Blue component + Uint8 a; ///< Alpha (opacity) component +}; + +//////////////////////////////////////////////////////////// +/// \relates Color +/// \brief Overload of the == operator +/// +/// This operator compares two colors and check if they are equal. +/// +/// \param left Left operand +/// \param right Right operand +/// +/// \return True if colors are equal, false if they are different +/// +//////////////////////////////////////////////////////////// +SFML_GRAPHICS_API bool operator ==(const Color& left, const Color& right); + +//////////////////////////////////////////////////////////// +/// \relates Color +/// \brief Overload of the != operator +/// +/// This operator compares two colors and check if they are different. +/// +/// \param left Left operand +/// \param right Right operand +/// +/// \return True if colors are different, false if they are equal +/// +//////////////////////////////////////////////////////////// +SFML_GRAPHICS_API bool operator !=(const Color& left, const Color& right); + +//////////////////////////////////////////////////////////// +/// \relates Color +/// \brief Overload of the binary + operator +/// +/// This operator returns the component-wise sum of two colors. +/// Components that exceed 255 are clamped to 255. +/// +/// \param left Left operand +/// \param right Right operand +/// +/// \return Result of \a left + \a right +/// +//////////////////////////////////////////////////////////// +SFML_GRAPHICS_API Color operator +(const Color& left, const Color& right); + +//////////////////////////////////////////////////////////// +/// \relates Color +/// \brief Overload of the binary - operator +/// +/// This operator returns the component-wise subtraction of two colors. +/// Components below 0 are clamped to 0. +/// +/// \param left Left operand +/// \param right Right operand +/// +/// \return Result of \a left - \a right +/// +//////////////////////////////////////////////////////////// +SFML_GRAPHICS_API Color operator -(const Color& left, const Color& right); + +//////////////////////////////////////////////////////////// +/// \relates Color +/// \brief Overload of the binary * operator +/// +/// This operator returns the component-wise multiplication +/// (also called "modulation") of two colors. +/// Components are then divided by 255 so that the result is +/// still in the range [0, 255]. +/// +/// \param left Left operand +/// \param right Right operand +/// +/// \return Result of \a left * \a right +/// +//////////////////////////////////////////////////////////// +SFML_GRAPHICS_API Color operator *(const Color& left, const Color& right); + +//////////////////////////////////////////////////////////// +/// \relates Color +/// \brief Overload of the binary += operator +/// +/// This operator computes the component-wise sum of two colors, +/// and assigns the result to the left operand. +/// Components that exceed 255 are clamped to 255. +/// +/// \param left Left operand +/// \param right Right operand +/// +/// \return Reference to \a left +/// +//////////////////////////////////////////////////////////// +SFML_GRAPHICS_API Color& operator +=(Color& left, const Color& right); + +//////////////////////////////////////////////////////////// +/// \relates Color +/// \brief Overload of the binary -= operator +/// +/// This operator computes the component-wise subtraction of two colors, +/// and assigns the result to the left operand. +/// Components below 0 are clamped to 0. +/// +/// \param left Left operand +/// \param right Right operand +/// +/// \return Reference to \a left +/// +//////////////////////////////////////////////////////////// +SFML_GRAPHICS_API Color& operator -=(Color& left, const Color& right); + +//////////////////////////////////////////////////////////// +/// \relates Color +/// \brief Overload of the binary *= operator +/// +/// This operator returns the component-wise multiplication +/// (also called "modulation") of two colors, and assigns +/// the result to the left operand. +/// Components are then divided by 255 so that the result is +/// still in the range [0, 255]. +/// +/// \param left Left operand +/// \param right Right operand +/// +/// \return Reference to \a left +/// +//////////////////////////////////////////////////////////// +SFML_GRAPHICS_API Color& operator *=(Color& left, const Color& right); + +} // namespace sf + + +#endif // SFML_COLOR_HPP + + +//////////////////////////////////////////////////////////// +/// \class sf::Color +/// \ingroup graphics +/// +/// sf::Color is a simple color class composed of 4 components: +/// \li Red +/// \li Green +/// \li Blue +/// \li Alpha (opacity) +/// +/// Each component is a public member, an unsigned integer in +/// the range [0, 255]. Thus, colors can be constructed and +/// manipulated very easily: +/// +/// \code +/// sf::Color color(255, 0, 0); // red +/// color.r = 0; // make it black +/// color.b = 128; // make it dark blue +/// \endcode +/// +/// The fourth component of colors, named "alpha", represents +/// the opacity of the color. A color with an alpha value of +/// 255 will be fully opaque, while an alpha value of 0 will +/// make a color fully transparent, whatever the value of the +/// other components is. +/// +/// The most common colors are already defined as static variables: +/// \code +/// sf::Color black = sf::Color::Black; +/// sf::Color white = sf::Color::White; +/// sf::Color red = sf::Color::Red; +/// sf::Color green = sf::Color::Green; +/// sf::Color blue = sf::Color::Blue; +/// sf::Color yellow = sf::Color::Yellow; +/// sf::Color magenta = sf::Color::Magenta; +/// sf::Color cyan = sf::Color::Cyan; +/// sf::Color transparent = sf::Color::Transparent; +/// \endcode +/// +/// Colors can also be added and modulated (multiplied) using the +/// overloaded operators + and *. +/// +//////////////////////////////////////////////////////////// diff --git a/mcclone/external/sfml23/include/SFML/Graphics/ConvexShape.hpp b/mcclone/external/sfml23/include/SFML/Graphics/ConvexShape.hpp new file mode 100644 index 0000000..82991a7 --- /dev/null +++ b/mcclone/external/sfml23/include/SFML/Graphics/ConvexShape.hpp @@ -0,0 +1,153 @@ +//////////////////////////////////////////////////////////// +// +// SFML - Simple and Fast Multimedia Library +// Copyright (C) 2007-2015 Laurent Gomila (laurent@sfml-dev.org) +// +// This software is provided 'as-is', without any express or implied warranty. +// In no event will the authors be held liable for any damages arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it freely, +// subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; +// you must not claim that you wrote the original software. +// If you use this software in a product, an acknowledgment +// in the product documentation would be appreciated but is not required. +// +// 2. Altered source versions must be plainly marked as such, +// and must not be misrepresented as being the original software. +// +// 3. This notice may not be removed or altered from any source distribution. +// +//////////////////////////////////////////////////////////// + +#ifndef SFML_CONVEXSHAPE_HPP +#define SFML_CONVEXSHAPE_HPP + +//////////////////////////////////////////////////////////// +// Headers +//////////////////////////////////////////////////////////// +#include +#include +#include + + +namespace sf +{ +//////////////////////////////////////////////////////////// +/// \brief Specialized shape representing a convex polygon +/// +//////////////////////////////////////////////////////////// +class SFML_GRAPHICS_API ConvexShape : public Shape +{ +public: + + //////////////////////////////////////////////////////////// + /// \brief Default constructor + /// + /// \param pointCount Number of points of the polygon + /// + //////////////////////////////////////////////////////////// + explicit ConvexShape(std::size_t pointCount = 0); + + //////////////////////////////////////////////////////////// + /// \brief Set the number of points of the polygon + /// + /// \a count must be greater than 2 to define a valid shape. + /// + /// \param count New number of points of the polygon + /// + /// \see getPointCount + /// + //////////////////////////////////////////////////////////// + void setPointCount(std::size_t count); + + //////////////////////////////////////////////////////////// + /// \brief Get the number of points of the polygon + /// + /// \return Number of points of the polygon + /// + /// \see setPointCount + /// + //////////////////////////////////////////////////////////// + virtual std::size_t getPointCount() const; + + //////////////////////////////////////////////////////////// + /// \brief Set the position of a point + /// + /// Don't forget that the polygon must remain convex, and + /// the points need to stay ordered! + /// setPointCount must be called first in order to set the total + /// number of points. The result is undefined if \a index is out + /// of the valid range. + /// + /// \param index Index of the point to change, in range [0 .. getPointCount() - 1] + /// \param point New position of the point + /// + /// \see getPoint + /// + //////////////////////////////////////////////////////////// + void setPoint(std::size_t index, const Vector2f& point); + + //////////////////////////////////////////////////////////// + /// \brief Get the position of a point + /// + /// The returned point is in local coordinates, that is, + /// the shape's transforms (position, rotation, scale) are + /// not taken into account. + /// The result is undefined if \a index is out of the valid range. + /// + /// \param index Index of the point to get, in range [0 .. getPointCount() - 1] + /// + /// \return Position of the index-th point of the polygon + /// + /// \see setPoint + /// + //////////////////////////////////////////////////////////// + virtual Vector2f getPoint(std::size_t index) const; + +private: + + //////////////////////////////////////////////////////////// + // Member data + //////////////////////////////////////////////////////////// + std::vector m_points; ///< Points composing the convex polygon +}; + +} // namespace sf + + +#endif // SFML_CONVEXSHAPE_HPP + + +//////////////////////////////////////////////////////////// +/// \class sf::ConvexShape +/// \ingroup graphics +/// +/// This class inherits all the functions of sf::Transformable +/// (position, rotation, scale, bounds, ...) as well as the +/// functions of sf::Shape (outline, color, texture, ...). +/// +/// It is important to keep in mind that a convex shape must +/// always be... convex, otherwise it may not be drawn correctly. +/// Moreover, the points must be defined in order; using a random +/// order would result in an incorrect shape. +/// +/// Usage example: +/// \code +/// sf::ConvexShape polygon; +/// polygon.setPointCount(3); +/// polygon.setPoint(0, sf::Vector2f(0, 0)); +/// polygon.setPoint(1, sf::Vector2f(0, 10)); +/// polygon.setPoint(2, sf::Vector2f(25, 5)); +/// polygon.setOutlineColor(sf::Color::Red); +/// polygon.setOutlineThickness(5); +/// polygon.setPosition(10, 20); +/// ... +/// window.draw(polygon); +/// \endcode +/// +/// \see sf::Shape, sf::RectangleShape, sf::CircleShape +/// +//////////////////////////////////////////////////////////// diff --git a/mcclone/external/sfml23/include/SFML/Graphics/Drawable.hpp b/mcclone/external/sfml23/include/SFML/Graphics/Drawable.hpp new file mode 100644 index 0000000..5ddf2da --- /dev/null +++ b/mcclone/external/sfml23/include/SFML/Graphics/Drawable.hpp @@ -0,0 +1,126 @@ +//////////////////////////////////////////////////////////// +// +// SFML - Simple and Fast Multimedia Library +// Copyright (C) 2007-2015 Laurent Gomila (laurent@sfml-dev.org) +// +// This software is provided 'as-is', without any express or implied warranty. +// In no event will the authors be held liable for any damages arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it freely, +// subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; +// you must not claim that you wrote the original software. +// If you use this software in a product, an acknowledgment +// in the product documentation would be appreciated but is not required. +// +// 2. Altered source versions must be plainly marked as such, +// and must not be misrepresented as being the original software. +// +// 3. This notice may not be removed or altered from any source distribution. +// +//////////////////////////////////////////////////////////// + +#ifndef SFML_DRAWABLE_HPP +#define SFML_DRAWABLE_HPP + +//////////////////////////////////////////////////////////// +// Headers +//////////////////////////////////////////////////////////// +#include +#include + + +namespace sf +{ +class RenderTarget; + +//////////////////////////////////////////////////////////// +/// \brief Abstract base class for objects that can be drawn +/// to a render target +/// +//////////////////////////////////////////////////////////// +class SFML_GRAPHICS_API Drawable +{ +public: + + //////////////////////////////////////////////////////////// + /// \brief Virtual destructor + /// + //////////////////////////////////////////////////////////// + virtual ~Drawable() {} + +protected: + + friend class RenderTarget; + + //////////////////////////////////////////////////////////// + /// \brief Draw the object to a render target + /// + /// This is a pure virtual function that has to be implemented + /// by the derived class to define how the drawable should be + /// drawn. + /// + /// \param target Render target to draw to + /// \param states Current render states + /// + //////////////////////////////////////////////////////////// + virtual void draw(RenderTarget& target, RenderStates states) const = 0; +}; + +} // namespace sf + + +#endif // SFML_DRAWABLE_HPP + + +//////////////////////////////////////////////////////////// +/// \class sf::Drawable +/// \ingroup graphics +/// +/// sf::Drawable is a very simple base class that allows objects +/// of derived classes to be drawn to a sf::RenderTarget. +/// +/// All you have to do in your derived class is to override the +/// draw virtual function. +/// +/// Note that inheriting from sf::Drawable is not mandatory, +/// but it allows this nice syntax "window.draw(object)" rather +/// than "object.draw(window)", which is more consistent with other +/// SFML classes. +/// +/// Example: +/// \code +/// class MyDrawable : public sf::Drawable +/// { +/// public: +/// +/// ... +/// +/// private: +/// +/// virtual void draw(sf::RenderTarget& target, sf::RenderStates states) const +/// { +/// // You can draw other high-level objects +/// target.draw(m_sprite, states); +/// +/// // ... or use the low-level API +/// states.texture = &m_texture; +/// target.draw(m_vertices, states); +/// +/// // ... or draw with OpenGL directly +/// glBegin(GL_QUADS); +/// ... +/// glEnd(); +/// } +/// +/// sf::Sprite m_sprite; +/// sf::Texture m_texture; +/// sf::VertexArray m_vertices; +/// }; +/// \endcode +/// +/// \see sf::RenderTarget +/// +//////////////////////////////////////////////////////////// diff --git a/mcclone/external/sfml23/include/SFML/Graphics/Export.hpp b/mcclone/external/sfml23/include/SFML/Graphics/Export.hpp new file mode 100644 index 0000000..624f1eb --- /dev/null +++ b/mcclone/external/sfml23/include/SFML/Graphics/Export.hpp @@ -0,0 +1,48 @@ +//////////////////////////////////////////////////////////// +// +// SFML - Simple and Fast Multimedia Library +// Copyright (C) 2007-2015 Laurent Gomila (laurent@sfml-dev.org) +// +// This software is provided 'as-is', without any express or implied warranty. +// In no event will the authors be held liable for any damages arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it freely, +// subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; +// you must not claim that you wrote the original software. +// If you use this software in a product, an acknowledgment +// in the product documentation would be appreciated but is not required. +// +// 2. Altered source versions must be plainly marked as such, +// and must not be misrepresented as being the original software. +// +// 3. This notice may not be removed or altered from any source distribution. +// +//////////////////////////////////////////////////////////// + +#ifndef SFML_GRAPHICS_EXPORT_HPP +#define SFML_GRAPHICS_EXPORT_HPP + +//////////////////////////////////////////////////////////// +// Headers +//////////////////////////////////////////////////////////// +#include + + +//////////////////////////////////////////////////////////// +// Define portable import / export macros +//////////////////////////////////////////////////////////// +#if defined(SFML_GRAPHICS_EXPORTS) + + #define SFML_GRAPHICS_API SFML_API_EXPORT + +#else + + #define SFML_GRAPHICS_API SFML_API_IMPORT + +#endif + + +#endif // SFML_GRAPHICS_EXPORT_HPP diff --git a/mcclone/external/sfml23/include/SFML/Graphics/Font.hpp b/mcclone/external/sfml23/include/SFML/Graphics/Font.hpp new file mode 100644 index 0000000..ac6b00e --- /dev/null +++ b/mcclone/external/sfml23/include/SFML/Graphics/Font.hpp @@ -0,0 +1,433 @@ +//////////////////////////////////////////////////////////// +// +// SFML - Simple and Fast Multimedia Library +// Copyright (C) 2007-2015 Laurent Gomila (laurent@sfml-dev.org) +// +// This software is provided 'as-is', without any express or implied warranty. +// In no event will the authors be held liable for any damages arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it freely, +// subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; +// you must not claim that you wrote the original software. +// If you use this software in a product, an acknowledgment +// in the product documentation would be appreciated but is not required. +// +// 2. Altered source versions must be plainly marked as such, +// and must not be misrepresented as being the original software. +// +// 3. This notice may not be removed or altered from any source distribution. +// +//////////////////////////////////////////////////////////// + +#ifndef SFML_FONT_HPP +#define SFML_FONT_HPP + +//////////////////////////////////////////////////////////// +// Headers +//////////////////////////////////////////////////////////// +#include +#include +#include +#include +#include +#include +#include +#include +#include + + +namespace sf +{ +class InputStream; + +//////////////////////////////////////////////////////////// +/// \brief Class for loading and manipulating character fonts +/// +//////////////////////////////////////////////////////////// +class SFML_GRAPHICS_API Font +{ +public: + + //////////////////////////////////////////////////////////// + /// \brief Holds various information about a font + /// + //////////////////////////////////////////////////////////// + struct Info + { + std::string family; ///< The font family + }; + +public: + + //////////////////////////////////////////////////////////// + /// \brief Default constructor + /// + /// This constructor defines an empty font + /// + //////////////////////////////////////////////////////////// + Font(); + + //////////////////////////////////////////////////////////// + /// \brief Copy constructor + /// + /// \param copy Instance to copy + /// + //////////////////////////////////////////////////////////// + Font(const Font& copy); + + //////////////////////////////////////////////////////////// + /// \brief Destructor + /// + /// Cleans up all the internal resources used by the font + /// + //////////////////////////////////////////////////////////// + ~Font(); + + //////////////////////////////////////////////////////////// + /// \brief Load the font from a file + /// + /// The supported font formats are: TrueType, Type 1, CFF, + /// OpenType, SFNT, X11 PCF, Windows FNT, BDF, PFR and Type 42. + /// Note that this function know nothing about the standard + /// fonts installed on the user's system, thus you can't + /// load them directly. + /// + /// \warning SFML cannot preload all the font data in this + /// function, so the file has to remain accessible until + /// the sf::Font object loads a new font or is destroyed. + /// + /// \param filename Path of the font file to load + /// + /// \return True if loading succeeded, false if it failed + /// + /// \see loadFromMemory, loadFromStream + /// + //////////////////////////////////////////////////////////// + bool loadFromFile(const std::string& filename); + + //////////////////////////////////////////////////////////// + /// \brief Load the font from a file in memory + /// + /// The supported font formats are: TrueType, Type 1, CFF, + /// OpenType, SFNT, X11 PCF, Windows FNT, BDF, PFR and Type 42. + /// + /// \warning SFML cannot preload all the font data in this + /// function, so the buffer pointed by \a data has to remain + /// valid until the sf::Font object loads a new font or + /// is destroyed. + /// + /// \param data Pointer to the file data in memory + /// \param sizeInBytes Size of the data to load, in bytes + /// + /// \return True if loading succeeded, false if it failed + /// + /// \see loadFromFile, loadFromStream + /// + //////////////////////////////////////////////////////////// + bool loadFromMemory(const void* data, std::size_t sizeInBytes); + + //////////////////////////////////////////////////////////// + /// \brief Load the font from a custom stream + /// + /// The supported font formats are: TrueType, Type 1, CFF, + /// OpenType, SFNT, X11 PCF, Windows FNT, BDF, PFR and Type 42. + /// Warning: SFML cannot preload all the font data in this + /// function, so the contents of \a stream have to remain + /// valid as long as the font is used. + /// + /// \warning SFML cannot preload all the font data in this + /// function, so the stream has to remain accessible until + /// the sf::Font object loads a new font or is destroyed. + /// + /// \param stream Source stream to read from + /// + /// \return True if loading succeeded, false if it failed + /// + /// \see loadFromFile, loadFromMemory + /// + //////////////////////////////////////////////////////////// + bool loadFromStream(InputStream& stream); + + //////////////////////////////////////////////////////////// + /// \brief Get the font information + /// + /// \return A structure that holds the font information + /// + //////////////////////////////////////////////////////////// + const Info& getInfo() const; + + //////////////////////////////////////////////////////////// + /// \brief Retrieve a glyph of the font + /// + /// If the font is a bitmap font, not all character sizes + /// might be available. If the glyph is not available at the + /// requested size, an empty glyph is returned. + /// + /// \param codePoint Unicode code point of the character to get + /// \param characterSize Reference character size + /// \param bold Retrieve the bold version or the regular one? + /// + /// \return The glyph corresponding to \a codePoint and \a characterSize + /// + //////////////////////////////////////////////////////////// + const Glyph& getGlyph(Uint32 codePoint, unsigned int characterSize, bool bold) const; + + //////////////////////////////////////////////////////////// + /// \brief Get the kerning offset of two glyphs + /// + /// The kerning is an extra offset (negative) to apply between two + /// glyphs when rendering them, to make the pair look more "natural". + /// For example, the pair "AV" have a special kerning to make them + /// closer than other characters. Most of the glyphs pairs have a + /// kerning offset of zero, though. + /// + /// \param first Unicode code point of the first character + /// \param second Unicode code point of the second character + /// \param characterSize Reference character size + /// + /// \return Kerning value for \a first and \a second, in pixels + /// + //////////////////////////////////////////////////////////// + float getKerning(Uint32 first, Uint32 second, unsigned int characterSize) const; + + //////////////////////////////////////////////////////////// + /// \brief Get the line spacing + /// + /// Line spacing is the vertical offset to apply between two + /// consecutive lines of text. + /// + /// \param characterSize Reference character size + /// + /// \return Line spacing, in pixels + /// + //////////////////////////////////////////////////////////// + float getLineSpacing(unsigned int characterSize) const; + + //////////////////////////////////////////////////////////// + /// \brief Get the position of the underline + /// + /// Underline position is the vertical offset to apply between the + /// baseline and the underline. + /// + /// \param characterSize Reference character size + /// + /// \return Underline position, in pixels + /// + /// \see getUnderlineThickness + /// + //////////////////////////////////////////////////////////// + float getUnderlinePosition(unsigned int characterSize) const; + + //////////////////////////////////////////////////////////// + /// \brief Get the thickness of the underline + /// + /// Underline thickness is the vertical size of the underline. + /// + /// \param characterSize Reference character size + /// + /// \return Underline thickness, in pixels + /// + /// \see getUnderlinePosition + /// + //////////////////////////////////////////////////////////// + float getUnderlineThickness(unsigned int characterSize) const; + + //////////////////////////////////////////////////////////// + /// \brief Retrieve the texture containing the loaded glyphs of a certain size + /// + /// The contents of the returned texture changes as more glyphs + /// are requested, thus it is not very relevant. It is mainly + /// used internally by sf::Text. + /// + /// \param characterSize Reference character size + /// + /// \return Texture containing the glyphs of the requested size + /// + //////////////////////////////////////////////////////////// + const Texture& getTexture(unsigned int characterSize) const; + + //////////////////////////////////////////////////////////// + /// \brief Overload of assignment operator + /// + /// \param right Instance to assign + /// + /// \return Reference to self + /// + //////////////////////////////////////////////////////////// + Font& operator =(const Font& right); + +private: + + //////////////////////////////////////////////////////////// + /// \brief Structure defining a row of glyphs + /// + //////////////////////////////////////////////////////////// + struct Row + { + Row(unsigned int rowTop, unsigned int rowHeight) : width(0), top(rowTop), height(rowHeight) {} + + unsigned int width; ///< Current width of the row + unsigned int top; ///< Y position of the row into the texture + unsigned int height; ///< Height of the row + }; + + //////////////////////////////////////////////////////////// + // Types + //////////////////////////////////////////////////////////// + typedef std::map GlyphTable; ///< Table mapping a codepoint to its glyph + + //////////////////////////////////////////////////////////// + /// \brief Structure defining a page of glyphs + /// + //////////////////////////////////////////////////////////// + struct Page + { + Page(); + + GlyphTable glyphs; ///< Table mapping code points to their corresponding glyph + Texture texture; ///< Texture containing the pixels of the glyphs + unsigned int nextRow; ///< Y position of the next new row in the texture + std::vector rows; ///< List containing the position of all the existing rows + }; + + //////////////////////////////////////////////////////////// + /// \brief Free all the internal resources + /// + //////////////////////////////////////////////////////////// + void cleanup(); + + //////////////////////////////////////////////////////////// + /// \brief Load a new glyph and store it in the cache + /// + /// \param codePoint Unicode code point of the character to load + /// \param characterSize Reference character size + /// \param bold Retrieve the bold version or the regular one? + /// + /// \return The glyph corresponding to \a codePoint and \a characterSize + /// + //////////////////////////////////////////////////////////// + Glyph loadGlyph(Uint32 codePoint, unsigned int characterSize, bool bold) const; + + //////////////////////////////////////////////////////////// + /// \brief Find a suitable rectangle within the texture for a glyph + /// + /// \param page Page of glyphs to search in + /// \param width Width of the rectangle + /// \param height Height of the rectangle + /// + /// \return Found rectangle within the texture + /// + //////////////////////////////////////////////////////////// + IntRect findGlyphRect(Page& page, unsigned int width, unsigned int height) const; + + //////////////////////////////////////////////////////////// + /// \brief Make sure that the given size is the current one + /// + /// \param characterSize Reference character size + /// + /// \return True on success, false if any error happened + /// + //////////////////////////////////////////////////////////// + bool setCurrentSize(unsigned int characterSize) const; + + //////////////////////////////////////////////////////////// + // Types + //////////////////////////////////////////////////////////// + typedef std::map PageTable; ///< Table mapping a character size to its page (texture) + + //////////////////////////////////////////////////////////// + // Member data + //////////////////////////////////////////////////////////// + void* m_library; ///< Pointer to the internal library interface (it is typeless to avoid exposing implementation details) + void* m_face; ///< Pointer to the internal font face (it is typeless to avoid exposing implementation details) + void* m_streamRec; ///< Pointer to the stream rec instance (it is typeless to avoid exposing implementation details) + int* m_refCount; ///< Reference counter used by implicit sharing + Info m_info; ///< Information about the font + mutable PageTable m_pages; ///< Table containing the glyphs pages by character size + mutable std::vector m_pixelBuffer; ///< Pixel buffer holding a glyph's pixels before being written to the texture + #ifdef SFML_SYSTEM_ANDROID + void* m_stream; ///< Asset file streamer (if loaded from file) + #endif +}; + +} // namespace sf + + +#endif // SFML_FONT_HPP + + +//////////////////////////////////////////////////////////// +/// \class sf::Font +/// \ingroup graphics +/// +/// Fonts can be loaded from a file, from memory or from a custom +/// stream, and supports the most common types of fonts. See +/// the loadFromFile function for the complete list of supported formats. +/// +/// Once it is loaded, a sf::Font instance provides three +/// types of information about the font: +/// \li Global metrics, such as the line spacing +/// \li Per-glyph metrics, such as bounding box or kerning +/// \li Pixel representation of glyphs +/// +/// Fonts alone are not very useful: they hold the font data +/// but cannot make anything useful of it. To do so you need to +/// use the sf::Text class, which is able to properly output text +/// with several options such as character size, style, color, +/// position, rotation, etc. +/// This separation allows more flexibility and better performances: +/// indeed a sf::Font is a heavy resource, and any operation on it +/// is slow (often too slow for real-time applications). On the other +/// side, a sf::Text is a lightweight object which can combine the +/// glyphs data and metrics of a sf::Font to display any text on a +/// render target. +/// Note that it is also possible to bind several sf::Text instances +/// to the same sf::Font. +/// +/// It is important to note that the sf::Text instance doesn't +/// copy the font that it uses, it only keeps a reference to it. +/// Thus, a sf::Font must not be destructed while it is +/// used by a sf::Text (i.e. never write a function that +/// uses a local sf::Font instance for creating a text). +/// +/// Usage example: +/// \code +/// // Declare a new font +/// sf::Font font; +/// +/// // Load it from a file +/// if (!font.loadFromFile("arial.ttf")) +/// { +/// // error... +/// } +/// +/// // Create a text which uses our font +/// sf::Text text1; +/// text1.setFont(font); +/// text1.setCharacterSize(30); +/// text1.setStyle(sf::Text::Regular); +/// +/// // Create another text using the same font, but with different parameters +/// sf::Text text2; +/// text2.setFont(font); +/// text2.setCharacterSize(50); +/// text2.setStyle(sf::Text::Italic); +/// \endcode +/// +/// Apart from loading font files, and passing them to instances +/// of sf::Text, you should normally not have to deal directly +/// with this class. However, it may be useful to access the +/// font metrics or rasterized glyphs for advanced usage. +/// +/// Note that if the font is a bitmap font, it is not scalable, +/// thus not all requested sizes will be available to use. This +/// needs to be taken into consideration when using sf::Text. +/// If you need to display text of a certain size, make sure the +/// corresponding bitmap font that supports that size is used. +/// +/// \see sf::Text +/// +//////////////////////////////////////////////////////////// diff --git a/mcclone/external/sfml23/include/SFML/Graphics/Glyph.hpp b/mcclone/external/sfml23/include/SFML/Graphics/Glyph.hpp new file mode 100644 index 0000000..0068872 --- /dev/null +++ b/mcclone/external/sfml23/include/SFML/Graphics/Glyph.hpp @@ -0,0 +1,79 @@ +//////////////////////////////////////////////////////////// +// +// SFML - Simple and Fast Multimedia Library +// Copyright (C) 2007-2015 Laurent Gomila (laurent@sfml-dev.org) +// +// This software is provided 'as-is', without any express or implied warranty. +// In no event will the authors be held liable for any damages arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it freely, +// subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; +// you must not claim that you wrote the original software. +// If you use this software in a product, an acknowledgment +// in the product documentation would be appreciated but is not required. +// +// 2. Altered source versions must be plainly marked as such, +// and must not be misrepresented as being the original software. +// +// 3. This notice may not be removed or altered from any source distribution. +// +//////////////////////////////////////////////////////////// + +#ifndef SFML_GLYPH_HPP +#define SFML_GLYPH_HPP + +//////////////////////////////////////////////////////////// +// Headers +//////////////////////////////////////////////////////////// +#include +#include + + +namespace sf +{ +//////////////////////////////////////////////////////////// +/// \brief Structure describing a glyph +/// +//////////////////////////////////////////////////////////// +class SFML_GRAPHICS_API Glyph +{ +public: + + //////////////////////////////////////////////////////////// + /// \brief Default constructor + /// + //////////////////////////////////////////////////////////// + Glyph() : advance(0) {} + + //////////////////////////////////////////////////////////// + // Member data + //////////////////////////////////////////////////////////// + float advance; ///< Offset to move horizontally to the next character + FloatRect bounds; ///< Bounding rectangle of the glyph, in coordinates relative to the baseline + IntRect textureRect; ///< Texture coordinates of the glyph inside the font's texture +}; + +} // namespace sf + + +#endif // SFML_GLYPH_HPP + + +//////////////////////////////////////////////////////////// +/// \class sf::Glyph +/// \ingroup graphics +/// +/// A glyph is the visual representation of a character. +/// +/// The sf::Glyph structure provides the information needed +/// to handle the glyph: +/// \li its coordinates in the font's texture +/// \li its bounding rectangle +/// \li the offset to apply to get the starting position of the next glyph +/// +/// \see sf::Font +/// +//////////////////////////////////////////////////////////// diff --git a/mcclone/external/sfml23/include/SFML/Graphics/Image.hpp b/mcclone/external/sfml23/include/SFML/Graphics/Image.hpp new file mode 100644 index 0000000..11dc8f7 --- /dev/null +++ b/mcclone/external/sfml23/include/SFML/Graphics/Image.hpp @@ -0,0 +1,327 @@ +//////////////////////////////////////////////////////////// +// +// SFML - Simple and Fast Multimedia Library +// Copyright (C) 2007-2015 Laurent Gomila (laurent@sfml-dev.org) +// +// This software is provided 'as-is', without any express or implied warranty. +// In no event will the authors be held liable for any damages arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it freely, +// subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; +// you must not claim that you wrote the original software. +// If you use this software in a product, an acknowledgment +// in the product documentation would be appreciated but is not required. +// +// 2. Altered source versions must be plainly marked as such, +// and must not be misrepresented as being the original software. +// +// 3. This notice may not be removed or altered from any source distribution. +// +//////////////////////////////////////////////////////////// + +#ifndef SFML_IMAGE_HPP +#define SFML_IMAGE_HPP + +//////////////////////////////////////////////////////////// +// Headers +//////////////////////////////////////////////////////////// +#include +#include +#include +#include +#include + + +namespace sf +{ +class InputStream; + +//////////////////////////////////////////////////////////// +/// \brief Class for loading, manipulating and saving images +/// +//////////////////////////////////////////////////////////// +class SFML_GRAPHICS_API Image +{ +public: + + //////////////////////////////////////////////////////////// + /// \brief Default constructor + /// + /// Creates an empty image. + /// + //////////////////////////////////////////////////////////// + Image(); + + //////////////////////////////////////////////////////////// + /// \brief Destructor + /// + //////////////////////////////////////////////////////////// + ~Image(); + + //////////////////////////////////////////////////////////// + /// \brief Create the image and fill it with a unique color + /// + /// \param width Width of the image + /// \param height Height of the image + /// \param color Fill color + /// + //////////////////////////////////////////////////////////// + void create(unsigned int width, unsigned int height, const Color& color = Color(0, 0, 0)); + + //////////////////////////////////////////////////////////// + /// \brief Create the image from an array of pixels + /// + /// The \a pixel array is assumed to contain 32-bits RGBA pixels, + /// and have the given \a width and \a height. If not, this is + /// an undefined behavior. + /// If \a pixels is null, an empty image is created. + /// + /// \param width Width of the image + /// \param height Height of the image + /// \param pixels Array of pixels to copy to the image + /// + //////////////////////////////////////////////////////////// + void create(unsigned int width, unsigned int height, const Uint8* pixels); + + //////////////////////////////////////////////////////////// + /// \brief Load the image from a file on disk + /// + /// The supported image formats are bmp, png, tga, jpg, gif, + /// psd, hdr and pic. Some format options are not supported, + /// like progressive jpeg. + /// If this function fails, the image is left unchanged. + /// + /// \param filename Path of the image file to load + /// + /// \return True if loading was successful + /// + /// \see loadFromMemory, loadFromStream, saveToFile + /// + //////////////////////////////////////////////////////////// + bool loadFromFile(const std::string& filename); + + //////////////////////////////////////////////////////////// + /// \brief Load the image from a file in memory + /// + /// The supported image formats are bmp, png, tga, jpg, gif, + /// psd, hdr and pic. Some format options are not supported, + /// like progressive jpeg. + /// If this function fails, the image is left unchanged. + /// + /// \param data Pointer to the file data in memory + /// \param size Size of the data to load, in bytes + /// + /// \return True if loading was successful + /// + /// \see loadFromFile, loadFromStream + /// + //////////////////////////////////////////////////////////// + bool loadFromMemory(const void* data, std::size_t size); + + //////////////////////////////////////////////////////////// + /// \brief Load the image from a custom stream + /// + /// The supported image formats are bmp, png, tga, jpg, gif, + /// psd, hdr and pic. Some format options are not supported, + /// like progressive jpeg. + /// If this function fails, the image is left unchanged. + /// + /// \param stream Source stream to read from + /// + /// \return True if loading was successful + /// + /// \see loadFromFile, loadFromMemory + /// + //////////////////////////////////////////////////////////// + bool loadFromStream(InputStream& stream); + + //////////////////////////////////////////////////////////// + /// \brief Save the image to a file on disk + /// + /// The format of the image is automatically deduced from + /// the extension. The supported image formats are bmp, png, + /// tga and jpg. The destination file is overwritten + /// if it already exists. This function fails if the image is empty. + /// + /// \param filename Path of the file to save + /// + /// \return True if saving was successful + /// + /// \see create, loadFromFile, loadFromMemory + /// + //////////////////////////////////////////////////////////// + bool saveToFile(const std::string& filename) const; + + //////////////////////////////////////////////////////////// + /// \brief Return the size (width and height) of the image + /// + /// \return Size of the image, in pixels + /// + //////////////////////////////////////////////////////////// + Vector2u getSize() const; + + //////////////////////////////////////////////////////////// + /// \brief Create a transparency mask from a specified color-key + /// + /// This function sets the alpha value of every pixel matching + /// the given color to \a alpha (0 by default), so that they + /// become transparent. + /// + /// \param color Color to make transparent + /// \param alpha Alpha value to assign to transparent pixels + /// + //////////////////////////////////////////////////////////// + void createMaskFromColor(const Color& color, Uint8 alpha = 0); + + //////////////////////////////////////////////////////////// + /// \brief Copy pixels from another image onto this one + /// + /// This function does a slow pixel copy and should not be + /// used intensively. It can be used to prepare a complex + /// static image from several others, but if you need this + /// kind of feature in real-time you'd better use sf::RenderTexture. + /// + /// If \a sourceRect is empty, the whole image is copied. + /// If \a applyAlpha is set to true, the transparency of + /// source pixels is applied. If it is false, the pixels are + /// copied unchanged with their alpha value. + /// + /// \param source Source image to copy + /// \param destX X coordinate of the destination position + /// \param destY Y coordinate of the destination position + /// \param sourceRect Sub-rectangle of the source image to copy + /// \param applyAlpha Should the copy take into account the source transparency? + /// + //////////////////////////////////////////////////////////// + void copy(const Image& source, unsigned int destX, unsigned int destY, const IntRect& sourceRect = IntRect(0, 0, 0, 0), bool applyAlpha = false); + + //////////////////////////////////////////////////////////// + /// \brief Change the color of a pixel + /// + /// This function doesn't check the validity of the pixel + /// coordinates, using out-of-range values will result in + /// an undefined behavior. + /// + /// \param x X coordinate of pixel to change + /// \param y Y coordinate of pixel to change + /// \param color New color of the pixel + /// + /// \see getPixel + /// + //////////////////////////////////////////////////////////// + void setPixel(unsigned int x, unsigned int y, const Color& color); + + //////////////////////////////////////////////////////////// + /// \brief Get the color of a pixel + /// + /// This function doesn't check the validity of the pixel + /// coordinates, using out-of-range values will result in + /// an undefined behavior. + /// + /// \param x X coordinate of pixel to get + /// \param y Y coordinate of pixel to get + /// + /// \return Color of the pixel at coordinates (x, y) + /// + /// \see setPixel + /// + //////////////////////////////////////////////////////////// + Color getPixel(unsigned int x, unsigned int y) const; + + //////////////////////////////////////////////////////////// + /// \brief Get a read-only pointer to the array of pixels + /// + /// The returned value points to an array of RGBA pixels made of + /// 8 bits integers components. The size of the array is + /// width * height * 4 (getSize().x * getSize().y * 4). + /// Warning: the returned pointer may become invalid if you + /// modify the image, so you should never store it for too long. + /// If the image is empty, a null pointer is returned. + /// + /// \return Read-only pointer to the array of pixels + /// + //////////////////////////////////////////////////////////// + const Uint8* getPixelsPtr() const; + + //////////////////////////////////////////////////////////// + /// \brief Flip the image horizontally (left <-> right) + /// + //////////////////////////////////////////////////////////// + void flipHorizontally(); + + //////////////////////////////////////////////////////////// + /// \brief Flip the image vertically (top <-> bottom) + /// + //////////////////////////////////////////////////////////// + void flipVertically(); + +private: + + //////////////////////////////////////////////////////////// + // Member data + //////////////////////////////////////////////////////////// + Vector2u m_size; ///< Image size + std::vector m_pixels; ///< Pixels of the image + #ifdef SFML_SYSTEM_ANDROID + void* m_stream; ///< Asset file streamer (if loaded from file) + #endif +}; + +} // namespace sf + + +#endif // SFML_IMAGE_HPP + + +//////////////////////////////////////////////////////////// +/// \class sf::Image +/// \ingroup graphics +/// +/// sf::Image is an abstraction to manipulate images +/// as bidimensional arrays of pixels. The class provides +/// functions to load, read, write and save pixels, as well +/// as many other useful functions. +/// +/// sf::Image can handle a unique internal representation of +/// pixels, which is RGBA 32 bits. This means that a pixel +/// must be composed of 8 bits red, green, blue and alpha +/// channels -- just like a sf::Color. +/// All the functions that return an array of pixels follow +/// this rule, and all parameters that you pass to sf::Image +/// functions (such as loadFromMemory) must use this +/// representation as well. +/// +/// A sf::Image can be copied, but it is a heavy resource and +/// if possible you should always use [const] references to +/// pass or return them to avoid useless copies. +/// +/// Usage example: +/// \code +/// // Load an image file from a file +/// sf::Image background; +/// if (!background.loadFromFile("background.jpg")) +/// return -1; +/// +/// // Create a 20x20 image filled with black color +/// sf::Image image; +/// image.create(20, 20, sf::Color::Black); +/// +/// // Copy image1 on image2 at position (10, 10) +/// image.copy(background, 10, 10); +/// +/// // Make the top-left pixel transparent +/// sf::Color color = image.getPixel(0, 0); +/// color.a = 0; +/// image.setPixel(0, 0, color); +/// +/// // Save the image to a file +/// if (!image.saveToFile("result.png")) +/// return -1; +/// \endcode +/// +/// \see sf::Texture +/// +//////////////////////////////////////////////////////////// diff --git a/mcclone/external/sfml23/include/SFML/Graphics/PrimitiveType.hpp b/mcclone/external/sfml23/include/SFML/Graphics/PrimitiveType.hpp new file mode 100644 index 0000000..9dae947 --- /dev/null +++ b/mcclone/external/sfml23/include/SFML/Graphics/PrimitiveType.hpp @@ -0,0 +1,53 @@ +//////////////////////////////////////////////////////////// +// +// SFML - Simple and Fast Multimedia Library +// Copyright (C) 2007-2015 Laurent Gomila (laurent@sfml-dev.org) +// +// This software is provided 'as-is', without any express or implied warranty. +// In no event will the authors be held liable for any damages arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it freely, +// subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; +// you must not claim that you wrote the original software. +// If you use this software in a product, an acknowledgment +// in the product documentation would be appreciated but is not required. +// +// 2. Altered source versions must be plainly marked as such, +// and must not be misrepresented as being the original software. +// +// 3. This notice may not be removed or altered from any source distribution. +// +//////////////////////////////////////////////////////////// + +#ifndef SFML_PRIMITIVETYPE_HPP +#define SFML_PRIMITIVETYPE_HPP + +namespace sf +{ +//////////////////////////////////////////////////////////// +/// \ingroup graphics +/// \brief Types of primitives that a sf::VertexArray can render +/// +/// Points and lines have no area, therefore their thickness +/// will always be 1 pixel, regardless the current transform +/// and view. +/// +//////////////////////////////////////////////////////////// +enum PrimitiveType +{ + Points, ///< List of individual points + Lines, ///< List of individual lines + LinesStrip, ///< List of connected lines, a point uses the previous point to form a line + Triangles, ///< List of individual triangles + TrianglesStrip, ///< List of connected triangles, a point uses the two previous points to form a triangle + TrianglesFan, ///< List of connected triangles, a point uses the common center and the previous point to form a triangle + Quads ///< List of individual quads (deprecated, don't work with OpenGL ES) +}; + +} // namespace sf + + +#endif // SFML_PRIMITIVETYPE_HPP diff --git a/mcclone/external/sfml23/include/SFML/Graphics/Rect.hpp b/mcclone/external/sfml23/include/SFML/Graphics/Rect.hpp new file mode 100644 index 0000000..f11a920 --- /dev/null +++ b/mcclone/external/sfml23/include/SFML/Graphics/Rect.hpp @@ -0,0 +1,248 @@ +//////////////////////////////////////////////////////////// +// +// SFML - Simple and Fast Multimedia Library +// Copyright (C) 2007-2015 Laurent Gomila (laurent@sfml-dev.org) +// +// This software is provided 'as-is', without any express or implied warranty. +// In no event will the authors be held liable for any damages arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it freely, +// subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; +// you must not claim that you wrote the original software. +// If you use this software in a product, an acknowledgment +// in the product documentation would be appreciated but is not required. +// +// 2. Altered source versions must be plainly marked as such, +// and must not be misrepresented as being the original software. +// +// 3. This notice may not be removed or altered from any source distribution. +// +//////////////////////////////////////////////////////////// + +#ifndef SFML_RECT_HPP +#define SFML_RECT_HPP + +//////////////////////////////////////////////////////////// +// Headers +//////////////////////////////////////////////////////////// +#include +#include + + +namespace sf +{ +//////////////////////////////////////////////////////////// +/// \brief Utility class for manipulating 2D axis aligned rectangles +/// +//////////////////////////////////////////////////////////// +template +class Rect +{ +public: + + //////////////////////////////////////////////////////////// + /// \brief Default constructor + /// + /// Creates an empty rectangle (it is equivalent to calling + /// Rect(0, 0, 0, 0)). + /// + //////////////////////////////////////////////////////////// + Rect(); + + //////////////////////////////////////////////////////////// + /// \brief Construct the rectangle from its coordinates + /// + /// Be careful, the last two parameters are the width + /// and height, not the right and bottom coordinates! + /// + /// \param rectLeft Left coordinate of the rectangle + /// \param rectTop Top coordinate of the rectangle + /// \param rectWidth Width of the rectangle + /// \param rectHeight Height of the rectangle + /// + //////////////////////////////////////////////////////////// + Rect(T rectLeft, T rectTop, T rectWidth, T rectHeight); + + //////////////////////////////////////////////////////////// + /// \brief Construct the rectangle from position and size + /// + /// Be careful, the last parameter is the size, + /// not the bottom-right corner! + /// + /// \param position Position of the top-left corner of the rectangle + /// \param size Size of the rectangle + /// + //////////////////////////////////////////////////////////// + Rect(const Vector2& position, const Vector2& size); + + //////////////////////////////////////////////////////////// + /// \brief Construct the rectangle from another type of rectangle + /// + /// This constructor doesn't replace the copy constructor, + /// it's called only when U != T. + /// A call to this constructor will fail to compile if U + /// is not convertible to T. + /// + /// \param rectangle Rectangle to convert + /// + //////////////////////////////////////////////////////////// + template + explicit Rect(const Rect& rectangle); + + //////////////////////////////////////////////////////////// + /// \brief Check if a point is inside the rectangle's area + /// + /// \param x X coordinate of the point to test + /// \param y Y coordinate of the point to test + /// + /// \return True if the point is inside, false otherwise + /// + /// \see intersects + /// + //////////////////////////////////////////////////////////// + bool contains(T x, T y) const; + + //////////////////////////////////////////////////////////// + /// \brief Check if a point is inside the rectangle's area + /// + /// \param point Point to test + /// + /// \return True if the point is inside, false otherwise + /// + /// \see intersects + /// + //////////////////////////////////////////////////////////// + bool contains(const Vector2& point) const; + + //////////////////////////////////////////////////////////// + /// \brief Check the intersection between two rectangles + /// + /// \param rectangle Rectangle to test + /// + /// \return True if rectangles overlap, false otherwise + /// + /// \see contains + /// + //////////////////////////////////////////////////////////// + bool intersects(const Rect& rectangle) const; + + //////////////////////////////////////////////////////////// + /// \brief Check the intersection between two rectangles + /// + /// This overload returns the overlapped rectangle in the + /// \a intersection parameter. + /// + /// \param rectangle Rectangle to test + /// \param intersection Rectangle to be filled with the intersection + /// + /// \return True if rectangles overlap, false otherwise + /// + /// \see contains + /// + //////////////////////////////////////////////////////////// + bool intersects(const Rect& rectangle, Rect& intersection) const; + + //////////////////////////////////////////////////////////// + // Member data + //////////////////////////////////////////////////////////// + T left; ///< Left coordinate of the rectangle + T top; ///< Top coordinate of the rectangle + T width; ///< Width of the rectangle + T height; ///< Height of the rectangle +}; + +//////////////////////////////////////////////////////////// +/// \relates Rect +/// \brief Overload of binary operator == +/// +/// This operator compares strict equality between two rectangles. +/// +/// \param left Left operand (a rectangle) +/// \param right Right operand (a rectangle) +/// +/// \return True if \a left is equal to \a right +/// +//////////////////////////////////////////////////////////// +template +bool operator ==(const Rect& left, const Rect& right); + +//////////////////////////////////////////////////////////// +/// \relates Rect +/// \brief Overload of binary operator != +/// +/// This operator compares strict difference between two rectangles. +/// +/// \param left Left operand (a rectangle) +/// \param right Right operand (a rectangle) +/// +/// \return True if \a left is not equal to \a right +/// +//////////////////////////////////////////////////////////// +template +bool operator !=(const Rect& left, const Rect& right); + +#include + +// Create typedefs for the most common types +typedef Rect IntRect; +typedef Rect FloatRect; + +} // namespace sf + + +#endif // SFML_RECT_HPP + + +//////////////////////////////////////////////////////////// +/// \class sf::Rect +/// \ingroup graphics +/// +/// A rectangle is defined by its top-left corner and its size. +/// It is a very simple class defined for convenience, so +/// its member variables (left, top, width and height) are public +/// and can be accessed directly, just like the vector classes +/// (Vector2 and Vector3). +/// +/// To keep things simple, sf::Rect doesn't define +/// functions to emulate the properties that are not directly +/// members (such as right, bottom, center, etc.), it rather +/// only provides intersection functions. +/// +/// sf::Rect uses the usual rules for its boundaries: +/// \li The left and top edges are included in the rectangle's area +/// \li The right (left + width) and bottom (top + height) edges are excluded from the rectangle's area +/// +/// This means that sf::IntRect(0, 0, 1, 1) and sf::IntRect(1, 1, 1, 1) +/// don't intersect. +/// +/// sf::Rect is a template and may be used with any numeric type, but +/// for simplicity the instantiations used by SFML are typedef'd: +/// \li sf::Rect is sf::IntRect +/// \li sf::Rect is sf::FloatRect +/// +/// So that you don't have to care about the template syntax. +/// +/// Usage example: +/// \code +/// // Define a rectangle, located at (0, 0) with a size of 20x5 +/// sf::IntRect r1(0, 0, 20, 5); +/// +/// // Define another rectangle, located at (4, 2) with a size of 18x10 +/// sf::Vector2i position(4, 2); +/// sf::Vector2i size(18, 10); +/// sf::IntRect r2(position, size); +/// +/// // Test intersections with the point (3, 1) +/// bool b1 = r1.contains(3, 1); // true +/// bool b2 = r2.contains(3, 1); // false +/// +/// // Test the intersection between r1 and r2 +/// sf::IntRect result; +/// bool b3 = r1.intersects(r2, result); // true +/// // result == (4, 2, 16, 3) +/// \endcode +/// +//////////////////////////////////////////////////////////// diff --git a/mcclone/external/sfml23/include/SFML/Graphics/Rect.inl b/mcclone/external/sfml23/include/SFML/Graphics/Rect.inl new file mode 100644 index 0000000..9ac4870 --- /dev/null +++ b/mcclone/external/sfml23/include/SFML/Graphics/Rect.inl @@ -0,0 +1,159 @@ +//////////////////////////////////////////////////////////// +// +// SFML - Simple and Fast Multimedia Library +// Copyright (C) 2007-2015 Laurent Gomila (laurent@sfml-dev.org) +// +// This software is provided 'as-is', without any express or implied warranty. +// In no event will the authors be held liable for any damages arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it freely, +// subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; +// you must not claim that you wrote the original software. +// If you use this software in a product, an acknowledgment +// in the product documentation would be appreciated but is not required. +// +// 2. Altered source versions must be plainly marked as such, +// and must not be misrepresented as being the original software. +// +// 3. This notice may not be removed or altered from any source distribution. +// +//////////////////////////////////////////////////////////// + + +//////////////////////////////////////////////////////////// +template +Rect::Rect() : +left (0), +top (0), +width (0), +height(0) +{ + +} + + +//////////////////////////////////////////////////////////// +template +Rect::Rect(T rectLeft, T rectTop, T rectWidth, T rectHeight) : +left (rectLeft), +top (rectTop), +width (rectWidth), +height(rectHeight) +{ + +} + + +//////////////////////////////////////////////////////////// +template +Rect::Rect(const Vector2& position, const Vector2& size) : +left (position.x), +top (position.y), +width (size.x), +height(size.y) +{ + +} + + +//////////////////////////////////////////////////////////// +template +template +Rect::Rect(const Rect& rectangle) : +left (static_cast(rectangle.left)), +top (static_cast(rectangle.top)), +width (static_cast(rectangle.width)), +height(static_cast(rectangle.height)) +{ +} + + +//////////////////////////////////////////////////////////// +template +bool Rect::contains(T x, T y) const +{ + // Rectangles with negative dimensions are allowed, so we must handle them correctly + + // Compute the real min and max of the rectangle on both axes + T minX = std::min(left, static_cast(left + width)); + T maxX = std::max(left, static_cast(left + width)); + T minY = std::min(top, static_cast(top + height)); + T maxY = std::max(top, static_cast(top + height)); + + return (x >= minX) && (x < maxX) && (y >= minY) && (y < maxY); +} + + +//////////////////////////////////////////////////////////// +template +bool Rect::contains(const Vector2& point) const +{ + return contains(point.x, point.y); +} + + +//////////////////////////////////////////////////////////// +template +bool Rect::intersects(const Rect& rectangle) const +{ + Rect intersection; + return intersects(rectangle, intersection); +} + + +//////////////////////////////////////////////////////////// +template +bool Rect::intersects(const Rect& rectangle, Rect& intersection) const +{ + // Rectangles with negative dimensions are allowed, so we must handle them correctly + + // Compute the min and max of the first rectangle on both axes + T r1MinX = std::min(left, static_cast(left + width)); + T r1MaxX = std::max(left, static_cast(left + width)); + T r1MinY = std::min(top, static_cast(top + height)); + T r1MaxY = std::max(top, static_cast(top + height)); + + // Compute the min and max of the second rectangle on both axes + T r2MinX = std::min(rectangle.left, static_cast(rectangle.left + rectangle.width)); + T r2MaxX = std::max(rectangle.left, static_cast(rectangle.left + rectangle.width)); + T r2MinY = std::min(rectangle.top, static_cast(rectangle.top + rectangle.height)); + T r2MaxY = std::max(rectangle.top, static_cast(rectangle.top + rectangle.height)); + + // Compute the intersection boundaries + T interLeft = std::max(r1MinX, r2MinX); + T interTop = std::max(r1MinY, r2MinY); + T interRight = std::min(r1MaxX, r2MaxX); + T interBottom = std::min(r1MaxY, r2MaxY); + + // If the intersection is valid (positive non zero area), then there is an intersection + if ((interLeft < interRight) && (interTop < interBottom)) + { + intersection = Rect(interLeft, interTop, interRight - interLeft, interBottom - interTop); + return true; + } + else + { + intersection = Rect(0, 0, 0, 0); + return false; + } +} + + +//////////////////////////////////////////////////////////// +template +inline bool operator ==(const Rect& left, const Rect& right) +{ + return (left.left == right.left) && (left.width == right.width) && + (left.top == right.top) && (left.height == right.height); +} + + +//////////////////////////////////////////////////////////// +template +inline bool operator !=(const Rect& left, const Rect& right) +{ + return !(left == right); +} diff --git a/mcclone/external/sfml23/include/SFML/Graphics/RectangleShape.hpp b/mcclone/external/sfml23/include/SFML/Graphics/RectangleShape.hpp new file mode 100644 index 0000000..3195dc3 --- /dev/null +++ b/mcclone/external/sfml23/include/SFML/Graphics/RectangleShape.hpp @@ -0,0 +1,132 @@ +//////////////////////////////////////////////////////////// +// +// SFML - Simple and Fast Multimedia Library +// Copyright (C) 2007-2015 Laurent Gomila (laurent@sfml-dev.org) +// +// This software is provided 'as-is', without any express or implied warranty. +// In no event will the authors be held liable for any damages arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it freely, +// subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; +// you must not claim that you wrote the original software. +// If you use this software in a product, an acknowledgment +// in the product documentation would be appreciated but is not required. +// +// 2. Altered source versions must be plainly marked as such, +// and must not be misrepresented as being the original software. +// +// 3. This notice may not be removed or altered from any source distribution. +// +//////////////////////////////////////////////////////////// + +#ifndef SFML_RECTANGLESHAPE_HPP +#define SFML_RECTANGLESHAPE_HPP + +//////////////////////////////////////////////////////////// +// Headers +//////////////////////////////////////////////////////////// +#include +#include + + +namespace sf +{ +//////////////////////////////////////////////////////////// +/// \brief Specialized shape representing a rectangle +/// +//////////////////////////////////////////////////////////// +class SFML_GRAPHICS_API RectangleShape : public Shape +{ +public: + + //////////////////////////////////////////////////////////// + /// \brief Default constructor + /// + /// \param size Size of the rectangle + /// + //////////////////////////////////////////////////////////// + explicit RectangleShape(const Vector2f& size = Vector2f(0, 0)); + + //////////////////////////////////////////////////////////// + /// \brief Set the size of the rectangle + /// + /// \param size New size of the rectangle + /// + /// \see getSize + /// + //////////////////////////////////////////////////////////// + void setSize(const Vector2f& size); + + //////////////////////////////////////////////////////////// + /// \brief Get the size of the rectangle + /// + /// \return Size of the rectangle + /// + /// \see setSize + /// + //////////////////////////////////////////////////////////// + const Vector2f& getSize() const; + + //////////////////////////////////////////////////////////// + /// \brief Get the number of points defining the shape + /// + /// \return Number of points of the shape. For rectangle + /// shapes, this number is always 4. + /// + //////////////////////////////////////////////////////////// + virtual std::size_t getPointCount() const; + + //////////////////////////////////////////////////////////// + /// \brief Get a point of the rectangle + /// + /// The returned point is in local coordinates, that is, + /// the shape's transforms (position, rotation, scale) are + /// not taken into account. + /// The result is undefined if \a index is out of the valid range. + /// + /// \param index Index of the point to get, in range [0 .. 3] + /// + /// \return index-th point of the shape + /// + //////////////////////////////////////////////////////////// + virtual Vector2f getPoint(std::size_t index) const; + +private: + + //////////////////////////////////////////////////////////// + // Member data + //////////////////////////////////////////////////////////// + Vector2f m_size; ///< Size of the rectangle +}; + +} // namespace sf + + +#endif // SFML_RECTANGLESHAPE_HPP + + +//////////////////////////////////////////////////////////// +/// \class sf::RectangleShape +/// \ingroup graphics +/// +/// This class inherits all the functions of sf::Transformable +/// (position, rotation, scale, bounds, ...) as well as the +/// functions of sf::Shape (outline, color, texture, ...). +/// +/// Usage example: +/// \code +/// sf::RectangleShape rectangle; +/// rectangle.setSize(sf::Vector2f(100, 50)); +/// rectangle.setOutlineColor(sf::Color::Red); +/// rectangle.setOutlineThickness(5); +/// rectangle.setPosition(10, 20); +/// ... +/// window.draw(rectangle); +/// \endcode +/// +/// \see sf::Shape, sf::CircleShape, sf::ConvexShape +/// +//////////////////////////////////////////////////////////// diff --git a/mcclone/external/sfml23/include/SFML/Graphics/RenderStates.hpp b/mcclone/external/sfml23/include/SFML/Graphics/RenderStates.hpp new file mode 100644 index 0000000..3ab3271 --- /dev/null +++ b/mcclone/external/sfml23/include/SFML/Graphics/RenderStates.hpp @@ -0,0 +1,174 @@ +//////////////////////////////////////////////////////////// +// +// SFML - Simple and Fast Multimedia Library +// Copyright (C) 2007-2015 Laurent Gomila (laurent@sfml-dev.org) +// +// This software is provided 'as-is', without any express or implied warranty. +// In no event will the authors be held liable for any damages arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it freely, +// subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; +// you must not claim that you wrote the original software. +// If you use this software in a product, an acknowledgment +// in the product documentation would be appreciated but is not required. +// +// 2. Altered source versions must be plainly marked as such, +// and must not be misrepresented as being the original software. +// +// 3. This notice may not be removed or altered from any source distribution. +// +//////////////////////////////////////////////////////////// + +#ifndef SFML_RENDERSTATES_HPP +#define SFML_RENDERSTATES_HPP + +//////////////////////////////////////////////////////////// +// Headers +//////////////////////////////////////////////////////////// +#include +#include +#include + + +namespace sf +{ +class Shader; +class Texture; + +//////////////////////////////////////////////////////////// +/// \brief Define the states used for drawing to a RenderTarget +/// +//////////////////////////////////////////////////////////// +class SFML_GRAPHICS_API RenderStates +{ +public: + + //////////////////////////////////////////////////////////// + /// \brief Default constructor + /// + /// Constructing a default set of render states is equivalent + /// to using sf::RenderStates::Default. + /// The default set defines: + /// \li the BlendAlpha blend mode + /// \li the identity transform + /// \li a null texture + /// \li a null shader + /// + //////////////////////////////////////////////////////////// + RenderStates(); + + //////////////////////////////////////////////////////////// + /// \brief Construct a default set of render states with a custom blend mode + /// + /// \param theBlendMode Blend mode to use + /// + //////////////////////////////////////////////////////////// + RenderStates(const BlendMode& theBlendMode); + + //////////////////////////////////////////////////////////// + /// \brief Construct a default set of render states with a custom transform + /// + /// \param theTransform Transform to use + /// + //////////////////////////////////////////////////////////// + RenderStates(const Transform& theTransform); + + //////////////////////////////////////////////////////////// + /// \brief Construct a default set of render states with a custom texture + /// + /// \param theTexture Texture to use + /// + //////////////////////////////////////////////////////////// + RenderStates(const Texture* theTexture); + + //////////////////////////////////////////////////////////// + /// \brief Construct a default set of render states with a custom shader + /// + /// \param theShader Shader to use + /// + //////////////////////////////////////////////////////////// + RenderStates(const Shader* theShader); + + //////////////////////////////////////////////////////////// + /// \brief Construct a set of render states with all its attributes + /// + /// \param theBlendMode Blend mode to use + /// \param theTransform Transform to use + /// \param theTexture Texture to use + /// \param theShader Shader to use + /// + //////////////////////////////////////////////////////////// + RenderStates(const BlendMode& theBlendMode, const Transform& theTransform, + const Texture* theTexture, const Shader* theShader); + + //////////////////////////////////////////////////////////// + // Static member data + //////////////////////////////////////////////////////////// + static const RenderStates Default; ///< Special instance holding the default render states + + //////////////////////////////////////////////////////////// + // Member data + //////////////////////////////////////////////////////////// + BlendMode blendMode; ///< Blending mode + Transform transform; ///< Transform + const Texture* texture; ///< Texture + const Shader* shader; ///< Shader +}; + +} // namespace sf + + +#endif // SFML_RENDERSTATES_HPP + + +//////////////////////////////////////////////////////////// +/// \class sf::RenderStates +/// \ingroup graphics +/// +/// There are four global states that can be applied to +/// the drawn objects: +/// \li the blend mode: how pixels of the object are blended with the background +/// \li the transform: how the object is positioned/rotated/scaled +/// \li the texture: what image is mapped to the object +/// \li the shader: what custom effect is applied to the object +/// +/// High-level objects such as sprites or text force some of +/// these states when they are drawn. For example, a sprite +/// will set its own texture, so that you don't have to care +/// about it when drawing the sprite. +/// +/// The transform is a special case: sprites, texts and shapes +/// (and it's a good idea to do it with your own drawable classes +/// too) combine their transform with the one that is passed in the +/// RenderStates structure. So that you can use a "global" transform +/// on top of each object's transform. +/// +/// Most objects, especially high-level drawables, can be drawn +/// directly without defining render states explicitly -- the +/// default set of states is ok in most cases. +/// \code +/// window.draw(sprite); +/// \endcode +/// +/// If you want to use a single specific render state, +/// for example a shader, you can pass it directly to the Draw +/// function: sf::RenderStates has an implicit one-argument +/// constructor for each state. +/// \code +/// window.draw(sprite, shader); +/// \endcode +/// +/// When you're inside the Draw function of a drawable +/// object (inherited from sf::Drawable), you can +/// either pass the render states unmodified, or change +/// some of them. +/// For example, a transformable object will combine the +/// current transform with its own transform. A sprite will +/// set its texture. Etc. +/// +/// \see sf::RenderTarget, sf::Drawable +/// +//////////////////////////////////////////////////////////// diff --git a/mcclone/external/sfml23/include/SFML/Graphics/RenderTarget.hpp b/mcclone/external/sfml23/include/SFML/Graphics/RenderTarget.hpp new file mode 100644 index 0000000..eb02355 --- /dev/null +++ b/mcclone/external/sfml23/include/SFML/Graphics/RenderTarget.hpp @@ -0,0 +1,451 @@ +//////////////////////////////////////////////////////////// +// +// SFML - Simple and Fast Multimedia Library +// Copyright (C) 2007-2015 Laurent Gomila (laurent@sfml-dev.org) +// +// This software is provided 'as-is', without any express or implied warranty. +// In no event will the authors be held liable for any damages arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it freely, +// subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; +// you must not claim that you wrote the original software. +// If you use this software in a product, an acknowledgment +// in the product documentation would be appreciated but is not required. +// +// 2. Altered source versions must be plainly marked as such, +// and must not be misrepresented as being the original software. +// +// 3. This notice may not be removed or altered from any source distribution. +// +//////////////////////////////////////////////////////////// + +#ifndef SFML_RENDERTARGET_HPP +#define SFML_RENDERTARGET_HPP + +//////////////////////////////////////////////////////////// +// Headers +//////////////////////////////////////////////////////////// +#include +#include +#include +#include +#include +#include +#include +#include +#include +#include + + +namespace sf +{ +class Drawable; + +//////////////////////////////////////////////////////////// +/// \brief Base class for all render targets (window, texture, ...) +/// +//////////////////////////////////////////////////////////// +class SFML_GRAPHICS_API RenderTarget : NonCopyable +{ +public: + + //////////////////////////////////////////////////////////// + /// \brief Destructor + /// + //////////////////////////////////////////////////////////// + virtual ~RenderTarget(); + + //////////////////////////////////////////////////////////// + /// \brief Clear the entire target with a single color + /// + /// This function is usually called once every frame, + /// to clear the previous contents of the target. + /// + /// \param color Fill color to use to clear the render target + /// + //////////////////////////////////////////////////////////// + void clear(const Color& color = Color(0, 0, 0, 255)); + + //////////////////////////////////////////////////////////// + /// \brief Change the current active view + /// + /// The view is like a 2D camera, it controls which part of + /// the 2D scene is visible, and how it is viewed in the + /// render target. + /// The new view will affect everything that is drawn, until + /// another view is set. + /// The render target keeps its own copy of the view object, + /// so it is not necessary to keep the original one alive + /// after calling this function. + /// To restore the original view of the target, you can pass + /// the result of getDefaultView() to this function. + /// + /// \param view New view to use + /// + /// \see getView, getDefaultView + /// + //////////////////////////////////////////////////////////// + void setView(const View& view); + + //////////////////////////////////////////////////////////// + /// \brief Get the view currently in use in the render target + /// + /// \return The view object that is currently used + /// + /// \see setView, getDefaultView + /// + //////////////////////////////////////////////////////////// + const View& getView() const; + + //////////////////////////////////////////////////////////// + /// \brief Get the default view of the render target + /// + /// The default view has the initial size of the render target, + /// and never changes after the target has been created. + /// + /// \return The default view of the render target + /// + /// \see setView, getView + /// + //////////////////////////////////////////////////////////// + const View& getDefaultView() const; + + //////////////////////////////////////////////////////////// + /// \brief Get the viewport of a view, applied to this render target + /// + /// The viewport is defined in the view as a ratio, this function + /// simply applies this ratio to the current dimensions of the + /// render target to calculate the pixels rectangle that the viewport + /// actually covers in the target. + /// + /// \param view The view for which we want to compute the viewport + /// + /// \return Viewport rectangle, expressed in pixels + /// + //////////////////////////////////////////////////////////// + IntRect getViewport(const View& view) const; + + //////////////////////////////////////////////////////////// + /// \brief Convert a point from target coordinates to world + /// coordinates, using the current view + /// + /// This function is an overload of the mapPixelToCoords + /// function that implicitly uses the current view. + /// It is equivalent to: + /// \code + /// target.mapPixelToCoords(point, target.getView()); + /// \endcode + /// + /// \param point Pixel to convert + /// + /// \return The converted point, in "world" coordinates + /// + /// \see mapCoordsToPixel + /// + //////////////////////////////////////////////////////////// + Vector2f mapPixelToCoords(const Vector2i& point) const; + + //////////////////////////////////////////////////////////// + /// \brief Convert a point from target coordinates to world coordinates + /// + /// This function finds the 2D position that matches the + /// given pixel of the render target. In other words, it does + /// the inverse of what the graphics card does, to find the + /// initial position of a rendered pixel. + /// + /// Initially, both coordinate systems (world units and target pixels) + /// match perfectly. But if you define a custom view or resize your + /// render target, this assertion is not true anymore, i.e. a point + /// located at (10, 50) in your render target may map to the point + /// (150, 75) in your 2D world -- if the view is translated by (140, 25). + /// + /// For render-windows, this function is typically used to find + /// which point (or object) is located below the mouse cursor. + /// + /// This version uses a custom view for calculations, see the other + /// overload of the function if you want to use the current view of the + /// render target. + /// + /// \param point Pixel to convert + /// \param view The view to use for converting the point + /// + /// \return The converted point, in "world" units + /// + /// \see mapCoordsToPixel + /// + //////////////////////////////////////////////////////////// + Vector2f mapPixelToCoords(const Vector2i& point, const View& view) const; + + //////////////////////////////////////////////////////////// + /// \brief Convert a point from world coordinates to target + /// coordinates, using the current view + /// + /// This function is an overload of the mapCoordsToPixel + /// function that implicitly uses the current view. + /// It is equivalent to: + /// \code + /// target.mapCoordsToPixel(point, target.getView()); + /// \endcode + /// + /// \param point Point to convert + /// + /// \return The converted point, in target coordinates (pixels) + /// + /// \see mapPixelToCoords + /// + //////////////////////////////////////////////////////////// + Vector2i mapCoordsToPixel(const Vector2f& point) const; + + //////////////////////////////////////////////////////////// + /// \brief Convert a point from world coordinates to target coordinates + /// + /// This function finds the pixel of the render target that matches + /// the given 2D point. In other words, it goes through the same process + /// as the graphics card, to compute the final position of a rendered point. + /// + /// Initially, both coordinate systems (world units and target pixels) + /// match perfectly. But if you define a custom view or resize your + /// render target, this assertion is not true anymore, i.e. a point + /// located at (150, 75) in your 2D world may map to the pixel + /// (10, 50) of your render target -- if the view is translated by (140, 25). + /// + /// This version uses a custom view for calculations, see the other + /// overload of the function if you want to use the current view of the + /// render target. + /// + /// \param point Point to convert + /// \param view The view to use for converting the point + /// + /// \return The converted point, in target coordinates (pixels) + /// + /// \see mapPixelToCoords + /// + //////////////////////////////////////////////////////////// + Vector2i mapCoordsToPixel(const Vector2f& point, const View& view) const; + + //////////////////////////////////////////////////////////// + /// \brief Draw a drawable object to the render target + /// + /// \param drawable Object to draw + /// \param states Render states to use for drawing + /// + //////////////////////////////////////////////////////////// + void draw(const Drawable& drawable, const RenderStates& states = RenderStates::Default); + + //////////////////////////////////////////////////////////// + /// \brief Draw primitives defined by an array of vertices + /// + /// \param vertices Pointer to the vertices + /// \param vertexCount Number of vertices in the array + /// \param type Type of primitives to draw + /// \param states Render states to use for drawing + /// + //////////////////////////////////////////////////////////// + void draw(const Vertex* vertices, std::size_t vertexCount, + PrimitiveType type, const RenderStates& states = RenderStates::Default); + + //////////////////////////////////////////////////////////// + /// \brief Return the size of the rendering region of the target + /// + /// \return Size in pixels + /// + //////////////////////////////////////////////////////////// + virtual Vector2u getSize() const = 0; + + //////////////////////////////////////////////////////////// + /// \brief Save the current OpenGL render states and matrices + /// + /// This function can be used when you mix SFML drawing + /// and direct OpenGL rendering. Combined with popGLStates, + /// it ensures that: + /// \li SFML's internal states are not messed up by your OpenGL code + /// \li your OpenGL states are not modified by a call to a SFML function + /// + /// More specifically, it must be used around code that + /// calls Draw functions. Example: + /// \code + /// // OpenGL code here... + /// window.pushGLStates(); + /// window.draw(...); + /// window.draw(...); + /// window.popGLStates(); + /// // OpenGL code here... + /// \endcode + /// + /// Note that this function is quite expensive: it saves all the + /// possible OpenGL states and matrices, even the ones you + /// don't care about. Therefore it should be used wisely. + /// It is provided for convenience, but the best results will + /// be achieved if you handle OpenGL states yourself (because + /// you know which states have really changed, and need to be + /// saved and restored). Take a look at the resetGLStates + /// function if you do so. + /// + /// \see popGLStates + /// + //////////////////////////////////////////////////////////// + void pushGLStates(); + + //////////////////////////////////////////////////////////// + /// \brief Restore the previously saved OpenGL render states and matrices + /// + /// See the description of pushGLStates to get a detailed + /// description of these functions. + /// + /// \see pushGLStates + /// + //////////////////////////////////////////////////////////// + void popGLStates(); + + //////////////////////////////////////////////////////////// + /// \brief Reset the internal OpenGL states so that the target is ready for drawing + /// + /// This function can be used when you mix SFML drawing + /// and direct OpenGL rendering, if you choose not to use + /// pushGLStates/popGLStates. It makes sure that all OpenGL + /// states needed by SFML are set, so that subsequent draw() + /// calls will work as expected. + /// + /// Example: + /// \code + /// // OpenGL code here... + /// glPushAttrib(...); + /// window.resetGLStates(); + /// window.draw(...); + /// window.draw(...); + /// glPopAttrib(...); + /// // OpenGL code here... + /// \endcode + /// + //////////////////////////////////////////////////////////// + void resetGLStates(); + +protected: + + //////////////////////////////////////////////////////////// + /// \brief Default constructor + /// + //////////////////////////////////////////////////////////// + RenderTarget(); + + //////////////////////////////////////////////////////////// + /// \brief Performs the common initialization step after creation + /// + /// The derived classes must call this function after the + /// target is created and ready for drawing. + /// + //////////////////////////////////////////////////////////// + void initialize(); + +private: + + //////////////////////////////////////////////////////////// + /// \brief Apply the current view + /// + //////////////////////////////////////////////////////////// + void applyCurrentView(); + + //////////////////////////////////////////////////////////// + /// \brief Apply a new blending mode + /// + /// \param mode Blending mode to apply + /// + //////////////////////////////////////////////////////////// + void applyBlendMode(const BlendMode& mode); + + //////////////////////////////////////////////////////////// + /// \brief Apply a new transform + /// + /// \param transform Transform to apply + /// + //////////////////////////////////////////////////////////// + void applyTransform(const Transform& transform); + + //////////////////////////////////////////////////////////// + /// \brief Apply a new texture + /// + /// \param texture Texture to apply + /// + //////////////////////////////////////////////////////////// + void applyTexture(const Texture* texture); + + //////////////////////////////////////////////////////////// + /// \brief Apply a new shader + /// + /// \param shader Shader to apply + /// + //////////////////////////////////////////////////////////// + void applyShader(const Shader* shader); + + //////////////////////////////////////////////////////////// + /// \brief Activate the target for rendering + /// + /// This function must be implemented by derived classes to make + /// their OpenGL context current; it is called by the base class + /// everytime it's going to use OpenGL calls. + /// + /// \param active True to make the target active, false to deactivate it + /// + /// \return True if the function succeeded + /// + //////////////////////////////////////////////////////////// + virtual bool activate(bool active) = 0; + + //////////////////////////////////////////////////////////// + /// \brief Render states cache + /// + //////////////////////////////////////////////////////////// + struct StatesCache + { + enum {VertexCacheSize = 4}; + + bool glStatesSet; ///< Are our internal GL states set yet? + bool viewChanged; ///< Has the current view changed since last draw? + BlendMode lastBlendMode; ///< Cached blending mode + Uint64 lastTextureId; ///< Cached texture + bool useVertexCache; ///< Did we previously use the vertex cache? + Vertex vertexCache[VertexCacheSize]; ///< Pre-transformed vertices cache + }; + + //////////////////////////////////////////////////////////// + // Member data + //////////////////////////////////////////////////////////// + View m_defaultView; ///< Default view + View m_view; ///< Current view + StatesCache m_cache; ///< Render states cache +}; + +} // namespace sf + + +#endif // SFML_RENDERTARGET_HPP + + +//////////////////////////////////////////////////////////// +/// \class sf::RenderTarget +/// \ingroup graphics +/// +/// sf::RenderTarget defines the common behavior of all the +/// 2D render targets usable in the graphics module. It makes +/// it possible to draw 2D entities like sprites, shapes, text +/// without using any OpenGL command directly. +/// +/// A sf::RenderTarget is also able to use views (sf::View), +/// which are a kind of 2D cameras. With views you can globally +/// scroll, rotate or zoom everything that is drawn, +/// without having to transform every single entity. See the +/// documentation of sf::View for more details and sample pieces of +/// code about this class. +/// +/// On top of that, render targets are still able to render direct +/// OpenGL stuff. It is even possible to mix together OpenGL calls +/// and regular SFML drawing commands. When doing so, make sure that +/// OpenGL states are not messed up by calling the +/// pushGLStates/popGLStates functions. +/// +/// \see sf::RenderWindow, sf::RenderTexture, sf::View +/// +//////////////////////////////////////////////////////////// diff --git a/mcclone/external/sfml23/include/SFML/Graphics/RenderTexture.hpp b/mcclone/external/sfml23/include/SFML/Graphics/RenderTexture.hpp new file mode 100644 index 0000000..5d38562 --- /dev/null +++ b/mcclone/external/sfml23/include/SFML/Graphics/RenderTexture.hpp @@ -0,0 +1,280 @@ +//////////////////////////////////////////////////////////// +// +// SFML - Simple and Fast Multimedia Library +// Copyright (C) 2007-2015 Laurent Gomila (laurent@sfml-dev.org) +// +// This software is provided 'as-is', without any express or implied warranty. +// In no event will the authors be held liable for any damages arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it freely, +// subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; +// you must not claim that you wrote the original software. +// If you use this software in a product, an acknowledgment +// in the product documentation would be appreciated but is not required. +// +// 2. Altered source versions must be plainly marked as such, +// and must not be misrepresented as being the original software. +// +// 3. This notice may not be removed or altered from any source distribution. +// +//////////////////////////////////////////////////////////// + +#ifndef SFML_RENDERTEXTURE_HPP +#define SFML_RENDERTEXTURE_HPP + +//////////////////////////////////////////////////////////// +// Headers +//////////////////////////////////////////////////////////// +#include +#include +#include + + +namespace sf +{ +namespace priv +{ + class RenderTextureImpl; +} + +//////////////////////////////////////////////////////////// +/// \brief Target for off-screen 2D rendering into a texture +/// +//////////////////////////////////////////////////////////// +class SFML_GRAPHICS_API RenderTexture : public RenderTarget +{ +public: + + //////////////////////////////////////////////////////////// + /// \brief Default constructor + /// + /// Constructs an empty, invalid render-texture. You must + /// call create to have a valid render-texture. + /// + /// \see create + /// + //////////////////////////////////////////////////////////// + RenderTexture(); + + //////////////////////////////////////////////////////////// + /// \brief Destructor + /// + //////////////////////////////////////////////////////////// + virtual ~RenderTexture(); + + //////////////////////////////////////////////////////////// + /// \brief Create the render-texture + /// + /// Before calling this function, the render-texture is in + /// an invalid state, thus it is mandatory to call it before + /// doing anything with the render-texture. + /// The last parameter, \a depthBuffer, is useful if you want + /// to use the render-texture for 3D OpenGL rendering that requires + /// a depth buffer. Otherwise it is unnecessary, and you should + /// leave this parameter to false (which is its default value). + /// + /// \param width Width of the render-texture + /// \param height Height of the render-texture + /// \param depthBuffer Do you want this render-texture to have a depth buffer? + /// + /// \return True if creation has been successful + /// + //////////////////////////////////////////////////////////// + bool create(unsigned int width, unsigned int height, bool depthBuffer = false); + + //////////////////////////////////////////////////////////// + /// \brief Enable or disable texture smoothing + /// + /// This function is similar to Texture::setSmooth. + /// This parameter is disabled by default. + /// + /// \param smooth True to enable smoothing, false to disable it + /// + /// \see isSmooth + /// + //////////////////////////////////////////////////////////// + void setSmooth(bool smooth); + + //////////////////////////////////////////////////////////// + /// \brief Tell whether the smooth filtering is enabled or not + /// + /// \return True if texture smoothing is enabled + /// + /// \see setSmooth + /// + //////////////////////////////////////////////////////////// + bool isSmooth() const; + + //////////////////////////////////////////////////////////// + /// \brief Enable or disable texture repeating + /// + /// This function is similar to Texture::setRepeated. + /// This parameter is disabled by default. + /// + /// \param repeated True to enable repeating, false to disable it + /// + /// \see isRepeated + /// + //////////////////////////////////////////////////////////// + void setRepeated(bool repeated); + + //////////////////////////////////////////////////////////// + /// \brief Tell whether the texture is repeated or not + /// + /// \return True if texture is repeated + /// + /// \see setRepeated + /// + //////////////////////////////////////////////////////////// + bool isRepeated() const; + + //////////////////////////////////////////////////////////// + /// \brief Activate of deactivate the render-texture for rendering + /// + /// This function makes the render-texture's context current for + /// future OpenGL rendering operations (so you shouldn't care + /// about it if you're not doing direct OpenGL stuff). + /// Only one context can be current in a thread, so if you + /// want to draw OpenGL geometry to another render target + /// (like a RenderWindow) don't forget to activate it again. + /// + /// \param active True to activate, false to deactivate + /// + /// \return True if operation was successful, false otherwise + /// + //////////////////////////////////////////////////////////// + bool setActive(bool active = true); + + //////////////////////////////////////////////////////////// + /// \brief Update the contents of the target texture + /// + /// This function updates the target texture with what + /// has been drawn so far. Like for windows, calling this + /// function is mandatory at the end of rendering. Not calling + /// it may leave the texture in an undefined state. + /// + //////////////////////////////////////////////////////////// + void display(); + + //////////////////////////////////////////////////////////// + /// \brief Return the size of the rendering region of the texture + /// + /// The returned value is the size that you passed to + /// the create function. + /// + /// \return Size in pixels + /// + //////////////////////////////////////////////////////////// + virtual Vector2u getSize() const; + + //////////////////////////////////////////////////////////// + /// \brief Get a read-only reference to the target texture + /// + /// After drawing to the render-texture and calling Display, + /// you can retrieve the updated texture using this function, + /// and draw it using a sprite (for example). + /// The internal sf::Texture of a render-texture is always the + /// same instance, so that it is possible to call this function + /// once and keep a reference to the texture even after it is + /// modified. + /// + /// \return Const reference to the texture + /// + //////////////////////////////////////////////////////////// + const Texture& getTexture() const; + +private: + + //////////////////////////////////////////////////////////// + /// \brief Activate the target for rendering + /// + /// This function is called by the base class + /// everytime it's going to use OpenGL calls. + /// + /// \param active True to make the target active, false to deactivate it + /// + /// \return True if the function succeeded + /// + //////////////////////////////////////////////////////////// + virtual bool activate(bool active); + + //////////////////////////////////////////////////////////// + // Member data + //////////////////////////////////////////////////////////// + priv::RenderTextureImpl* m_impl; ///< Platform/hardware specific implementation + Texture m_texture; ///< Target texture to draw on +}; + +} // namespace sf + + +#endif // SFML_RENDERTEXTURE_HPP + + +//////////////////////////////////////////////////////////// +/// \class sf::RenderTexture +/// \ingroup graphics +/// +/// sf::RenderTexture is the little brother of sf::RenderWindow. +/// It implements the same 2D drawing and OpenGL-related functions +/// (see their base class sf::RenderTarget for more details), +/// the difference is that the result is stored in an off-screen +/// texture rather than being show in a window. +/// +/// Rendering to a texture can be useful in a variety of situations: +/// \li precomputing a complex static texture (like a level's background from multiple tiles) +/// \li applying post-effects to the whole scene with shaders +/// \li creating a sprite from a 3D object rendered with OpenGL +/// \li etc. +/// +/// Usage example: +/// +/// \code +/// // Create a new render-window +/// sf::RenderWindow window(sf::VideoMode(800, 600), "SFML window"); +/// +/// // Create a new render-texture +/// sf::RenderTexture texture; +/// if (!texture.create(500, 500)) +/// return -1; +/// +/// // The main loop +/// while (window.isOpen()) +/// { +/// // Event processing +/// // ... +/// +/// // Clear the whole texture with red color +/// texture.clear(sf::Color::Red); +/// +/// // Draw stuff to the texture +/// texture.draw(sprite); // sprite is a sf::Sprite +/// texture.draw(shape); // shape is a sf::Shape +/// texture.draw(text); // text is a sf::Text +/// +/// // We're done drawing to the texture +/// texture.display(); +/// +/// // Now we start rendering to the window, clear it first +/// window.clear(); +/// +/// // Draw the texture +/// sf::Sprite sprite(texture.getTexture()); +/// window.draw(sprite); +/// +/// // End the current frame and display its contents on screen +/// window.display(); +/// } +/// \endcode +/// +/// Like sf::RenderWindow, sf::RenderTexture is still able to render direct +/// OpenGL stuff. It is even possible to mix together OpenGL calls +/// and regular SFML drawing commands. If you need a depth buffer for +/// 3D rendering, don't forget to request it when calling RenderTexture::create. +/// +/// \see sf::RenderTarget, sf::RenderWindow, sf::View, sf::Texture +/// +//////////////////////////////////////////////////////////// diff --git a/mcclone/external/sfml23/include/SFML/Graphics/RenderWindow.hpp b/mcclone/external/sfml23/include/SFML/Graphics/RenderWindow.hpp new file mode 100644 index 0000000..98e5b9a --- /dev/null +++ b/mcclone/external/sfml23/include/SFML/Graphics/RenderWindow.hpp @@ -0,0 +1,267 @@ +//////////////////////////////////////////////////////////// +// +// SFML - Simple and Fast Multimedia Library +// Copyright (C) 2007-2015 Laurent Gomila (laurent@sfml-dev.org) +// +// This software is provided 'as-is', without any express or implied warranty. +// In no event will the authors be held liable for any damages arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it freely, +// subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; +// you must not claim that you wrote the original software. +// If you use this software in a product, an acknowledgment +// in the product documentation would be appreciated but is not required. +// +// 2. Altered source versions must be plainly marked as such, +// and must not be misrepresented as being the original software. +// +// 3. This notice may not be removed or altered from any source distribution. +// +//////////////////////////////////////////////////////////// + +#ifndef SFML_RENDERWINDOW_HPP +#define SFML_RENDERWINDOW_HPP + +//////////////////////////////////////////////////////////// +// Headers +//////////////////////////////////////////////////////////// +#include +#include +#include +#include +#include + + +namespace sf +{ +//////////////////////////////////////////////////////////// +/// \brief Window that can serve as a target for 2D drawing +/// +//////////////////////////////////////////////////////////// +class SFML_GRAPHICS_API RenderWindow : public Window, public RenderTarget +{ +public: + + //////////////////////////////////////////////////////////// + /// \brief Default constructor + /// + /// This constructor doesn't actually create the window, + /// use the other constructors or call create() to do so. + /// + //////////////////////////////////////////////////////////// + RenderWindow(); + + //////////////////////////////////////////////////////////// + /// \brief Construct a new window + /// + /// This constructor creates the window with the size and pixel + /// depth defined in \a mode. An optional style can be passed to + /// customize the look and behavior of the window (borders, + /// title bar, resizable, closable, ...). + /// + /// The fourth parameter is an optional structure specifying + /// advanced OpenGL context settings such as antialiasing, + /// depth-buffer bits, etc. You shouldn't care about these + /// parameters for a regular usage of the graphics module. + /// + /// \param mode Video mode to use (defines the width, height and depth of the rendering area of the window) + /// \param title Title of the window + /// \param style %Window style, a bitwise OR combination of sf::Style enumerators + /// \param settings Additional settings for the underlying OpenGL context + /// + //////////////////////////////////////////////////////////// + RenderWindow(VideoMode mode, const String& title, Uint32 style = Style::Default, const ContextSettings& settings = ContextSettings()); + + //////////////////////////////////////////////////////////// + /// \brief Construct the window from an existing control + /// + /// Use this constructor if you want to create an SFML + /// rendering area into an already existing control. + /// + /// The second parameter is an optional structure specifying + /// advanced OpenGL context settings such as antialiasing, + /// depth-buffer bits, etc. You shouldn't care about these + /// parameters for a regular usage of the graphics module. + /// + /// \param handle Platform-specific handle of the control (\a HWND on + /// Windows, \a %Window on Linux/FreeBSD, \a NSWindow on OS X) + /// \param settings Additional settings for the underlying OpenGL context + /// + //////////////////////////////////////////////////////////// + explicit RenderWindow(WindowHandle handle, const ContextSettings& settings = ContextSettings()); + + //////////////////////////////////////////////////////////// + /// \brief Destructor + /// + /// Closes the window and frees all the resources attached to it. + /// + //////////////////////////////////////////////////////////// + virtual ~RenderWindow(); + + //////////////////////////////////////////////////////////// + /// \brief Get the size of the rendering region of the window + /// + /// The size doesn't include the titlebar and borders + /// of the window. + /// + /// \return Size in pixels + /// + //////////////////////////////////////////////////////////// + virtual Vector2u getSize() const; + + //////////////////////////////////////////////////////////// + /// \brief Copy the current contents of the window to an image + /// + /// This is a slow operation, whose main purpose is to make + /// screenshots of the application. If you want to update an + /// image with the contents of the window and then use it for + /// drawing, you should rather use a sf::Texture and its + /// update(Window&) function. + /// You can also draw things directly to a texture with the + /// sf::RenderTexture class. + /// + /// \return Image containing the captured contents + /// + //////////////////////////////////////////////////////////// + Image capture() const; + +protected: + + //////////////////////////////////////////////////////////// + /// \brief Function called after the window has been created + /// + /// This function is called so that derived classes can + /// perform their own specific initialization as soon as + /// the window is created. + /// + //////////////////////////////////////////////////////////// + virtual void onCreate(); + + //////////////////////////////////////////////////////////// + /// \brief Function called after the window has been resized + /// + /// This function is called so that derived classes can + /// perform custom actions when the size of the window changes. + /// + //////////////////////////////////////////////////////////// + virtual void onResize(); + +private: + + //////////////////////////////////////////////////////////// + /// \brief Activate the target for rendering + /// + /// \param active True to make the target active, false to deactivate it + /// + /// \return True if the function succeeded + /// + //////////////////////////////////////////////////////////// + virtual bool activate(bool active); +}; + +} // namespace sf + + +#endif // SFML_RENDERWINDOW_HPP + + +//////////////////////////////////////////////////////////// +/// \class sf::RenderWindow +/// \ingroup graphics +/// +/// sf::RenderWindow is the main class of the Graphics module. +/// It defines an OS window that can be painted using the other +/// classes of the graphics module. +/// +/// sf::RenderWindow is derived from sf::Window, thus it inherits +/// all its features: events, window management, OpenGL rendering, +/// etc. See the documentation of sf::Window for a more complete +/// description of all these features, as well as code examples. +/// +/// On top of that, sf::RenderWindow adds more features related to +/// 2D drawing with the graphics module (see its base class +/// sf::RenderTarget for more details). +/// Here is a typical rendering and event loop with a sf::RenderWindow: +/// +/// \code +/// // Declare and create a new render-window +/// sf::RenderWindow window(sf::VideoMode(800, 600), "SFML window"); +/// +/// // Limit the framerate to 60 frames per second (this step is optional) +/// window.setFramerateLimit(60); +/// +/// // The main loop - ends as soon as the window is closed +/// while (window.isOpen()) +/// { +/// // Event processing +/// sf::Event event; +/// while (window.pollEvent(event)) +/// { +/// // Request for closing the window +/// if (event.type == sf::Event::Closed) +/// window.close(); +/// } +/// +/// // Clear the whole window before rendering a new frame +/// window.clear(); +/// +/// // Draw some graphical entities +/// window.draw(sprite); +/// window.draw(circle); +/// window.draw(text); +/// +/// // End the current frame and display its contents on screen +/// window.display(); +/// } +/// \endcode +/// +/// Like sf::Window, sf::RenderWindow is still able to render direct +/// OpenGL stuff. It is even possible to mix together OpenGL calls +/// and regular SFML drawing commands. +/// +/// \code +/// // Create the render window +/// sf::RenderWindow window(sf::VideoMode(800, 600), "SFML OpenGL"); +/// +/// // Create a sprite and a text to display +/// sf::Sprite sprite; +/// sf::Text text; +/// ... +/// +/// // Perform OpenGL initializations +/// glMatrixMode(GL_PROJECTION); +/// ... +/// +/// // Start the rendering loop +/// while (window.isOpen()) +/// { +/// // Process events +/// ... +/// +/// // Draw a background sprite +/// window.pushGLStates(); +/// window.draw(sprite); +/// window.popGLStates(); +/// +/// // Draw a 3D object using OpenGL +/// glBegin(GL_QUADS); +/// glVertex3f(...); +/// ... +/// glEnd(); +/// +/// // Draw text on top of the 3D object +/// window.pushGLStates(); +/// window.draw(text); +/// window.popGLStates(); +/// +/// // Finally, display the rendered frame on screen +/// window.display(); +/// } +/// \endcode +/// +/// \see sf::Window, sf::RenderTarget, sf::RenderTexture, sf::View +/// +//////////////////////////////////////////////////////////// diff --git a/mcclone/external/sfml23/include/SFML/Graphics/Shader.hpp b/mcclone/external/sfml23/include/SFML/Graphics/Shader.hpp new file mode 100644 index 0000000..55cc3bb --- /dev/null +++ b/mcclone/external/sfml23/include/SFML/Graphics/Shader.hpp @@ -0,0 +1,659 @@ +//////////////////////////////////////////////////////////// +// +// SFML - Simple and Fast Multimedia Library +// Copyright (C) 2007-2015 Laurent Gomila (laurent@sfml-dev.org) +// +// This software is provided 'as-is', without any express or implied warranty. +// In no event will the authors be held liable for any damages arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it freely, +// subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; +// you must not claim that you wrote the original software. +// If you use this software in a product, an acknowledgment +// in the product documentation would be appreciated but is not required. +// +// 2. Altered source versions must be plainly marked as such, +// and must not be misrepresented as being the original software. +// +// 3. This notice may not be removed or altered from any source distribution. +// +//////////////////////////////////////////////////////////// + +#ifndef SFML_SHADER_HPP +#define SFML_SHADER_HPP + +//////////////////////////////////////////////////////////// +// Headers +//////////////////////////////////////////////////////////// +#include +#include +#include +#include +#include +#include +#include +#include +#include + + +namespace sf +{ +class InputStream; +class Texture; + +//////////////////////////////////////////////////////////// +/// \brief Shader class (vertex and fragment) +/// +//////////////////////////////////////////////////////////// +class SFML_GRAPHICS_API Shader : GlResource, NonCopyable +{ +public: + + //////////////////////////////////////////////////////////// + /// \brief Types of shaders + /// + //////////////////////////////////////////////////////////// + enum Type + { + Vertex, ///< Vertex shader + Fragment ///< Fragment (pixel) shader + }; + + //////////////////////////////////////////////////////////// + /// \brief Special type that can be passed to setParameter, + /// and that represents the texture of the object being drawn + /// + /// \see setParameter(const std::string&, CurrentTextureType) + /// + //////////////////////////////////////////////////////////// + struct CurrentTextureType {}; + + //////////////////////////////////////////////////////////// + /// \brief Represents the texture of the object being drawn + /// + /// \see setParameter(const std::string&, CurrentTextureType) + /// + //////////////////////////////////////////////////////////// + static CurrentTextureType CurrentTexture; + +public: + + //////////////////////////////////////////////////////////// + /// \brief Default constructor + /// + /// This constructor creates an invalid shader. + /// + //////////////////////////////////////////////////////////// + Shader(); + + //////////////////////////////////////////////////////////// + /// \brief Destructor + /// + //////////////////////////////////////////////////////////// + ~Shader(); + + //////////////////////////////////////////////////////////// + /// \brief Load either the vertex or fragment shader from a file + /// + /// This function loads a single shader, either vertex or + /// fragment, identified by the second argument. + /// The source must be a text file containing a valid + /// shader in GLSL language. GLSL is a C-like language + /// dedicated to OpenGL shaders; you'll probably need to + /// read a good documentation for it before writing your + /// own shaders. + /// + /// \param filename Path of the vertex or fragment shader file to load + /// \param type Type of shader (vertex or fragment) + /// + /// \return True if loading succeeded, false if it failed + /// + /// \see loadFromMemory, loadFromStream + /// + //////////////////////////////////////////////////////////// + bool loadFromFile(const std::string& filename, Type type); + + //////////////////////////////////////////////////////////// + /// \brief Load both the vertex and fragment shaders from files + /// + /// This function loads both the vertex and the fragment + /// shaders. If one of them fails to load, the shader is left + /// empty (the valid shader is unloaded). + /// The sources must be text files containing valid shaders + /// in GLSL language. GLSL is a C-like language dedicated to + /// OpenGL shaders; you'll probably need to read a good documentation + /// for it before writing your own shaders. + /// + /// \param vertexShaderFilename Path of the vertex shader file to load + /// \param fragmentShaderFilename Path of the fragment shader file to load + /// + /// \return True if loading succeeded, false if it failed + /// + /// \see loadFromMemory, loadFromStream + /// + //////////////////////////////////////////////////////////// + bool loadFromFile(const std::string& vertexShaderFilename, const std::string& fragmentShaderFilename); + + //////////////////////////////////////////////////////////// + /// \brief Load either the vertex or fragment shader from a source code in memory + /// + /// This function loads a single shader, either vertex or + /// fragment, identified by the second argument. + /// The source code must be a valid shader in GLSL language. + /// GLSL is a C-like language dedicated to OpenGL shaders; + /// you'll probably need to read a good documentation for + /// it before writing your own shaders. + /// + /// \param shader String containing the source code of the shader + /// \param type Type of shader (vertex or fragment) + /// + /// \return True if loading succeeded, false if it failed + /// + /// \see loadFromFile, loadFromStream + /// + //////////////////////////////////////////////////////////// + bool loadFromMemory(const std::string& shader, Type type); + + //////////////////////////////////////////////////////////// + /// \brief Load both the vertex and fragment shaders from source codes in memory + /// + /// This function loads both the vertex and the fragment + /// shaders. If one of them fails to load, the shader is left + /// empty (the valid shader is unloaded). + /// The sources must be valid shaders in GLSL language. GLSL is + /// a C-like language dedicated to OpenGL shaders; you'll + /// probably need to read a good documentation for it before + /// writing your own shaders. + /// + /// \param vertexShader String containing the source code of the vertex shader + /// \param fragmentShader String containing the source code of the fragment shader + /// + /// \return True if loading succeeded, false if it failed + /// + /// \see loadFromFile, loadFromStream + /// + //////////////////////////////////////////////////////////// + bool loadFromMemory(const std::string& vertexShader, const std::string& fragmentShader); + + //////////////////////////////////////////////////////////// + /// \brief Load either the vertex or fragment shader from a custom stream + /// + /// This function loads a single shader, either vertex or + /// fragment, identified by the second argument. + /// The source code must be a valid shader in GLSL language. + /// GLSL is a C-like language dedicated to OpenGL shaders; + /// you'll probably need to read a good documentation for it + /// before writing your own shaders. + /// + /// \param stream Source stream to read from + /// \param type Type of shader (vertex or fragment) + /// + /// \return True if loading succeeded, false if it failed + /// + /// \see loadFromFile, loadFromMemory + /// + //////////////////////////////////////////////////////////// + bool loadFromStream(InputStream& stream, Type type); + + //////////////////////////////////////////////////////////// + /// \brief Load both the vertex and fragment shaders from custom streams + /// + /// This function loads both the vertex and the fragment + /// shaders. If one of them fails to load, the shader is left + /// empty (the valid shader is unloaded). + /// The source codes must be valid shaders in GLSL language. + /// GLSL is a C-like language dedicated to OpenGL shaders; + /// you'll probably need to read a good documentation for + /// it before writing your own shaders. + /// + /// \param vertexShaderStream Source stream to read the vertex shader from + /// \param fragmentShaderStream Source stream to read the fragment shader from + /// + /// \return True if loading succeeded, false if it failed + /// + /// \see loadFromFile, loadFromMemory + /// + //////////////////////////////////////////////////////////// + bool loadFromStream(InputStream& vertexShaderStream, InputStream& fragmentShaderStream); + + //////////////////////////////////////////////////////////// + /// \brief Change a float parameter of the shader + /// + /// \a name is the name of the variable to change in the shader. + /// The corresponding parameter in the shader must be a float + /// (float GLSL type). + /// + /// Example: + /// \code + /// uniform float myparam; // this is the variable in the shader + /// \endcode + /// \code + /// shader.setParameter("myparam", 5.2f); + /// \endcode + /// + /// \param name Name of the parameter in the shader + /// \param x Value to assign + /// + //////////////////////////////////////////////////////////// + void setParameter(const std::string& name, float x); + + //////////////////////////////////////////////////////////// + /// \brief Change a 2-components vector parameter of the shader + /// + /// \a name is the name of the variable to change in the shader. + /// The corresponding parameter in the shader must be a 2x1 vector + /// (vec2 GLSL type). + /// + /// Example: + /// \code + /// uniform vec2 myparam; // this is the variable in the shader + /// \endcode + /// \code + /// shader.setParameter("myparam", 5.2f, 6.0f); + /// \endcode + /// + /// \param name Name of the parameter in the shader + /// \param x First component of the value to assign + /// \param y Second component of the value to assign + /// + //////////////////////////////////////////////////////////// + void setParameter(const std::string& name, float x, float y); + + //////////////////////////////////////////////////////////// + /// \brief Change a 3-components vector parameter of the shader + /// + /// \a name is the name of the variable to change in the shader. + /// The corresponding parameter in the shader must be a 3x1 vector + /// (vec3 GLSL type). + /// + /// Example: + /// \code + /// uniform vec3 myparam; // this is the variable in the shader + /// \endcode + /// \code + /// shader.setParameter("myparam", 5.2f, 6.0f, -8.1f); + /// \endcode + /// + /// \param name Name of the parameter in the shader + /// \param x First component of the value to assign + /// \param y Second component of the value to assign + /// \param z Third component of the value to assign + /// + //////////////////////////////////////////////////////////// + void setParameter(const std::string& name, float x, float y, float z); + + //////////////////////////////////////////////////////////// + /// \brief Change a 4-components vector parameter of the shader + /// + /// \a name is the name of the variable to change in the shader. + /// The corresponding parameter in the shader must be a 4x1 vector + /// (vec4 GLSL type). + /// + /// Example: + /// \code + /// uniform vec4 myparam; // this is the variable in the shader + /// \endcode + /// \code + /// shader.setParameter("myparam", 5.2f, 6.0f, -8.1f, 0.4f); + /// \endcode + /// + /// \param name Name of the parameter in the shader + /// \param x First component of the value to assign + /// \param y Second component of the value to assign + /// \param z Third component of the value to assign + /// \param w Fourth component of the value to assign + /// + //////////////////////////////////////////////////////////// + void setParameter(const std::string& name, float x, float y, float z, float w); + + //////////////////////////////////////////////////////////// + /// \brief Change a 2-components vector parameter of the shader + /// + /// \a name is the name of the variable to change in the shader. + /// The corresponding parameter in the shader must be a 2x1 vector + /// (vec2 GLSL type). + /// + /// Example: + /// \code + /// uniform vec2 myparam; // this is the variable in the shader + /// \endcode + /// \code + /// shader.setParameter("myparam", sf::Vector2f(5.2f, 6.0f)); + /// \endcode + /// + /// \param name Name of the parameter in the shader + /// \param vector Vector to assign + /// + //////////////////////////////////////////////////////////// + void setParameter(const std::string& name, const Vector2f& vector); + + //////////////////////////////////////////////////////////// + /// \brief Change a 3-components vector parameter of the shader + /// + /// \a name is the name of the variable to change in the shader. + /// The corresponding parameter in the shader must be a 3x1 vector + /// (vec3 GLSL type). + /// + /// Example: + /// \code + /// uniform vec3 myparam; // this is the variable in the shader + /// \endcode + /// \code + /// shader.setParameter("myparam", sf::Vector3f(5.2f, 6.0f, -8.1f)); + /// \endcode + /// + /// \param name Name of the parameter in the shader + /// \param vector Vector to assign + /// + //////////////////////////////////////////////////////////// + void setParameter(const std::string& name, const Vector3f& vector); + + //////////////////////////////////////////////////////////// + /// \brief Change a color parameter of the shader + /// + /// \a name is the name of the variable to change in the shader. + /// The corresponding parameter in the shader must be a 4x1 vector + /// (vec4 GLSL type). + /// + /// It is important to note that the components of the color are + /// normalized before being passed to the shader. Therefore, + /// they are converted from range [0 .. 255] to range [0 .. 1]. + /// For example, a sf::Color(255, 125, 0, 255) will be transformed + /// to a vec4(1.0, 0.5, 0.0, 1.0) in the shader. + /// + /// Example: + /// \code + /// uniform vec4 color; // this is the variable in the shader + /// \endcode + /// \code + /// shader.setParameter("color", sf::Color(255, 128, 0, 255)); + /// \endcode + /// + /// \param name Name of the parameter in the shader + /// \param color Color to assign + /// + //////////////////////////////////////////////////////////// + void setParameter(const std::string& name, const Color& color); + + //////////////////////////////////////////////////////////// + /// \brief Change a matrix parameter of the shader + /// + /// \a name is the name of the variable to change in the shader. + /// The corresponding parameter in the shader must be a 4x4 matrix + /// (mat4 GLSL type). + /// + /// Example: + /// \code + /// uniform mat4 matrix; // this is the variable in the shader + /// \endcode + /// \code + /// sf::Transform transform; + /// transform.translate(5, 10); + /// shader.setParameter("matrix", transform); + /// \endcode + /// + /// \param name Name of the parameter in the shader + /// \param transform Transform to assign + /// + //////////////////////////////////////////////////////////// + void setParameter(const std::string& name, const Transform& transform); + + //////////////////////////////////////////////////////////// + /// \brief Change a texture parameter of the shader + /// + /// \a name is the name of the variable to change in the shader. + /// The corresponding parameter in the shader must be a 2D texture + /// (sampler2D GLSL type). + /// + /// Example: + /// \code + /// uniform sampler2D the_texture; // this is the variable in the shader + /// \endcode + /// \code + /// sf::Texture texture; + /// ... + /// shader.setParameter("the_texture", texture); + /// \endcode + /// It is important to note that \a texture must remain alive as long + /// as the shader uses it, no copy is made internally. + /// + /// To use the texture of the object being draw, which cannot be + /// known in advance, you can pass the special value + /// sf::Shader::CurrentTexture: + /// \code + /// shader.setParameter("the_texture", sf::Shader::CurrentTexture). + /// \endcode + /// + /// \param name Name of the texture in the shader + /// \param texture Texture to assign + /// + //////////////////////////////////////////////////////////// + void setParameter(const std::string& name, const Texture& texture); + + //////////////////////////////////////////////////////////// + /// \brief Change a texture parameter of the shader + /// + /// This overload maps a shader texture variable to the + /// texture of the object being drawn, which cannot be + /// known in advance. The second argument must be + /// sf::Shader::CurrentTexture. + /// The corresponding parameter in the shader must be a 2D texture + /// (sampler2D GLSL type). + /// + /// Example: + /// \code + /// uniform sampler2D current; // this is the variable in the shader + /// \endcode + /// \code + /// shader.setParameter("current", sf::Shader::CurrentTexture); + /// \endcode + /// + /// \param name Name of the texture in the shader + /// + //////////////////////////////////////////////////////////// + void setParameter(const std::string& name, CurrentTextureType); + + //////////////////////////////////////////////////////////// + /// \brief Get the underlying OpenGL handle of the shader. + /// + /// You shouldn't need to use this function, unless you have + /// very specific stuff to implement that SFML doesn't support, + /// or implement a temporary workaround until a bug is fixed. + /// + /// \return OpenGL handle of the shader or 0 if not yet loaded + /// + //////////////////////////////////////////////////////////// + unsigned int getNativeHandle() const; + + //////////////////////////////////////////////////////////// + /// \brief Bind a shader for rendering + /// + /// This function is not part of the graphics API, it mustn't be + /// used when drawing SFML entities. It must be used only if you + /// mix sf::Shader with OpenGL code. + /// + /// \code + /// sf::Shader s1, s2; + /// ... + /// sf::Shader::bind(&s1); + /// // draw OpenGL stuff that use s1... + /// sf::Shader::bind(&s2); + /// // draw OpenGL stuff that use s2... + /// sf::Shader::bind(NULL); + /// // draw OpenGL stuff that use no shader... + /// \endcode + /// + /// \param shader Shader to bind, can be null to use no shader + /// + //////////////////////////////////////////////////////////// + static void bind(const Shader* shader); + + //////////////////////////////////////////////////////////// + /// \brief Tell whether or not the system supports shaders + /// + /// This function should always be called before using + /// the shader features. If it returns false, then + /// any attempt to use sf::Shader will fail. + /// + /// Note: The first call to this function, whether by your + /// code or SFML will result in a context switch. + /// + /// \return True if shaders are supported, false otherwise + /// + //////////////////////////////////////////////////////////// + static bool isAvailable(); + +private: + + //////////////////////////////////////////////////////////// + /// \brief Compile the shader(s) and create the program + /// + /// If one of the arguments is NULL, the corresponding shader + /// is not created. + /// + /// \param vertexShaderCode Source code of the vertex shader + /// \param fragmentShaderCode Source code of the fragment shader + /// + /// \return True on success, false if any error happened + /// + //////////////////////////////////////////////////////////// + bool compile(const char* vertexShaderCode, const char* fragmentShaderCode); + + //////////////////////////////////////////////////////////// + /// \brief Bind all the textures used by the shader + /// + /// This function each texture to a different unit, and + /// updates the corresponding variables in the shader accordingly. + /// + //////////////////////////////////////////////////////////// + void bindTextures() const; + + //////////////////////////////////////////////////////////// + /// \brief Get the location ID of a shader parameter + /// + /// \param name Name of the parameter to search + /// + /// \return Location ID of the parameter, or -1 if not found + /// + //////////////////////////////////////////////////////////// + int getParamLocation(const std::string& name); + + //////////////////////////////////////////////////////////// + // Types + //////////////////////////////////////////////////////////// + typedef std::map TextureTable; + typedef std::map ParamTable; + + //////////////////////////////////////////////////////////// + // Member data + //////////////////////////////////////////////////////////// + unsigned int m_shaderProgram; ///< OpenGL identifier for the program + int m_currentTexture; ///< Location of the current texture in the shader + TextureTable m_textures; ///< Texture variables in the shader, mapped to their location + ParamTable m_params; ///< Parameters location cache +}; + +} // namespace sf + + +#endif // SFML_SHADER_HPP + + +//////////////////////////////////////////////////////////// +/// \class sf::Shader +/// \ingroup graphics +/// +/// Shaders are programs written using a specific language, +/// executed directly by the graphics card and allowing +/// to apply real-time operations to the rendered entities. +/// +/// There are two kinds of shaders: +/// \li Vertex shaders, that process vertices +/// \li Fragment (pixel) shaders, that process pixels +/// +/// A sf::Shader can be composed of either a vertex shader +/// alone, a fragment shader alone, or both combined +/// (see the variants of the load functions). +/// +/// Shaders are written in GLSL, which is a C-like +/// language dedicated to OpenGL shaders. You'll probably +/// need to learn its basics before writing your own shaders +/// for SFML. +/// +/// Like any C/C++ program, a shader has its own variables +/// that you can set from your C++ application. sf::Shader +/// handles 5 different types of variables: +/// \li floats +/// \li vectors (2, 3 or 4 components) +/// \li colors +/// \li textures +/// \li transforms (matrices) +/// +/// The value of the variables can be changed at any time +/// with the various overloads of the setParameter function: +/// \code +/// shader.setParameter("offset", 2.f); +/// shader.setParameter("point", 0.5f, 0.8f, 0.3f); +/// shader.setParameter("color", sf::Color(128, 50, 255)); +/// shader.setParameter("matrix", transform); // transform is a sf::Transform +/// shader.setParameter("overlay", texture); // texture is a sf::Texture +/// shader.setParameter("texture", sf::Shader::CurrentTexture); +/// \endcode +/// +/// The special Shader::CurrentTexture argument maps the +/// given texture variable to the current texture of the +/// object being drawn (which cannot be known in advance). +/// +/// To apply a shader to a drawable, you must pass it as an +/// additional parameter to the Draw function: +/// \code +/// window.draw(sprite, &shader); +/// \endcode +/// +/// ... which is in fact just a shortcut for this: +/// \code +/// sf::RenderStates states; +/// states.shader = &shader; +/// window.draw(sprite, states); +/// \endcode +/// +/// In the code above we pass a pointer to the shader, because it may +/// be null (which means "no shader"). +/// +/// Shaders can be used on any drawable, but some combinations are +/// not interesting. For example, using a vertex shader on a sf::Sprite +/// is limited because there are only 4 vertices, the sprite would +/// have to be subdivided in order to apply wave effects. +/// Another bad example is a fragment shader with sf::Text: the texture +/// of the text is not the actual text that you see on screen, it is +/// a big texture containing all the characters of the font in an +/// arbitrary order; thus, texture lookups on pixels other than the +/// current one may not give you the expected result. +/// +/// Shaders can also be used to apply global post-effects to the +/// current contents of the target (like the old sf::PostFx class +/// in SFML 1). This can be done in two different ways: +/// \li draw everything to a sf::RenderTexture, then draw it to +/// the main target using the shader +/// \li draw everything directly to the main target, then use +/// sf::Texture::update(Window&) to copy its contents to a texture +/// and draw it to the main target using the shader +/// +/// The first technique is more optimized because it doesn't involve +/// retrieving the target's pixels to system memory, but the +/// second one doesn't impact the rendering process and can be +/// easily inserted anywhere without impacting all the code. +/// +/// Like sf::Texture that can be used as a raw OpenGL texture, +/// sf::Shader can also be used directly as a raw shader for +/// custom OpenGL geometry. +/// \code +/// sf::Shader::bind(&shader); +/// ... render OpenGL geometry ... +/// sf::Shader::bind(NULL); +/// \endcode +/// +//////////////////////////////////////////////////////////// diff --git a/mcclone/external/sfml23/include/SFML/Graphics/Shape.hpp b/mcclone/external/sfml23/include/SFML/Graphics/Shape.hpp new file mode 100644 index 0000000..5983a9d --- /dev/null +++ b/mcclone/external/sfml23/include/SFML/Graphics/Shape.hpp @@ -0,0 +1,355 @@ +//////////////////////////////////////////////////////////// +// +// SFML - Simple and Fast Multimedia Library +// Copyright (C) 2007-2015 Laurent Gomila (laurent@sfml-dev.org) +// +// This software is provided 'as-is', without any express or implied warranty. +// In no event will the authors be held liable for any damages arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it freely, +// subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; +// you must not claim that you wrote the original software. +// If you use this software in a product, an acknowledgment +// in the product documentation would be appreciated but is not required. +// +// 2. Altered source versions must be plainly marked as such, +// and must not be misrepresented as being the original software. +// +// 3. This notice may not be removed or altered from any source distribution. +// +//////////////////////////////////////////////////////////// + +#ifndef SFML_SHAPE_HPP +#define SFML_SHAPE_HPP + +//////////////////////////////////////////////////////////// +// Headers +//////////////////////////////////////////////////////////// +#include +#include +#include +#include +#include + + +namespace sf +{ +//////////////////////////////////////////////////////////// +/// \brief Base class for textured shapes with outline +/// +//////////////////////////////////////////////////////////// +class SFML_GRAPHICS_API Shape : public Drawable, public Transformable +{ +public: + + //////////////////////////////////////////////////////////// + /// \brief Virtual destructor + /// + //////////////////////////////////////////////////////////// + virtual ~Shape(); + + //////////////////////////////////////////////////////////// + /// \brief Change the source texture of the shape + /// + /// The \a texture argument refers to a texture that must + /// exist as long as the shape uses it. Indeed, the shape + /// doesn't store its own copy of the texture, but rather keeps + /// a pointer to the one that you passed to this function. + /// If the source texture is destroyed and the shape tries to + /// use it, the behavior is undefined. + /// \a texture can be NULL to disable texturing. + /// If \a resetRect is true, the TextureRect property of + /// the shape is automatically adjusted to the size of the new + /// texture. If it is false, the texture rect is left unchanged. + /// + /// \param texture New texture + /// \param resetRect Should the texture rect be reset to the size of the new texture? + /// + /// \see getTexture, setTextureRect + /// + //////////////////////////////////////////////////////////// + void setTexture(const Texture* texture, bool resetRect = false); + + //////////////////////////////////////////////////////////// + /// \brief Set the sub-rectangle of the texture that the shape will display + /// + /// The texture rect is useful when you don't want to display + /// the whole texture, but rather a part of it. + /// By default, the texture rect covers the entire texture. + /// + /// \param rect Rectangle defining the region of the texture to display + /// + /// \see getTextureRect, setTexture + /// + //////////////////////////////////////////////////////////// + void setTextureRect(const IntRect& rect); + + //////////////////////////////////////////////////////////// + /// \brief Set the fill color of the shape + /// + /// This color is modulated (multiplied) with the shape's + /// texture if any. It can be used to colorize the shape, + /// or change its global opacity. + /// You can use sf::Color::Transparent to make the inside of + /// the shape transparent, and have the outline alone. + /// By default, the shape's fill color is opaque white. + /// + /// \param color New color of the shape + /// + /// \see getFillColor, setOutlineColor + /// + //////////////////////////////////////////////////////////// + void setFillColor(const Color& color); + + //////////////////////////////////////////////////////////// + /// \brief Set the outline color of the shape + /// + /// By default, the shape's outline color is opaque white. + /// + /// \param color New outline color of the shape + /// + /// \see getOutlineColor, setFillColor + /// + //////////////////////////////////////////////////////////// + void setOutlineColor(const Color& color); + + //////////////////////////////////////////////////////////// + /// \brief Set the thickness of the shape's outline + /// + /// Note that negative values are allowed (so that the outline + /// expands towards the center of the shape), and using zero + /// disables the outline. + /// By default, the outline thickness is 0. + /// + /// \param thickness New outline thickness + /// + /// \see getOutlineThickness + /// + //////////////////////////////////////////////////////////// + void setOutlineThickness(float thickness); + + //////////////////////////////////////////////////////////// + /// \brief Get the source texture of the shape + /// + /// If the shape has no source texture, a NULL pointer is returned. + /// The returned pointer is const, which means that you can't + /// modify the texture when you retrieve it with this function. + /// + /// \return Pointer to the shape's texture + /// + /// \see setTexture + /// + //////////////////////////////////////////////////////////// + const Texture* getTexture() const; + + //////////////////////////////////////////////////////////// + /// \brief Get the sub-rectangle of the texture displayed by the shape + /// + /// \return Texture rectangle of the shape + /// + /// \see setTextureRect + /// + //////////////////////////////////////////////////////////// + const IntRect& getTextureRect() const; + + //////////////////////////////////////////////////////////// + /// \brief Get the fill color of the shape + /// + /// \return Fill color of the shape + /// + /// \see setFillColor + /// + //////////////////////////////////////////////////////////// + const Color& getFillColor() const; + + //////////////////////////////////////////////////////////// + /// \brief Get the outline color of the shape + /// + /// \return Outline color of the shape + /// + /// \see setOutlineColor + /// + //////////////////////////////////////////////////////////// + const Color& getOutlineColor() const; + + //////////////////////////////////////////////////////////// + /// \brief Get the outline thickness of the shape + /// + /// \return Outline thickness of the shape + /// + /// \see setOutlineThickness + /// + //////////////////////////////////////////////////////////// + float getOutlineThickness() const; + + //////////////////////////////////////////////////////////// + /// \brief Get the total number of points of the shape + /// + /// \return Number of points of the shape + /// + /// \see getPoint + /// + //////////////////////////////////////////////////////////// + virtual std::size_t getPointCount() const = 0; + + //////////////////////////////////////////////////////////// + /// \brief Get a point of the shape + /// + /// The returned point is in local coordinates, that is, + /// the shape's transforms (position, rotation, scale) are + /// not taken into account. + /// The result is undefined if \a index is out of the valid range. + /// + /// \param index Index of the point to get, in range [0 .. getPointCount() - 1] + /// + /// \return index-th point of the shape + /// + /// \see getPointCount + /// + //////////////////////////////////////////////////////////// + virtual Vector2f getPoint(std::size_t index) const = 0; + + //////////////////////////////////////////////////////////// + /// \brief Get the local bounding rectangle of the entity + /// + /// The returned rectangle is in local coordinates, which means + /// that it ignores the transformations (translation, rotation, + /// scale, ...) that are applied to the entity. + /// In other words, this function returns the bounds of the + /// entity in the entity's coordinate system. + /// + /// \return Local bounding rectangle of the entity + /// + //////////////////////////////////////////////////////////// + FloatRect getLocalBounds() const; + + //////////////////////////////////////////////////////////// + /// \brief Get the global (non-minimal) bounding rectangle of the entity + /// + /// The returned rectangle is in global coordinates, which means + /// that it takes into account the transformations (translation, + /// rotation, scale, ...) that are applied to the entity. + /// In other words, this function returns the bounds of the + /// shape in the global 2D world's coordinate system. + /// + /// This function does not necessarily return the \a minimal + /// bounding rectangle. It merely ensures that the returned + /// rectangle covers all the vertices (but possibly more). + /// This allows for a fast approximation of the bounds as a + /// first check; you may want to use more precise checks + /// on top of that. + /// + /// \return Global bounding rectangle of the entity + /// + //////////////////////////////////////////////////////////// + FloatRect getGlobalBounds() const; + +protected: + + //////////////////////////////////////////////////////////// + /// \brief Default constructor + /// + //////////////////////////////////////////////////////////// + Shape(); + + //////////////////////////////////////////////////////////// + /// \brief Recompute the internal geometry of the shape + /// + /// This function must be called by the derived class everytime + /// the shape's points change (i.e. the result of either + /// getPointCount or getPoint is different). + /// + //////////////////////////////////////////////////////////// + void update(); + +private: + + //////////////////////////////////////////////////////////// + /// \brief Draw the shape to a render target + /// + /// \param target Render target to draw to + /// \param states Current render states + /// + //////////////////////////////////////////////////////////// + virtual void draw(RenderTarget& target, RenderStates states) const; + + //////////////////////////////////////////////////////////// + /// \brief Update the fill vertices' color + /// + //////////////////////////////////////////////////////////// + void updateFillColors(); + + //////////////////////////////////////////////////////////// + /// \brief Update the fill vertices' texture coordinates + /// + //////////////////////////////////////////////////////////// + void updateTexCoords(); + + //////////////////////////////////////////////////////////// + /// \brief Update the outline vertices' position + /// + //////////////////////////////////////////////////////////// + void updateOutline(); + + //////////////////////////////////////////////////////////// + /// \brief Update the outline vertices' color + /// + //////////////////////////////////////////////////////////// + void updateOutlineColors(); + +private: + + //////////////////////////////////////////////////////////// + // Member data + //////////////////////////////////////////////////////////// + const Texture* m_texture; ///< Texture of the shape + IntRect m_textureRect; ///< Rectangle defining the area of the source texture to display + Color m_fillColor; ///< Fill color + Color m_outlineColor; ///< Outline color + float m_outlineThickness; ///< Thickness of the shape's outline + VertexArray m_vertices; ///< Vertex array containing the fill geometry + VertexArray m_outlineVertices; ///< Vertex array containing the outline geometry + FloatRect m_insideBounds; ///< Bounding rectangle of the inside (fill) + FloatRect m_bounds; ///< Bounding rectangle of the whole shape (outline + fill) +}; + +} // namespace sf + + +#endif // SFML_SHAPE_HPP + + +//////////////////////////////////////////////////////////// +/// \class sf::Shape +/// \ingroup graphics +/// +/// sf::Shape is a drawable class that allows to define and +/// display a custom convex shape on a render target. +/// It's only an abstract base, it needs to be specialized for +/// concrete types of shapes (circle, rectangle, convex polygon, +/// star, ...). +/// +/// In addition to the attributes provided by the specialized +/// shape classes, a shape always has the following attributes: +/// \li a texture +/// \li a texture rectangle +/// \li a fill color +/// \li an outline color +/// \li an outline thickness +/// +/// Each feature is optional, and can be disabled easily: +/// \li the texture can be null +/// \li the fill/outline colors can be sf::Color::Transparent +/// \li the outline thickness can be zero +/// +/// You can write your own derived shape class, there are only +/// two virtual functions to override: +/// \li getPointCount must return the number of points of the shape +/// \li getPoint must return the points of the shape +/// +/// \see sf::RectangleShape, sf::CircleShape, sf::ConvexShape, sf::Transformable +/// +//////////////////////////////////////////////////////////// diff --git a/mcclone/external/sfml23/include/SFML/Graphics/Sprite.hpp b/mcclone/external/sfml23/include/SFML/Graphics/Sprite.hpp new file mode 100644 index 0000000..c7447df --- /dev/null +++ b/mcclone/external/sfml23/include/SFML/Graphics/Sprite.hpp @@ -0,0 +1,279 @@ +//////////////////////////////////////////////////////////// +// +// SFML - Simple and Fast Multimedia Library +// Copyright (C) 2007-2015 Laurent Gomila (laurent@sfml-dev.org) +// +// This software is provided 'as-is', without any express or implied warranty. +// In no event will the authors be held liable for any damages arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it freely, +// subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; +// you must not claim that you wrote the original software. +// If you use this software in a product, an acknowledgment +// in the product documentation would be appreciated but is not required. +// +// 2. Altered source versions must be plainly marked as such, +// and must not be misrepresented as being the original software. +// +// 3. This notice may not be removed or altered from any source distribution. +// +//////////////////////////////////////////////////////////// + +#ifndef SFML_SPRITE_HPP +#define SFML_SPRITE_HPP + +//////////////////////////////////////////////////////////// +// Headers +//////////////////////////////////////////////////////////// +#include +#include +#include +#include +#include + + +namespace sf +{ +class Texture; + +//////////////////////////////////////////////////////////// +/// \brief Drawable representation of a texture, with its +/// own transformations, color, etc. +/// +//////////////////////////////////////////////////////////// +class SFML_GRAPHICS_API Sprite : public Drawable, public Transformable +{ +public: + + //////////////////////////////////////////////////////////// + /// \brief Default constructor + /// + /// Creates an empty sprite with no source texture. + /// + //////////////////////////////////////////////////////////// + Sprite(); + + //////////////////////////////////////////////////////////// + /// \brief Construct the sprite from a source texture + /// + /// \param texture Source texture + /// + /// \see setTexture + /// + //////////////////////////////////////////////////////////// + explicit Sprite(const Texture& texture); + + //////////////////////////////////////////////////////////// + /// \brief Construct the sprite from a sub-rectangle of a source texture + /// + /// \param texture Source texture + /// \param rectangle Sub-rectangle of the texture to assign to the sprite + /// + /// \see setTexture, setTextureRect + /// + //////////////////////////////////////////////////////////// + Sprite(const Texture& texture, const IntRect& rectangle); + + //////////////////////////////////////////////////////////// + /// \brief Change the source texture of the sprite + /// + /// The \a texture argument refers to a texture that must + /// exist as long as the sprite uses it. Indeed, the sprite + /// doesn't store its own copy of the texture, but rather keeps + /// a pointer to the one that you passed to this function. + /// If the source texture is destroyed and the sprite tries to + /// use it, the behavior is undefined. + /// If \a resetRect is true, the TextureRect property of + /// the sprite is automatically adjusted to the size of the new + /// texture. If it is false, the texture rect is left unchanged. + /// + /// \param texture New texture + /// \param resetRect Should the texture rect be reset to the size of the new texture? + /// + /// \see getTexture, setTextureRect + /// + //////////////////////////////////////////////////////////// + void setTexture(const Texture& texture, bool resetRect = false); + + //////////////////////////////////////////////////////////// + /// \brief Set the sub-rectangle of the texture that the sprite will display + /// + /// The texture rect is useful when you don't want to display + /// the whole texture, but rather a part of it. + /// By default, the texture rect covers the entire texture. + /// + /// \param rectangle Rectangle defining the region of the texture to display + /// + /// \see getTextureRect, setTexture + /// + //////////////////////////////////////////////////////////// + void setTextureRect(const IntRect& rectangle); + + //////////////////////////////////////////////////////////// + /// \brief Set the global color of the sprite + /// + /// This color is modulated (multiplied) with the sprite's + /// texture. It can be used to colorize the sprite, or change + /// its global opacity. + /// By default, the sprite's color is opaque white. + /// + /// \param color New color of the sprite + /// + /// \see getColor + /// + //////////////////////////////////////////////////////////// + void setColor(const Color& color); + + //////////////////////////////////////////////////////////// + /// \brief Get the source texture of the sprite + /// + /// If the sprite has no source texture, a NULL pointer is returned. + /// The returned pointer is const, which means that you can't + /// modify the texture when you retrieve it with this function. + /// + /// \return Pointer to the sprite's texture + /// + /// \see setTexture + /// + //////////////////////////////////////////////////////////// + const Texture* getTexture() const; + + //////////////////////////////////////////////////////////// + /// \brief Get the sub-rectangle of the texture displayed by the sprite + /// + /// \return Texture rectangle of the sprite + /// + /// \see setTextureRect + /// + //////////////////////////////////////////////////////////// + const IntRect& getTextureRect() const; + + //////////////////////////////////////////////////////////// + /// \brief Get the global color of the sprite + /// + /// \return Global color of the sprite + /// + /// \see setColor + /// + //////////////////////////////////////////////////////////// + const Color& getColor() const; + + //////////////////////////////////////////////////////////// + /// \brief Get the local bounding rectangle of the entity + /// + /// The returned rectangle is in local coordinates, which means + /// that it ignores the transformations (translation, rotation, + /// scale, ...) that are applied to the entity. + /// In other words, this function returns the bounds of the + /// entity in the entity's coordinate system. + /// + /// \return Local bounding rectangle of the entity + /// + //////////////////////////////////////////////////////////// + FloatRect getLocalBounds() const; + + //////////////////////////////////////////////////////////// + /// \brief Get the global bounding rectangle of the entity + /// + /// The returned rectangle is in global coordinates, which means + /// that it takes into account the transformations (translation, + /// rotation, scale, ...) that are applied to the entity. + /// In other words, this function returns the bounds of the + /// sprite in the global 2D world's coordinate system. + /// + /// \return Global bounding rectangle of the entity + /// + //////////////////////////////////////////////////////////// + FloatRect getGlobalBounds() const; + +private: + + //////////////////////////////////////////////////////////// + /// \brief Draw the sprite to a render target + /// + /// \param target Render target to draw to + /// \param states Current render states + /// + //////////////////////////////////////////////////////////// + virtual void draw(RenderTarget& target, RenderStates states) const; + + //////////////////////////////////////////////////////////// + /// \brief Update the vertices' positions + /// + //////////////////////////////////////////////////////////// + void updatePositions(); + + //////////////////////////////////////////////////////////// + /// \brief Update the vertices' texture coordinates + /// + //////////////////////////////////////////////////////////// + void updateTexCoords(); + + //////////////////////////////////////////////////////////// + // Member data + //////////////////////////////////////////////////////////// + Vertex m_vertices[4]; ///< Vertices defining the sprite's geometry + const Texture* m_texture; ///< Texture of the sprite + IntRect m_textureRect; ///< Rectangle defining the area of the source texture to display +}; + +} // namespace sf + + +#endif // SFML_SPRITE_HPP + + +//////////////////////////////////////////////////////////// +/// \class sf::Sprite +/// \ingroup graphics +/// +/// sf::Sprite is a drawable class that allows to easily display +/// a texture (or a part of it) on a render target. +/// +/// It inherits all the functions from sf::Transformable: +/// position, rotation, scale, origin. It also adds sprite-specific +/// properties such as the texture to use, the part of it to display, +/// and some convenience functions to change the overall color of the +/// sprite, or to get its bounding rectangle. +/// +/// sf::Sprite works in combination with the sf::Texture class, which +/// loads and provides the pixel data of a given texture. +/// +/// The separation of sf::Sprite and sf::Texture allows more flexibility +/// and better performances: indeed a sf::Texture is a heavy resource, +/// and any operation on it is slow (often too slow for real-time +/// applications). On the other side, a sf::Sprite is a lightweight +/// object which can use the pixel data of a sf::Texture and draw +/// it with its own transformation/color/blending attributes. +/// +/// It is important to note that the sf::Sprite instance doesn't +/// copy the texture that it uses, it only keeps a reference to it. +/// Thus, a sf::Texture must not be destroyed while it is +/// used by a sf::Sprite (i.e. never write a function that +/// uses a local sf::Texture instance for creating a sprite). +/// +/// See also the note on coordinates and undistorted rendering in sf::Transformable. +/// +/// Usage example: +/// \code +/// // Declare and load a texture +/// sf::Texture texture; +/// texture.loadFromFile("texture.png"); +/// +/// // Create a sprite +/// sf::Sprite sprite; +/// sprite.setTexture(texture); +/// sprite.setTextureRect(sf::IntRect(10, 10, 50, 30)); +/// sprite.setColor(sf::Color(255, 255, 255, 200)); +/// sprite.setPosition(100, 25); +/// +/// // Draw it +/// window.draw(sprite); +/// \endcode +/// +/// \see sf::Texture, sf::Transformable +/// +//////////////////////////////////////////////////////////// diff --git a/mcclone/external/sfml23/include/SFML/Graphics/Text.hpp b/mcclone/external/sfml23/include/SFML/Graphics/Text.hpp new file mode 100644 index 0000000..c31ec61 --- /dev/null +++ b/mcclone/external/sfml23/include/SFML/Graphics/Text.hpp @@ -0,0 +1,372 @@ +//////////////////////////////////////////////////////////// +// +// SFML - Simple and Fast Multimedia Library +// Copyright (C) 2007-2015 Laurent Gomila (laurent@sfml-dev.org) +// +// This software is provided 'as-is', without any express or implied warranty. +// In no event will the authors be held liable for any damages arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it freely, +// subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; +// you must not claim that you wrote the original software. +// If you use this software in a product, an acknowledgment +// in the product documentation would be appreciated but is not required. +// +// 2. Altered source versions must be plainly marked as such, +// and must not be misrepresented as being the original software. +// +// 3. This notice may not be removed or altered from any source distribution. +// +//////////////////////////////////////////////////////////// + +#ifndef SFML_TEXT_HPP +#define SFML_TEXT_HPP + +//////////////////////////////////////////////////////////// +// Headers +//////////////////////////////////////////////////////////// +#include +#include +#include +#include +#include +#include +#include +#include +#include + + +namespace sf +{ +//////////////////////////////////////////////////////////// +/// \brief Graphical text that can be drawn to a render target +/// +//////////////////////////////////////////////////////////// +class SFML_GRAPHICS_API Text : public Drawable, public Transformable +{ +public: + + //////////////////////////////////////////////////////////// + /// \brief Enumeration of the string drawing styles + /// + //////////////////////////////////////////////////////////// + enum Style + { + Regular = 0, ///< Regular characters, no style + Bold = 1 << 0, ///< Bold characters + Italic = 1 << 1, ///< Italic characters + Underlined = 1 << 2, ///< Underlined characters + StrikeThrough = 1 << 3 ///< Strike through characters + }; + + //////////////////////////////////////////////////////////// + /// \brief Default constructor + /// + /// Creates an empty text. + /// + //////////////////////////////////////////////////////////// + Text(); + + //////////////////////////////////////////////////////////// + /// \brief Construct the text from a string, font and size + /// + /// Note that if the used font is a bitmap font, it is not + /// scalable, thus not all requested sizes will be available + /// to use. This needs to be taken into consideration when + /// setting the character size. If you need to display text + /// of a certain size, make sure the corresponding bitmap + /// font that supports that size is used. + /// + /// \param string Text assigned to the string + /// \param font Font used to draw the string + /// \param characterSize Base size of characters, in pixels + /// + //////////////////////////////////////////////////////////// + Text(const String& string, const Font& font, unsigned int characterSize = 30); + + //////////////////////////////////////////////////////////// + /// \brief Set the text's string + /// + /// The \a string argument is a sf::String, which can + /// automatically be constructed from standard string types. + /// So, the following calls are all valid: + /// \code + /// text.setString("hello"); + /// text.setString(L"hello"); + /// text.setString(std::string("hello")); + /// text.setString(std::wstring(L"hello")); + /// \endcode + /// A text's string is empty by default. + /// + /// \param string New string + /// + /// \see getString + /// + //////////////////////////////////////////////////////////// + void setString(const String& string); + + //////////////////////////////////////////////////////////// + /// \brief Set the text's font + /// + /// The \a font argument refers to a font that must + /// exist as long as the text uses it. Indeed, the text + /// doesn't store its own copy of the font, but rather keeps + /// a pointer to the one that you passed to this function. + /// If the font is destroyed and the text tries to + /// use it, the behavior is undefined. + /// + /// \param font New font + /// + /// \see getFont + /// + //////////////////////////////////////////////////////////// + void setFont(const Font& font); + + //////////////////////////////////////////////////////////// + /// \brief Set the character size + /// + /// The default size is 30. + /// + /// Note that if the used font is a bitmap font, it is not + /// scalable, thus not all requested sizes will be available + /// to use. This needs to be taken into consideration when + /// setting the character size. If you need to display text + /// of a certain size, make sure the corresponding bitmap + /// font that supports that size is used. + /// + /// \param size New character size, in pixels + /// + /// \see getCharacterSize + /// + //////////////////////////////////////////////////////////// + void setCharacterSize(unsigned int size); + + //////////////////////////////////////////////////////////// + /// \brief Set the text's style + /// + /// You can pass a combination of one or more styles, for + /// example sf::Text::Bold | sf::Text::Italic. + /// The default style is sf::Text::Regular. + /// + /// \param style New style + /// + /// \see getStyle + /// + //////////////////////////////////////////////////////////// + void setStyle(Uint32 style); + + //////////////////////////////////////////////////////////// + /// \brief Set the global color of the text + /// + /// By default, the text's color is opaque white. + /// + /// \param color New color of the text + /// + /// \see getColor + /// + //////////////////////////////////////////////////////////// + void setColor(const Color& color); + + //////////////////////////////////////////////////////////// + /// \brief Get the text's string + /// + /// The returned string is a sf::String, which can automatically + /// be converted to standard string types. So, the following + /// lines of code are all valid: + /// \code + /// sf::String s1 = text.getString(); + /// std::string s2 = text.getString(); + /// std::wstring s3 = text.getString(); + /// \endcode + /// + /// \return Text's string + /// + /// \see setString + /// + //////////////////////////////////////////////////////////// + const String& getString() const; + + //////////////////////////////////////////////////////////// + /// \brief Get the text's font + /// + /// If the text has no font attached, a NULL pointer is returned. + /// The returned pointer is const, which means that you + /// cannot modify the font when you get it from this function. + /// + /// \return Pointer to the text's font + /// + /// \see setFont + /// + //////////////////////////////////////////////////////////// + const Font* getFont() const; + + //////////////////////////////////////////////////////////// + /// \brief Get the character size + /// + /// \return Size of the characters, in pixels + /// + /// \see setCharacterSize + /// + //////////////////////////////////////////////////////////// + unsigned int getCharacterSize() const; + + //////////////////////////////////////////////////////////// + /// \brief Get the text's style + /// + /// \return Text's style + /// + /// \see setStyle + /// + //////////////////////////////////////////////////////////// + Uint32 getStyle() const; + + //////////////////////////////////////////////////////////// + /// \brief Get the global color of the text + /// + /// \return Global color of the text + /// + /// \see setColor + /// + //////////////////////////////////////////////////////////// + const Color& getColor() const; + + //////////////////////////////////////////////////////////// + /// \brief Return the position of the \a index-th character + /// + /// This function computes the visual position of a character + /// from its index in the string. The returned position is + /// in global coordinates (translation, rotation, scale and + /// origin are applied). + /// If \a index is out of range, the position of the end of + /// the string is returned. + /// + /// \param index Index of the character + /// + /// \return Position of the character + /// + //////////////////////////////////////////////////////////// + Vector2f findCharacterPos(std::size_t index) const; + + //////////////////////////////////////////////////////////// + /// \brief Get the local bounding rectangle of the entity + /// + /// The returned rectangle is in local coordinates, which means + /// that it ignores the transformations (translation, rotation, + /// scale, ...) that are applied to the entity. + /// In other words, this function returns the bounds of the + /// entity in the entity's coordinate system. + /// + /// \return Local bounding rectangle of the entity + /// + //////////////////////////////////////////////////////////// + FloatRect getLocalBounds() const; + + //////////////////////////////////////////////////////////// + /// \brief Get the global bounding rectangle of the entity + /// + /// The returned rectangle is in global coordinates, which means + /// that it takes into account the transformations (translation, + /// rotation, scale, ...) that are applied to the entity. + /// In other words, this function returns the bounds of the + /// text in the global 2D world's coordinate system. + /// + /// \return Global bounding rectangle of the entity + /// + //////////////////////////////////////////////////////////// + FloatRect getGlobalBounds() const; + +private: + + //////////////////////////////////////////////////////////// + /// \brief Draw the text to a render target + /// + /// \param target Render target to draw to + /// \param states Current render states + /// + //////////////////////////////////////////////////////////// + virtual void draw(RenderTarget& target, RenderStates states) const; + + //////////////////////////////////////////////////////////// + /// \brief Make sure the text's geometry is updated + /// + /// All the attributes related to rendering are cached, such + /// that the geometry is only updated when necessary. + /// + //////////////////////////////////////////////////////////// + void ensureGeometryUpdate() const; + + //////////////////////////////////////////////////////////// + // Member data + //////////////////////////////////////////////////////////// + String m_string; ///< String to display + const Font* m_font; ///< Font used to display the string + unsigned int m_characterSize; ///< Base size of characters, in pixels + Uint32 m_style; ///< Text style (see Style enum) + Color m_color; ///< Text color + mutable VertexArray m_vertices; ///< Vertex array containing the text's geometry + mutable FloatRect m_bounds; ///< Bounding rectangle of the text (in local coordinates) + mutable bool m_geometryNeedUpdate; ///< Does the geometry need to be recomputed? +}; + +} // namespace sf + + +#endif // SFML_TEXT_HPP + + +//////////////////////////////////////////////////////////// +/// \class sf::Text +/// \ingroup graphics +/// +/// sf::Text is a drawable class that allows to easily display +/// some text with custom style and color on a render target. +/// +/// It inherits all the functions from sf::Transformable: +/// position, rotation, scale, origin. It also adds text-specific +/// properties such as the font to use, the character size, +/// the font style (bold, italic, underlined, strike through), the +/// global color and the text to display of course. +/// It also provides convenience functions to calculate the +/// graphical size of the text, or to get the global position +/// of a given character. +/// +/// sf::Text works in combination with the sf::Font class, which +/// loads and provides the glyphs (visual characters) of a given font. +/// +/// The separation of sf::Font and sf::Text allows more flexibility +/// and better performances: indeed a sf::Font is a heavy resource, +/// and any operation on it is slow (often too slow for real-time +/// applications). On the other side, a sf::Text is a lightweight +/// object which can combine the glyphs data and metrics of a sf::Font +/// to display any text on a render target. +/// +/// It is important to note that the sf::Text instance doesn't +/// copy the font that it uses, it only keeps a reference to it. +/// Thus, a sf::Font must not be destructed while it is +/// used by a sf::Text (i.e. never write a function that +/// uses a local sf::Font instance for creating a text). +/// +/// See also the note on coordinates and undistorted rendering in sf::Transformable. +/// +/// Usage example: +/// \code +/// // Declare and load a font +/// sf::Font font; +/// font.loadFromFile("arial.ttf"); +/// +/// // Create a text +/// sf::Text text("hello", font); +/// text.setCharacterSize(30); +/// text.setStyle(sf::Text::Bold); +/// text.setColor(sf::Color::Red); +/// +/// // Draw it +/// window.draw(text); +/// \endcode +/// +/// \see sf::Font, sf::Transformable +/// +//////////////////////////////////////////////////////////// diff --git a/mcclone/external/sfml23/include/SFML/Graphics/Texture.hpp b/mcclone/external/sfml23/include/SFML/Graphics/Texture.hpp new file mode 100644 index 0000000..2471531 --- /dev/null +++ b/mcclone/external/sfml23/include/SFML/Graphics/Texture.hpp @@ -0,0 +1,618 @@ +//////////////////////////////////////////////////////////// +// +// SFML - Simple and Fast Multimedia Library +// Copyright (C) 2007-2015 Laurent Gomila (laurent@sfml-dev.org) +// +// This software is provided 'as-is', without any express or implied warranty. +// In no event will the authors be held liable for any damages arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it freely, +// subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; +// you must not claim that you wrote the original software. +// If you use this software in a product, an acknowledgment +// in the product documentation would be appreciated but is not required. +// +// 2. Altered source versions must be plainly marked as such, +// and must not be misrepresented as being the original software. +// +// 3. This notice may not be removed or altered from any source distribution. +// +//////////////////////////////////////////////////////////// + +#ifndef SFML_TEXTURE_HPP +#define SFML_TEXTURE_HPP + +//////////////////////////////////////////////////////////// +// Headers +//////////////////////////////////////////////////////////// +#include +#include +#include + + +namespace sf +{ +class Window; +class RenderTarget; +class RenderTexture; +class InputStream; + +//////////////////////////////////////////////////////////// +/// \brief Image living on the graphics card that can be used for drawing +/// +//////////////////////////////////////////////////////////// +class SFML_GRAPHICS_API Texture : GlResource +{ +public: + + //////////////////////////////////////////////////////////// + /// \brief Types of texture coordinates that can be used for rendering + /// + //////////////////////////////////////////////////////////// + enum CoordinateType + { + Normalized, ///< Texture coordinates in range [0 .. 1] + Pixels ///< Texture coordinates in range [0 .. size] + }; + +public: + + //////////////////////////////////////////////////////////// + /// \brief Default constructor + /// + /// Creates an empty texture. + /// + //////////////////////////////////////////////////////////// + Texture(); + + //////////////////////////////////////////////////////////// + /// \brief Copy constructor + /// + /// \param copy instance to copy + /// + //////////////////////////////////////////////////////////// + Texture(const Texture& copy); + + //////////////////////////////////////////////////////////// + /// \brief Destructor + /// + //////////////////////////////////////////////////////////// + ~Texture(); + + //////////////////////////////////////////////////////////// + /// \brief Create the texture + /// + /// If this function fails, the texture is left unchanged. + /// + /// \param width Width of the texture + /// \param height Height of the texture + /// + /// \return True if creation was successful + /// + //////////////////////////////////////////////////////////// + bool create(unsigned int width, unsigned int height); + + //////////////////////////////////////////////////////////// + /// \brief Load the texture from a file on disk + /// + /// This function is a shortcut for the following code: + /// \code + /// sf::Image image; + /// image.loadFromFile(filename); + /// texture.loadFromImage(image, area); + /// \endcode + /// + /// The \a area argument can be used to load only a sub-rectangle + /// of the whole image. If you want the entire image then leave + /// the default value (which is an empty IntRect). + /// If the \a area rectangle crosses the bounds of the image, it + /// is adjusted to fit the image size. + /// + /// The maximum size for a texture depends on the graphics + /// driver and can be retrieved with the getMaximumSize function. + /// + /// If this function fails, the texture is left unchanged. + /// + /// \param filename Path of the image file to load + /// \param area Area of the image to load + /// + /// \return True if loading was successful + /// + /// \see loadFromMemory, loadFromStream, loadFromImage + /// + //////////////////////////////////////////////////////////// + bool loadFromFile(const std::string& filename, const IntRect& area = IntRect()); + + //////////////////////////////////////////////////////////// + /// \brief Load the texture from a file in memory + /// + /// This function is a shortcut for the following code: + /// \code + /// sf::Image image; + /// image.loadFromMemory(data, size); + /// texture.loadFromImage(image, area); + /// \endcode + /// + /// The \a area argument can be used to load only a sub-rectangle + /// of the whole image. If you want the entire image then leave + /// the default value (which is an empty IntRect). + /// If the \a area rectangle crosses the bounds of the image, it + /// is adjusted to fit the image size. + /// + /// The maximum size for a texture depends on the graphics + /// driver and can be retrieved with the getMaximumSize function. + /// + /// If this function fails, the texture is left unchanged. + /// + /// \param data Pointer to the file data in memory + /// \param size Size of the data to load, in bytes + /// \param area Area of the image to load + /// + /// \return True if loading was successful + /// + /// \see loadFromFile, loadFromStream, loadFromImage + /// + //////////////////////////////////////////////////////////// + bool loadFromMemory(const void* data, std::size_t size, const IntRect& area = IntRect()); + + //////////////////////////////////////////////////////////// + /// \brief Load the texture from a custom stream + /// + /// This function is a shortcut for the following code: + /// \code + /// sf::Image image; + /// image.loadFromStream(stream); + /// texture.loadFromImage(image, area); + /// \endcode + /// + /// The \a area argument can be used to load only a sub-rectangle + /// of the whole image. If you want the entire image then leave + /// the default value (which is an empty IntRect). + /// If the \a area rectangle crosses the bounds of the image, it + /// is adjusted to fit the image size. + /// + /// The maximum size for a texture depends on the graphics + /// driver and can be retrieved with the getMaximumSize function. + /// + /// If this function fails, the texture is left unchanged. + /// + /// \param stream Source stream to read from + /// \param area Area of the image to load + /// + /// \return True if loading was successful + /// + /// \see loadFromFile, loadFromMemory, loadFromImage + /// + //////////////////////////////////////////////////////////// + bool loadFromStream(InputStream& stream, const IntRect& area = IntRect()); + + //////////////////////////////////////////////////////////// + /// \brief Load the texture from an image + /// + /// The \a area argument can be used to load only a sub-rectangle + /// of the whole image. If you want the entire image then leave + /// the default value (which is an empty IntRect). + /// If the \a area rectangle crosses the bounds of the image, it + /// is adjusted to fit the image size. + /// + /// The maximum size for a texture depends on the graphics + /// driver and can be retrieved with the getMaximumSize function. + /// + /// If this function fails, the texture is left unchanged. + /// + /// \param image Image to load into the texture + /// \param area Area of the image to load + /// + /// \return True if loading was successful + /// + /// \see loadFromFile, loadFromMemory + /// + //////////////////////////////////////////////////////////// + bool loadFromImage(const Image& image, const IntRect& area = IntRect()); + + //////////////////////////////////////////////////////////// + /// \brief Return the size of the texture + /// + /// \return Size in pixels + /// + //////////////////////////////////////////////////////////// + Vector2u getSize() const; + + //////////////////////////////////////////////////////////// + /// \brief Copy the texture pixels to an image + /// + /// This function performs a slow operation that downloads + /// the texture's pixels from the graphics card and copies + /// them to a new image, potentially applying transformations + /// to pixels if necessary (texture may be padded or flipped). + /// + /// \return Image containing the texture's pixels + /// + /// \see loadFromImage + /// + //////////////////////////////////////////////////////////// + Image copyToImage() const; + + //////////////////////////////////////////////////////////// + /// \brief Update the whole texture from an array of pixels + /// + /// The \a pixel array is assumed to have the same size as + /// the \a area rectangle, and to contain 32-bits RGBA pixels. + /// + /// No additional check is performed on the size of the pixel + /// array, passing invalid arguments will lead to an undefined + /// behavior. + /// + /// This function does nothing if \a pixels is null or if the + /// texture was not previously created. + /// + /// \param pixels Array of pixels to copy to the texture + /// + //////////////////////////////////////////////////////////// + void update(const Uint8* pixels); + + //////////////////////////////////////////////////////////// + /// \brief Update a part of the texture from an array of pixels + /// + /// The size of the \a pixel array must match the \a width and + /// \a height arguments, and it must contain 32-bits RGBA pixels. + /// + /// No additional check is performed on the size of the pixel + /// array or the bounds of the area to update, passing invalid + /// arguments will lead to an undefined behavior. + /// + /// This function does nothing if \a pixels is null or if the + /// texture was not previously created. + /// + /// \param pixels Array of pixels to copy to the texture + /// \param width Width of the pixel region contained in \a pixels + /// \param height Height of the pixel region contained in \a pixels + /// \param x X offset in the texture where to copy the source pixels + /// \param y Y offset in the texture where to copy the source pixels + /// + //////////////////////////////////////////////////////////// + void update(const Uint8* pixels, unsigned int width, unsigned int height, unsigned int x, unsigned int y); + + //////////////////////////////////////////////////////////// + /// \brief Update the texture from an image + /// + /// Although the source image can be smaller than the texture, + /// this function is usually used for updating the whole texture. + /// The other overload, which has (x, y) additional arguments, + /// is more convenient for updating a sub-area of the texture. + /// + /// No additional check is performed on the size of the image, + /// passing an image bigger than the texture will lead to an + /// undefined behavior. + /// + /// This function does nothing if the texture was not + /// previously created. + /// + /// \param image Image to copy to the texture + /// + //////////////////////////////////////////////////////////// + void update(const Image& image); + + //////////////////////////////////////////////////////////// + /// \brief Update a part of the texture from an image + /// + /// No additional check is performed on the size of the image, + /// passing an invalid combination of image size and offset + /// will lead to an undefined behavior. + /// + /// This function does nothing if the texture was not + /// previously created. + /// + /// \param image Image to copy to the texture + /// \param x X offset in the texture where to copy the source image + /// \param y Y offset in the texture where to copy the source image + /// + //////////////////////////////////////////////////////////// + void update(const Image& image, unsigned int x, unsigned int y); + + //////////////////////////////////////////////////////////// + /// \brief Update the texture from the contents of a window + /// + /// Although the source window can be smaller than the texture, + /// this function is usually used for updating the whole texture. + /// The other overload, which has (x, y) additional arguments, + /// is more convenient for updating a sub-area of the texture. + /// + /// No additional check is performed on the size of the window, + /// passing a window bigger than the texture will lead to an + /// undefined behavior. + /// + /// This function does nothing if either the texture or the window + /// was not previously created. + /// + /// \param window Window to copy to the texture + /// + //////////////////////////////////////////////////////////// + void update(const Window& window); + + //////////////////////////////////////////////////////////// + /// \brief Update a part of the texture from the contents of a window + /// + /// No additional check is performed on the size of the window, + /// passing an invalid combination of window size and offset + /// will lead to an undefined behavior. + /// + /// This function does nothing if either the texture or the window + /// was not previously created. + /// + /// \param window Window to copy to the texture + /// \param x X offset in the texture where to copy the source window + /// \param y Y offset in the texture where to copy the source window + /// + //////////////////////////////////////////////////////////// + void update(const Window& window, unsigned int x, unsigned int y); + + //////////////////////////////////////////////////////////// + /// \brief Enable or disable the smooth filter + /// + /// When the filter is activated, the texture appears smoother + /// so that pixels are less noticeable. However if you want + /// the texture to look exactly the same as its source file, + /// you should leave it disabled. + /// The smooth filter is disabled by default. + /// + /// \param smooth True to enable smoothing, false to disable it + /// + /// \see isSmooth + /// + //////////////////////////////////////////////////////////// + void setSmooth(bool smooth); + + //////////////////////////////////////////////////////////// + /// \brief Tell whether the smooth filter is enabled or not + /// + /// \return True if smoothing is enabled, false if it is disabled + /// + /// \see setSmooth + /// + //////////////////////////////////////////////////////////// + bool isSmooth() const; + + //////////////////////////////////////////////////////////// + /// \brief Enable or disable repeating + /// + /// Repeating is involved when using texture coordinates + /// outside the texture rectangle [0, 0, width, height]. + /// In this case, if repeat mode is enabled, the whole texture + /// will be repeated as many times as needed to reach the + /// coordinate (for example, if the X texture coordinate is + /// 3 * width, the texture will be repeated 3 times). + /// If repeat mode is disabled, the "extra space" will instead + /// be filled with border pixels. + /// Warning: on very old graphics cards, white pixels may appear + /// when the texture is repeated. With such cards, repeat mode + /// can be used reliably only if the texture has power-of-two + /// dimensions (such as 256x128). + /// Repeating is disabled by default. + /// + /// \param repeated True to repeat the texture, false to disable repeating + /// + /// \see isRepeated + /// + //////////////////////////////////////////////////////////// + void setRepeated(bool repeated); + + //////////////////////////////////////////////////////////// + /// \brief Tell whether the texture is repeated or not + /// + /// \return True if repeat mode is enabled, false if it is disabled + /// + /// \see setRepeated + /// + //////////////////////////////////////////////////////////// + bool isRepeated() const; + + //////////////////////////////////////////////////////////// + /// \brief Overload of assignment operator + /// + /// \param right Instance to assign + /// + /// \return Reference to self + /// + //////////////////////////////////////////////////////////// + Texture& operator =(const Texture& right); + + //////////////////////////////////////////////////////////// + /// \brief Get the underlying OpenGL handle of the texture. + /// + /// You shouldn't need to use this function, unless you have + /// very specific stuff to implement that SFML doesn't support, + /// or implement a temporary workaround until a bug is fixed. + /// + /// \return OpenGL handle of the texture or 0 if not yet created + /// + //////////////////////////////////////////////////////////// + unsigned int getNativeHandle() const; + + //////////////////////////////////////////////////////////// + /// \brief Bind a texture for rendering + /// + /// This function is not part of the graphics API, it mustn't be + /// used when drawing SFML entities. It must be used only if you + /// mix sf::Texture with OpenGL code. + /// + /// \code + /// sf::Texture t1, t2; + /// ... + /// sf::Texture::bind(&t1); + /// // draw OpenGL stuff that use t1... + /// sf::Texture::bind(&t2); + /// // draw OpenGL stuff that use t2... + /// sf::Texture::bind(NULL); + /// // draw OpenGL stuff that use no texture... + /// \endcode + /// + /// The \a coordinateType argument controls how texture + /// coordinates will be interpreted. If Normalized (the default), they + /// must be in range [0 .. 1], which is the default way of handling + /// texture coordinates with OpenGL. If Pixels, they must be given + /// in pixels (range [0 .. size]). This mode is used internally by + /// the graphics classes of SFML, it makes the definition of texture + /// coordinates more intuitive for the high-level API, users don't need + /// to compute normalized values. + /// + /// \param texture Pointer to the texture to bind, can be null to use no texture + /// \param coordinateType Type of texture coordinates to use + /// + //////////////////////////////////////////////////////////// + static void bind(const Texture* texture, CoordinateType coordinateType = Normalized); + + //////////////////////////////////////////////////////////// + /// \brief Get the maximum texture size allowed + /// + /// This maximum size is defined by the graphics driver. + /// You can expect a value of 512 pixels for low-end graphics + /// card, and up to 8192 pixels or more for newer hardware. + /// + /// Note: The first call to this function, whether by your + /// code or SFML will result in a context switch. + /// + /// \return Maximum size allowed for textures, in pixels + /// + //////////////////////////////////////////////////////////// + static unsigned int getMaximumSize(); + +private: + + friend class RenderTexture; + friend class RenderTarget; + + //////////////////////////////////////////////////////////// + /// \brief Get a valid image size according to hardware support + /// + /// This function checks whether the graphics driver supports + /// non power of two sizes or not, and adjusts the size + /// accordingly. + /// The returned size is greater than or equal to the original size. + /// + /// \param size size to convert + /// + /// \return Valid nearest size (greater than or equal to specified size) + /// + //////////////////////////////////////////////////////////// + static unsigned int getValidSize(unsigned int size); + + //////////////////////////////////////////////////////////// + // Member data + //////////////////////////////////////////////////////////// + Vector2u m_size; ///< Public texture size + Vector2u m_actualSize; ///< Actual texture size (can be greater than public size because of padding) + unsigned int m_texture; ///< Internal texture identifier + bool m_isSmooth; ///< Status of the smooth filter + bool m_isRepeated; ///< Is the texture in repeat mode? + mutable bool m_pixelsFlipped; ///< To work around the inconsistency in Y orientation + bool m_fboAttachment; ///< Is this texture owned by a framebuffer object? + Uint64 m_cacheId; ///< Unique number that identifies the texture to the render target's cache +}; + +} // namespace sf + + +#endif // SFML_TEXTURE_HPP + +//////////////////////////////////////////////////////////// +/// \class sf::Texture +/// \ingroup graphics +/// +/// sf::Texture stores pixels that can be drawn, with a sprite +/// for example. A texture lives in the graphics card memory, +/// therefore it is very fast to draw a texture to a render target, +/// or copy a render target to a texture (the graphics card can +/// access both directly). +/// +/// Being stored in the graphics card memory has some drawbacks. +/// A texture cannot be manipulated as freely as a sf::Image, +/// you need to prepare the pixels first and then upload them +/// to the texture in a single operation (see Texture::update). +/// +/// sf::Texture makes it easy to convert from/to sf::Image, but +/// keep in mind that these calls require transfers between +/// the graphics card and the central memory, therefore they are +/// slow operations. +/// +/// A texture can be loaded from an image, but also directly +/// from a file/memory/stream. The necessary shortcuts are defined +/// so that you don't need an image first for the most common cases. +/// However, if you want to perform some modifications on the pixels +/// before creating the final texture, you can load your file to a +/// sf::Image, do whatever you need with the pixels, and then call +/// Texture::loadFromImage. +/// +/// Since they live in the graphics card memory, the pixels of a texture +/// cannot be accessed without a slow copy first. And they cannot be +/// accessed individually. Therefore, if you need to read the texture's +/// pixels (like for pixel-perfect collisions), it is recommended to +/// store the collision information separately, for example in an array +/// of booleans. +/// +/// Like sf::Image, sf::Texture can handle a unique internal +/// representation of pixels, which is RGBA 32 bits. This means +/// that a pixel must be composed of 8 bits red, green, blue and +/// alpha channels -- just like a sf::Color. +/// +/// Usage example: +/// \code +/// // This example shows the most common use of sf::Texture: +/// // drawing a sprite +/// +/// // Load a texture from a file +/// sf::Texture texture; +/// if (!texture.loadFromFile("texture.png")) +/// return -1; +/// +/// // Assign it to a sprite +/// sf::Sprite sprite; +/// sprite.setTexture(texture); +/// +/// // Draw the textured sprite +/// window.draw(sprite); +/// \endcode +/// +/// \code +/// // This example shows another common use of sf::Texture: +/// // streaming real-time data, like video frames +/// +/// // Create an empty texture +/// sf::Texture texture; +/// if (!texture.create(640, 480)) +/// return -1; +/// +/// // Create a sprite that will display the texture +/// sf::Sprite sprite(texture); +/// +/// while (...) // the main loop +/// { +/// ... +/// +/// // update the texture +/// sf::Uint8* pixels = ...; // get a fresh chunk of pixels (the next frame of a movie, for example) +/// texture.update(pixels); +/// +/// // draw it +/// window.draw(sprite); +/// +/// ... +/// } +/// +/// \endcode +/// +/// Like sf::Shader that can be used as a raw OpenGL shader, +/// sf::Texture can also be used directly as a raw texture for +/// custom OpenGL geometry. +/// \code +/// sf::Texture::bind(&texture); +/// ... render OpenGL geometry ... +/// sf::Texture::bind(NULL); +/// \endcode +/// +/// \see sf::Sprite, sf::Image, sf::RenderTexture +/// +//////////////////////////////////////////////////////////// diff --git a/mcclone/external/sfml23/include/SFML/Graphics/Transform.hpp b/mcclone/external/sfml23/include/SFML/Graphics/Transform.hpp new file mode 100644 index 0000000..a555a33 --- /dev/null +++ b/mcclone/external/sfml23/include/SFML/Graphics/Transform.hpp @@ -0,0 +1,450 @@ +//////////////////////////////////////////////////////////// +// +// SFML - Simple and Fast Multimedia Library +// Copyright (C) 2007-2015 Laurent Gomila (laurent@sfml-dev.org) +// +// This software is provided 'as-is', without any express or implied warranty. +// In no event will the authors be held liable for any damages arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it freely, +// subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; +// you must not claim that you wrote the original software. +// If you use this software in a product, an acknowledgment +// in the product documentation would be appreciated but is not required. +// +// 2. Altered source versions must be plainly marked as such, +// and must not be misrepresented as being the original software. +// +// 3. This notice may not be removed or altered from any source distribution. +// +//////////////////////////////////////////////////////////// + +#ifndef SFML_TRANSFORM_HPP +#define SFML_TRANSFORM_HPP + +//////////////////////////////////////////////////////////// +// Headers +//////////////////////////////////////////////////////////// +#include +#include +#include + + +namespace sf +{ +//////////////////////////////////////////////////////////// +/// \brief Define a 3x3 transform matrix +/// +//////////////////////////////////////////////////////////// +class SFML_GRAPHICS_API Transform +{ +public: + + //////////////////////////////////////////////////////////// + /// \brief Default constructor + /// + /// Creates an identity transform (a transform that does nothing). + /// + //////////////////////////////////////////////////////////// + Transform(); + + //////////////////////////////////////////////////////////// + /// \brief Construct a transform from a 3x3 matrix + /// + /// \param a00 Element (0, 0) of the matrix + /// \param a01 Element (0, 1) of the matrix + /// \param a02 Element (0, 2) of the matrix + /// \param a10 Element (1, 0) of the matrix + /// \param a11 Element (1, 1) of the matrix + /// \param a12 Element (1, 2) of the matrix + /// \param a20 Element (2, 0) of the matrix + /// \param a21 Element (2, 1) of the matrix + /// \param a22 Element (2, 2) of the matrix + /// + //////////////////////////////////////////////////////////// + Transform(float a00, float a01, float a02, + float a10, float a11, float a12, + float a20, float a21, float a22); + + //////////////////////////////////////////////////////////// + /// \brief Return the transform as a 4x4 matrix + /// + /// This function returns a pointer to an array of 16 floats + /// containing the transform elements as a 4x4 matrix, which + /// is directly compatible with OpenGL functions. + /// + /// \code + /// sf::Transform transform = ...; + /// glLoadMatrixf(transform.getMatrix()); + /// \endcode + /// + /// \return Pointer to a 4x4 matrix + /// + //////////////////////////////////////////////////////////// + const float* getMatrix() const; + + //////////////////////////////////////////////////////////// + /// \brief Return the inverse of the transform + /// + /// If the inverse cannot be computed, an identity transform + /// is returned. + /// + /// \return A new transform which is the inverse of self + /// + //////////////////////////////////////////////////////////// + Transform getInverse() const; + + //////////////////////////////////////////////////////////// + /// \brief Transform a 2D point + /// + /// \param x X coordinate of the point to transform + /// \param y Y coordinate of the point to transform + /// + /// \return Transformed point + /// + //////////////////////////////////////////////////////////// + Vector2f transformPoint(float x, float y) const; + + //////////////////////////////////////////////////////////// + /// \brief Transform a 2D point + /// + /// \param point Point to transform + /// + /// \return Transformed point + /// + //////////////////////////////////////////////////////////// + Vector2f transformPoint(const Vector2f& point) const; + + //////////////////////////////////////////////////////////// + /// \brief Transform a rectangle + /// + /// Since SFML doesn't provide support for oriented rectangles, + /// the result of this function is always an axis-aligned + /// rectangle. Which means that if the transform contains a + /// rotation, the bounding rectangle of the transformed rectangle + /// is returned. + /// + /// \param rectangle Rectangle to transform + /// + /// \return Transformed rectangle + /// + //////////////////////////////////////////////////////////// + FloatRect transformRect(const FloatRect& rectangle) const; + + //////////////////////////////////////////////////////////// + /// \brief Combine the current transform with another one + /// + /// The result is a transform that is equivalent to applying + /// *this followed by \a transform. Mathematically, it is + /// equivalent to a matrix multiplication. + /// + /// \param transform Transform to combine with this transform + /// + /// \return Reference to *this + /// + //////////////////////////////////////////////////////////// + Transform& combine(const Transform& transform); + + //////////////////////////////////////////////////////////// + /// \brief Combine the current transform with a translation + /// + /// This function returns a reference to *this, so that calls + /// can be chained. + /// \code + /// sf::Transform transform; + /// transform.translate(100, 200).rotate(45); + /// \endcode + /// + /// \param x Offset to apply on X axis + /// \param y Offset to apply on Y axis + /// + /// \return Reference to *this + /// + /// \see rotate, scale + /// + //////////////////////////////////////////////////////////// + Transform& translate(float x, float y); + + //////////////////////////////////////////////////////////// + /// \brief Combine the current transform with a translation + /// + /// This function returns a reference to *this, so that calls + /// can be chained. + /// \code + /// sf::Transform transform; + /// transform.translate(sf::Vector2f(100, 200)).rotate(45); + /// \endcode + /// + /// \param offset Translation offset to apply + /// + /// \return Reference to *this + /// + /// \see rotate, scale + /// + //////////////////////////////////////////////////////////// + Transform& translate(const Vector2f& offset); + + //////////////////////////////////////////////////////////// + /// \brief Combine the current transform with a rotation + /// + /// This function returns a reference to *this, so that calls + /// can be chained. + /// \code + /// sf::Transform transform; + /// transform.rotate(90).translate(50, 20); + /// \endcode + /// + /// \param angle Rotation angle, in degrees + /// + /// \return Reference to *this + /// + /// \see translate, scale + /// + //////////////////////////////////////////////////////////// + Transform& rotate(float angle); + + //////////////////////////////////////////////////////////// + /// \brief Combine the current transform with a rotation + /// + /// The center of rotation is provided for convenience as a second + /// argument, so that you can build rotations around arbitrary points + /// more easily (and efficiently) than the usual + /// translate(-center).rotate(angle).translate(center). + /// + /// This function returns a reference to *this, so that calls + /// can be chained. + /// \code + /// sf::Transform transform; + /// transform.rotate(90, 8, 3).translate(50, 20); + /// \endcode + /// + /// \param angle Rotation angle, in degrees + /// \param centerX X coordinate of the center of rotation + /// \param centerY Y coordinate of the center of rotation + /// + /// \return Reference to *this + /// + /// \see translate, scale + /// + //////////////////////////////////////////////////////////// + Transform& rotate(float angle, float centerX, float centerY); + + //////////////////////////////////////////////////////////// + /// \brief Combine the current transform with a rotation + /// + /// The center of rotation is provided for convenience as a second + /// argument, so that you can build rotations around arbitrary points + /// more easily (and efficiently) than the usual + /// translate(-center).rotate(angle).translate(center). + /// + /// This function returns a reference to *this, so that calls + /// can be chained. + /// \code + /// sf::Transform transform; + /// transform.rotate(90, sf::Vector2f(8, 3)).translate(sf::Vector2f(50, 20)); + /// \endcode + /// + /// \param angle Rotation angle, in degrees + /// \param center Center of rotation + /// + /// \return Reference to *this + /// + /// \see translate, scale + /// + //////////////////////////////////////////////////////////// + Transform& rotate(float angle, const Vector2f& center); + + //////////////////////////////////////////////////////////// + /// \brief Combine the current transform with a scaling + /// + /// This function returns a reference to *this, so that calls + /// can be chained. + /// \code + /// sf::Transform transform; + /// transform.scale(2, 1).rotate(45); + /// \endcode + /// + /// \param scaleX Scaling factor on the X axis + /// \param scaleY Scaling factor on the Y axis + /// + /// \return Reference to *this + /// + /// \see translate, rotate + /// + //////////////////////////////////////////////////////////// + Transform& scale(float scaleX, float scaleY); + + //////////////////////////////////////////////////////////// + /// \brief Combine the current transform with a scaling + /// + /// The center of scaling is provided for convenience as a second + /// argument, so that you can build scaling around arbitrary points + /// more easily (and efficiently) than the usual + /// translate(-center).scale(factors).translate(center). + /// + /// This function returns a reference to *this, so that calls + /// can be chained. + /// \code + /// sf::Transform transform; + /// transform.scale(2, 1, 8, 3).rotate(45); + /// \endcode + /// + /// \param scaleX Scaling factor on X axis + /// \param scaleY Scaling factor on Y axis + /// \param centerX X coordinate of the center of scaling + /// \param centerY Y coordinate of the center of scaling + /// + /// \return Reference to *this + /// + /// \see translate, rotate + /// + //////////////////////////////////////////////////////////// + Transform& scale(float scaleX, float scaleY, float centerX, float centerY); + + //////////////////////////////////////////////////////////// + /// \brief Combine the current transform with a scaling + /// + /// This function returns a reference to *this, so that calls + /// can be chained. + /// \code + /// sf::Transform transform; + /// transform.scale(sf::Vector2f(2, 1)).rotate(45); + /// \endcode + /// + /// \param factors Scaling factors + /// + /// \return Reference to *this + /// + /// \see translate, rotate + /// + //////////////////////////////////////////////////////////// + Transform& scale(const Vector2f& factors); + + //////////////////////////////////////////////////////////// + /// \brief Combine the current transform with a scaling + /// + /// The center of scaling is provided for convenience as a second + /// argument, so that you can build scaling around arbitrary points + /// more easily (and efficiently) than the usual + /// translate(-center).scale(factors).translate(center). + /// + /// This function returns a reference to *this, so that calls + /// can be chained. + /// \code + /// sf::Transform transform; + /// transform.scale(sf::Vector2f(2, 1), sf::Vector2f(8, 3)).rotate(45); + /// \endcode + /// + /// \param factors Scaling factors + /// \param center Center of scaling + /// + /// \return Reference to *this + /// + /// \see translate, rotate + /// + //////////////////////////////////////////////////////////// + Transform& scale(const Vector2f& factors, const Vector2f& center); + + //////////////////////////////////////////////////////////// + // Static member data + //////////////////////////////////////////////////////////// + static const Transform Identity; ///< The identity transform (does nothing) + +private: + + //////////////////////////////////////////////////////////// + // Member data + //////////////////////////////////////////////////////////// + float m_matrix[16]; ///< 4x4 matrix defining the transformation +}; + +//////////////////////////////////////////////////////////// +/// \relates sf::Transform +/// \brief Overload of binary operator * to combine two transforms +/// +/// This call is equivalent to calling Transform(left).combine(right). +/// +/// \param left Left operand (the first transform) +/// \param right Right operand (the second transform) +/// +/// \return New combined transform +/// +//////////////////////////////////////////////////////////// +SFML_GRAPHICS_API Transform operator *(const Transform& left, const Transform& right); + +//////////////////////////////////////////////////////////// +/// \relates sf::Transform +/// \brief Overload of binary operator *= to combine two transforms +/// +/// This call is equivalent to calling left.combine(right). +/// +/// \param left Left operand (the first transform) +/// \param right Right operand (the second transform) +/// +/// \return The combined transform +/// +//////////////////////////////////////////////////////////// +SFML_GRAPHICS_API Transform& operator *=(Transform& left, const Transform& right); + +//////////////////////////////////////////////////////////// +/// \relates sf::Transform +/// \brief Overload of binary operator * to transform a point +/// +/// This call is equivalent to calling left.transformPoint(right). +/// +/// \param left Left operand (the transform) +/// \param right Right operand (the point to transform) +/// +/// \return New transformed point +/// +//////////////////////////////////////////////////////////// +SFML_GRAPHICS_API Vector2f operator *(const Transform& left, const Vector2f& right); + +} // namespace sf + + +#endif // SFML_TRANSFORM_HPP + + +//////////////////////////////////////////////////////////// +/// \class sf::Transform +/// \ingroup graphics +/// +/// A sf::Transform specifies how to translate, rotate, scale, +/// shear, project, whatever things. In mathematical terms, it defines +/// how to transform a coordinate system into another. +/// +/// For example, if you apply a rotation transform to a sprite, the +/// result will be a rotated sprite. And anything that is transformed +/// by this rotation transform will be rotated the same way, according +/// to its initial position. +/// +/// Transforms are typically used for drawing. But they can also be +/// used for any computation that requires to transform points between +/// the local and global coordinate systems of an entity (like collision +/// detection). +/// +/// Example: +/// \code +/// // define a translation transform +/// sf::Transform translation; +/// translation.translate(20, 50); +/// +/// // define a rotation transform +/// sf::Transform rotation; +/// rotation.rotate(45); +/// +/// // combine them +/// sf::Transform transform = translation * rotation; +/// +/// // use the result to transform stuff... +/// sf::Vector2f point = transform.transformPoint(10, 20); +/// sf::FloatRect rect = transform.transformRect(sf::FloatRect(0, 0, 10, 100)); +/// \endcode +/// +/// \see sf::Transformable, sf::RenderStates +/// +//////////////////////////////////////////////////////////// diff --git a/mcclone/external/sfml23/include/SFML/Graphics/Transformable.hpp b/mcclone/external/sfml23/include/SFML/Graphics/Transformable.hpp new file mode 100644 index 0000000..e4b86cf --- /dev/null +++ b/mcclone/external/sfml23/include/SFML/Graphics/Transformable.hpp @@ -0,0 +1,429 @@ +//////////////////////////////////////////////////////////// +// +// SFML - Simple and Fast Multimedia Library +// Copyright (C) 2007-2015 Laurent Gomila (laurent@sfml-dev.org) +// +// This software is provided 'as-is', without any express or implied warranty. +// In no event will the authors be held liable for any damages arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it freely, +// subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; +// you must not claim that you wrote the original software. +// If you use this software in a product, an acknowledgment +// in the product documentation would be appreciated but is not required. +// +// 2. Altered source versions must be plainly marked as such, +// and must not be misrepresented as being the original software. +// +// 3. This notice may not be removed or altered from any source distribution. +// +//////////////////////////////////////////////////////////// + +#ifndef SFML_TRANSFORMABLE_HPP +#define SFML_TRANSFORMABLE_HPP + +//////////////////////////////////////////////////////////// +// Headers +//////////////////////////////////////////////////////////// +#include +#include + + +namespace sf +{ +//////////////////////////////////////////////////////////// +/// \brief Decomposed transform defined by a position, a rotation and a scale +/// +//////////////////////////////////////////////////////////// +class SFML_GRAPHICS_API Transformable +{ +public: + + //////////////////////////////////////////////////////////// + /// \brief Default constructor + /// + //////////////////////////////////////////////////////////// + Transformable(); + + //////////////////////////////////////////////////////////// + /// \brief Virtual destructor + /// + //////////////////////////////////////////////////////////// + virtual ~Transformable(); + + //////////////////////////////////////////////////////////// + /// \brief set the position of the object + /// + /// This function completely overwrites the previous position. + /// See the move function to apply an offset based on the previous position instead. + /// The default position of a transformable object is (0, 0). + /// + /// \param x X coordinate of the new position + /// \param y Y coordinate of the new position + /// + /// \see move, getPosition + /// + //////////////////////////////////////////////////////////// + void setPosition(float x, float y); + + //////////////////////////////////////////////////////////// + /// \brief set the position of the object + /// + /// This function completely overwrites the previous position. + /// See the move function to apply an offset based on the previous position instead. + /// The default position of a transformable object is (0, 0). + /// + /// \param position New position + /// + /// \see move, getPosition + /// + //////////////////////////////////////////////////////////// + void setPosition(const Vector2f& position); + + //////////////////////////////////////////////////////////// + /// \brief set the orientation of the object + /// + /// This function completely overwrites the previous rotation. + /// See the rotate function to add an angle based on the previous rotation instead. + /// The default rotation of a transformable object is 0. + /// + /// \param angle New rotation, in degrees + /// + /// \see rotate, getRotation + /// + //////////////////////////////////////////////////////////// + void setRotation(float angle); + + //////////////////////////////////////////////////////////// + /// \brief set the scale factors of the object + /// + /// This function completely overwrites the previous scale. + /// See the scale function to add a factor based on the previous scale instead. + /// The default scale of a transformable object is (1, 1). + /// + /// \param factorX New horizontal scale factor + /// \param factorY New vertical scale factor + /// + /// \see scale, getScale + /// + //////////////////////////////////////////////////////////// + void setScale(float factorX, float factorY); + + //////////////////////////////////////////////////////////// + /// \brief set the scale factors of the object + /// + /// This function completely overwrites the previous scale. + /// See the scale function to add a factor based on the previous scale instead. + /// The default scale of a transformable object is (1, 1). + /// + /// \param factors New scale factors + /// + /// \see scale, getScale + /// + //////////////////////////////////////////////////////////// + void setScale(const Vector2f& factors); + + //////////////////////////////////////////////////////////// + /// \brief set the local origin of the object + /// + /// The origin of an object defines the center point for + /// all transformations (position, scale, rotation). + /// The coordinates of this point must be relative to the + /// top-left corner of the object, and ignore all + /// transformations (position, scale, rotation). + /// The default origin of a transformable object is (0, 0). + /// + /// \param x X coordinate of the new origin + /// \param y Y coordinate of the new origin + /// + /// \see getOrigin + /// + //////////////////////////////////////////////////////////// + void setOrigin(float x, float y); + + //////////////////////////////////////////////////////////// + /// \brief set the local origin of the object + /// + /// The origin of an object defines the center point for + /// all transformations (position, scale, rotation). + /// The coordinates of this point must be relative to the + /// top-left corner of the object, and ignore all + /// transformations (position, scale, rotation). + /// The default origin of a transformable object is (0, 0). + /// + /// \param origin New origin + /// + /// \see getOrigin + /// + //////////////////////////////////////////////////////////// + void setOrigin(const Vector2f& origin); + + //////////////////////////////////////////////////////////// + /// \brief get the position of the object + /// + /// \return Current position + /// + /// \see setPosition + /// + //////////////////////////////////////////////////////////// + const Vector2f& getPosition() const; + + //////////////////////////////////////////////////////////// + /// \brief get the orientation of the object + /// + /// The rotation is always in the range [0, 360]. + /// + /// \return Current rotation, in degrees + /// + /// \see setRotation + /// + //////////////////////////////////////////////////////////// + float getRotation() const; + + //////////////////////////////////////////////////////////// + /// \brief get the current scale of the object + /// + /// \return Current scale factors + /// + /// \see setScale + /// + //////////////////////////////////////////////////////////// + const Vector2f& getScale() const; + + //////////////////////////////////////////////////////////// + /// \brief get the local origin of the object + /// + /// \return Current origin + /// + /// \see setOrigin + /// + //////////////////////////////////////////////////////////// + const Vector2f& getOrigin() const; + + //////////////////////////////////////////////////////////// + /// \brief Move the object by a given offset + /// + /// This function adds to the current position of the object, + /// unlike setPosition which overwrites it. + /// Thus, it is equivalent to the following code: + /// \code + /// sf::Vector2f pos = object.getPosition(); + /// object.setPosition(pos.x + offsetX, pos.y + offsetY); + /// \endcode + /// + /// \param offsetX X offset + /// \param offsetY Y offset + /// + /// \see setPosition + /// + //////////////////////////////////////////////////////////// + void move(float offsetX, float offsetY); + + //////////////////////////////////////////////////////////// + /// \brief Move the object by a given offset + /// + /// This function adds to the current position of the object, + /// unlike setPosition which overwrites it. + /// Thus, it is equivalent to the following code: + /// \code + /// object.setPosition(object.getPosition() + offset); + /// \endcode + /// + /// \param offset Offset + /// + /// \see setPosition + /// + //////////////////////////////////////////////////////////// + void move(const Vector2f& offset); + + //////////////////////////////////////////////////////////// + /// \brief Rotate the object + /// + /// This function adds to the current rotation of the object, + /// unlike setRotation which overwrites it. + /// Thus, it is equivalent to the following code: + /// \code + /// object.setRotation(object.getRotation() + angle); + /// \endcode + /// + /// \param angle Angle of rotation, in degrees + /// + //////////////////////////////////////////////////////////// + void rotate(float angle); + + //////////////////////////////////////////////////////////// + /// \brief Scale the object + /// + /// This function multiplies the current scale of the object, + /// unlike setScale which overwrites it. + /// Thus, it is equivalent to the following code: + /// \code + /// sf::Vector2f scale = object.getScale(); + /// object.setScale(scale.x * factorX, scale.y * factorY); + /// \endcode + /// + /// \param factorX Horizontal scale factor + /// \param factorY Vertical scale factor + /// + /// \see setScale + /// + //////////////////////////////////////////////////////////// + void scale(float factorX, float factorY); + + //////////////////////////////////////////////////////////// + /// \brief Scale the object + /// + /// This function multiplies the current scale of the object, + /// unlike setScale which overwrites it. + /// Thus, it is equivalent to the following code: + /// \code + /// sf::Vector2f scale = object.getScale(); + /// object.setScale(scale.x * factor.x, scale.y * factor.y); + /// \endcode + /// + /// \param factor Scale factors + /// + /// \see setScale + /// + //////////////////////////////////////////////////////////// + void scale(const Vector2f& factor); + + //////////////////////////////////////////////////////////// + /// \brief get the combined transform of the object + /// + /// \return Transform combining the position/rotation/scale/origin of the object + /// + /// \see getInverseTransform + /// + //////////////////////////////////////////////////////////// + const Transform& getTransform() const; + + //////////////////////////////////////////////////////////// + /// \brief get the inverse of the combined transform of the object + /// + /// \return Inverse of the combined transformations applied to the object + /// + /// \see getTransform + /// + //////////////////////////////////////////////////////////// + const Transform& getInverseTransform() const; + +private: + + //////////////////////////////////////////////////////////// + // Member data + //////////////////////////////////////////////////////////// + Vector2f m_origin; ///< Origin of translation/rotation/scaling of the object + Vector2f m_position; ///< Position of the object in the 2D world + float m_rotation; ///< Orientation of the object, in degrees + Vector2f m_scale; ///< Scale of the object + mutable Transform m_transform; ///< Combined transformation of the object + mutable bool m_transformNeedUpdate; ///< Does the transform need to be recomputed? + mutable Transform m_inverseTransform; ///< Combined transformation of the object + mutable bool m_inverseTransformNeedUpdate; ///< Does the transform need to be recomputed? +}; + +} // namespace sf + + +#endif // SFML_TRANSFORMABLE_HPP + + +//////////////////////////////////////////////////////////// +/// \class sf::Transformable +/// \ingroup graphics +/// +/// This class is provided for convenience, on top of sf::Transform. +/// +/// sf::Transform, as a low-level class, offers a great level of +/// flexibility but it is not always convenient to manage. Indeed, +/// one can easily combine any kind of operation, such as a translation +/// followed by a rotation followed by a scaling, but once the result +/// transform is built, there's no way to go backward and, let's say, +/// change only the rotation without modifying the translation and scaling. +/// The entire transform must be recomputed, which means that you +/// need to retrieve the initial translation and scale factors as +/// well, and combine them the same way you did before updating the +/// rotation. This is a tedious operation, and it requires to store +/// all the individual components of the final transform. +/// +/// That's exactly what sf::Transformable was written for: it hides +/// these variables and the composed transform behind an easy to use +/// interface. You can set or get any of the individual components +/// without worrying about the others. It also provides the composed +/// transform (as a sf::Transform), and keeps it up-to-date. +/// +/// In addition to the position, rotation and scale, sf::Transformable +/// provides an "origin" component, which represents the local origin +/// of the three other components. Let's take an example with a 10x10 +/// pixels sprite. By default, the sprite is positioned/rotated/scaled +/// relatively to its top-left corner, because it is the local point +/// (0, 0). But if we change the origin to be (5, 5), the sprite will +/// be positioned/rotated/scaled around its center instead. And if +/// we set the origin to (10, 10), it will be transformed around its +/// bottom-right corner. +/// +/// To keep the sf::Transformable class simple, there's only one +/// origin for all the components. You cannot position the sprite +/// relatively to its top-left corner while rotating it around its +/// center, for example. To do such things, use sf::Transform directly. +/// +/// sf::Transformable can be used as a base class. It is often +/// combined with sf::Drawable -- that's what SFML's sprites, +/// texts and shapes do. +/// \code +/// class MyEntity : public sf::Transformable, public sf::Drawable +/// { +/// virtual void draw(sf::RenderTarget& target, sf::RenderStates states) const +/// { +/// states.transform *= getTransform(); +/// target.draw(..., states); +/// } +/// }; +/// +/// MyEntity entity; +/// entity.setPosition(10, 20); +/// entity.setRotation(45); +/// window.draw(entity); +/// \endcode +/// +/// It can also be used as a member, if you don't want to use +/// its API directly (because you don't need all its functions, +/// or you have different naming conventions for example). +/// \code +/// class MyEntity +/// { +/// public: +/// void SetPosition(const MyVector& v) +/// { +/// myTransform.setPosition(v.x(), v.y()); +/// } +/// +/// void Draw(sf::RenderTarget& target) const +/// { +/// target.draw(..., myTransform.getTransform()); +/// } +/// +/// private: +/// sf::Transformable myTransform; +/// }; +/// \endcode +/// +/// A note on coordinates and undistorted rendering: \n +/// By default, SFML (or more exactly, OpenGL) may interpolate drawable objects +/// such as sprites or texts when rendering. While this allows transitions +/// like slow movements or rotations to appear smoothly, it can lead to +/// unwanted results in some cases, for example blurred or distorted objects. +/// In order to render a sf::Drawable object pixel-perfectly, make sure +/// the involved coordinates allow a 1:1 mapping of pixels in the window +/// to texels (pixels in the texture). More specifically, this means: +/// * The object's position, origin and scale have no fractional part +/// * The object's and the view's rotation are a multiple of 90 degrees +/// * The view's center and size have no fractional part +/// +/// \see sf::Transform +/// +//////////////////////////////////////////////////////////// diff --git a/mcclone/external/sfml23/include/SFML/Graphics/Vertex.hpp b/mcclone/external/sfml23/include/SFML/Graphics/Vertex.hpp new file mode 100644 index 0000000..2509976 --- /dev/null +++ b/mcclone/external/sfml23/include/SFML/Graphics/Vertex.hpp @@ -0,0 +1,148 @@ +//////////////////////////////////////////////////////////// +// +// SFML - Simple and Fast Multimedia Library +// Copyright (C) 2007-2015 Laurent Gomila (laurent@sfml-dev.org) +// +// This software is provided 'as-is', without any express or implied warranty. +// In no event will the authors be held liable for any damages arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it freely, +// subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; +// you must not claim that you wrote the original software. +// If you use this software in a product, an acknowledgment +// in the product documentation would be appreciated but is not required. +// +// 2. Altered source versions must be plainly marked as such, +// and must not be misrepresented as being the original software. +// +// 3. This notice may not be removed or altered from any source distribution. +// +//////////////////////////////////////////////////////////// + +#ifndef SFML_VERTEX_HPP +#define SFML_VERTEX_HPP + +//////////////////////////////////////////////////////////// +// Headers +//////////////////////////////////////////////////////////// +#include +#include +#include + + +namespace sf +{ +//////////////////////////////////////////////////////////// +/// \brief Define a point with color and texture coordinates +/// +//////////////////////////////////////////////////////////// +class SFML_GRAPHICS_API Vertex +{ +public: + + //////////////////////////////////////////////////////////// + /// \brief Default constructor + /// + //////////////////////////////////////////////////////////// + Vertex(); + + //////////////////////////////////////////////////////////// + /// \brief Construct the vertex from its position + /// + /// The vertex color is white and texture coordinates are (0, 0). + /// + /// \param thePosition Vertex position + /// + //////////////////////////////////////////////////////////// + Vertex(const Vector2f& thePosition); + + //////////////////////////////////////////////////////////// + /// \brief Construct the vertex from its position and color + /// + /// The texture coordinates are (0, 0). + /// + /// \param thePosition Vertex position + /// \param theColor Vertex color + /// + //////////////////////////////////////////////////////////// + Vertex(const Vector2f& thePosition, const Color& theColor); + + //////////////////////////////////////////////////////////// + /// \brief Construct the vertex from its position and texture coordinates + /// + /// The vertex color is white. + /// + /// \param thePosition Vertex position + /// \param theTexCoords Vertex texture coordinates + /// + //////////////////////////////////////////////////////////// + Vertex(const Vector2f& thePosition, const Vector2f& theTexCoords); + + //////////////////////////////////////////////////////////// + /// \brief Construct the vertex from its position, color and texture coordinates + /// + /// \param thePosition Vertex position + /// \param theColor Vertex color + /// \param theTexCoords Vertex texture coordinates + /// + //////////////////////////////////////////////////////////// + Vertex(const Vector2f& thePosition, const Color& theColor, const Vector2f& theTexCoords); + + //////////////////////////////////////////////////////////// + // Member data + //////////////////////////////////////////////////////////// + Vector2f position; ///< 2D position of the vertex + Color color; ///< Color of the vertex + Vector2f texCoords; ///< Coordinates of the texture's pixel to map to the vertex +}; + +} // namespace sf + + +#endif // SFML_VERTEX_HPP + + +//////////////////////////////////////////////////////////// +/// \class sf::Vertex +/// \ingroup graphics +/// +/// A vertex is an improved point. It has a position and other +/// extra attributes that will be used for drawing: in SFML, +/// vertices also have a color and a pair of texture coordinates. +/// +/// The vertex is the building block of drawing. Everything which +/// is visible on screen is made of vertices. They are grouped +/// as 2D primitives (triangles, quads, ...), and these primitives +/// are grouped to create even more complex 2D entities such as +/// sprites, texts, etc. +/// +/// If you use the graphical entities of SFML (sprite, text, shape) +/// you won't have to deal with vertices directly. But if you want +/// to define your own 2D entities, such as tiled maps or particle +/// systems, using vertices will allow you to get maximum performances. +/// +/// Example: +/// \code +/// // define a 100x100 square, red, with a 10x10 texture mapped on it +/// sf::Vertex vertices[] = +/// { +/// sf::Vertex(sf::Vector2f( 0, 0), sf::Color::Red, sf::Vector2f( 0, 0)), +/// sf::Vertex(sf::Vector2f( 0, 100), sf::Color::Red, sf::Vector2f( 0, 10)), +/// sf::Vertex(sf::Vector2f(100, 100), sf::Color::Red, sf::Vector2f(10, 10)), +/// sf::Vertex(sf::Vector2f(100, 0), sf::Color::Red, sf::Vector2f(10, 0)) +/// }; +/// +/// // draw it +/// window.draw(vertices, 4, sf::Quads); +/// \endcode +/// +/// Note: although texture coordinates are supposed to be an integer +/// amount of pixels, their type is float because of some buggy graphics +/// drivers that are not able to process integer coordinates correctly. +/// +/// \see sf::VertexArray +/// +//////////////////////////////////////////////////////////// diff --git a/mcclone/external/sfml23/include/SFML/Graphics/VertexArray.hpp b/mcclone/external/sfml23/include/SFML/Graphics/VertexArray.hpp new file mode 100644 index 0000000..f0820a5 --- /dev/null +++ b/mcclone/external/sfml23/include/SFML/Graphics/VertexArray.hpp @@ -0,0 +1,223 @@ +//////////////////////////////////////////////////////////// +// +// SFML - Simple and Fast Multimedia Library +// Copyright (C) 2007-2015 Laurent Gomila (laurent@sfml-dev.org) +// +// This software is provided 'as-is', without any express or implied warranty. +// In no event will the authors be held liable for any damages arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it freely, +// subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; +// you must not claim that you wrote the original software. +// If you use this software in a product, an acknowledgment +// in the product documentation would be appreciated but is not required. +// +// 2. Altered source versions must be plainly marked as such, +// and must not be misrepresented as being the original software. +// +// 3. This notice may not be removed or altered from any source distribution. +// +//////////////////////////////////////////////////////////// + +#ifndef SFML_VERTEXARRAY_HPP +#define SFML_VERTEXARRAY_HPP + +//////////////////////////////////////////////////////////// +// Headers +//////////////////////////////////////////////////////////// +#include +#include +#include +#include +#include +#include + + +namespace sf +{ +//////////////////////////////////////////////////////////// +/// \brief Define a set of one or more 2D primitives +/// +//////////////////////////////////////////////////////////// +class SFML_GRAPHICS_API VertexArray : public Drawable +{ +public: + + //////////////////////////////////////////////////////////// + /// \brief Default constructor + /// + /// Creates an empty vertex array. + /// + //////////////////////////////////////////////////////////// + VertexArray(); + + //////////////////////////////////////////////////////////// + /// \brief Construct the vertex array with a type and an initial number of vertices + /// + /// \param type Type of primitives + /// \param vertexCount Initial number of vertices in the array + /// + //////////////////////////////////////////////////////////// + explicit VertexArray(PrimitiveType type, std::size_t vertexCount = 0); + + //////////////////////////////////////////////////////////// + /// \brief Return the vertex count + /// + /// \return Number of vertices in the array + /// + //////////////////////////////////////////////////////////// + std::size_t getVertexCount() const; + + //////////////////////////////////////////////////////////// + /// \brief Get a read-write access to a vertex by its index + /// + /// This function doesn't check \a index, it must be in range + /// [0, getVertexCount() - 1]. The behavior is undefined + /// otherwise. + /// + /// \param index Index of the vertex to get + /// + /// \return Reference to the index-th vertex + /// + /// \see getVertexCount + /// + //////////////////////////////////////////////////////////// + Vertex& operator [](std::size_t index); + + //////////////////////////////////////////////////////////// + /// \brief Get a read-only access to a vertex by its index + /// + /// This function doesn't check \a index, it must be in range + /// [0, getVertexCount() - 1]. The behavior is undefined + /// otherwise. + /// + /// \param index Index of the vertex to get + /// + /// \return Const reference to the index-th vertex + /// + /// \see getVertexCount + /// + //////////////////////////////////////////////////////////// + const Vertex& operator [](std::size_t index) const; + + //////////////////////////////////////////////////////////// + /// \brief Clear the vertex array + /// + /// This function removes all the vertices from the array. + /// It doesn't deallocate the corresponding memory, so that + /// adding new vertices after clearing doesn't involve + /// reallocating all the memory. + /// + //////////////////////////////////////////////////////////// + void clear(); + + //////////////////////////////////////////////////////////// + /// \brief Resize the vertex array + /// + /// If \a vertexCount is greater than the current size, the previous + /// vertices are kept and new (default-constructed) vertices are + /// added. + /// If \a vertexCount is less than the current size, existing vertices + /// are removed from the array. + /// + /// \param vertexCount New size of the array (number of vertices) + /// + //////////////////////////////////////////////////////////// + void resize(std::size_t vertexCount); + + //////////////////////////////////////////////////////////// + /// \brief Add a vertex to the array + /// + /// \param vertex Vertex to add + /// + //////////////////////////////////////////////////////////// + void append(const Vertex& vertex); + + //////////////////////////////////////////////////////////// + /// \brief Set the type of primitives to draw + /// + /// This function defines how the vertices must be interpreted + /// when it's time to draw them: + /// \li As points + /// \li As lines + /// \li As triangles + /// \li As quads + /// The default primitive type is sf::Points. + /// + /// \param type Type of primitive + /// + //////////////////////////////////////////////////////////// + void setPrimitiveType(PrimitiveType type); + + //////////////////////////////////////////////////////////// + /// \brief Get the type of primitives drawn by the vertex array + /// + /// \return Primitive type + /// + //////////////////////////////////////////////////////////// + PrimitiveType getPrimitiveType() const; + + //////////////////////////////////////////////////////////// + /// \brief Compute the bounding rectangle of the vertex array + /// + /// This function returns the minimal axis-aligned rectangle + /// that contains all the vertices of the array. + /// + /// \return Bounding rectangle of the vertex array + /// + //////////////////////////////////////////////////////////// + FloatRect getBounds() const; + +private: + + //////////////////////////////////////////////////////////// + /// \brief Draw the vertex array to a render target + /// + /// \param target Render target to draw to + /// \param states Current render states + /// + //////////////////////////////////////////////////////////// + virtual void draw(RenderTarget& target, RenderStates states) const; + +private: + + //////////////////////////////////////////////////////////// + // Member data + //////////////////////////////////////////////////////////// + std::vector m_vertices; ///< Vertices contained in the array + PrimitiveType m_primitiveType; ///< Type of primitives to draw +}; + +} // namespace sf + + +#endif // SFML_VERTEXARRAY_HPP + + +//////////////////////////////////////////////////////////// +/// \class sf::VertexArray +/// \ingroup graphics +/// +/// sf::VertexArray is a very simple wrapper around a dynamic +/// array of vertices and a primitives type. +/// +/// It inherits sf::Drawable, but unlike other drawables it +/// is not transformable. +/// +/// Example: +/// \code +/// sf::VertexArray lines(sf::LinesStrip, 4); +/// lines[0].position = sf::Vector2f(10, 0); +/// lines[1].position = sf::Vector2f(20, 0); +/// lines[2].position = sf::Vector2f(30, 5); +/// lines[3].position = sf::Vector2f(40, 2); +/// +/// window.draw(lines); +/// \endcode +/// +/// \see sf::Vertex +/// +//////////////////////////////////////////////////////////// diff --git a/mcclone/external/sfml23/include/SFML/Graphics/View.hpp b/mcclone/external/sfml23/include/SFML/Graphics/View.hpp new file mode 100644 index 0000000..4bd62d8 --- /dev/null +++ b/mcclone/external/sfml23/include/SFML/Graphics/View.hpp @@ -0,0 +1,343 @@ +//////////////////////////////////////////////////////////// +// +// SFML - Simple and Fast Multimedia Library +// Copyright (C) 2007-2015 Laurent Gomila (laurent@sfml-dev.org) +// +// This software is provided 'as-is', without any express or implied warranty. +// In no event will the authors be held liable for any damages arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it freely, +// subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; +// you must not claim that you wrote the original software. +// If you use this software in a product, an acknowledgment +// in the product documentation would be appreciated but is not required. +// +// 2. Altered source versions must be plainly marked as such, +// and must not be misrepresented as being the original software. +// +// 3. This notice may not be removed or altered from any source distribution. +// +//////////////////////////////////////////////////////////// + +#ifndef SFML_VIEW_HPP +#define SFML_VIEW_HPP + +//////////////////////////////////////////////////////////// +// Headers +//////////////////////////////////////////////////////////// +#include +#include +#include +#include + + +namespace sf +{ +//////////////////////////////////////////////////////////// +/// \brief 2D camera that defines what region is shown on screen +/// +//////////////////////////////////////////////////////////// +class SFML_GRAPHICS_API View +{ +public: + + //////////////////////////////////////////////////////////// + /// \brief Default constructor + /// + /// This constructor creates a default view of (0, 0, 1000, 1000) + /// + //////////////////////////////////////////////////////////// + View(); + + //////////////////////////////////////////////////////////// + /// \brief Construct the view from a rectangle + /// + /// \param rectangle Rectangle defining the zone to display + /// + //////////////////////////////////////////////////////////// + explicit View(const FloatRect& rectangle); + + //////////////////////////////////////////////////////////// + /// \brief Construct the view from its center and size + /// + /// \param center Center of the zone to display + /// \param size Size of zone to display + /// + //////////////////////////////////////////////////////////// + View(const Vector2f& center, const Vector2f& size); + + //////////////////////////////////////////////////////////// + /// \brief Set the center of the view + /// + /// \param x X coordinate of the new center + /// \param y Y coordinate of the new center + /// + /// \see setSize, getCenter + /// + //////////////////////////////////////////////////////////// + void setCenter(float x, float y); + + //////////////////////////////////////////////////////////// + /// \brief Set the center of the view + /// + /// \param center New center + /// + /// \see setSize, getCenter + /// + //////////////////////////////////////////////////////////// + void setCenter(const Vector2f& center); + + //////////////////////////////////////////////////////////// + /// \brief Set the size of the view + /// + /// \param width New width of the view + /// \param height New height of the view + /// + /// \see setCenter, getCenter + /// + //////////////////////////////////////////////////////////// + void setSize(float width, float height); + + //////////////////////////////////////////////////////////// + /// \brief Set the size of the view + /// + /// \param size New size + /// + /// \see setCenter, getCenter + /// + //////////////////////////////////////////////////////////// + void setSize(const Vector2f& size); + + //////////////////////////////////////////////////////////// + /// \brief Set the orientation of the view + /// + /// The default rotation of a view is 0 degree. + /// + /// \param angle New angle, in degrees + /// + /// \see getRotation + /// + //////////////////////////////////////////////////////////// + void setRotation(float angle); + + //////////////////////////////////////////////////////////// + /// \brief Set the target viewport + /// + /// The viewport is the rectangle into which the contents of the + /// view are displayed, expressed as a factor (between 0 and 1) + /// of the size of the RenderTarget to which the view is applied. + /// For example, a view which takes the left side of the target would + /// be defined with View.setViewport(sf::FloatRect(0, 0, 0.5, 1)). + /// By default, a view has a viewport which covers the entire target. + /// + /// \param viewport New viewport rectangle + /// + /// \see getViewport + /// + //////////////////////////////////////////////////////////// + void setViewport(const FloatRect& viewport); + + //////////////////////////////////////////////////////////// + /// \brief Reset the view to the given rectangle + /// + /// Note that this function resets the rotation angle to 0. + /// + /// \param rectangle Rectangle defining the zone to display + /// + /// \see setCenter, setSize, setRotation + /// + //////////////////////////////////////////////////////////// + void reset(const FloatRect& rectangle); + + //////////////////////////////////////////////////////////// + /// \brief Get the center of the view + /// + /// \return Center of the view + /// + /// \see getSize, setCenter + /// + //////////////////////////////////////////////////////////// + const Vector2f& getCenter() const; + + //////////////////////////////////////////////////////////// + /// \brief Get the size of the view + /// + /// \return Size of the view + /// + /// \see getCenter, setSize + /// + //////////////////////////////////////////////////////////// + const Vector2f& getSize() const; + + //////////////////////////////////////////////////////////// + /// \brief Get the current orientation of the view + /// + /// \return Rotation angle of the view, in degrees + /// + /// \see setRotation + /// + //////////////////////////////////////////////////////////// + float getRotation() const; + + //////////////////////////////////////////////////////////// + /// \brief Get the target viewport rectangle of the view + /// + /// \return Viewport rectangle, expressed as a factor of the target size + /// + /// \see setViewport + /// + //////////////////////////////////////////////////////////// + const FloatRect& getViewport() const; + + //////////////////////////////////////////////////////////// + /// \brief Move the view relatively to its current position + /// + /// \param offsetX X coordinate of the move offset + /// \param offsetY Y coordinate of the move offset + /// + /// \see setCenter, rotate, zoom + /// + //////////////////////////////////////////////////////////// + void move(float offsetX, float offsetY); + + //////////////////////////////////////////////////////////// + /// \brief Move the view relatively to its current position + /// + /// \param offset Move offset + /// + /// \see setCenter, rotate, zoom + /// + //////////////////////////////////////////////////////////// + void move(const Vector2f& offset); + + //////////////////////////////////////////////////////////// + /// \brief Rotate the view relatively to its current orientation + /// + /// \param angle Angle to rotate, in degrees + /// + /// \see setRotation, move, zoom + /// + //////////////////////////////////////////////////////////// + void rotate(float angle); + + //////////////////////////////////////////////////////////// + /// \brief Resize the view rectangle relatively to its current size + /// + /// Resizing the view simulates a zoom, as the zone displayed on + /// screen grows or shrinks. + /// \a factor is a multiplier: + /// \li 1 keeps the size unchanged + /// \li > 1 makes the view bigger (objects appear smaller) + /// \li < 1 makes the view smaller (objects appear bigger) + /// + /// \param factor Zoom factor to apply + /// + /// \see setSize, move, rotate + /// + //////////////////////////////////////////////////////////// + void zoom(float factor); + + //////////////////////////////////////////////////////////// + /// \brief Get the projection transform of the view + /// + /// This function is meant for internal use only. + /// + /// \return Projection transform defining the view + /// + /// \see getInverseTransform + /// + //////////////////////////////////////////////////////////// + const Transform& getTransform() const; + + //////////////////////////////////////////////////////////// + /// \brief Get the inverse projection transform of the view + /// + /// This function is meant for internal use only. + /// + /// \return Inverse of the projection transform defining the view + /// + /// \see getTransform + /// + //////////////////////////////////////////////////////////// + const Transform& getInverseTransform() const; + +private: + + //////////////////////////////////////////////////////////// + // Member data + //////////////////////////////////////////////////////////// + Vector2f m_center; ///< Center of the view, in scene coordinates + Vector2f m_size; ///< Size of the view, in scene coordinates + float m_rotation; ///< Angle of rotation of the view rectangle, in degrees + FloatRect m_viewport; ///< Viewport rectangle, expressed as a factor of the render-target's size + mutable Transform m_transform; ///< Precomputed projection transform corresponding to the view + mutable Transform m_inverseTransform; ///< Precomputed inverse projection transform corresponding to the view + mutable bool m_transformUpdated; ///< Internal state telling if the transform needs to be updated + mutable bool m_invTransformUpdated; ///< Internal state telling if the inverse transform needs to be updated +}; + +} // namespace sf + + +#endif // SFML_VIEW_HPP + + +//////////////////////////////////////////////////////////// +/// \class sf::View +/// \ingroup graphics +/// +/// sf::View defines a camera in the 2D scene. This is a +/// very powerful concept: you can scroll, rotate or zoom +/// the entire scene without altering the way that your +/// drawable objects are drawn. +/// +/// A view is composed of a source rectangle, which defines +/// what part of the 2D scene is shown, and a target viewport, +/// which defines where the contents of the source rectangle +/// will be displayed on the render target (window or texture). +/// +/// The viewport allows to map the scene to a custom part +/// of the render target, and can be used for split-screen +/// or for displaying a minimap, for example. If the source +/// rectangle has not the same size as the viewport, its +/// contents will be stretched to fit in. +/// +/// To apply a view, you have to assign it to the render target. +/// Then, every objects drawn in this render target will be +/// affected by the view until you use another view. +/// +/// Usage example: +/// \code +/// sf::RenderWindow window; +/// sf::View view; +/// +/// // Initialize the view to a rectangle located at (100, 100) and with a size of 400x200 +/// view.reset(sf::FloatRect(100, 100, 400, 200)); +/// +/// // Rotate it by 45 degrees +/// view.rotate(45); +/// +/// // Set its target viewport to be half of the window +/// view.setViewport(sf::FloatRect(0.f, 0.f, 0.5f, 1.f)); +/// +/// // Apply it +/// window.setView(view); +/// +/// // Render stuff +/// window.draw(someSprite); +/// +/// // Set the default view back +/// window.setView(window.getDefaultView()); +/// +/// // Render stuff not affected by the view +/// window.draw(someText); +/// \endcode +/// +/// See also the note on coordinates and undistorted rendering in sf::Transformable. +/// +/// \see sf::RenderWindow, sf::RenderTexture +/// +//////////////////////////////////////////////////////////// diff --git a/mcclone/external/sfml23/include/SFML/Main.hpp b/mcclone/external/sfml23/include/SFML/Main.hpp new file mode 100644 index 0000000..23973d0 --- /dev/null +++ b/mcclone/external/sfml23/include/SFML/Main.hpp @@ -0,0 +1,43 @@ +//////////////////////////////////////////////////////////// +// +// SFML - Simple and Fast Multimedia Library +// Copyright (C) 2007-2015 Laurent Gomila (laurent@sfml-dev.org) +// +// This software is provided 'as-is', without any express or implied warranty. +// In no event will the authors be held liable for any damages arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it freely, +// subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; +// you must not claim that you wrote the original software. +// If you use this software in a product, an acknowledgment +// in the product documentation would be appreciated but is not required. +// +// 2. Altered source versions must be plainly marked as such, +// and must not be misrepresented as being the original software. +// +// 3. This notice may not be removed or altered from any source distribution. +// +//////////////////////////////////////////////////////////// + +#ifndef SFML_MAIN_HPP +#define SFML_MAIN_HPP + +//////////////////////////////////////////////////////////// +// Headers +//////////////////////////////////////////////////////////// +#include + + +#if defined(SFML_SYSTEM_IOS) + + // On iOS, we have no choice but to have our own main, + // so we need to rename the user one and call it later + #define main sfmlMain + +#endif + + +#endif // SFML_MAIN_HPP diff --git a/mcclone/external/sfml23/include/SFML/Network.hpp b/mcclone/external/sfml23/include/SFML/Network.hpp new file mode 100644 index 0000000..68507af --- /dev/null +++ b/mcclone/external/sfml23/include/SFML/Network.hpp @@ -0,0 +1,53 @@ +//////////////////////////////////////////////////////////// +// +// SFML - Simple and Fast Multimedia Library +// Copyright (C) 2007-2015 Laurent Gomila (laurent@sfml-dev.org) +// +// This software is provided 'as-is', without any express or implied warranty. +// In no event will the authors be held liable for any damages arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it freely, +// subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; +// you must not claim that you wrote the original software. +// If you use this software in a product, an acknowledgment +// in the product documentation would be appreciated but is not required. +// +// 2. Altered source versions must be plainly marked as such, +// and must not be misrepresented as being the original software. +// +// 3. This notice may not be removed or altered from any source distribution. +// +//////////////////////////////////////////////////////////// + +#ifndef SFML_NETWORK_HPP +#define SFML_NETWORK_HPP + +//////////////////////////////////////////////////////////// +// Headers +//////////////////////////////////////////////////////////// + +#include +#include +#include +#include +#include +#include +#include +#include +#include +#include +#include + + +#endif // SFML_NETWORK_HPP + +//////////////////////////////////////////////////////////// +/// \defgroup network Network module +/// +/// Socket-based communication, utilities and higher-level +/// network protocols (HTTP, FTP). +/// +//////////////////////////////////////////////////////////// diff --git a/mcclone/external/sfml23/include/SFML/Network/Export.hpp b/mcclone/external/sfml23/include/SFML/Network/Export.hpp new file mode 100644 index 0000000..6c880f6 --- /dev/null +++ b/mcclone/external/sfml23/include/SFML/Network/Export.hpp @@ -0,0 +1,48 @@ +//////////////////////////////////////////////////////////// +// +// SFML - Simple and Fast Multimedia Library +// Copyright (C) 2007-2015 Laurent Gomila (laurent@sfml-dev.org) +// +// This software is provided 'as-is', without any express or implied warranty. +// In no event will the authors be held liable for any damages arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it freely, +// subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; +// you must not claim that you wrote the original software. +// If you use this software in a product, an acknowledgment +// in the product documentation would be appreciated but is not required. +// +// 2. Altered source versions must be plainly marked as such, +// and must not be misrepresented as being the original software. +// +// 3. This notice may not be removed or altered from any source distribution. +// +//////////////////////////////////////////////////////////// + +#ifndef SFML_NETWORK_EXPORT_HPP +#define SFML_NETWORK_EXPORT_HPP + +//////////////////////////////////////////////////////////// +// Headers +//////////////////////////////////////////////////////////// +#include + + +//////////////////////////////////////////////////////////// +// Define portable import / export macros +//////////////////////////////////////////////////////////// +#if defined(SFML_NETWORK_EXPORTS) + + #define SFML_NETWORK_API SFML_API_EXPORT + +#else + + #define SFML_NETWORK_API SFML_API_IMPORT + +#endif + + +#endif // SFML_NETWORK_EXPORT_HPP diff --git a/mcclone/external/sfml23/include/SFML/Network/Ftp.hpp b/mcclone/external/sfml23/include/SFML/Network/Ftp.hpp new file mode 100644 index 0000000..c62db7b --- /dev/null +++ b/mcclone/external/sfml23/include/SFML/Network/Ftp.hpp @@ -0,0 +1,611 @@ +//////////////////////////////////////////////////////////// +// +// SFML - Simple and Fast Multimedia Library +// Copyright (C) 2007-2015 Laurent Gomila (laurent@sfml-dev.org) +// +// This software is provided 'as-is', without any express or implied warranty. +// In no event will the authors be held liable for any damages arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it freely, +// subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; +// you must not claim that you wrote the original software. +// If you use this software in a product, an acknowledgment +// in the product documentation would be appreciated but is not required. +// +// 2. Altered source versions must be plainly marked as such, +// and must not be misrepresented as being the original software. +// +// 3. This notice may not be removed or altered from any source distribution. +// +//////////////////////////////////////////////////////////// + +#ifndef SFML_FTP_HPP +#define SFML_FTP_HPP + +//////////////////////////////////////////////////////////// +// Headers +//////////////////////////////////////////////////////////// +#include +#include +#include +#include +#include +#include + + +namespace sf +{ +class IpAddress; + +//////////////////////////////////////////////////////////// +/// \brief A FTP client +/// +//////////////////////////////////////////////////////////// +class SFML_NETWORK_API Ftp : NonCopyable +{ +public: + + //////////////////////////////////////////////////////////// + /// \brief Enumeration of transfer modes + /// + //////////////////////////////////////////////////////////// + enum TransferMode + { + Binary, ///< Binary mode (file is transfered as a sequence of bytes) + Ascii, ///< Text mode using ASCII encoding + Ebcdic ///< Text mode using EBCDIC encoding + }; + + //////////////////////////////////////////////////////////// + /// \brief Define a FTP response + /// + //////////////////////////////////////////////////////////// + class SFML_NETWORK_API Response + { + public: + + //////////////////////////////////////////////////////////// + /// \brief Status codes possibly returned by a FTP response + /// + //////////////////////////////////////////////////////////// + enum Status + { + // 1xx: the requested action is being initiated, + // expect another reply before proceeding with a new command + RestartMarkerReply = 110, ///< Restart marker reply + ServiceReadySoon = 120, ///< Service ready in N minutes + DataConnectionAlreadyOpened = 125, ///< Data connection already opened, transfer starting + OpeningDataConnection = 150, ///< File status ok, about to open data connection + + // 2xx: the requested action has been successfully completed + Ok = 200, ///< Command ok + PointlessCommand = 202, ///< Command not implemented + SystemStatus = 211, ///< System status, or system help reply + DirectoryStatus = 212, ///< Directory status + FileStatus = 213, ///< File status + HelpMessage = 214, ///< Help message + SystemType = 215, ///< NAME system type, where NAME is an official system name from the list in the Assigned Numbers document + ServiceReady = 220, ///< Service ready for new user + ClosingConnection = 221, ///< Service closing control connection + DataConnectionOpened = 225, ///< Data connection open, no transfer in progress + ClosingDataConnection = 226, ///< Closing data connection, requested file action successful + EnteringPassiveMode = 227, ///< Entering passive mode + LoggedIn = 230, ///< User logged in, proceed. Logged out if appropriate + FileActionOk = 250, ///< Requested file action ok + DirectoryOk = 257, ///< PATHNAME created + + // 3xx: the command has been accepted, but the requested action + // is dormant, pending receipt of further information + NeedPassword = 331, ///< User name ok, need password + NeedAccountToLogIn = 332, ///< Need account for login + NeedInformation = 350, ///< Requested file action pending further information + + // 4xx: the command was not accepted and the requested action did not take place, + // but the error condition is temporary and the action may be requested again + ServiceUnavailable = 421, ///< Service not available, closing control connection + DataConnectionUnavailable = 425, ///< Can't open data connection + TransferAborted = 426, ///< Connection closed, transfer aborted + FileActionAborted = 450, ///< Requested file action not taken + LocalError = 451, ///< Requested action aborted, local error in processing + InsufficientStorageSpace = 452, ///< Requested action not taken; insufficient storage space in system, file unavailable + + // 5xx: the command was not accepted and + // the requested action did not take place + CommandUnknown = 500, ///< Syntax error, command unrecognized + ParametersUnknown = 501, ///< Syntax error in parameters or arguments + CommandNotImplemented = 502, ///< Command not implemented + BadCommandSequence = 503, ///< Bad sequence of commands + ParameterNotImplemented = 504, ///< Command not implemented for that parameter + NotLoggedIn = 530, ///< Not logged in + NeedAccountToStore = 532, ///< Need account for storing files + FileUnavailable = 550, ///< Requested action not taken, file unavailable + PageTypeUnknown = 551, ///< Requested action aborted, page type unknown + NotEnoughMemory = 552, ///< Requested file action aborted, exceeded storage allocation + FilenameNotAllowed = 553, ///< Requested action not taken, file name not allowed + + // 10xx: SFML custom codes + InvalidResponse = 1000, ///< Not part of the FTP standard, generated by SFML when a received response cannot be parsed + ConnectionFailed = 1001, ///< Not part of the FTP standard, generated by SFML when the low-level socket connection with the server fails + ConnectionClosed = 1002, ///< Not part of the FTP standard, generated by SFML when the low-level socket connection is unexpectedly closed + InvalidFile = 1003 ///< Not part of the FTP standard, generated by SFML when a local file cannot be read or written + }; + + //////////////////////////////////////////////////////////// + /// \brief Default constructor + /// + /// This constructor is used by the FTP client to build + /// the response. + /// + /// \param code Response status code + /// \param message Response message + /// + //////////////////////////////////////////////////////////// + explicit Response(Status code = InvalidResponse, const std::string& message = ""); + + //////////////////////////////////////////////////////////// + /// \brief Check if the status code means a success + /// + /// This function is defined for convenience, it is + /// equivalent to testing if the status code is < 400. + /// + /// \return True if the status is a success, false if it is a failure + /// + //////////////////////////////////////////////////////////// + bool isOk() const; + + //////////////////////////////////////////////////////////// + /// \brief Get the status code of the response + /// + /// \return Status code + /// + //////////////////////////////////////////////////////////// + Status getStatus() const; + + //////////////////////////////////////////////////////////// + /// \brief Get the full message contained in the response + /// + /// \return The response message + /// + //////////////////////////////////////////////////////////// + const std::string& getMessage() const; + + private: + + //////////////////////////////////////////////////////////// + // Member data + //////////////////////////////////////////////////////////// + Status m_status; ///< Status code returned from the server + std::string m_message; ///< Last message received from the server + }; + + //////////////////////////////////////////////////////////// + /// \brief Specialization of FTP response returning a directory + /// + //////////////////////////////////////////////////////////// + class SFML_NETWORK_API DirectoryResponse : public Response + { + public: + + //////////////////////////////////////////////////////////// + /// \brief Default constructor + /// + /// \param response Source response + /// + //////////////////////////////////////////////////////////// + DirectoryResponse(const Response& response); + + //////////////////////////////////////////////////////////// + /// \brief Get the directory returned in the response + /// + /// \return Directory name + /// + //////////////////////////////////////////////////////////// + const std::string& getDirectory() const; + + private: + + //////////////////////////////////////////////////////////// + // Member data + //////////////////////////////////////////////////////////// + std::string m_directory; ///< Directory extracted from the response message + }; + + + //////////////////////////////////////////////////////////// + /// \brief Specialization of FTP response returning a + /// filename listing + //////////////////////////////////////////////////////////// + class SFML_NETWORK_API ListingResponse : public Response + { + public: + + //////////////////////////////////////////////////////////// + /// \brief Default constructor + /// + /// \param response Source response + /// \param data Data containing the raw listing + /// + //////////////////////////////////////////////////////////// + ListingResponse(const Response& response, const std::string& data); + + //////////////////////////////////////////////////////////// + /// \brief Return the array of directory/file names + /// + /// \return Array containing the requested listing + /// + //////////////////////////////////////////////////////////// + const std::vector& getListing() const; + + private: + + //////////////////////////////////////////////////////////// + // Member data + //////////////////////////////////////////////////////////// + std::vector m_listing; ///< Directory/file names extracted from the data + }; + + + //////////////////////////////////////////////////////////// + /// \brief Destructor + /// + /// Automatically closes the connection with the server if + /// it is still opened. + /// + //////////////////////////////////////////////////////////// + ~Ftp(); + + //////////////////////////////////////////////////////////// + /// \brief Connect to the specified FTP server + /// + /// The port has a default value of 21, which is the standard + /// port used by the FTP protocol. You shouldn't use a different + /// value, unless you really know what you do. + /// This function tries to connect to the server so it may take + /// a while to complete, especially if the server is not + /// reachable. To avoid blocking your application for too long, + /// you can use a timeout. The default value, Time::Zero, means that the + /// system timeout will be used (which is usually pretty long). + /// + /// \param server Name or address of the FTP server to connect to + /// \param port Port used for the connection + /// \param timeout Maximum time to wait + /// + /// \return Server response to the request + /// + /// \see disconnect + /// + //////////////////////////////////////////////////////////// + Response connect(const IpAddress& server, unsigned short port = 21, Time timeout = Time::Zero); + + //////////////////////////////////////////////////////////// + /// \brief Close the connection with the server + /// + /// \return Server response to the request + /// + /// \see connect + /// + //////////////////////////////////////////////////////////// + Response disconnect(); + + //////////////////////////////////////////////////////////// + /// \brief Log in using an anonymous account + /// + /// Logging in is mandatory after connecting to the server. + /// Users that are not logged in cannot perform any operation. + /// + /// \return Server response to the request + /// + //////////////////////////////////////////////////////////// + Response login(); + + //////////////////////////////////////////////////////////// + /// \brief Log in using a username and a password + /// + /// Logging in is mandatory after connecting to the server. + /// Users that are not logged in cannot perform any operation. + /// + /// \param name User name + /// \param password Password + /// + /// \return Server response to the request + /// + //////////////////////////////////////////////////////////// + Response login(const std::string& name, const std::string& password); + + //////////////////////////////////////////////////////////// + /// \brief Send a null command to keep the connection alive + /// + /// This command is useful because the server may close the + /// connection automatically if no command is sent. + /// + /// \return Server response to the request + /// + //////////////////////////////////////////////////////////// + Response keepAlive(); + + //////////////////////////////////////////////////////////// + /// \brief Get the current working directory + /// + /// The working directory is the root path for subsequent + /// operations involving directories and/or filenames. + /// + /// \return Server response to the request + /// + /// \see getDirectoryListing, changeDirectory, parentDirectory + /// + //////////////////////////////////////////////////////////// + DirectoryResponse getWorkingDirectory(); + + //////////////////////////////////////////////////////////// + /// \brief Get the contents of the given directory + /// + /// This function retrieves the sub-directories and files + /// contained in the given directory. It is not recursive. + /// The \a directory parameter is relative to the current + /// working directory. + /// + /// \param directory Directory to list + /// + /// \return Server response to the request + /// + /// \see getWorkingDirectory, changeDirectory, parentDirectory + /// + //////////////////////////////////////////////////////////// + ListingResponse getDirectoryListing(const std::string& directory = ""); + + //////////////////////////////////////////////////////////// + /// \brief Change the current working directory + /// + /// The new directory must be relative to the current one. + /// + /// \param directory New working directory + /// + /// \return Server response to the request + /// + /// \see getWorkingDirectory, getDirectoryListing, parentDirectory + /// + //////////////////////////////////////////////////////////// + Response changeDirectory(const std::string& directory); + + //////////////////////////////////////////////////////////// + /// \brief Go to the parent directory of the current one + /// + /// \return Server response to the request + /// + /// \see getWorkingDirectory, getDirectoryListing, changeDirectory + /// + //////////////////////////////////////////////////////////// + Response parentDirectory(); + + //////////////////////////////////////////////////////////// + /// \brief Create a new directory + /// + /// The new directory is created as a child of the current + /// working directory. + /// + /// \param name Name of the directory to create + /// + /// \return Server response to the request + /// + /// \see deleteDirectory + /// + //////////////////////////////////////////////////////////// + Response createDirectory(const std::string& name); + + //////////////////////////////////////////////////////////// + /// \brief Remove an existing directory + /// + /// The directory to remove must be relative to the + /// current working directory. + /// Use this function with caution, the directory will + /// be removed permanently! + /// + /// \param name Name of the directory to remove + /// + /// \return Server response to the request + /// + /// \see createDirectory + /// + //////////////////////////////////////////////////////////// + Response deleteDirectory(const std::string& name); + + //////////////////////////////////////////////////////////// + /// \brief Rename an existing file + /// + /// The filenames must be relative to the current working + /// directory. + /// + /// \param file File to rename + /// \param newName New name of the file + /// + /// \return Server response to the request + /// + /// \see deleteFile + /// + //////////////////////////////////////////////////////////// + Response renameFile(const std::string& file, const std::string& newName); + + //////////////////////////////////////////////////////////// + /// \brief Remove an existing file + /// + /// The file name must be relative to the current working + /// directory. + /// Use this function with caution, the file will be + /// removed permanently! + /// + /// \param name File to remove + /// + /// \return Server response to the request + /// + /// \see renameFile + /// + //////////////////////////////////////////////////////////// + Response deleteFile(const std::string& name); + + //////////////////////////////////////////////////////////// + /// \brief Download a file from the server + /// + /// The filename of the distant file is relative to the + /// current working directory of the server, and the local + /// destination path is relative to the current directory + /// of your application. + /// If a file with the same filename as the distant file + /// already exists in the local destination path, it will + /// be overwritten. + /// + /// \param remoteFile Filename of the distant file to download + /// \param localPath The directory in which to put the file on the local computer + /// \param mode Transfer mode + /// + /// \return Server response to the request + /// + /// \see upload + /// + //////////////////////////////////////////////////////////// + Response download(const std::string& remoteFile, const std::string& localPath, TransferMode mode = Binary); + + //////////////////////////////////////////////////////////// + /// \brief Upload a file to the server + /// + /// The name of the local file is relative to the current + /// working directory of your application, and the + /// remote path is relative to the current directory of the + /// FTP server. + /// + /// \param localFile Path of the local file to upload + /// \param remotePath The directory in which to put the file on the server + /// \param mode Transfer mode + /// + /// \return Server response to the request + /// + /// \see download + /// + //////////////////////////////////////////////////////////// + Response upload(const std::string& localFile, const std::string& remotePath, TransferMode mode = Binary); + + //////////////////////////////////////////////////////////// + /// \brief Send a command to the FTP server + /// + /// While the most often used commands are provided as member + /// functions in the sf::Ftp class, this method can be used + /// to send any FTP command to the server. If the command + /// requires one or more parameters, they can be specified + /// in \a parameter. If the server returns information, you + /// can extract it from the response using Response::getMessage(). + /// + /// \param command Command to send + /// \param parameter Command parameter + /// + /// \return Server response to the request + /// + //////////////////////////////////////////////////////////// + Response sendCommand(const std::string& command, const std::string& parameter = ""); + +private: + + //////////////////////////////////////////////////////////// + /// \brief Receive a response from the server + /// + /// This function must be called after each call to + /// sendCommand that expects a response. + /// + /// \return Server response to the request + /// + //////////////////////////////////////////////////////////// + Response getResponse(); + + //////////////////////////////////////////////////////////// + /// \brief Utility class for exchanging datas with the server + /// on the data channel + /// + //////////////////////////////////////////////////////////// + class DataChannel; + + friend class DataChannel; + + //////////////////////////////////////////////////////////// + // Member data + //////////////////////////////////////////////////////////// + TcpSocket m_commandSocket; ///< Socket holding the control connection with the server +}; + +} // namespace sf + + +#endif // SFML_FTP_HPP + + +//////////////////////////////////////////////////////////// +/// \class sf::Ftp +/// \ingroup network +/// +/// sf::Ftp is a very simple FTP client that allows you +/// to communicate with a FTP server. The FTP protocol allows +/// you to manipulate a remote file system (list files, +/// upload, download, create, remove, ...). +/// +/// Using the FTP client consists of 4 parts: +/// \li Connecting to the FTP server +/// \li Logging in (either as a registered user or anonymously) +/// \li Sending commands to the server +/// \li Disconnecting (this part can be done implicitly by the destructor) +/// +/// Every command returns a FTP response, which contains the +/// status code as well as a message from the server. Some +/// commands such as getWorkingDirectory() and getDirectoryListing() +/// return additional data, and use a class derived from +/// sf::Ftp::Response to provide this data. The most often used +/// commands are directly provided as member functions, but it is +/// also possible to use specific commands with the sendCommand() function. +/// +/// Note that response statuses >= 1000 are not part of the FTP standard, +/// they are generated by SFML when an internal error occurs. +/// +/// All commands, especially upload and download, may take some +/// time to complete. This is important to know if you don't want +/// to block your application while the server is completing +/// the task. +/// +/// Usage example: +/// \code +/// // Create a new FTP client +/// sf::Ftp ftp; +/// +/// // Connect to the server +/// sf::Ftp::Response response = ftp.connect("ftp://ftp.myserver.com"); +/// if (response.isOk()) +/// std::cout << "Connected" << std::endl; +/// +/// // Log in +/// response = ftp.login("laurent", "dF6Zm89D"); +/// if (response.isOk()) +/// std::cout << "Logged in" << std::endl; +/// +/// // Print the working directory +/// sf::Ftp::DirectoryResponse directory = ftp.getWorkingDirectory(); +/// if (directory.isOk()) +/// std::cout << "Working directory: " << directory.getDirectory() << std::endl; +/// +/// // Create a new directory +/// response = ftp.createDirectory("files"); +/// if (response.isOk()) +/// std::cout << "Created new directory" << std::endl; +/// +/// // Upload a file to this new directory +/// response = ftp.upload("local-path/file.txt", "files", sf::Ftp::Ascii); +/// if (response.isOk()) +/// std::cout << "File uploaded" << std::endl; +/// +/// // Send specific commands (here: FEAT to list supported FTP features) +/// response = ftp.sendCommand("FEAT"); +/// if (response.isOk()) +/// std::cout << "Feature list:\n" << response.getMessage() << std::endl; +/// +/// // Disconnect from the server (optional) +/// ftp.disconnect(); +/// \endcode +/// +//////////////////////////////////////////////////////////// diff --git a/mcclone/external/sfml23/include/SFML/Network/Http.hpp b/mcclone/external/sfml23/include/SFML/Network/Http.hpp new file mode 100644 index 0000000..057b86b --- /dev/null +++ b/mcclone/external/sfml23/include/SFML/Network/Http.hpp @@ -0,0 +1,482 @@ +//////////////////////////////////////////////////////////// +// +// SFML - Simple and Fast Multimedia Library +// Copyright (C) 2007-2015 Laurent Gomila (laurent@sfml-dev.org) +// +// This software is provided 'as-is', without any express or implied warranty. +// In no event will the authors be held liable for any damages arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it freely, +// subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; +// you must not claim that you wrote the original software. +// If you use this software in a product, an acknowledgment +// in the product documentation would be appreciated but is not required. +// +// 2. Altered source versions must be plainly marked as such, +// and must not be misrepresented as being the original software. +// +// 3. This notice may not be removed or altered from any source distribution. +// +//////////////////////////////////////////////////////////// + +#ifndef SFML_HTTP_HPP +#define SFML_HTTP_HPP + +//////////////////////////////////////////////////////////// +// Headers +//////////////////////////////////////////////////////////// +#include +#include +#include +#include +#include +#include +#include + + +namespace sf +{ +//////////////////////////////////////////////////////////// +/// \brief A HTTP client +/// +//////////////////////////////////////////////////////////// +class SFML_NETWORK_API Http : NonCopyable +{ +public: + + //////////////////////////////////////////////////////////// + /// \brief Define a HTTP request + /// + //////////////////////////////////////////////////////////// + class SFML_NETWORK_API Request + { + public: + + //////////////////////////////////////////////////////////// + /// \brief Enumerate the available HTTP methods for a request + /// + //////////////////////////////////////////////////////////// + enum Method + { + Get, ///< Request in get mode, standard method to retrieve a page + Post, ///< Request in post mode, usually to send data to a page + Head, ///< Request a page's header only + Put, ///< Request in put mode, useful for a REST API + Delete ///< Request in delete mode, useful for a REST API + }; + + //////////////////////////////////////////////////////////// + /// \brief Default constructor + /// + /// This constructor creates a GET request, with the root + /// URI ("/") and an empty body. + /// + /// \param uri Target URI + /// \param method Method to use for the request + /// \param body Content of the request's body + /// + //////////////////////////////////////////////////////////// + Request(const std::string& uri = "/", Method method = Get, const std::string& body = ""); + + //////////////////////////////////////////////////////////// + /// \brief Set the value of a field + /// + /// The field is created if it doesn't exist. The name of + /// the field is case-insensitive. + /// By default, a request doesn't contain any field (but the + /// mandatory fields are added later by the HTTP client when + /// sending the request). + /// + /// \param field Name of the field to set + /// \param value Value of the field + /// + //////////////////////////////////////////////////////////// + void setField(const std::string& field, const std::string& value); + + //////////////////////////////////////////////////////////// + /// \brief Set the request method + /// + /// See the Method enumeration for a complete list of all + /// the availale methods. + /// The method is Http::Request::Get by default. + /// + /// \param method Method to use for the request + /// + //////////////////////////////////////////////////////////// + void setMethod(Method method); + + //////////////////////////////////////////////////////////// + /// \brief Set the requested URI + /// + /// The URI is the resource (usually a web page or a file) + /// that you want to get or post. + /// The URI is "/" (the root page) by default. + /// + /// \param uri URI to request, relative to the host + /// + //////////////////////////////////////////////////////////// + void setUri(const std::string& uri); + + //////////////////////////////////////////////////////////// + /// \brief Set the HTTP version for the request + /// + /// The HTTP version is 1.0 by default. + /// + /// \param major Major HTTP version number + /// \param minor Minor HTTP version number + /// + //////////////////////////////////////////////////////////// + void setHttpVersion(unsigned int major, unsigned int minor); + + //////////////////////////////////////////////////////////// + /// \brief Set the body of the request + /// + /// The body of a request is optional and only makes sense + /// for POST requests. It is ignored for all other methods. + /// The body is empty by default. + /// + /// \param body Content of the body + /// + //////////////////////////////////////////////////////////// + void setBody(const std::string& body); + + private: + + friend class Http; + + //////////////////////////////////////////////////////////// + /// \brief Prepare the final request to send to the server + /// + /// This is used internally by Http before sending the + /// request to the web server. + /// + /// \return String containing the request, ready to be sent + /// + //////////////////////////////////////////////////////////// + std::string prepare() const; + + //////////////////////////////////////////////////////////// + /// \brief Check if the request defines a field + /// + /// This function uses case-insensitive comparisons. + /// + /// \param field Name of the field to test + /// + /// \return True if the field exists, false otherwise + /// + //////////////////////////////////////////////////////////// + bool hasField(const std::string& field) const; + + //////////////////////////////////////////////////////////// + // Types + //////////////////////////////////////////////////////////// + typedef std::map FieldTable; + + //////////////////////////////////////////////////////////// + // Member data + //////////////////////////////////////////////////////////// + FieldTable m_fields; ///< Fields of the header associated to their value + Method m_method; ///< Method to use for the request + std::string m_uri; ///< Target URI of the request + unsigned int m_majorVersion; ///< Major HTTP version + unsigned int m_minorVersion; ///< Minor HTTP version + std::string m_body; ///< Body of the request + }; + + //////////////////////////////////////////////////////////// + /// \brief Define a HTTP response + /// + //////////////////////////////////////////////////////////// + class SFML_NETWORK_API Response + { + public: + + //////////////////////////////////////////////////////////// + /// \brief Enumerate all the valid status codes for a response + /// + //////////////////////////////////////////////////////////// + enum Status + { + // 2xx: success + Ok = 200, ///< Most common code returned when operation was successful + Created = 201, ///< The resource has successfully been created + Accepted = 202, ///< The request has been accepted, but will be processed later by the server + NoContent = 204, ///< The server didn't send any data in return + ResetContent = 205, ///< The server informs the client that it should clear the view (form) that caused the request to be sent + PartialContent = 206, ///< The server has sent a part of the resource, as a response to a partial GET request + + // 3xx: redirection + MultipleChoices = 300, ///< The requested page can be accessed from several locations + MovedPermanently = 301, ///< The requested page has permanently moved to a new location + MovedTemporarily = 302, ///< The requested page has temporarily moved to a new location + NotModified = 304, ///< For conditional requests, means the requested page hasn't changed and doesn't need to be refreshed + + // 4xx: client error + BadRequest = 400, ///< The server couldn't understand the request (syntax error) + Unauthorized = 401, ///< The requested page needs an authentication to be accessed + Forbidden = 403, ///< The requested page cannot be accessed at all, even with authentication + NotFound = 404, ///< The requested page doesn't exist + RangeNotSatisfiable = 407, ///< The server can't satisfy the partial GET request (with a "Range" header field) + + // 5xx: server error + InternalServerError = 500, ///< The server encountered an unexpected error + NotImplemented = 501, ///< The server doesn't implement a requested feature + BadGateway = 502, ///< The gateway server has received an error from the source server + ServiceNotAvailable = 503, ///< The server is temporarily unavailable (overloaded, in maintenance, ...) + GatewayTimeout = 504, ///< The gateway server couldn't receive a response from the source server + VersionNotSupported = 505, ///< The server doesn't support the requested HTTP version + + // 10xx: SFML custom codes + InvalidResponse = 1000, ///< Response is not a valid HTTP one + ConnectionFailed = 1001 ///< Connection with server failed + }; + + //////////////////////////////////////////////////////////// + /// \brief Default constructor + /// + /// Constructs an empty response. + /// + //////////////////////////////////////////////////////////// + Response(); + + //////////////////////////////////////////////////////////// + /// \brief Get the value of a field + /// + /// If the field \a field is not found in the response header, + /// the empty string is returned. This function uses + /// case-insensitive comparisons. + /// + /// \param field Name of the field to get + /// + /// \return Value of the field, or empty string if not found + /// + //////////////////////////////////////////////////////////// + const std::string& getField(const std::string& field) const; + + //////////////////////////////////////////////////////////// + /// \brief Get the response status code + /// + /// The status code should be the first thing to be checked + /// after receiving a response, it defines whether it is a + /// success, a failure or anything else (see the Status + /// enumeration). + /// + /// \return Status code of the response + /// + //////////////////////////////////////////////////////////// + Status getStatus() const; + + //////////////////////////////////////////////////////////// + /// \brief Get the major HTTP version number of the response + /// + /// \return Major HTTP version number + /// + /// \see getMinorHttpVersion + /// + //////////////////////////////////////////////////////////// + unsigned int getMajorHttpVersion() const; + + //////////////////////////////////////////////////////////// + /// \brief Get the minor HTTP version number of the response + /// + /// \return Minor HTTP version number + /// + /// \see getMajorHttpVersion + /// + //////////////////////////////////////////////////////////// + unsigned int getMinorHttpVersion() const; + + //////////////////////////////////////////////////////////// + /// \brief Get the body of the response + /// + /// The body of a response may contain: + /// \li the requested page (for GET requests) + /// \li a response from the server (for POST requests) + /// \li nothing (for HEAD requests) + /// \li an error message (in case of an error) + /// + /// \return The response body + /// + //////////////////////////////////////////////////////////// + const std::string& getBody() const; + + private: + + friend class Http; + + //////////////////////////////////////////////////////////// + /// \brief Construct the header from a response string + /// + /// This function is used by Http to build the response + /// of a request. + /// + /// \param data Content of the response to parse + /// + //////////////////////////////////////////////////////////// + void parse(const std::string& data); + + + //////////////////////////////////////////////////////////// + /// \brief Read values passed in the answer header + /// + /// This function is used by Http to extract values passed + /// in the response. + /// + /// \param in String stream containing the header values + /// + //////////////////////////////////////////////////////////// + void parseFields(std::istream &in); + + //////////////////////////////////////////////////////////// + // Types + //////////////////////////////////////////////////////////// + typedef std::map FieldTable; + + //////////////////////////////////////////////////////////// + // Member data + //////////////////////////////////////////////////////////// + FieldTable m_fields; ///< Fields of the header + Status m_status; ///< Status code + unsigned int m_majorVersion; ///< Major HTTP version + unsigned int m_minorVersion; ///< Minor HTTP version + std::string m_body; ///< Body of the response + }; + + //////////////////////////////////////////////////////////// + /// \brief Default constructor + /// + //////////////////////////////////////////////////////////// + Http(); + + //////////////////////////////////////////////////////////// + /// \brief Construct the HTTP client with the target host + /// + /// This is equivalent to calling setHost(host, port). + /// The port has a default value of 0, which means that the + /// HTTP client will use the right port according to the + /// protocol used (80 for HTTP). You should leave it like + /// this unless you really need a port other than the + /// standard one, or use an unknown protocol. + /// + /// \param host Web server to connect to + /// \param port Port to use for connection + /// + //////////////////////////////////////////////////////////// + Http(const std::string& host, unsigned short port = 0); + + //////////////////////////////////////////////////////////// + /// \brief Set the target host + /// + /// This function just stores the host address and port, it + /// doesn't actually connect to it until you send a request. + /// The port has a default value of 0, which means that the + /// HTTP client will use the right port according to the + /// protocol used (80 for HTTP). You should leave it like + /// this unless you really need a port other than the + /// standard one, or use an unknown protocol. + /// + /// \param host Web server to connect to + /// \param port Port to use for connection + /// + //////////////////////////////////////////////////////////// + void setHost(const std::string& host, unsigned short port = 0); + + //////////////////////////////////////////////////////////// + /// \brief Send a HTTP request and return the server's response. + /// + /// You must have a valid host before sending a request (see setHost). + /// Any missing mandatory header field in the request will be added + /// with an appropriate value. + /// Warning: this function waits for the server's response and may + /// not return instantly; use a thread if you don't want to block your + /// application, or use a timeout to limit the time to wait. A value + /// of Time::Zero means that the client will use the system default timeout + /// (which is usually pretty long). + /// + /// \param request Request to send + /// \param timeout Maximum time to wait + /// + /// \return Server's response + /// + //////////////////////////////////////////////////////////// + Response sendRequest(const Request& request, Time timeout = Time::Zero); + +private: + + //////////////////////////////////////////////////////////// + // Member data + //////////////////////////////////////////////////////////// + TcpSocket m_connection; ///< Connection to the host + IpAddress m_host; ///< Web host address + std::string m_hostName; ///< Web host name + unsigned short m_port; ///< Port used for connection with host +}; + +} // namespace sf + + +#endif // SFML_HTTP_HPP + + +//////////////////////////////////////////////////////////// +/// \class sf::Http +/// \ingroup network +/// +/// sf::Http is a very simple HTTP client that allows you +/// to communicate with a web server. You can retrieve +/// web pages, send data to an interactive resource, +/// download a remote file, etc. The HTTPS protocol is +/// not supported. +/// +/// The HTTP client is split into 3 classes: +/// \li sf::Http::Request +/// \li sf::Http::Response +/// \li sf::Http +/// +/// sf::Http::Request builds the request that will be +/// sent to the server. A request is made of: +/// \li a method (what you want to do) +/// \li a target URI (usually the name of the web page or file) +/// \li one or more header fields (options that you can pass to the server) +/// \li an optional body (for POST requests) +/// +/// sf::Http::Response parse the response from the web server +/// and provides getters to read them. The response contains: +/// \li a status code +/// \li header fields (that may be answers to the ones that you requested) +/// \li a body, which contains the contents of the requested resource +/// +/// sf::Http provides a simple function, SendRequest, to send a +/// sf::Http::Request and return the corresponding sf::Http::Response +/// from the server. +/// +/// Usage example: +/// \code +/// // Create a new HTTP client +/// sf::Http http; +/// +/// // We'll work on http://www.sfml-dev.org +/// http.setHost("http://www.sfml-dev.org"); +/// +/// // Prepare a request to get the 'features.php' page +/// sf::Http::Request request("features.php"); +/// +/// // Send the request +/// sf::Http::Response response = http.sendRequest(request); +/// +/// // Check the status code and display the result +/// sf::Http::Response::Status status = response.getStatus(); +/// if (status == sf::Http::Response::Ok) +/// { +/// std::cout << response.getBody() << std::endl; +/// } +/// else +/// { +/// std::cout << "Error " << status << std::endl; +/// } +/// \endcode +/// +//////////////////////////////////////////////////////////// diff --git a/mcclone/external/sfml23/include/SFML/Network/IpAddress.hpp b/mcclone/external/sfml23/include/SFML/Network/IpAddress.hpp new file mode 100644 index 0000000..8205e9f --- /dev/null +++ b/mcclone/external/sfml23/include/SFML/Network/IpAddress.hpp @@ -0,0 +1,316 @@ +//////////////////////////////////////////////////////////// +// +// SFML - Simple and Fast Multimedia Library +// Copyright (C) 2007-2015 Laurent Gomila (laurent@sfml-dev.org) +// +// This software is provided 'as-is', without any express or implied warranty. +// In no event will the authors be held liable for any damages arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it freely, +// subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; +// you must not claim that you wrote the original software. +// If you use this software in a product, an acknowledgment +// in the product documentation would be appreciated but is not required. +// +// 2. Altered source versions must be plainly marked as such, +// and must not be misrepresented as being the original software. +// +// 3. This notice may not be removed or altered from any source distribution. +// +//////////////////////////////////////////////////////////// + +#ifndef SFML_IPADDRESS_HPP +#define SFML_IPADDRESS_HPP + +//////////////////////////////////////////////////////////// +// Headers +//////////////////////////////////////////////////////////// +#include +#include +#include +#include +#include + + +namespace sf +{ +//////////////////////////////////////////////////////////// +/// \brief Encapsulate an IPv4 network address +/// +//////////////////////////////////////////////////////////// +class SFML_NETWORK_API IpAddress +{ +public: + + //////////////////////////////////////////////////////////// + /// \brief Default constructor + /// + /// This constructor creates an empty (invalid) address + /// + //////////////////////////////////////////////////////////// + IpAddress(); + + //////////////////////////////////////////////////////////// + /// \brief Construct the address from a string + /// + /// Here \a address can be either a decimal address + /// (ex: "192.168.1.56") or a network name (ex: "localhost"). + /// + /// \param address IP address or network name + /// + //////////////////////////////////////////////////////////// + IpAddress(const std::string& address); + + //////////////////////////////////////////////////////////// + /// \brief Construct the address from a string + /// + /// Here \a address can be either a decimal address + /// (ex: "192.168.1.56") or a network name (ex: "localhost"). + /// This is equivalent to the constructor taking a std::string + /// parameter, it is defined for convenience so that the + /// implicit conversions from literal strings to IpAddress work. + /// + /// \param address IP address or network name + /// + //////////////////////////////////////////////////////////// + IpAddress(const char* address); + + //////////////////////////////////////////////////////////// + /// \brief Construct the address from 4 bytes + /// + /// Calling IpAddress(a, b, c, d) is equivalent to calling + /// IpAddress("a.b.c.d"), but safer as it doesn't have to + /// parse a string to get the address components. + /// + /// \param byte0 First byte of the address + /// \param byte1 Second byte of the address + /// \param byte2 Third byte of the address + /// \param byte3 Fourth byte of the address + /// + //////////////////////////////////////////////////////////// + IpAddress(Uint8 byte0, Uint8 byte1, Uint8 byte2, Uint8 byte3); + + //////////////////////////////////////////////////////////// + /// \brief Construct the address from a 32-bits integer + /// + /// This constructor uses the internal representation of + /// the address directly. It should be used for optimization + /// purposes, and only if you got that representation from + /// IpAddress::ToInteger(). + /// + /// \param address 4 bytes of the address packed into a 32-bits integer + /// + /// \see toInteger + /// + //////////////////////////////////////////////////////////// + explicit IpAddress(Uint32 address); + + //////////////////////////////////////////////////////////// + /// \brief Get a string representation of the address + /// + /// The returned string is the decimal representation of the + /// IP address (like "192.168.1.56"), even if it was constructed + /// from a host name. + /// + /// \return String representation of the address + /// + /// \see toInteger + /// + //////////////////////////////////////////////////////////// + std::string toString() const; + + //////////////////////////////////////////////////////////// + /// \brief Get an integer representation of the address + /// + /// The returned number is the internal representation of the + /// address, and should be used for optimization purposes only + /// (like sending the address through a socket). + /// The integer produced by this function can then be converted + /// back to a sf::IpAddress with the proper constructor. + /// + /// \return 32-bits unsigned integer representation of the address + /// + /// \see toString + /// + //////////////////////////////////////////////////////////// + Uint32 toInteger() const; + + //////////////////////////////////////////////////////////// + /// \brief Get the computer's local address + /// + /// The local address is the address of the computer from the + /// LAN point of view, i.e. something like 192.168.1.56. It is + /// meaningful only for communications over the local network. + /// Unlike getPublicAddress, this function is fast and may be + /// used safely anywhere. + /// + /// \return Local IP address of the computer + /// + /// \see getPublicAddress + /// + //////////////////////////////////////////////////////////// + static IpAddress getLocalAddress(); + + //////////////////////////////////////////////////////////// + /// \brief Get the computer's public address + /// + /// The public address is the address of the computer from the + /// internet point of view, i.e. something like 89.54.1.169. + /// It is necessary for communications over the world wide web. + /// The only way to get a public address is to ask it to a + /// distant website; as a consequence, this function depends on + /// both your network connection and the server, and may be + /// very slow. You should use it as few as possible. Because + /// this function depends on the network connection and on a distant + /// server, you may use a time limit if you don't want your program + /// to be possibly stuck waiting in case there is a problem; this + /// limit is deactivated by default. + /// + /// \param timeout Maximum time to wait + /// + /// \return Public IP address of the computer + /// + /// \see getLocalAddress + /// + //////////////////////////////////////////////////////////// + static IpAddress getPublicAddress(Time timeout = Time::Zero); + + //////////////////////////////////////////////////////////// + // Static member data + //////////////////////////////////////////////////////////// + static const IpAddress None; ///< Value representing an empty/invalid address + static const IpAddress LocalHost; ///< The "localhost" address (for connecting a computer to itself locally) + static const IpAddress Broadcast; ///< The "broadcast" address (for sending UDP messages to everyone on a local network) + +private: + + //////////////////////////////////////////////////////////// + // Member data + //////////////////////////////////////////////////////////// + Uint32 m_address; ///< Address stored as an unsigned 32 bits integer +}; + +//////////////////////////////////////////////////////////// +/// \brief Overload of == operator to compare two IP addresses +/// +/// \param left Left operand (a IP address) +/// \param right Right operand (a IP address) +/// +/// \return True if both addresses are equal +/// +//////////////////////////////////////////////////////////// +SFML_NETWORK_API bool operator ==(const IpAddress& left, const IpAddress& right); + +//////////////////////////////////////////////////////////// +/// \brief Overload of != operator to compare two IP addresses +/// +/// \param left Left operand (a IP address) +/// \param right Right operand (a IP address) +/// +/// \return True if both addresses are different +/// +//////////////////////////////////////////////////////////// +SFML_NETWORK_API bool operator !=(const IpAddress& left, const IpAddress& right); + +//////////////////////////////////////////////////////////// +/// \brief Overload of < operator to compare two IP addresses +/// +/// \param left Left operand (a IP address) +/// \param right Right operand (a IP address) +/// +/// \return True if \a left is lesser than \a right +/// +//////////////////////////////////////////////////////////// +SFML_NETWORK_API bool operator <(const IpAddress& left, const IpAddress& right); + +//////////////////////////////////////////////////////////// +/// \brief Overload of > operator to compare two IP addresses +/// +/// \param left Left operand (a IP address) +/// \param right Right operand (a IP address) +/// +/// \return True if \a left is greater than \a right +/// +//////////////////////////////////////////////////////////// +SFML_NETWORK_API bool operator >(const IpAddress& left, const IpAddress& right); + +//////////////////////////////////////////////////////////// +/// \brief Overload of <= operator to compare two IP addresses +/// +/// \param left Left operand (a IP address) +/// \param right Right operand (a IP address) +/// +/// \return True if \a left is lesser or equal than \a right +/// +//////////////////////////////////////////////////////////// +SFML_NETWORK_API bool operator <=(const IpAddress& left, const IpAddress& right); + +//////////////////////////////////////////////////////////// +/// \brief Overload of >= operator to compare two IP addresses +/// +/// \param left Left operand (a IP address) +/// \param right Right operand (a IP address) +/// +/// \return True if \a left is greater or equal than \a right +/// +//////////////////////////////////////////////////////////// +SFML_NETWORK_API bool operator >=(const IpAddress& left, const IpAddress& right); + +//////////////////////////////////////////////////////////// +/// \brief Overload of >> operator to extract an IP address from an input stream +/// +/// \param stream Input stream +/// \param address IP address to extract +/// +/// \return Reference to the input stream +/// +//////////////////////////////////////////////////////////// +SFML_NETWORK_API std::istream& operator >>(std::istream& stream, IpAddress& address); + +//////////////////////////////////////////////////////////// +/// \brief Overload of << operator to print an IP address to an output stream +/// +/// \param stream Output stream +/// \param address IP address to print +/// +/// \return Reference to the output stream +/// +//////////////////////////////////////////////////////////// +SFML_NETWORK_API std::ostream& operator <<(std::ostream& stream, const IpAddress& address); + +} // namespace sf + + +#endif // SFML_IPADDRESS_HPP + + +//////////////////////////////////////////////////////////// +/// \class sf::IpAddress +/// \ingroup network +/// +/// sf::IpAddress is a utility class for manipulating network +/// addresses. It provides a set a implicit constructors and +/// conversion functions to easily build or transform an IP +/// address from/to various representations. +/// +/// Usage example: +/// \code +/// sf::IpAddress a0; // an invalid address +/// sf::IpAddress a1 = sf::IpAddress::None; // an invalid address (same as a0) +/// sf::IpAddress a2("127.0.0.1"); // the local host address +/// sf::IpAddress a3 = sf::IpAddress::Broadcast; // the broadcast address +/// sf::IpAddress a4(192, 168, 1, 56); // a local address +/// sf::IpAddress a5("my_computer"); // a local address created from a network name +/// sf::IpAddress a6("89.54.1.169"); // a distant address +/// sf::IpAddress a7("www.google.com"); // a distant address created from a network name +/// sf::IpAddress a8 = sf::IpAddress::getLocalAddress(); // my address on the local network +/// sf::IpAddress a9 = sf::IpAddress::getPublicAddress(); // my address on the internet +/// \endcode +/// +/// Note that sf::IpAddress currently doesn't support IPv6 +/// nor other types of network addresses. +/// +//////////////////////////////////////////////////////////// diff --git a/mcclone/external/sfml23/include/SFML/Network/Packet.hpp b/mcclone/external/sfml23/include/SFML/Network/Packet.hpp new file mode 100644 index 0000000..0b7da9f --- /dev/null +++ b/mcclone/external/sfml23/include/SFML/Network/Packet.hpp @@ -0,0 +1,412 @@ +//////////////////////////////////////////////////////////// +// +// SFML - Simple and Fast Multimedia Library +// Copyright (C) 2007-2015 Laurent Gomila (laurent@sfml-dev.org) +// +// This software is provided 'as-is', without any express or implied warranty. +// In no event will the authors be held liable for any damages arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it freely, +// subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; +// you must not claim that you wrote the original software. +// If you use this software in a product, an acknowledgment +// in the product documentation would be appreciated but is not required. +// +// 2. Altered source versions must be plainly marked as such, +// and must not be misrepresented as being the original software. +// +// 3. This notice may not be removed or altered from any source distribution. +// +//////////////////////////////////////////////////////////// + +#ifndef SFML_PACKET_HPP +#define SFML_PACKET_HPP + +//////////////////////////////////////////////////////////// +// Headers +//////////////////////////////////////////////////////////// +#include +#include +#include + + +namespace sf +{ +class String; +class TcpSocket; +class UdpSocket; + +//////////////////////////////////////////////////////////// +/// \brief Utility class to build blocks of data to transfer +/// over the network +/// +//////////////////////////////////////////////////////////// +class SFML_NETWORK_API Packet +{ + // A bool-like type that cannot be converted to integer or pointer types + typedef bool (Packet::*BoolType)(std::size_t); + +public: + + //////////////////////////////////////////////////////////// + /// \brief Default constructor + /// + /// Creates an empty packet. + /// + //////////////////////////////////////////////////////////// + Packet(); + + //////////////////////////////////////////////////////////// + /// \brief Virtual destructor + /// + //////////////////////////////////////////////////////////// + virtual ~Packet(); + + //////////////////////////////////////////////////////////// + /// \brief Append data to the end of the packet + /// + /// \param data Pointer to the sequence of bytes to append + /// \param sizeInBytes Number of bytes to append + /// + /// \see clear + /// + //////////////////////////////////////////////////////////// + void append(const void* data, std::size_t sizeInBytes); + + //////////////////////////////////////////////////////////// + /// \brief Clear the packet + /// + /// After calling Clear, the packet is empty. + /// + /// \see append + /// + //////////////////////////////////////////////////////////// + void clear(); + + //////////////////////////////////////////////////////////// + /// \brief Get a pointer to the data contained in the packet + /// + /// Warning: the returned pointer may become invalid after + /// you append data to the packet, therefore it should never + /// be stored. + /// The return pointer is NULL if the packet is empty. + /// + /// \return Pointer to the data + /// + /// \see getDataSize + /// + //////////////////////////////////////////////////////////// + const void* getData() const; + + //////////////////////////////////////////////////////////// + /// \brief Get the size of the data contained in the packet + /// + /// This function returns the number of bytes pointed to by + /// what getData returns. + /// + /// \return Data size, in bytes + /// + /// \see getData + /// + //////////////////////////////////////////////////////////// + std::size_t getDataSize() const; + + //////////////////////////////////////////////////////////// + /// \brief Tell if the reading position has reached the + /// end of the packet + /// + /// This function is useful to know if there is some data + /// left to be read, without actually reading it. + /// + /// \return True if all data was read, false otherwise + /// + /// \see operator bool + /// + //////////////////////////////////////////////////////////// + bool endOfPacket() const; + +public: + + //////////////////////////////////////////////////////////// + /// \brief Test the validity of the packet, for reading + /// + /// This operator allows to test the packet as a boolean + /// variable, to check if a reading operation was successful. + /// + /// A packet will be in an invalid state if it has no more + /// data to read. + /// + /// This behavior is the same as standard C++ streams. + /// + /// Usage example: + /// \code + /// float x; + /// packet >> x; + /// if (packet) + /// { + /// // ok, x was extracted successfully + /// } + /// + /// // -- or -- + /// + /// float x; + /// if (packet >> x) + /// { + /// // ok, x was extracted successfully + /// } + /// \endcode + /// + /// Don't focus on the return type, it's equivalent to bool but + /// it disallows unwanted implicit conversions to integer or + /// pointer types. + /// + /// \return True if last data extraction from packet was successful + /// + /// \see endOfPacket + /// + //////////////////////////////////////////////////////////// + operator BoolType() const; + + //////////////////////////////////////////////////////////// + /// Overloads of operator >> to read data from the packet + /// + //////////////////////////////////////////////////////////// + Packet& operator >>(bool& data); + Packet& operator >>(Int8& data); + Packet& operator >>(Uint8& data); + Packet& operator >>(Int16& data); + Packet& operator >>(Uint16& data); + Packet& operator >>(Int32& data); + Packet& operator >>(Uint32& data); + Packet& operator >>(Int64& data); + Packet& operator >>(Uint64& data); + Packet& operator >>(float& data); + Packet& operator >>(double& data); + Packet& operator >>(char* data); + Packet& operator >>(std::string& data); + Packet& operator >>(wchar_t* data); + Packet& operator >>(std::wstring& data); + Packet& operator >>(String& data); + + //////////////////////////////////////////////////////////// + /// Overloads of operator << to write data into the packet + /// + //////////////////////////////////////////////////////////// + Packet& operator <<(bool data); + Packet& operator <<(Int8 data); + Packet& operator <<(Uint8 data); + Packet& operator <<(Int16 data); + Packet& operator <<(Uint16 data); + Packet& operator <<(Int32 data); + Packet& operator <<(Uint32 data); + Packet& operator <<(Int64 data); + Packet& operator <<(Uint64 data); + Packet& operator <<(float data); + Packet& operator <<(double data); + Packet& operator <<(const char* data); + Packet& operator <<(const std::string& data); + Packet& operator <<(const wchar_t* data); + Packet& operator <<(const std::wstring& data); + Packet& operator <<(const String& data); + +protected: + + friend class TcpSocket; + friend class UdpSocket; + + //////////////////////////////////////////////////////////// + /// \brief Called before the packet is sent over the network + /// + /// This function can be defined by derived classes to + /// transform the data before it is sent; this can be + /// used for compression, encryption, etc. + /// The function must return a pointer to the modified data, + /// as well as the number of bytes pointed. + /// The default implementation provides the packet's data + /// without transforming it. + /// + /// \param size Variable to fill with the size of data to send + /// + /// \return Pointer to the array of bytes to send + /// + /// \see onReceive + /// + //////////////////////////////////////////////////////////// + virtual const void* onSend(std::size_t& size); + + //////////////////////////////////////////////////////////// + /// \brief Called after the packet is received over the network + /// + /// This function can be defined by derived classes to + /// transform the data after it is received; this can be + /// used for decompression, decryption, etc. + /// The function receives a pointer to the received data, + /// and must fill the packet with the transformed bytes. + /// The default implementation fills the packet directly + /// without transforming the data. + /// + /// \param data Pointer to the received bytes + /// \param size Number of bytes + /// + /// \see onSend + /// + //////////////////////////////////////////////////////////// + virtual void onReceive(const void* data, std::size_t size); + +private: + + //////////////////////////////////////////////////////////// + /// Disallow comparisons between packets + /// + //////////////////////////////////////////////////////////// + bool operator ==(const Packet& right) const; + bool operator !=(const Packet& right) const; + + //////////////////////////////////////////////////////////// + /// \brief Check if the packet can extract a given number of bytes + /// + /// This function updates accordingly the state of the packet. + /// + /// \param size Size to check + /// + /// \return True if \a size bytes can be read from the packet + /// + //////////////////////////////////////////////////////////// + bool checkSize(std::size_t size); + + //////////////////////////////////////////////////////////// + // Member data + //////////////////////////////////////////////////////////// + std::vector m_data; ///< Data stored in the packet + std::size_t m_readPos; ///< Current reading position in the packet + std::size_t m_sendPos; ///< Current send position in the packet (for handling partial sends) + bool m_isValid; ///< Reading state of the packet +}; + +} // namespace sf + + +#endif // SFML_PACKET_HPP + + +//////////////////////////////////////////////////////////// +/// \class sf::Packet +/// \ingroup network +/// +/// Packets provide a safe and easy way to serialize data, +/// in order to send it over the network using sockets +/// (sf::TcpSocket, sf::UdpSocket). +/// +/// Packets solve 2 fundamental problems that arise when +/// transferring data over the network: +/// \li data is interpreted correctly according to the endianness +/// \li the bounds of the packet are preserved (one send == one receive) +/// +/// The sf::Packet class provides both input and output modes. +/// It is designed to follow the behavior of standard C++ streams, +/// using operators >> and << to extract and insert data. +/// +/// It is recommended to use only fixed-size types (like sf::Int32, etc.), +/// to avoid possible differences between the sender and the receiver. +/// Indeed, the native C++ types may have different sizes on two platforms +/// and your data may be corrupted if that happens. +/// +/// Usage example: +/// \code +/// sf::Uint32 x = 24; +/// std::string s = "hello"; +/// double d = 5.89; +/// +/// // Group the variables to send into a packet +/// sf::Packet packet; +/// packet << x << s << d; +/// +/// // Send it over the network (socket is a valid sf::TcpSocket) +/// socket.send(packet); +/// +/// ----------------------------------------------------------------- +/// +/// // Receive the packet at the other end +/// sf::Packet packet; +/// socket.receive(packet); +/// +/// // Extract the variables contained in the packet +/// sf::Uint32 x; +/// std::string s; +/// double d; +/// if (packet >> x >> s >> d) +/// { +/// // Data extracted successfully... +/// } +/// \endcode +/// +/// Packets have built-in operator >> and << overloads for +/// standard types: +/// \li bool +/// \li fixed-size integer types (sf::Int8/16/32, sf::Uint8/16/32) +/// \li floating point numbers (float, double) +/// \li string types (char*, wchar_t*, std::string, std::wstring, sf::String) +/// +/// Like standard streams, it is also possible to define your own +/// overloads of operators >> and << in order to handle your +/// custom types. +/// +/// \code +/// struct MyStruct +/// { +/// float number; +/// sf::Int8 integer; +/// std::string str; +/// }; +/// +/// sf::Packet& operator <<(sf::Packet& packet, const MyStruct& m) +/// { +/// return packet << m.number << m.integer << m.str; +/// } +/// +/// sf::Packet& operator >>(sf::Packet& packet, MyStruct& m) +/// { +/// return packet >> m.number >> m.integer >> m.str; +/// } +/// \endcode +/// +/// Packets also provide an extra feature that allows to apply +/// custom transformations to the data before it is sent, +/// and after it is received. This is typically used to +/// handle automatic compression or encryption of the data. +/// This is achieved by inheriting from sf::Packet, and overriding +/// the onSend and onReceive functions. +/// +/// Here is an example: +/// \code +/// class ZipPacket : public sf::Packet +/// { +/// virtual const void* onSend(std::size_t& size) +/// { +/// const void* srcData = getData(); +/// std::size_t srcSize = getDataSize(); +/// +/// return MySuperZipFunction(srcData, srcSize, &size); +/// } +/// +/// virtual void onReceive(const void* data, std::size_t size) +/// { +/// std::size_t dstSize; +/// const void* dstData = MySuperUnzipFunction(data, size, &dstSize); +/// +/// append(dstData, dstSize); +/// } +/// }; +/// +/// // Use like regular packets: +/// ZipPacket packet; +/// packet << x << s << d; +/// ... +/// \endcode +/// +/// \see sf::TcpSocket, sf::UdpSocket +/// +//////////////////////////////////////////////////////////// diff --git a/mcclone/external/sfml23/include/SFML/Network/Socket.hpp b/mcclone/external/sfml23/include/SFML/Network/Socket.hpp new file mode 100644 index 0000000..d63f55e --- /dev/null +++ b/mcclone/external/sfml23/include/SFML/Network/Socket.hpp @@ -0,0 +1,219 @@ +//////////////////////////////////////////////////////////// +// +// SFML - Simple and Fast Multimedia Library +// Copyright (C) 2007-2015 Laurent Gomila (laurent@sfml-dev.org) +// +// This software is provided 'as-is', without any express or implied warranty. +// In no event will the authors be held liable for any damages arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it freely, +// subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; +// you must not claim that you wrote the original software. +// If you use this software in a product, an acknowledgment +// in the product documentation would be appreciated but is not required. +// +// 2. Altered source versions must be plainly marked as such, +// and must not be misrepresented as being the original software. +// +// 3. This notice may not be removed or altered from any source distribution. +// +//////////////////////////////////////////////////////////// + +#ifndef SFML_SOCKET_HPP +#define SFML_SOCKET_HPP + +//////////////////////////////////////////////////////////// +// Headers +//////////////////////////////////////////////////////////// +#include +#include +#include +#include + + +namespace sf +{ +class SocketSelector; + +//////////////////////////////////////////////////////////// +/// \brief Base class for all the socket types +/// +//////////////////////////////////////////////////////////// +class SFML_NETWORK_API Socket : NonCopyable +{ +public: + + //////////////////////////////////////////////////////////// + /// \brief Status codes that may be returned by socket functions + /// + //////////////////////////////////////////////////////////// + enum Status + { + Done, ///< The socket has sent / received the data + NotReady, ///< The socket is not ready to send / receive data yet + Partial, ///< The socket sent a part of the data + Disconnected, ///< The TCP socket has been disconnected + Error ///< An unexpected error happened + }; + + //////////////////////////////////////////////////////////// + /// \brief Some special values used by sockets + /// + //////////////////////////////////////////////////////////// + enum + { + AnyPort = 0 ///< Special value that tells the system to pick any available port + }; + +public: + + //////////////////////////////////////////////////////////// + /// \brief Destructor + /// + //////////////////////////////////////////////////////////// + virtual ~Socket(); + + //////////////////////////////////////////////////////////// + /// \brief Set the blocking state of the socket + /// + /// In blocking mode, calls will not return until they have + /// completed their task. For example, a call to Receive in + /// blocking mode won't return until some data was actually + /// received. + /// In non-blocking mode, calls will always return immediately, + /// using the return code to signal whether there was data + /// available or not. + /// By default, all sockets are blocking. + /// + /// \param blocking True to set the socket as blocking, false for non-blocking + /// + /// \see isBlocking + /// + //////////////////////////////////////////////////////////// + void setBlocking(bool blocking); + + //////////////////////////////////////////////////////////// + /// \brief Tell whether the socket is in blocking or non-blocking mode + /// + /// \return True if the socket is blocking, false otherwise + /// + /// \see setBlocking + /// + //////////////////////////////////////////////////////////// + bool isBlocking() const; + +protected: + + //////////////////////////////////////////////////////////// + /// \brief Types of protocols that the socket can use + /// + //////////////////////////////////////////////////////////// + enum Type + { + Tcp, ///< TCP protocol + Udp ///< UDP protocol + }; + + //////////////////////////////////////////////////////////// + /// \brief Default constructor + /// + /// This constructor can only be accessed by derived classes. + /// + /// \param type Type of the socket (TCP or UDP) + /// + //////////////////////////////////////////////////////////// + Socket(Type type); + + //////////////////////////////////////////////////////////// + /// \brief Return the internal handle of the socket + /// + /// The returned handle may be invalid if the socket + /// was not created yet (or already destroyed). + /// This function can only be accessed by derived classes. + /// + /// \return The internal (OS-specific) handle of the socket + /// + //////////////////////////////////////////////////////////// + SocketHandle getHandle() const; + + //////////////////////////////////////////////////////////// + /// \brief Create the internal representation of the socket + /// + /// This function can only be accessed by derived classes. + /// + //////////////////////////////////////////////////////////// + void create(); + + //////////////////////////////////////////////////////////// + /// \brief Create the internal representation of the socket + /// from a socket handle + /// + /// This function can only be accessed by derived classes. + /// + /// \param handle OS-specific handle of the socket to wrap + /// + //////////////////////////////////////////////////////////// + void create(SocketHandle handle); + + //////////////////////////////////////////////////////////// + /// \brief Close the socket gracefully + /// + /// This function can only be accessed by derived classes. + /// + //////////////////////////////////////////////////////////// + void close(); + +private: + + friend class SocketSelector; + + //////////////////////////////////////////////////////////// + // Member data + //////////////////////////////////////////////////////////// + Type m_type; ///< Type of the socket (TCP or UDP) + SocketHandle m_socket; ///< Socket descriptor + bool m_isBlocking; ///< Current blocking mode of the socket +}; + +} // namespace sf + + +#endif // SFML_SOCKET_HPP + + +//////////////////////////////////////////////////////////// +/// \class sf::Socket +/// \ingroup network +/// +/// This class mainly defines internal stuff to be used by +/// derived classes. +/// +/// The only public features that it defines, and which +/// is therefore common to all the socket classes, is the +/// blocking state. All sockets can be set as blocking or +/// non-blocking. +/// +/// In blocking mode, socket functions will hang until +/// the operation completes, which means that the entire +/// program (well, in fact the current thread if you use +/// multiple ones) will be stuck waiting for your socket +/// operation to complete. +/// +/// In non-blocking mode, all the socket functions will +/// return immediately. If the socket is not ready to complete +/// the requested operation, the function simply returns +/// the proper status code (Socket::NotReady). +/// +/// The default mode, which is blocking, is the one that is +/// generally used, in combination with threads or selectors. +/// The non-blocking mode is rather used in real-time +/// applications that run an endless loop that can poll +/// the socket often enough, and cannot afford blocking +/// this loop. +/// +/// \see sf::TcpListener, sf::TcpSocket, sf::UdpSocket +/// +//////////////////////////////////////////////////////////// diff --git a/mcclone/external/sfml23/include/SFML/Network/SocketHandle.hpp b/mcclone/external/sfml23/include/SFML/Network/SocketHandle.hpp new file mode 100644 index 0000000..7808ab5 --- /dev/null +++ b/mcclone/external/sfml23/include/SFML/Network/SocketHandle.hpp @@ -0,0 +1,57 @@ +//////////////////////////////////////////////////////////// +// +// SFML - Simple and Fast Multimedia Library +// Copyright (C) 2007-2015 Laurent Gomila (laurent@sfml-dev.org) +// +// This software is provided 'as-is', without any express or implied warranty. +// In no event will the authors be held liable for any damages arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it freely, +// subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; +// you must not claim that you wrote the original software. +// If you use this software in a product, an acknowledgment +// in the product documentation would be appreciated but is not required. +// +// 2. Altered source versions must be plainly marked as such, +// and must not be misrepresented as being the original software. +// +// 3. This notice may not be removed or altered from any source distribution. +// +//////////////////////////////////////////////////////////// + +#ifndef SFML_SOCKETHANDLE_HPP +#define SFML_SOCKETHANDLE_HPP + +//////////////////////////////////////////////////////////// +// Headers +//////////////////////////////////////////////////////////// +#include + +#if defined(SFML_SYSTEM_WINDOWS) + #include +#endif + + +namespace sf +{ +//////////////////////////////////////////////////////////// +// Define the low-level socket handle type, specific to +// each platform +//////////////////////////////////////////////////////////// +#if defined(SFML_SYSTEM_WINDOWS) + + typedef UINT_PTR SocketHandle; + +#else + + typedef int SocketHandle; + +#endif + +} // namespace sf + + +#endif // SFML_SOCKETHANDLE_HPP diff --git a/mcclone/external/sfml23/include/SFML/Network/SocketSelector.hpp b/mcclone/external/sfml23/include/SFML/Network/SocketSelector.hpp new file mode 100644 index 0000000..4d334c6 --- /dev/null +++ b/mcclone/external/sfml23/include/SFML/Network/SocketSelector.hpp @@ -0,0 +1,263 @@ +//////////////////////////////////////////////////////////// +// +// SFML - Simple and Fast Multimedia Library +// Copyright (C) 2007-2015 Laurent Gomila (laurent@sfml-dev.org) +// +// This software is provided 'as-is', without any express or implied warranty. +// In no event will the authors be held liable for any damages arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it freely, +// subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; +// you must not claim that you wrote the original software. +// If you use this software in a product, an acknowledgment +// in the product documentation would be appreciated but is not required. +// +// 2. Altered source versions must be plainly marked as such, +// and must not be misrepresented as being the original software. +// +// 3. This notice may not be removed or altered from any source distribution. +// +//////////////////////////////////////////////////////////// + +#ifndef SFML_SOCKETSELECTOR_HPP +#define SFML_SOCKETSELECTOR_HPP + +//////////////////////////////////////////////////////////// +// Headers +//////////////////////////////////////////////////////////// +#include +#include + + +namespace sf +{ +class Socket; + +//////////////////////////////////////////////////////////// +/// \brief Multiplexer that allows to read from multiple sockets +/// +//////////////////////////////////////////////////////////// +class SFML_NETWORK_API SocketSelector +{ +public: + + //////////////////////////////////////////////////////////// + /// \brief Default constructor + /// + //////////////////////////////////////////////////////////// + SocketSelector(); + + //////////////////////////////////////////////////////////// + /// \brief Copy constructor + /// + /// \param copy Instance to copy + /// + //////////////////////////////////////////////////////////// + SocketSelector(const SocketSelector& copy); + + //////////////////////////////////////////////////////////// + /// \brief Destructor + /// + //////////////////////////////////////////////////////////// + ~SocketSelector(); + + //////////////////////////////////////////////////////////// + /// \brief Add a new socket to the selector + /// + /// This function keeps a weak reference to the socket, + /// so you have to make sure that the socket is not destroyed + /// while it is stored in the selector. + /// This function does nothing if the socket is not valid. + /// + /// \param socket Reference to the socket to add + /// + /// \see remove, clear + /// + //////////////////////////////////////////////////////////// + void add(Socket& socket); + + //////////////////////////////////////////////////////////// + /// \brief Remove a socket from the selector + /// + /// This function doesn't destroy the socket, it simply + /// removes the reference that the selector has to it. + /// + /// \param socket Reference to the socket to remove + /// + /// \see add, clear + /// + //////////////////////////////////////////////////////////// + void remove(Socket& socket); + + //////////////////////////////////////////////////////////// + /// \brief Remove all the sockets stored in the selector + /// + /// This function doesn't destroy any instance, it simply + /// removes all the references that the selector has to + /// external sockets. + /// + /// \see add, remove + /// + //////////////////////////////////////////////////////////// + void clear(); + + //////////////////////////////////////////////////////////// + /// \brief Wait until one or more sockets are ready to receive + /// + /// This function returns as soon as at least one socket has + /// some data available to be received. To know which sockets are + /// ready, use the isReady function. + /// If you use a timeout and no socket is ready before the timeout + /// is over, the function returns false. + /// + /// \param timeout Maximum time to wait, (use Time::Zero for infinity) + /// + /// \return True if there are sockets ready, false otherwise + /// + /// \see isReady + /// + //////////////////////////////////////////////////////////// + bool wait(Time timeout = Time::Zero); + + //////////////////////////////////////////////////////////// + /// \brief Test a socket to know if it is ready to receive data + /// + /// This function must be used after a call to Wait, to know + /// which sockets are ready to receive data. If a socket is + /// ready, a call to receive will never block because we know + /// that there is data available to read. + /// Note that if this function returns true for a TcpListener, + /// this means that it is ready to accept a new connection. + /// + /// \param socket Socket to test + /// + /// \return True if the socket is ready to read, false otherwise + /// + /// \see isReady + /// + //////////////////////////////////////////////////////////// + bool isReady(Socket& socket) const; + + //////////////////////////////////////////////////////////// + /// \brief Overload of assignment operator + /// + /// \param right Instance to assign + /// + /// \return Reference to self + /// + //////////////////////////////////////////////////////////// + SocketSelector& operator =(const SocketSelector& right); + +private: + + struct SocketSelectorImpl; + + //////////////////////////////////////////////////////////// + // Member data + //////////////////////////////////////////////////////////// + SocketSelectorImpl* m_impl; ///< Opaque pointer to the implementation (which requires OS-specific types) +}; + +} // namespace sf + + +#endif // SFML_SOCKETSELECTOR_HPP + + +//////////////////////////////////////////////////////////// +/// \class sf::SocketSelector +/// \ingroup network +/// +/// Socket selectors provide a way to wait until some data is +/// available on a set of sockets, instead of just one. This +/// is convenient when you have multiple sockets that may +/// possibly receive data, but you don't know which one will +/// be ready first. In particular, it avoids to use a thread +/// for each socket; with selectors, a single thread can handle +/// all the sockets. +/// +/// All types of sockets can be used in a selector: +/// \li sf::TcpListener +/// \li sf::TcpSocket +/// \li sf::UdpSocket +/// +/// A selector doesn't store its own copies of the sockets +/// (socket classes are not copyable anyway), it simply keeps +/// a reference to the original sockets that you pass to the +/// "add" function. Therefore, you can't use the selector as a +/// socket container, you must store them outside and make sure +/// that they are alive as long as they are used in the selector. +/// +/// Using a selector is simple: +/// \li populate the selector with all the sockets that you want to observe +/// \li make it wait until there is data available on any of the sockets +/// \li test each socket to find out which ones are ready +/// +/// Usage example: +/// \code +/// // Create a socket to listen to new connections +/// sf::TcpListener listener; +/// listener.listen(55001); +/// +/// // Create a list to store the future clients +/// std::list clients; +/// +/// // Create a selector +/// sf::SocketSelector selector; +/// +/// // Add the listener to the selector +/// selector.add(listener); +/// +/// // Endless loop that waits for new connections +/// while (running) +/// { +/// // Make the selector wait for data on any socket +/// if (selector.wait()) +/// { +/// // Test the listener +/// if (selector.isReady(listener)) +/// { +/// // The listener is ready: there is a pending connection +/// sf::TcpSocket* client = new sf::TcpSocket; +/// if (listener.accept(*client) == sf::Socket::Done) +/// { +/// // Add the new client to the clients list +/// clients.push_back(client); +/// +/// // Add the new client to the selector so that we will +/// // be notified when he sends something +/// selector.add(*client); +/// } +/// else +/// { +/// // Error, we won't get a new connection, delete the socket +/// delete client; +/// } +/// } +/// else +/// { +/// // The listener socket is not ready, test all other sockets (the clients) +/// for (std::list::iterator it = clients.begin(); it != clients.end(); ++it) +/// { +/// sf::TcpSocket& client = **it; +/// if (selector.isReady(client)) +/// { +/// // The client has sent some data, we can receive it +/// sf::Packet packet; +/// if (client.receive(packet) == sf::Socket::Done) +/// { +/// ... +/// } +/// } +/// } +/// } +/// } +/// } +/// \endcode +/// +/// \see sf::Socket +/// +//////////////////////////////////////////////////////////// diff --git a/mcclone/external/sfml23/include/SFML/Network/TcpListener.hpp b/mcclone/external/sfml23/include/SFML/Network/TcpListener.hpp new file mode 100644 index 0000000..a46ef29 --- /dev/null +++ b/mcclone/external/sfml23/include/SFML/Network/TcpListener.hpp @@ -0,0 +1,162 @@ +//////////////////////////////////////////////////////////// +// +// SFML - Simple and Fast Multimedia Library +// Copyright (C) 2007-2015 Laurent Gomila (laurent@sfml-dev.org) +// +// This software is provided 'as-is', without any express or implied warranty. +// In no event will the authors be held liable for any damages arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it freely, +// subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; +// you must not claim that you wrote the original software. +// If you use this software in a product, an acknowledgment +// in the product documentation would be appreciated but is not required. +// +// 2. Altered source versions must be plainly marked as such, +// and must not be misrepresented as being the original software. +// +// 3. This notice may not be removed or altered from any source distribution. +// +//////////////////////////////////////////////////////////// + +#ifndef SFML_TCPLISTENER_HPP +#define SFML_TCPLISTENER_HPP + +//////////////////////////////////////////////////////////// +// Headers +//////////////////////////////////////////////////////////// +#include +#include + + +namespace sf +{ +class TcpSocket; + +//////////////////////////////////////////////////////////// +/// \brief Socket that listens to new TCP connections +/// +//////////////////////////////////////////////////////////// +class SFML_NETWORK_API TcpListener : public Socket +{ +public: + + //////////////////////////////////////////////////////////// + /// \brief Default constructor + /// + //////////////////////////////////////////////////////////// + TcpListener(); + + //////////////////////////////////////////////////////////// + /// \brief Get the port to which the socket is bound locally + /// + /// If the socket is not listening to a port, this function + /// returns 0. + /// + /// \return Port to which the socket is bound + /// + /// \see listen + /// + //////////////////////////////////////////////////////////// + unsigned short getLocalPort() const; + + //////////////////////////////////////////////////////////// + /// \brief Start listening for connections + /// + /// This functions makes the socket listen to the specified + /// port, waiting for new connections. + /// If the socket was previously listening to another port, + /// it will be stopped first and bound to the new port. + /// + /// \param port Port to listen for new connections + /// + /// \return Status code + /// + /// \see accept, close + /// + //////////////////////////////////////////////////////////// + Status listen(unsigned short port); + + //////////////////////////////////////////////////////////// + /// \brief Stop listening and close the socket + /// + /// This function gracefully stops the listener. If the + /// socket is not listening, this function has no effect. + /// + /// \see listen + /// + //////////////////////////////////////////////////////////// + void close(); + + //////////////////////////////////////////////////////////// + /// \brief Accept a new connection + /// + /// If the socket is in blocking mode, this function will + /// not return until a connection is actually received. + /// + /// \param socket Socket that will hold the new connection + /// + /// \return Status code + /// + /// \see listen + /// + //////////////////////////////////////////////////////////// + Status accept(TcpSocket& socket); +}; + + +} // namespace sf + + +#endif // SFML_TCPLISTENER_HPP + + +//////////////////////////////////////////////////////////// +/// \class sf::TcpListener +/// \ingroup network +/// +/// A listener socket is a special type of socket that listens to +/// a given port and waits for connections on that port. +/// This is all it can do. +/// +/// When a new connection is received, you must call accept and +/// the listener returns a new instance of sf::TcpSocket that +/// is properly initialized and can be used to communicate with +/// the new client. +/// +/// Listener sockets are specific to the TCP protocol, +/// UDP sockets are connectionless and can therefore communicate +/// directly. As a consequence, a listener socket will always +/// return the new connections as sf::TcpSocket instances. +/// +/// A listener is automatically closed on destruction, like all +/// other types of socket. However if you want to stop listening +/// before the socket is destroyed, you can call its close() +/// function. +/// +/// Usage example: +/// \code +/// // Create a listener socket and make it wait for new +/// // connections on port 55001 +/// sf::TcpListener listener; +/// listener.listen(55001); +/// +/// // Endless loop that waits for new connections +/// while (running) +/// { +/// sf::TcpSocket client; +/// if (listener.accept(client) == sf::Socket::Done) +/// { +/// // A new client just connected! +/// std::cout << "New connection received from " << client.getRemoteAddress() << std::endl; +/// doSomethingWith(client); +/// } +/// } +/// \endcode +/// +/// \see sf::TcpSocket, sf::Socket +/// +//////////////////////////////////////////////////////////// diff --git a/mcclone/external/sfml23/include/SFML/Network/TcpSocket.hpp b/mcclone/external/sfml23/include/SFML/Network/TcpSocket.hpp new file mode 100644 index 0000000..a402506 --- /dev/null +++ b/mcclone/external/sfml23/include/SFML/Network/TcpSocket.hpp @@ -0,0 +1,315 @@ +//////////////////////////////////////////////////////////// +// +// SFML - Simple and Fast Multimedia Library +// Copyright (C) 2007-2015 Laurent Gomila (laurent@sfml-dev.org) +// +// This software is provided 'as-is', without any express or implied warranty. +// In no event will the authors be held liable for any damages arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it freely, +// subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; +// you must not claim that you wrote the original software. +// If you use this software in a product, an acknowledgment +// in the product documentation would be appreciated but is not required. +// +// 2. Altered source versions must be plainly marked as such, +// and must not be misrepresented as being the original software. +// +// 3. This notice may not be removed or altered from any source distribution. +// +//////////////////////////////////////////////////////////// + +#ifndef SFML_TCPSOCKET_HPP +#define SFML_TCPSOCKET_HPP + +//////////////////////////////////////////////////////////// +// Headers +//////////////////////////////////////////////////////////// +#include +#include +#include + + +namespace sf +{ +class TcpListener; +class IpAddress; +class Packet; + +//////////////////////////////////////////////////////////// +/// \brief Specialized socket using the TCP protocol +/// +//////////////////////////////////////////////////////////// +class SFML_NETWORK_API TcpSocket : public Socket +{ +public: + + //////////////////////////////////////////////////////////// + /// \brief Default constructor + /// + //////////////////////////////////////////////////////////// + TcpSocket(); + + //////////////////////////////////////////////////////////// + /// \brief Get the port to which the socket is bound locally + /// + /// If the socket is not connected, this function returns 0. + /// + /// \return Port to which the socket is bound + /// + /// \see connect, getRemotePort + /// + //////////////////////////////////////////////////////////// + unsigned short getLocalPort() const; + + //////////////////////////////////////////////////////////// + /// \brief Get the address of the connected peer + /// + /// It the socket is not connected, this function returns + /// sf::IpAddress::None. + /// + /// \return Address of the remote peer + /// + /// \see getRemotePort + /// + //////////////////////////////////////////////////////////// + IpAddress getRemoteAddress() const; + + //////////////////////////////////////////////////////////// + /// \brief Get the port of the connected peer to which + /// the socket is connected + /// + /// If the socket is not connected, this function returns 0. + /// + /// \return Remote port to which the socket is connected + /// + /// \see getRemoteAddress + /// + //////////////////////////////////////////////////////////// + unsigned short getRemotePort() const; + + //////////////////////////////////////////////////////////// + /// \brief Connect the socket to a remote peer + /// + /// In blocking mode, this function may take a while, especially + /// if the remote peer is not reachable. The last parameter allows + /// you to stop trying to connect after a given timeout. + /// If the socket was previously connected, it is first disconnected. + /// + /// \param remoteAddress Address of the remote peer + /// \param remotePort Port of the remote peer + /// \param timeout Optional maximum time to wait + /// + /// \return Status code + /// + /// \see disconnect + /// + //////////////////////////////////////////////////////////// + Status connect(const IpAddress& remoteAddress, unsigned short remotePort, Time timeout = Time::Zero); + + //////////////////////////////////////////////////////////// + /// \brief Disconnect the socket from its remote peer + /// + /// This function gracefully closes the connection. If the + /// socket is not connected, this function has no effect. + /// + /// \see connect + /// + //////////////////////////////////////////////////////////// + void disconnect(); + + //////////////////////////////////////////////////////////// + /// \brief Send raw data to the remote peer + /// + /// To be able to handle partial sends over non-blocking + /// sockets, use the send(const void*, std::size_t, std::size_t&) + /// overload instead. + /// This function will fail if the socket is not connected. + /// + /// \param data Pointer to the sequence of bytes to send + /// \param size Number of bytes to send + /// + /// \return Status code + /// + /// \see receive + /// + //////////////////////////////////////////////////////////// + Status send(const void* data, std::size_t size); + + //////////////////////////////////////////////////////////// + /// \brief Send raw data to the remote peer + /// + /// This function will fail if the socket is not connected. + /// + /// \param data Pointer to the sequence of bytes to send + /// \param size Number of bytes to send + /// \param sent The number of bytes sent will be written here + /// + /// \return Status code + /// + /// \see receive + /// + //////////////////////////////////////////////////////////// + Status send(const void* data, std::size_t size, std::size_t& sent); + + //////////////////////////////////////////////////////////// + /// \brief Receive raw data from the remote peer + /// + /// In blocking mode, this function will wait until some + /// bytes are actually received. + /// This function will fail if the socket is not connected. + /// + /// \param data Pointer to the array to fill with the received bytes + /// \param size Maximum number of bytes that can be received + /// \param received This variable is filled with the actual number of bytes received + /// + /// \return Status code + /// + /// \see send + /// + //////////////////////////////////////////////////////////// + Status receive(void* data, std::size_t size, std::size_t& received); + + //////////////////////////////////////////////////////////// + /// \brief Send a formatted packet of data to the remote peer + /// + /// In non-blocking mode, if this function returns sf::Socket::Partial, + /// you \em must retry sending the same unmodified packet before sending + /// anything else in order to guarantee the packet arrives at the remote + /// peer uncorrupted. + /// This function will fail if the socket is not connected. + /// + /// \param packet Packet to send + /// + /// \return Status code + /// + /// \see receive + /// + //////////////////////////////////////////////////////////// + Status send(Packet& packet); + + //////////////////////////////////////////////////////////// + /// \brief Receive a formatted packet of data from the remote peer + /// + /// In blocking mode, this function will wait until the whole packet + /// has been received. + /// This function will fail if the socket is not connected. + /// + /// \param packet Packet to fill with the received data + /// + /// \return Status code + /// + /// \see send + /// + //////////////////////////////////////////////////////////// + Status receive(Packet& packet); + +private: + + friend class TcpListener; + + //////////////////////////////////////////////////////////// + /// \brief Structure holding the data of a pending packet + /// + //////////////////////////////////////////////////////////// + struct PendingPacket + { + PendingPacket(); + + Uint32 Size; ///< Data of packet size + std::size_t SizeReceived; ///< Number of size bytes received so far + std::vector Data; ///< Data of the packet + }; + + //////////////////////////////////////////////////////////// + // Member data + //////////////////////////////////////////////////////////// + PendingPacket m_pendingPacket; ///< Temporary data of the packet currently being received +}; + +} // namespace sf + + +#endif // SFML_TCPSOCKET_HPP + + +//////////////////////////////////////////////////////////// +/// \class sf::TcpSocket +/// \ingroup network +/// +/// TCP is a connected protocol, which means that a TCP +/// socket can only communicate with the host it is connected +/// to. It can't send or receive anything if it is not connected. +/// +/// The TCP protocol is reliable but adds a slight overhead. +/// It ensures that your data will always be received in order +/// and without errors (no data corrupted, lost or duplicated). +/// +/// When a socket is connected to a remote host, you can +/// retrieve informations about this host with the +/// getRemoteAddress and getRemotePort functions. You can +/// also get the local port to which the socket is bound +/// (which is automatically chosen when the socket is connected), +/// with the getLocalPort function. +/// +/// Sending and receiving data can use either the low-level +/// or the high-level functions. The low-level functions +/// process a raw sequence of bytes, and cannot ensure that +/// one call to Send will exactly match one call to Receive +/// at the other end of the socket. +/// +/// The high-level interface uses packets (see sf::Packet), +/// which are easier to use and provide more safety regarding +/// the data that is exchanged. You can look at the sf::Packet +/// class to get more details about how they work. +/// +/// The socket is automatically disconnected when it is destroyed, +/// but if you want to explicitly close the connection while +/// the socket instance is still alive, you can call disconnect. +/// +/// Usage example: +/// \code +/// // ----- The client ----- +/// +/// // Create a socket and connect it to 192.168.1.50 on port 55001 +/// sf::TcpSocket socket; +/// socket.connect("192.168.1.50", 55001); +/// +/// // Send a message to the connected host +/// std::string message = "Hi, I am a client"; +/// socket.send(message.c_str(), message.size() + 1); +/// +/// // Receive an answer from the server +/// char buffer[1024]; +/// std::size_t received = 0; +/// socket.receive(buffer, sizeof(buffer), received); +/// std::cout << "The server said: " << buffer << std::endl; +/// +/// // ----- The server ----- +/// +/// // Create a listener to wait for incoming connections on port 55001 +/// sf::TcpListener listener; +/// listener.listen(55001); +/// +/// // Wait for a connection +/// sf::TcpSocket socket; +/// listener.accept(socket); +/// std::cout << "New client connected: " << socket.getRemoteAddress() << std::endl; +/// +/// // Receive a message from the client +/// char buffer[1024]; +/// std::size_t received = 0; +/// socket.receive(buffer, sizeof(buffer), received); +/// std::cout << "The client said: " << buffer << std::endl; +/// +/// // Send an answer +/// std::string message = "Welcome, client"; +/// socket.send(message.c_str(), message.size() + 1); +/// \endcode +/// +/// \see sf::Socket, sf::UdpSocket, sf::Packet +/// +//////////////////////////////////////////////////////////// diff --git a/mcclone/external/sfml23/include/SFML/Network/UdpSocket.hpp b/mcclone/external/sfml23/include/SFML/Network/UdpSocket.hpp new file mode 100644 index 0000000..f00c257 --- /dev/null +++ b/mcclone/external/sfml23/include/SFML/Network/UdpSocket.hpp @@ -0,0 +1,283 @@ +//////////////////////////////////////////////////////////// +// +// SFML - Simple and Fast Multimedia Library +// Copyright (C) 2007-2015 Laurent Gomila (laurent@sfml-dev.org) +// +// This software is provided 'as-is', without any express or implied warranty. +// In no event will the authors be held liable for any damages arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it freely, +// subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; +// you must not claim that you wrote the original software. +// If you use this software in a product, an acknowledgment +// in the product documentation would be appreciated but is not required. +// +// 2. Altered source versions must be plainly marked as such, +// and must not be misrepresented as being the original software. +// +// 3. This notice may not be removed or altered from any source distribution. +// +//////////////////////////////////////////////////////////// + +#ifndef SFML_UDPSOCKET_HPP +#define SFML_UDPSOCKET_HPP + +//////////////////////////////////////////////////////////// +// Headers +//////////////////////////////////////////////////////////// +#include +#include +#include + + +namespace sf +{ +class IpAddress; +class Packet; + +//////////////////////////////////////////////////////////// +/// \brief Specialized socket using the UDP protocol +/// +//////////////////////////////////////////////////////////// +class SFML_NETWORK_API UdpSocket : public Socket +{ +public: + + //////////////////////////////////////////////////////////// + // Constants + //////////////////////////////////////////////////////////// + enum + { + MaxDatagramSize = 65507 ///< The maximum number of bytes that can be sent in a single UDP datagram + }; + + //////////////////////////////////////////////////////////// + /// \brief Default constructor + /// + //////////////////////////////////////////////////////////// + UdpSocket(); + + //////////////////////////////////////////////////////////// + /// \brief Get the port to which the socket is bound locally + /// + /// If the socket is not bound to a port, this function + /// returns 0. + /// + /// \return Port to which the socket is bound + /// + /// \see bind + /// + //////////////////////////////////////////////////////////// + unsigned short getLocalPort() const; + + //////////////////////////////////////////////////////////// + /// \brief Bind the socket to a specific port + /// + /// Binding the socket to a port is necessary for being + /// able to receive data on that port. + /// You can use the special value Socket::AnyPort to tell the + /// system to automatically pick an available port, and then + /// call getLocalPort to retrieve the chosen port. + /// + /// \param port Port to bind the socket to + /// + /// \return Status code + /// + /// \see unbind, getLocalPort + /// + //////////////////////////////////////////////////////////// + Status bind(unsigned short port); + + //////////////////////////////////////////////////////////// + /// \brief Unbind the socket from the local port to which it is bound + /// + /// The port that the socket was previously using is immediately + /// available after this function is called. If the + /// socket is not bound to a port, this function has no effect. + /// + /// \see bind + /// + //////////////////////////////////////////////////////////// + void unbind(); + + //////////////////////////////////////////////////////////// + /// \brief Send raw data to a remote peer + /// + /// Make sure that \a size is not greater than + /// UdpSocket::MaxDatagramSize, otherwise this function will + /// fail and no data will be sent. + /// + /// \param data Pointer to the sequence of bytes to send + /// \param size Number of bytes to send + /// \param remoteAddress Address of the receiver + /// \param remotePort Port of the receiver to send the data to + /// + /// \return Status code + /// + /// \see receive + /// + //////////////////////////////////////////////////////////// + Status send(const void* data, std::size_t size, const IpAddress& remoteAddress, unsigned short remotePort); + + //////////////////////////////////////////////////////////// + /// \brief Receive raw data from a remote peer + /// + /// In blocking mode, this function will wait until some + /// bytes are actually received. + /// Be careful to use a buffer which is large enough for + /// the data that you intend to receive, if it is too small + /// then an error will be returned and *all* the data will + /// be lost. + /// + /// \param data Pointer to the array to fill with the received bytes + /// \param size Maximum number of bytes that can be received + /// \param received This variable is filled with the actual number of bytes received + /// \param remoteAddress Address of the peer that sent the data + /// \param remotePort Port of the peer that sent the data + /// + /// \return Status code + /// + /// \see send + /// + //////////////////////////////////////////////////////////// + Status receive(void* data, std::size_t size, std::size_t& received, IpAddress& remoteAddress, unsigned short& remotePort); + + //////////////////////////////////////////////////////////// + /// \brief Send a formatted packet of data to a remote peer + /// + /// Make sure that the packet size is not greater than + /// UdpSocket::MaxDatagramSize, otherwise this function will + /// fail and no data will be sent. + /// + /// \param packet Packet to send + /// \param remoteAddress Address of the receiver + /// \param remotePort Port of the receiver to send the data to + /// + /// \return Status code + /// + /// \see receive + /// + //////////////////////////////////////////////////////////// + Status send(Packet& packet, const IpAddress& remoteAddress, unsigned short remotePort); + + //////////////////////////////////////////////////////////// + /// \brief Receive a formatted packet of data from a remote peer + /// + /// In blocking mode, this function will wait until the whole packet + /// has been received. + /// + /// \param packet Packet to fill with the received data + /// \param remoteAddress Address of the peer that sent the data + /// \param remotePort Port of the peer that sent the data + /// + /// \return Status code + /// + /// \see send + /// + //////////////////////////////////////////////////////////// + Status receive(Packet& packet, IpAddress& remoteAddress, unsigned short& remotePort); + +private: + + //////////////////////////////////////////////////////////// + // Member data + //////////////////////////////////////////////////////////// + std::vector m_buffer; ///< Temporary buffer holding the received data in Receive(Packet) +}; + +} // namespace sf + + +#endif // SFML_UDPSOCKET_HPP + + +//////////////////////////////////////////////////////////// +/// \class sf::UdpSocket +/// \ingroup network +/// +/// A UDP socket is a connectionless socket. Instead of +/// connecting once to a remote host, like TCP sockets, +/// it can send to and receive from any host at any time. +/// +/// It is a datagram protocol: bounded blocks of data (datagrams) +/// are transfered over the network rather than a continuous +/// stream of data (TCP). Therefore, one call to send will always +/// match one call to receive (if the datagram is not lost), +/// with the same data that was sent. +/// +/// The UDP protocol is lightweight but unreliable. Unreliable +/// means that datagrams may be duplicated, be lost or +/// arrive reordered. However, if a datagram arrives, its +/// data is guaranteed to be valid. +/// +/// UDP is generally used for real-time communication +/// (audio or video streaming, real-time games, etc.) where +/// speed is crucial and lost data doesn't matter much. +/// +/// Sending and receiving data can use either the low-level +/// or the high-level functions. The low-level functions +/// process a raw sequence of bytes, whereas the high-level +/// interface uses packets (see sf::Packet), which are easier +/// to use and provide more safety regarding the data that is +/// exchanged. You can look at the sf::Packet class to get +/// more details about how they work. +/// +/// It is important to note that UdpSocket is unable to send +/// datagrams bigger than MaxDatagramSize. In this case, it +/// returns an error and doesn't send anything. This applies +/// to both raw data and packets. Indeed, even packets are +/// unable to split and recompose data, due to the unreliability +/// of the protocol (dropped, mixed or duplicated datagrams may +/// lead to a big mess when trying to recompose a packet). +/// +/// If the socket is bound to a port, it is automatically +/// unbound from it when the socket is destroyed. However, +/// you can unbind the socket explicitly with the Unbind +/// function if necessary, to stop receiving messages or +/// make the port available for other sockets. +/// +/// Usage example: +/// \code +/// // ----- The client ----- +/// +/// // Create a socket and bind it to the port 55001 +/// sf::UdpSocket socket; +/// socket.bind(55001); +/// +/// // Send a message to 192.168.1.50 on port 55002 +/// std::string message = "Hi, I am " + sf::IpAddress::getLocalAddress().toString(); +/// socket.send(message.c_str(), message.size() + 1, "192.168.1.50", 55002); +/// +/// // Receive an answer (most likely from 192.168.1.50, but could be anyone else) +/// char buffer[1024]; +/// std::size_t received = 0; +/// sf::IpAddress sender; +/// unsigned short port; +/// socket.receive(buffer, sizeof(buffer), received, sender, port); +/// std::cout << sender.ToString() << " said: " << buffer << std::endl; +/// +/// // ----- The server ----- +/// +/// // Create a socket and bind it to the port 55002 +/// sf::UdpSocket socket; +/// socket.bind(55002); +/// +/// // Receive a message from anyone +/// char buffer[1024]; +/// std::size_t received = 0; +/// sf::IpAddress sender; +/// unsigned short port; +/// socket.receive(buffer, sizeof(buffer), received, sender, port); +/// std::cout << sender.ToString() << " said: " << buffer << std::endl; +/// +/// // Send an answer +/// std::string message = "Welcome " + sender.toString(); +/// socket.send(message.c_str(), message.size() + 1, sender, port); +/// \endcode +/// +/// \see sf::Socket, sf::TcpSocket, sf::Packet +/// +//////////////////////////////////////////////////////////// diff --git a/mcclone/external/sfml23/include/SFML/OpenGL.hpp b/mcclone/external/sfml23/include/SFML/OpenGL.hpp new file mode 100644 index 0000000..a5d964f --- /dev/null +++ b/mcclone/external/sfml23/include/SFML/OpenGL.hpp @@ -0,0 +1,74 @@ +//////////////////////////////////////////////////////////// +// +// SFML - Simple and Fast Multimedia Library +// Copyright (C) 2007-2015 Laurent Gomila (laurent@sfml-dev.org) +// +// This software is provided 'as-is', without any express or implied warranty. +// In no event will the authors be held liable for any damages arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it freely, +// subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; +// you must not claim that you wrote the original software. +// If you use this software in a product, an acknowledgment +// in the product documentation would be appreciated but is not required. +// +// 2. Altered source versions must be plainly marked as such, +// and must not be misrepresented as being the original software. +// +// 3. This notice may not be removed or altered from any source distribution. +// +//////////////////////////////////////////////////////////// + +#ifndef SFML_OPENGL_HPP +#define SFML_OPENGL_HPP + + +//////////////////////////////////////////////////////////// +/// Headers +//////////////////////////////////////////////////////////// +#include + + +//////////////////////////////////////////////////////////// +/// This file just includes the OpenGL headers, +/// which have actually different paths on each system +//////////////////////////////////////////////////////////// +#if defined(SFML_SYSTEM_WINDOWS) + + // The Visual C++ version of gl.h uses WINGDIAPI and APIENTRY but doesn't define them + #ifdef _MSC_VER + #include + #endif + + #include + +#elif defined(SFML_SYSTEM_LINUX) || defined(SFML_SYSTEM_FREEBSD) + + #if defined(SFML_OPENGL_ES) + #include + #include + #else + #include + #endif + +#elif defined(SFML_SYSTEM_MACOS) + + #include + +#elif defined (SFML_SYSTEM_IOS) + + #include + #include + +#elif defined (SFML_SYSTEM_ANDROID) + + #include + #include + +#endif + + +#endif // SFML_OPENGL_HPP diff --git a/mcclone/external/sfml23/include/SFML/System.hpp b/mcclone/external/sfml23/include/SFML/System.hpp new file mode 100644 index 0000000..6af0652 --- /dev/null +++ b/mcclone/external/sfml23/include/SFML/System.hpp @@ -0,0 +1,60 @@ +//////////////////////////////////////////////////////////// +// +// SFML - Simple and Fast Multimedia Library +// Copyright (C) 2007-2015 Laurent Gomila (laurent@sfml-dev.org) +// +// This software is provided 'as-is', without any express or implied warranty. +// In no event will the authors be held liable for any damages arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it freely, +// subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; +// you must not claim that you wrote the original software. +// If you use this software in a product, an acknowledgment +// in the product documentation would be appreciated but is not required. +// +// 2. Altered source versions must be plainly marked as such, +// and must not be misrepresented as being the original software. +// +// 3. This notice may not be removed or altered from any source distribution. +// +//////////////////////////////////////////////////////////// + +#ifndef SFML_SYSTEM_HPP +#define SFML_SYSTEM_HPP + +//////////////////////////////////////////////////////////// +// Headers +//////////////////////////////////////////////////////////// + +#include +#include +#include +#include +#include +#include +#include +#include +#include +#include +#include +#include +#include +#include +#include +#include +#include +#include + +#endif // SFML_SYSTEM_HPP + +//////////////////////////////////////////////////////////// +/// \defgroup system System module +/// +/// Base module of SFML, defining various utilities. It provides +/// vector classes, Unicode strings and conversion functions, +/// threads and mutexes, timing classes. +/// +//////////////////////////////////////////////////////////// diff --git a/mcclone/external/sfml23/include/SFML/System/Clock.hpp b/mcclone/external/sfml23/include/SFML/System/Clock.hpp new file mode 100644 index 0000000..684c616 --- /dev/null +++ b/mcclone/external/sfml23/include/SFML/System/Clock.hpp @@ -0,0 +1,117 @@ +//////////////////////////////////////////////////////////// +// +// SFML - Simple and Fast Multimedia Library +// Copyright (C) 2007-2015 Laurent Gomila (laurent@sfml-dev.org) +// +// This software is provided 'as-is', without any express or implied warranty. +// In no event will the authors be held liable for any damages arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it freely, +// subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; +// you must not claim that you wrote the original software. +// If you use this software in a product, an acknowledgment +// in the product documentation would be appreciated but is not required. +// +// 2. Altered source versions must be plainly marked as such, +// and must not be misrepresented as being the original software. +// +// 3. This notice may not be removed or altered from any source distribution. +// +//////////////////////////////////////////////////////////// + +#ifndef SFML_CLOCK_HPP +#define SFML_CLOCK_HPP + +//////////////////////////////////////////////////////////// +// Headers +//////////////////////////////////////////////////////////// +#include +#include + + +namespace sf +{ +//////////////////////////////////////////////////////////// +/// \brief Utility class that measures the elapsed time +/// +//////////////////////////////////////////////////////////// +class SFML_SYSTEM_API Clock +{ +public: + + //////////////////////////////////////////////////////////// + /// \brief Default constructor + /// + /// The clock starts automatically after being constructed. + /// + //////////////////////////////////////////////////////////// + Clock(); + + //////////////////////////////////////////////////////////// + /// \brief Get the elapsed time + /// + /// This function returns the time elapsed since the last call + /// to restart() (or the construction of the instance if restart() + /// has not been called). + /// + /// \return Time elapsed + /// + //////////////////////////////////////////////////////////// + Time getElapsedTime() const; + + //////////////////////////////////////////////////////////// + /// \brief Restart the clock + /// + /// This function puts the time counter back to zero. + /// It also returns the time elapsed since the clock was started. + /// + /// \return Time elapsed + /// + //////////////////////////////////////////////////////////// + Time restart(); + +private: + + //////////////////////////////////////////////////////////// + // Member data + //////////////////////////////////////////////////////////// + Time m_startTime; ///< Time of last reset, in microseconds +}; + +} // namespace sf + + +#endif // SFML_CLOCK_HPP + + +//////////////////////////////////////////////////////////// +/// \class sf::Clock +/// \ingroup system +/// +/// sf::Clock is a lightweight class for measuring time. +/// +/// Its provides the most precise time that the underlying +/// OS can achieve (generally microseconds or nanoseconds). +/// It also ensures monotonicity, which means that the returned +/// time can never go backward, even if the system time is +/// changed. +/// +/// Usage example: +/// \code +/// sf::Clock clock; +/// ... +/// Time time1 = clock.getElapsedTime(); +/// ... +/// Time time2 = clock.restart(); +/// \endcode +/// +/// The sf::Time value returned by the clock can then be +/// converted to a number of seconds, milliseconds or even +/// microseconds. +/// +/// \see sf::Time +/// +//////////////////////////////////////////////////////////// diff --git a/mcclone/external/sfml23/include/SFML/System/Err.hpp b/mcclone/external/sfml23/include/SFML/System/Err.hpp new file mode 100644 index 0000000..1c5b468 --- /dev/null +++ b/mcclone/external/sfml23/include/SFML/System/Err.hpp @@ -0,0 +1,80 @@ +//////////////////////////////////////////////////////////// +// +// SFML - Simple and Fast Multimedia Library +// Copyright (C) 2007-2015 Laurent Gomila (laurent@sfml-dev.org) +// +// This software is provided 'as-is', without any express or implied warranty. +// In no event will the authors be held liable for any damages arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it freely, +// subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; +// you must not claim that you wrote the original software. +// If you use this software in a product, an acknowledgment +// in the product documentation would be appreciated but is not required. +// +// 2. Altered source versions must be plainly marked as such, +// and must not be misrepresented as being the original software. +// +// 3. This notice may not be removed or altered from any source distribution. +// +//////////////////////////////////////////////////////////// + +#ifndef SFML_ERR_HPP +#define SFML_ERR_HPP + +//////////////////////////////////////////////////////////// +// Headers +//////////////////////////////////////////////////////////// +#include +#include + + +namespace sf +{ +//////////////////////////////////////////////////////////// +/// \brief Standard stream used by SFML to output warnings and errors +/// +//////////////////////////////////////////////////////////// +SFML_SYSTEM_API std::ostream& err(); + +} // namespace sf + + +#endif // SFML_ERR_HPP + + +//////////////////////////////////////////////////////////// +/// \fn sf::err +/// \ingroup system +/// +/// By default, sf::err() outputs to the same location as std::cerr, +/// (-> the stderr descriptor) which is the console if there's +/// one available. +/// +/// It is a standard std::ostream instance, so it supports all the +/// insertion operations defined by the STL +/// (operator <<, manipulators, etc.). +/// +/// sf::err() can be redirected to write to another output, independently +/// of std::cerr, by using the rdbuf() function provided by the +/// std::ostream class. +/// +/// Example: +/// \code +/// // Redirect to a file +/// std::ofstream file("sfml-log.txt"); +/// std::streambuf* previous = sf::err().rdbuf(file.rdbuf()); +/// +/// // Redirect to nothing +/// sf::err().rdbuf(NULL); +/// +/// // Restore the original output +/// sf::err().rdbuf(previous); +/// \endcode +/// +/// \return Reference to std::ostream representing the SFML error stream +/// +//////////////////////////////////////////////////////////// diff --git a/mcclone/external/sfml23/include/SFML/System/Export.hpp b/mcclone/external/sfml23/include/SFML/System/Export.hpp new file mode 100644 index 0000000..f4adc10 --- /dev/null +++ b/mcclone/external/sfml23/include/SFML/System/Export.hpp @@ -0,0 +1,48 @@ +//////////////////////////////////////////////////////////// +// +// SFML - Simple and Fast Multimedia Library +// Copyright (C) 2007-2015 Laurent Gomila (laurent@sfml-dev.org) +// +// This software is provided 'as-is', without any express or implied warranty. +// In no event will the authors be held liable for any damages arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it freely, +// subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; +// you must not claim that you wrote the original software. +// If you use this software in a product, an acknowledgment +// in the product documentation would be appreciated but is not required. +// +// 2. Altered source versions must be plainly marked as such, +// and must not be misrepresented as being the original software. +// +// 3. This notice may not be removed or altered from any source distribution. +// +//////////////////////////////////////////////////////////// + +#ifndef SFML_SYSTEM_EXPORT_HPP +#define SFML_SYSTEM_EXPORT_HPP + +//////////////////////////////////////////////////////////// +// Headers +//////////////////////////////////////////////////////////// +#include + + +//////////////////////////////////////////////////////////// +// Define portable import / export macros +//////////////////////////////////////////////////////////// +#if defined(SFML_SYSTEM_EXPORTS) + + #define SFML_SYSTEM_API SFML_API_EXPORT + +#else + + #define SFML_SYSTEM_API SFML_API_IMPORT + +#endif + + +#endif // SFML_SYSTEM_EXPORT_HPP diff --git a/mcclone/external/sfml23/include/SFML/System/FileInputStream.hpp b/mcclone/external/sfml23/include/SFML/System/FileInputStream.hpp new file mode 100644 index 0000000..995351c --- /dev/null +++ b/mcclone/external/sfml23/include/SFML/System/FileInputStream.hpp @@ -0,0 +1,169 @@ +//////////////////////////////////////////////////////////// +// +// SFML - Simple and Fast Multimedia Library +// Copyright (C) 2007-2015 Laurent Gomila (laurent@sfml-dev.org) +// +// This software is provided 'as-is', without any express or implied warranty. +// In no event will the authors be held liable for any damages arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it freely, +// subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; +// you must not claim that you wrote the original software. +// If you use this software in a product, an acknowledgment +// in the product documentation would be appreciated but is not required. +// +// 2. Altered source versions must be plainly marked as such, +// and must not be misrepresented as being the original software. +// +// 3. This notice may not be removed or altered from any source distribution. +// +//////////////////////////////////////////////////////////// + +#ifndef SFML_FILEINPUTSTREAM_HPP +#define SFML_FILEINPUTSTREAM_HPP + +//////////////////////////////////////////////////////////// +// Headers +//////////////////////////////////////////////////////////// +#include +#include +#include +#include +#include +#include + +#ifdef ANDROID +namespace sf +{ +namespace priv +{ +class SFML_SYSTEM_API ResourceStream; +} +} +#endif + + +namespace sf +{ +//////////////////////////////////////////////////////////// +/// \brief Implementation of input stream based on a file +/// +//////////////////////////////////////////////////////////// +class SFML_SYSTEM_API FileInputStream : public InputStream, NonCopyable +{ +public: + //////////////////////////////////////////////////////////// + /// \brief Default constructor + /// + //////////////////////////////////////////////////////////// + FileInputStream(); + + //////////////////////////////////////////////////////////// + /// \brief Default destructor + /// + //////////////////////////////////////////////////////////// + virtual ~FileInputStream(); + + //////////////////////////////////////////////////////////// + /// \brief Open the stream from a file path + /// + /// \param filename Name of the file to open + /// + /// \return True on success, false on error + /// + //////////////////////////////////////////////////////////// + bool open(const std::string& filename); + + //////////////////////////////////////////////////////////// + /// \brief Read data from the stream + /// + /// After reading, the stream's reading position must be + /// advanced by the amount of bytes read. + /// + /// \param data Buffer where to copy the read data + /// \param size Desired number of bytes to read + /// + /// \return The number of bytes actually read, or -1 on error + /// + //////////////////////////////////////////////////////////// + virtual Int64 read(void* data, Int64 size); + + //////////////////////////////////////////////////////////// + /// \brief Change the current reading position + /// + /// \param position The position to seek to, from the beginning + /// + /// \return The position actually sought to, or -1 on error + /// + //////////////////////////////////////////////////////////// + virtual Int64 seek(Int64 position); + + //////////////////////////////////////////////////////////// + /// \brief Get the current reading position in the stream + /// + /// \return The current position, or -1 on error. + /// + //////////////////////////////////////////////////////////// + virtual Int64 tell(); + + //////////////////////////////////////////////////////////// + /// \brief Return the size of the stream + /// + /// \return The total number of bytes available in the stream, or -1 on error + /// + //////////////////////////////////////////////////////////// + virtual Int64 getSize(); + +private: + + //////////////////////////////////////////////////////////// + // Member data + //////////////////////////////////////////////////////////// +#ifdef ANDROID + priv::ResourceStream* m_file; +#else + std::FILE* m_file; ///< stdio file stream +#endif +}; + +} // namespace sf + + +#endif // SFML_FILEINPUTSTREAM_HPP + + +//////////////////////////////////////////////////////////// +/// \class FileInputStream +/// \ingroup system +/// +/// This class is a specialization of InputStream that +/// reads from a file on disk. +/// +/// It wraps a file in the common InputStream interface +/// and therefore allows to use generic classes or functions +/// that accept such a stream, with a file on disk as the data +/// source. +/// +/// In addition to the virtual functions inherited from +/// InputStream, FileInputStream adds a function to +/// specify the file to open. +/// +/// SFML resource classes can usually be loaded directly from +/// a filename, so this class shouldn't be useful to you unless +/// you create your own algorithms that operate on a InputStream. +/// +/// Usage example: +/// \code +/// void process(InputStream& stream); +/// +/// FileStream stream; +/// if (stream.open("some_file.dat")) +/// process(stream); +/// \endcode +/// +/// InputStream, MemoryStream +/// +//////////////////////////////////////////////////////////// diff --git a/mcclone/external/sfml23/include/SFML/System/InputStream.hpp b/mcclone/external/sfml23/include/SFML/System/InputStream.hpp new file mode 100644 index 0000000..e5694fa --- /dev/null +++ b/mcclone/external/sfml23/include/SFML/System/InputStream.hpp @@ -0,0 +1,152 @@ +//////////////////////////////////////////////////////////// +// +// SFML - Simple and Fast Multimedia Library +// Copyright (C) 2007-2015 Laurent Gomila (laurent@sfml-dev.org) +// +// This software is provided 'as-is', without any express or implied warranty. +// In no event will the authors be held liable for any damages arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it freely, +// subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; +// you must not claim that you wrote the original software. +// If you use this software in a product, an acknowledgment +// in the product documentation would be appreciated but is not required. +// +// 2. Altered source versions must be plainly marked as such, +// and must not be misrepresented as being the original software. +// +// 3. This notice may not be removed or altered from any source distribution. +// +//////////////////////////////////////////////////////////// + +#ifndef SFML_INPUTSTREAM_HPP +#define SFML_INPUTSTREAM_HPP + +//////////////////////////////////////////////////////////// +// Headers +//////////////////////////////////////////////////////////// +#include +#include + + +namespace sf +{ +//////////////////////////////////////////////////////////// +/// \brief Abstract class for custom file input streams +/// +//////////////////////////////////////////////////////////// +class SFML_SYSTEM_API InputStream +{ +public: + + //////////////////////////////////////////////////////////// + /// \brief Virtual destructor + /// + //////////////////////////////////////////////////////////// + virtual ~InputStream() {} + + //////////////////////////////////////////////////////////// + /// \brief Read data from the stream + /// + /// After reading, the stream's reading position must be + /// advanced by the amount of bytes read. + /// + /// \param data Buffer where to copy the read data + /// \param size Desired number of bytes to read + /// + /// \return The number of bytes actually read, or -1 on error + /// + //////////////////////////////////////////////////////////// + virtual Int64 read(void* data, Int64 size) = 0; + + //////////////////////////////////////////////////////////// + /// \brief Change the current reading position + /// + /// \param position The position to seek to, from the beginning + /// + /// \return The position actually sought to, or -1 on error + /// + //////////////////////////////////////////////////////////// + virtual Int64 seek(Int64 position) = 0; + + //////////////////////////////////////////////////////////// + /// \brief Get the current reading position in the stream + /// + /// \return The current position, or -1 on error. + /// + //////////////////////////////////////////////////////////// + virtual Int64 tell() = 0; + + //////////////////////////////////////////////////////////// + /// \brief Return the size of the stream + /// + /// \return The total number of bytes available in the stream, or -1 on error + /// + //////////////////////////////////////////////////////////// + virtual Int64 getSize() = 0; +}; + +} // namespace sf + + +#endif // SFML_INPUTSTREAM_HPP + + +//////////////////////////////////////////////////////////// +/// \class sf::InputStream +/// \ingroup system +/// +/// This class allows users to define their own file input sources +/// from which SFML can load resources. +/// +/// SFML resource classes like sf::Texture and +/// sf::SoundBuffer provide loadFromFile and loadFromMemory functions, +/// which read data from conventional sources. However, if you +/// have data coming from a different source (over a network, +/// embedded, encrypted, compressed, etc) you can derive your +/// own class from sf::InputStream and load SFML resources with +/// their loadFromStream function. +/// +/// Usage example: +/// \code +/// // custom stream class that reads from inside a zip file +/// class ZipStream : public sf::InputStream +/// { +/// public: +/// +/// ZipStream(std::string archive); +/// +/// bool open(std::string filename); +/// +/// Int64 read(void* data, Int64 size); +/// +/// Int64 seek(Int64 position); +/// +/// Int64 tell(); +/// +/// Int64 getSize(); +/// +/// private: +/// +/// ... +/// }; +/// +/// // now you can load textures... +/// sf::Texture texture; +/// ZipStream stream("resources.zip"); +/// stream.open("images/img.png"); +/// texture.loadFromStream(stream); +/// +/// // musics... +/// sf::Music music; +/// ZipStream stream("resources.zip"); +/// stream.open("musics/msc.ogg"); +/// music.openFromStream(stream); +/// +/// // etc. +/// \endcode +/// +//////////////////////////////////////////////////////////// diff --git a/mcclone/external/sfml23/include/SFML/System/Lock.hpp b/mcclone/external/sfml23/include/SFML/System/Lock.hpp new file mode 100644 index 0000000..05dac10 --- /dev/null +++ b/mcclone/external/sfml23/include/SFML/System/Lock.hpp @@ -0,0 +1,139 @@ +//////////////////////////////////////////////////////////// +// +// SFML - Simple and Fast Multimedia Library +// Copyright (C) 2007-2015 Laurent Gomila (laurent@sfml-dev.org) +// +// This software is provided 'as-is', without any express or implied warranty. +// In no event will the authors be held liable for any damages arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it freely, +// subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; +// you must not claim that you wrote the original software. +// If you use this software in a product, an acknowledgment +// in the product documentation would be appreciated but is not required. +// +// 2. Altered source versions must be plainly marked as such, +// and must not be misrepresented as being the original software. +// +// 3. This notice may not be removed or altered from any source distribution. +// +//////////////////////////////////////////////////////////// + +#ifndef SFML_LOCK_HPP +#define SFML_LOCK_HPP + +//////////////////////////////////////////////////////////// +// Headers +//////////////////////////////////////////////////////////// +#include +#include + + +namespace sf +{ +class Mutex; + +//////////////////////////////////////////////////////////// +/// \brief Automatic wrapper for locking and unlocking mutexes +/// +//////////////////////////////////////////////////////////// +class SFML_SYSTEM_API Lock : NonCopyable +{ +public: + + //////////////////////////////////////////////////////////// + /// \brief Construct the lock with a target mutex + /// + /// The mutex passed to sf::Lock is automatically locked. + /// + /// \param mutex Mutex to lock + /// + //////////////////////////////////////////////////////////// + explicit Lock(Mutex& mutex); + + //////////////////////////////////////////////////////////// + /// \brief Destructor + /// + /// The destructor of sf::Lock automatically unlocks its mutex. + /// + //////////////////////////////////////////////////////////// + ~Lock(); + +private: + + //////////////////////////////////////////////////////////// + // Member data + //////////////////////////////////////////////////////////// + Mutex& m_mutex; ///< Mutex to lock / unlock +}; + +} // namespace sf + + +#endif // SFML_LOCK_HPP + + +//////////////////////////////////////////////////////////// +/// \class sf::Lock +/// \ingroup system +/// +/// sf::Lock is a RAII wrapper for sf::Mutex. By unlocking +/// it in its destructor, it ensures that the mutex will +/// always be released when the current scope (most likely +/// a function) ends. +/// This is even more important when an exception or an early +/// return statement can interrupt the execution flow of the +/// function. +/// +/// For maximum robustness, sf::Lock should always be used +/// to lock/unlock a mutex. +/// +/// Usage example: +/// \code +/// sf::Mutex mutex; +/// +/// void function() +/// { +/// sf::Lock lock(mutex); // mutex is now locked +/// +/// functionThatMayThrowAnException(); // mutex is unlocked if this function throws +/// +/// if (someCondition) +/// return; // mutex is unlocked +/// +/// } // mutex is unlocked +/// \endcode +/// +/// Because the mutex is not explicitly unlocked in the code, +/// it may remain locked longer than needed. If the region +/// of the code that needs to be protected by the mutex is +/// not the entire function, a good practice is to create a +/// smaller, inner scope so that the lock is limited to this +/// part of the code. +/// +/// \code +/// sf::Mutex mutex; +/// +/// void function() +/// { +/// { +/// sf::Lock lock(mutex); +/// codeThatRequiresProtection(); +/// +/// } // mutex is unlocked here +/// +/// codeThatDoesntCareAboutTheMutex(); +/// } +/// \endcode +/// +/// Having a mutex locked longer than required is a bad practice +/// which can lead to bad performances. Don't forget that when +/// a mutex is locked, other threads may be waiting doing nothing +/// until it is released. +/// +/// \see sf::Mutex +/// +//////////////////////////////////////////////////////////// diff --git a/mcclone/external/sfml23/include/SFML/System/MemoryInputStream.hpp b/mcclone/external/sfml23/include/SFML/System/MemoryInputStream.hpp new file mode 100644 index 0000000..250466c --- /dev/null +++ b/mcclone/external/sfml23/include/SFML/System/MemoryInputStream.hpp @@ -0,0 +1,148 @@ +//////////////////////////////////////////////////////////// +// +// SFML - Simple and Fast Multimedia Library +// Copyright (C) 2007-2015 Laurent Gomila (laurent@sfml-dev.org) +// +// This software is provided 'as-is', without any express or implied warranty. +// In no event will the authors be held liable for any damages arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it freely, +// subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; +// you must not claim that you wrote the original software. +// If you use this software in a product, an acknowledgment +// in the product documentation would be appreciated but is not required. +// +// 2. Altered source versions must be plainly marked as such, +// and must not be misrepresented as being the original software. +// +// 3. This notice may not be removed or altered from any source distribution. +// +//////////////////////////////////////////////////////////// + +#ifndef SFML_MEMORYINPUTSTREAM_HPP +#define SFML_MEMORYINPUTSTREAM_HPP + +//////////////////////////////////////////////////////////// +// Headers +//////////////////////////////////////////////////////////// +#include +#include +#include +#include + + +namespace sf +{ +//////////////////////////////////////////////////////////// +/// \brief Implementation of input stream based on a memory chunk +/// +//////////////////////////////////////////////////////////// +class SFML_SYSTEM_API MemoryInputStream : public InputStream +{ +public: + + //////////////////////////////////////////////////////////// + /// \brief Default constructor + /// + //////////////////////////////////////////////////////////// + MemoryInputStream(); + + //////////////////////////////////////////////////////////// + /// \brief Open the stream from its data + /// + /// \param data Pointer to the data in memory + /// \param sizeInBytes Size of the data, in bytes + /// + //////////////////////////////////////////////////////////// + void open(const void* data, std::size_t sizeInBytes); + + //////////////////////////////////////////////////////////// + /// \brief Read data from the stream + /// + /// After reading, the stream's reading position must be + /// advanced by the amount of bytes read. + /// + /// \param data Buffer where to copy the read data + /// \param size Desired number of bytes to read + /// + /// \return The number of bytes actually read, or -1 on error + /// + //////////////////////////////////////////////////////////// + virtual Int64 read(void* data, Int64 size); + + //////////////////////////////////////////////////////////// + /// \brief Change the current reading position + /// + /// \param position The position to seek to, from the beginning + /// + /// \return The position actually sought to, or -1 on error + /// + //////////////////////////////////////////////////////////// + virtual Int64 seek(Int64 position); + + //////////////////////////////////////////////////////////// + /// \brief Get the current reading position in the stream + /// + /// \return The current position, or -1 on error. + /// + //////////////////////////////////////////////////////////// + virtual Int64 tell(); + + //////////////////////////////////////////////////////////// + /// \brief Return the size of the stream + /// + /// \return The total number of bytes available in the stream, or -1 on error + /// + //////////////////////////////////////////////////////////// + virtual Int64 getSize(); + +private: + + //////////////////////////////////////////////////////////// + // Member data + //////////////////////////////////////////////////////////// + const char* m_data; ///< Pointer to the data in memory + Int64 m_size; ///< Total size of the data + Int64 m_offset; ///< Current reading position +}; + +} // namespace sf + + +#endif // SFML_MEMORYINPUTSTREAM_HPP + + +//////////////////////////////////////////////////////////// +/// \class MemoryeInputStream +/// \ingroup system +/// +/// This class is a specialization of InputStream that +/// reads from data in memory. +/// +/// It wraps a memory chunk in the common InputStream interface +/// and therefore allows to use generic classes or functions +/// that accept such a stream, with content already loaded in memory. +/// +/// In addition to the virtual functions inherited from +/// InputStream, MemoryInputStream adds a function to +/// specify the pointer and size of the data in memory. +/// +/// SFML resource classes can usually be loaded directly from +/// memory, so this class shouldn't be useful to you unless +/// you create your own algorithms that operate on a InputStream. +/// +/// Usage example: +/// \code +/// void process(InputStream& stream); +/// +/// MemoryStream stream; +/// stream.open(thePtr, theSize); +/// process(stream); +/// \endcode +/// +/// InputStream, FileStream +/// +//////////////////////////////////////////////////////////// diff --git a/mcclone/external/sfml23/include/SFML/System/Mutex.hpp b/mcclone/external/sfml23/include/SFML/System/Mutex.hpp new file mode 100644 index 0000000..67a8473 --- /dev/null +++ b/mcclone/external/sfml23/include/SFML/System/Mutex.hpp @@ -0,0 +1,148 @@ +//////////////////////////////////////////////////////////// +// +// SFML - Simple and Fast Multimedia Library +// Copyright (C) 2007-2015 Laurent Gomila (laurent@sfml-dev.org) +// +// This software is provided 'as-is', without any express or implied warranty. +// In no event will the authors be held liable for any damages arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it freely, +// subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; +// you must not claim that you wrote the original software. +// If you use this software in a product, an acknowledgment +// in the product documentation would be appreciated but is not required. +// +// 2. Altered source versions must be plainly marked as such, +// and must not be misrepresented as being the original software. +// +// 3. This notice may not be removed or altered from any source distribution. +// +//////////////////////////////////////////////////////////// + +#ifndef SFML_MUTEX_HPP +#define SFML_MUTEX_HPP + +//////////////////////////////////////////////////////////// +// Headers +//////////////////////////////////////////////////////////// +#include +#include + + +namespace sf +{ +namespace priv +{ + class MutexImpl; +} + +//////////////////////////////////////////////////////////// +/// \brief Blocks concurrent access to shared resources +/// from multiple threads +/// +//////////////////////////////////////////////////////////// +class SFML_SYSTEM_API Mutex : NonCopyable +{ +public: + + //////////////////////////////////////////////////////////// + /// \brief Default constructor + /// + //////////////////////////////////////////////////////////// + Mutex(); + + //////////////////////////////////////////////////////////// + /// \brief Destructor + /// + //////////////////////////////////////////////////////////// + ~Mutex(); + + //////////////////////////////////////////////////////////// + /// \brief Lock the mutex + /// + /// If the mutex is already locked in another thread, + /// this call will block the execution until the mutex + /// is released. + /// + /// \see unlock + /// + //////////////////////////////////////////////////////////// + void lock(); + + //////////////////////////////////////////////////////////// + /// \brief Unlock the mutex + /// + /// \see lock + /// + //////////////////////////////////////////////////////////// + void unlock(); + +private: + + //////////////////////////////////////////////////////////// + // Member data + //////////////////////////////////////////////////////////// + priv::MutexImpl* m_mutexImpl; ///< OS-specific implementation +}; + +} // namespace sf + + +#endif // SFML_MUTEX_HPP + + +//////////////////////////////////////////////////////////// +/// \class sf::Mutex +/// \ingroup system +/// +/// Mutex stands for "MUTual EXclusion". A mutex is a +/// synchronization object, used when multiple threads are involved. +/// +/// When you want to protect a part of the code from being accessed +/// simultaneously by multiple threads, you typically use a +/// mutex. When a thread is locked by a mutex, any other thread +/// trying to lock it will be blocked until the mutex is released +/// by the thread that locked it. This way, you can allow only +/// one thread at a time to access a critical region of your code. +/// +/// Usage example: +/// \code +/// Database database; // this is a critical resource that needs some protection +/// sf::Mutex mutex; +/// +/// void thread1() +/// { +/// mutex.lock(); // this call will block the thread if the mutex is already locked by thread2 +/// database.write(...); +/// mutex.unlock(); // if thread2 was waiting, it will now be unblocked +/// } +/// +/// void thread2() +/// { +/// mutex.lock(); // this call will block the thread if the mutex is already locked by thread1 +/// database.write(...); +/// mutex.unlock(); // if thread1 was waiting, it will now be unblocked +/// } +/// \endcode +/// +/// Be very careful with mutexes. A bad usage can lead to bad problems, +/// like deadlocks (two threads are waiting for each other and the +/// application is globally stuck). +/// +/// To make the usage of mutexes more robust, particularly in +/// environments where exceptions can be thrown, you should +/// use the helper class sf::Lock to lock/unlock mutexes. +/// +/// SFML mutexes are recursive, which means that you can lock +/// a mutex multiple times in the same thread without creating +/// a deadlock. In this case, the first call to lock() behaves +/// as usual, and the following ones have no effect. +/// However, you must call unlock() exactly as many times as you +/// called lock(). If you don't, the mutex won't be released. +/// +/// \see sf::Lock +/// +//////////////////////////////////////////////////////////// diff --git a/mcclone/external/sfml23/include/SFML/System/NonCopyable.hpp b/mcclone/external/sfml23/include/SFML/System/NonCopyable.hpp new file mode 100644 index 0000000..9eb291c --- /dev/null +++ b/mcclone/external/sfml23/include/SFML/System/NonCopyable.hpp @@ -0,0 +1,119 @@ +//////////////////////////////////////////////////////////// +// +// SFML - Simple and Fast Multimedia Library +// Copyright (C) 2007-2015 Laurent Gomila (laurent@sfml-dev.org) +// +// This software is provided 'as-is', without any express or implied warranty. +// In no event will the authors be held liable for any damages arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it freely, +// subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; +// you must not claim that you wrote the original software. +// If you use this software in a product, an acknowledgment +// in the product documentation would be appreciated but is not required. +// +// 2. Altered source versions must be plainly marked as such, +// and must not be misrepresented as being the original software. +// +// 3. This notice may not be removed or altered from any source distribution. +// +//////////////////////////////////////////////////////////// + +#ifndef SFML_NONCOPYABLE_HPP +#define SFML_NONCOPYABLE_HPP + +//////////////////////////////////////////////////////////// +// Headers +//////////////////////////////////////////////////////////// +#include + + +namespace sf +{ +//////////////////////////////////////////////////////////// +/// \brief Utility class that makes any derived +/// class non-copyable +/// +//////////////////////////////////////////////////////////// +class SFML_SYSTEM_API NonCopyable +{ +protected: + + //////////////////////////////////////////////////////////// + /// \brief Default constructor + /// + /// Because this class has a copy constructor, the compiler + /// will not automatically generate the default constructor. + /// That's why we must define it explicitly. + /// + //////////////////////////////////////////////////////////// + NonCopyable() {} + +private: + + //////////////////////////////////////////////////////////// + /// \brief Disabled copy constructor + /// + /// By making the copy constructor private, the compiler will + /// trigger an error if anyone outside tries to use it. + /// To prevent NonCopyable or friend classes from using it, + /// we also give no definition, so that the linker will + /// produce an error if the first protection was inefficient. + /// + //////////////////////////////////////////////////////////// + NonCopyable(const NonCopyable&); + + //////////////////////////////////////////////////////////// + /// \brief Disabled assignment operator + /// + /// By making the assignment operator private, the compiler will + /// trigger an error if anyone outside tries to use it. + /// To prevent NonCopyable or friend classes from using it, + /// we also give no definition, so that the linker will + /// produce an error if the first protection was inefficient. + /// + //////////////////////////////////////////////////////////// + NonCopyable& operator =(const NonCopyable&); +}; + +} // namespace sf + + +#endif // SFML_NONCOPYABLE_HPP + + +//////////////////////////////////////////////////////////// +/// \class sf::NonCopyable +/// \ingroup system +/// +/// This class makes its instances non-copyable, by explicitly +/// disabling its copy constructor and its assignment operator. +/// +/// To create a non-copyable class, simply inherit from +/// sf::NonCopyable. +/// +/// The type of inheritance (public or private) doesn't matter, +/// the copy constructor and assignment operator are declared private +/// in sf::NonCopyable so they will end up being inaccessible in both +/// cases. Thus you can use a shorter syntax for inheriting from it +/// (see below). +/// +/// Usage example: +/// \code +/// class MyNonCopyableClass : sf::NonCopyable +/// { +/// ... +/// }; +/// \endcode +/// +/// Deciding whether the instances of a class can be copied +/// or not is a very important design choice. You are strongly +/// encouraged to think about it before writing a class, +/// and to use sf::NonCopyable when necessary to prevent +/// many potential future errors when using it. This is also +/// a very important indication to users of your class. +/// +//////////////////////////////////////////////////////////// diff --git a/mcclone/external/sfml23/include/SFML/System/Sleep.hpp b/mcclone/external/sfml23/include/SFML/System/Sleep.hpp new file mode 100644 index 0000000..3c0d04a --- /dev/null +++ b/mcclone/external/sfml23/include/SFML/System/Sleep.hpp @@ -0,0 +1,52 @@ +//////////////////////////////////////////////////////////// +// +// SFML - Simple and Fast Multimedia Library +// Copyright (C) 2007-2015 Laurent Gomila (laurent@sfml-dev.org) +// +// This software is provided 'as-is', without any express or implied warranty. +// In no event will the authors be held liable for any damages arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it freely, +// subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; +// you must not claim that you wrote the original software. +// If you use this software in a product, an acknowledgment +// in the product documentation would be appreciated but is not required. +// +// 2. Altered source versions must be plainly marked as such, +// and must not be misrepresented as being the original software. +// +// 3. This notice may not be removed or altered from any source distribution. +// +//////////////////////////////////////////////////////////// + +#ifndef SFML_SLEEP_HPP +#define SFML_SLEEP_HPP + +//////////////////////////////////////////////////////////// +// Headers +//////////////////////////////////////////////////////////// +#include +#include + + +namespace sf +{ +//////////////////////////////////////////////////////////// +/// \ingroup system +/// \brief Make the current thread sleep for a given duration +/// +/// sf::sleep is the best way to block a program or one of its +/// threads, as it doesn't consume any CPU power. +/// +/// \param duration Time to sleep +/// +//////////////////////////////////////////////////////////// +void SFML_SYSTEM_API sleep(Time duration); + +} // namespace sf + + +#endif // SFML_SLEEP_HPP diff --git a/mcclone/external/sfml23/include/SFML/System/String.hpp b/mcclone/external/sfml23/include/SFML/System/String.hpp new file mode 100644 index 0000000..5a8c576 --- /dev/null +++ b/mcclone/external/sfml23/include/SFML/System/String.hpp @@ -0,0 +1,668 @@ +//////////////////////////////////////////////////////////// +// +// SFML - Simple and Fast Multimedia Library +// Copyright (C) 2007-2015 Laurent Gomila (laurent@sfml-dev.org) +// +// This software is provided 'as-is', without any express or implied warranty. +// In no event will the authors be held liable for any damages arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it freely, +// subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; +// you must not claim that you wrote the original software. +// If you use this software in a product, an acknowledgment +// in the product documentation would be appreciated but is not required. +// +// 2. Altered source versions must be plainly marked as such, +// and must not be misrepresented as being the original software. +// +// 3. This notice may not be removed or altered from any source distribution. +// +//////////////////////////////////////////////////////////// + +#ifndef SFML_STRING_HPP +#define SFML_STRING_HPP + +//////////////////////////////////////////////////////////// +// Headers +//////////////////////////////////////////////////////////// +#include +#include +#include +#include + + +namespace sf +{ +//////////////////////////////////////////////////////////// +/// \brief Utility string class that automatically handles +/// conversions between types and encodings +/// +//////////////////////////////////////////////////////////// +class SFML_SYSTEM_API String +{ +public: + + //////////////////////////////////////////////////////////// + // Types + //////////////////////////////////////////////////////////// + typedef std::basic_string::iterator Iterator; ///< Iterator type + typedef std::basic_string::const_iterator ConstIterator; ///< Read-only iterator type + + //////////////////////////////////////////////////////////// + // Static member data + //////////////////////////////////////////////////////////// + static const std::size_t InvalidPos; ///< Represents an invalid position in the string + + //////////////////////////////////////////////////////////// + /// \brief Default constructor + /// + /// This constructor creates an empty string. + /// + //////////////////////////////////////////////////////////// + String(); + + //////////////////////////////////////////////////////////// + /// \brief Construct from a single ANSI character and a locale + /// + /// The source character is converted to UTF-32 according + /// to the given locale. + /// + /// \param ansiChar ANSI character to convert + /// \param locale Locale to use for conversion + /// + //////////////////////////////////////////////////////////// + String(char ansiChar, const std::locale& locale = std::locale()); + + //////////////////////////////////////////////////////////// + /// \brief Construct from single wide character + /// + /// \param wideChar Wide character to convert + /// + //////////////////////////////////////////////////////////// + String(wchar_t wideChar); + + //////////////////////////////////////////////////////////// + /// \brief Construct from single UTF-32 character + /// + /// \param utf32Char UTF-32 character to convert + /// + //////////////////////////////////////////////////////////// + String(Uint32 utf32Char); + + //////////////////////////////////////////////////////////// + /// \brief Construct from a null-terminated C-style ANSI string and a locale + /// + /// The source string is converted to UTF-32 according + /// to the given locale. + /// + /// \param ansiString ANSI string to convert + /// \param locale Locale to use for conversion + /// + //////////////////////////////////////////////////////////// + String(const char* ansiString, const std::locale& locale = std::locale()); + + //////////////////////////////////////////////////////////// + /// \brief Construct from an ANSI string and a locale + /// + /// The source string is converted to UTF-32 according + /// to the given locale. + /// + /// \param ansiString ANSI string to convert + /// \param locale Locale to use for conversion + /// + //////////////////////////////////////////////////////////// + String(const std::string& ansiString, const std::locale& locale = std::locale()); + + //////////////////////////////////////////////////////////// + /// \brief Construct from null-terminated C-style wide string + /// + /// \param wideString Wide string to convert + /// + //////////////////////////////////////////////////////////// + String(const wchar_t* wideString); + + //////////////////////////////////////////////////////////// + /// \brief Construct from a wide string + /// + /// \param wideString Wide string to convert + /// + //////////////////////////////////////////////////////////// + String(const std::wstring& wideString); + + //////////////////////////////////////////////////////////// + /// \brief Construct from a null-terminated C-style UTF-32 string + /// + /// \param utf32String UTF-32 string to assign + /// + //////////////////////////////////////////////////////////// + String(const Uint32* utf32String); + + //////////////////////////////////////////////////////////// + /// \brief Construct from an UTF-32 string + /// + /// \param utf32String UTF-32 string to assign + /// + //////////////////////////////////////////////////////////// + String(const std::basic_string& utf32String); + + //////////////////////////////////////////////////////////// + /// \brief Copy constructor + /// + /// \param copy Instance to copy + /// + //////////////////////////////////////////////////////////// + String(const String& copy); + + //////////////////////////////////////////////////////////// + /// \brief Create a new sf::String from a UTF-8 encoded string + /// + /// \param begin Forward iterator to the beginning of the UTF-8 sequence + /// \param end Forward iterator to the end of the UTF-8 sequence + /// + /// \return A sf::String containing the source string + /// + /// \see fromUtf16, fromUtf32 + /// + //////////////////////////////////////////////////////////// + template + static String fromUtf8(T begin, T end); + + //////////////////////////////////////////////////////////// + /// \brief Create a new sf::String from a UTF-16 encoded string + /// + /// \param begin Forward iterator to the beginning of the UTF-16 sequence + /// \param end Forward iterator to the end of the UTF-16 sequence + /// + /// \return A sf::String containing the source string + /// + /// \see fromUtf8, fromUtf32 + /// + //////////////////////////////////////////////////////////// + template + static String fromUtf16(T begin, T end); + + //////////////////////////////////////////////////////////// + /// \brief Create a new sf::String from a UTF-32 encoded string + /// + /// This function is provided for consistency, it is equivalent to + /// using the constructors that takes a const sf::Uint32* or + /// a std::basic_string. + /// + /// \param begin Forward iterator to the beginning of the UTF-32 sequence + /// \param end Forward iterator to the end of the UTF-32 sequence + /// + /// \return A sf::String containing the source string + /// + /// \see fromUtf8, fromUtf16 + /// + //////////////////////////////////////////////////////////// + template + static String fromUtf32(T begin, T end); + + //////////////////////////////////////////////////////////// + /// \brief Implicit conversion operator to std::string (ANSI string) + /// + /// The current global locale is used for conversion. If you + /// want to explicitly specify a locale, see toAnsiString. + /// Characters that do not fit in the target encoding are + /// discarded from the returned string. + /// This operator is defined for convenience, and is equivalent + /// to calling toAnsiString(). + /// + /// \return Converted ANSI string + /// + /// \see toAnsiString, operator std::wstring + /// + //////////////////////////////////////////////////////////// + operator std::string() const; + + //////////////////////////////////////////////////////////// + /// \brief Implicit conversion operator to std::wstring (wide string) + /// + /// Characters that do not fit in the target encoding are + /// discarded from the returned string. + /// This operator is defined for convenience, and is equivalent + /// to calling toWideString(). + /// + /// \return Converted wide string + /// + /// \see toWideString, operator std::string + /// + //////////////////////////////////////////////////////////// + operator std::wstring() const; + + //////////////////////////////////////////////////////////// + /// \brief Convert the Unicode string to an ANSI string + /// + /// The UTF-32 string is converted to an ANSI string in + /// the encoding defined by \a locale. + /// Characters that do not fit in the target encoding are + /// discarded from the returned string. + /// + /// \param locale Locale to use for conversion + /// + /// \return Converted ANSI string + /// + /// \see toWideString, operator std::string + /// + //////////////////////////////////////////////////////////// + std::string toAnsiString(const std::locale& locale = std::locale()) const; + + //////////////////////////////////////////////////////////// + /// \brief Convert the Unicode string to a wide string + /// + /// Characters that do not fit in the target encoding are + /// discarded from the returned string. + /// + /// \return Converted wide string + /// + /// \see toAnsiString, operator std::wstring + /// + //////////////////////////////////////////////////////////// + std::wstring toWideString() const; + + //////////////////////////////////////////////////////////// + /// \brief Convert the Unicode string to a UTF-8 string + /// + /// \return Converted UTF-8 string + /// + /// \see toUtf16, toUtf32 + /// + //////////////////////////////////////////////////////////// + std::basic_string toUtf8() const; + + //////////////////////////////////////////////////////////// + /// \brief Convert the Unicode string to a UTF-16 string + /// + /// \return Converted UTF-16 string + /// + /// \see toUtf8, toUtf32 + /// + //////////////////////////////////////////////////////////// + std::basic_string toUtf16() const; + + //////////////////////////////////////////////////////////// + /// \brief Convert the Unicode string to a UTF-32 string + /// + /// This function doesn't perform any conversion, since the + /// string is already stored as UTF-32 internally. + /// + /// \return Converted UTF-32 string + /// + /// \see toUtf8, toUtf16 + /// + //////////////////////////////////////////////////////////// + std::basic_string toUtf32() const; + + //////////////////////////////////////////////////////////// + /// \brief Overload of assignment operator + /// + /// \param right Instance to assign + /// + /// \return Reference to self + /// + //////////////////////////////////////////////////////////// + String& operator =(const String& right); + + //////////////////////////////////////////////////////////// + /// \brief Overload of += operator to append an UTF-32 string + /// + /// \param right String to append + /// + /// \return Reference to self + /// + //////////////////////////////////////////////////////////// + String& operator +=(const String& right); + + //////////////////////////////////////////////////////////// + /// \brief Overload of [] operator to access a character by its position + /// + /// This function provides read-only access to characters. + /// Note: the behavior is undefined if \a index is out of range. + /// + /// \param index Index of the character to get + /// + /// \return Character at position \a index + /// + //////////////////////////////////////////////////////////// + Uint32 operator [](std::size_t index) const; + + //////////////////////////////////////////////////////////// + /// \brief Overload of [] operator to access a character by its position + /// + /// This function provides read and write access to characters. + /// Note: the behavior is undefined if \a index is out of range. + /// + /// \param index Index of the character to get + /// + /// \return Reference to the character at position \a index + /// + //////////////////////////////////////////////////////////// + Uint32& operator [](std::size_t index); + + //////////////////////////////////////////////////////////// + /// \brief Clear the string + /// + /// This function removes all the characters from the string. + /// + /// \see isEmpty, erase + /// + //////////////////////////////////////////////////////////// + void clear(); + + //////////////////////////////////////////////////////////// + /// \brief Get the size of the string + /// + /// \return Number of characters in the string + /// + /// \see isEmpty + /// + //////////////////////////////////////////////////////////// + std::size_t getSize() const; + + //////////////////////////////////////////////////////////// + /// \brief Check whether the string is empty or not + /// + /// \return True if the string is empty (i.e. contains no character) + /// + /// \see clear, getSize + /// + //////////////////////////////////////////////////////////// + bool isEmpty() const; + + //////////////////////////////////////////////////////////// + /// \brief Erase one or more characters from the string + /// + /// This function removes a sequence of \a count characters + /// starting from \a position. + /// + /// \param position Position of the first character to erase + /// \param count Number of characters to erase + /// + //////////////////////////////////////////////////////////// + void erase(std::size_t position, std::size_t count = 1); + + //////////////////////////////////////////////////////////// + /// \brief Insert one or more characters into the string + /// + /// This function inserts the characters of \a str + /// into the string, starting from \a position. + /// + /// \param position Position of insertion + /// \param str Characters to insert + /// + //////////////////////////////////////////////////////////// + void insert(std::size_t position, const String& str); + + //////////////////////////////////////////////////////////// + /// \brief Find a sequence of one or more characters in the string + /// + /// This function searches for the characters of \a str + /// in the string, starting from \a start. + /// + /// \param str Characters to find + /// \param start Where to begin searching + /// + /// \return Position of \a str in the string, or String::InvalidPos if not found + /// + //////////////////////////////////////////////////////////// + std::size_t find(const String& str, std::size_t start = 0) const; + + //////////////////////////////////////////////////////////// + /// \brief Replace a substring with another string + /// + /// This function replaces the substring that starts at index \a position + /// and spans \a length characters with the string \a replaceWith. + /// + /// \param position Index of the first character to be replaced + /// \param length Number of characters to replace. You can pass InvalidPos to + /// replace all characters until the end of the string. + /// \param replaceWith String that replaces the given substring. + /// + //////////////////////////////////////////////////////////// + void replace(std::size_t position, std::size_t length, const String& replaceWith); + + //////////////////////////////////////////////////////////// + /// \brief Replace all occurrences of a substring with a replacement string + /// + /// This function replaces all occurrences of \a searchFor in this string + /// with the string \a replaceWith. + /// + /// \param searchFor The value being searched for + /// \param replaceWith The value that replaces found \a searchFor values + /// + //////////////////////////////////////////////////////////// + void replace(const String& searchFor, const String& replaceWith); + + //////////////////////////////////////////////////////////// + /// \brief Return a part of the string + /// + /// This function returns the substring that starts at index \a position + /// and spans \a length characters. + /// + /// \param position Index of the first character + /// \param length Number of characters to include in the substring (if + /// the string is shorter, as many characters as possible + /// are included). \ref InvalidPos can be used to include all + /// characters until the end of the string. + /// + /// \return String object containing a substring of this object + /// + //////////////////////////////////////////////////////////// + String substring(std::size_t position, std::size_t length = InvalidPos) const; + + //////////////////////////////////////////////////////////// + /// \brief Get a pointer to the C-style array of characters + /// + /// This functions provides a read-only access to a + /// null-terminated C-style representation of the string. + /// The returned pointer is temporary and is meant only for + /// immediate use, thus it is not recommended to store it. + /// + /// \return Read-only pointer to the array of characters + /// + //////////////////////////////////////////////////////////// + const Uint32* getData() const; + + //////////////////////////////////////////////////////////// + /// \brief Return an iterator to the beginning of the string + /// + /// \return Read-write iterator to the beginning of the string characters + /// + /// \see end + /// + //////////////////////////////////////////////////////////// + Iterator begin(); + + //////////////////////////////////////////////////////////// + /// \brief Return an iterator to the beginning of the string + /// + /// \return Read-only iterator to the beginning of the string characters + /// + /// \see end + /// + //////////////////////////////////////////////////////////// + ConstIterator begin() const; + + //////////////////////////////////////////////////////////// + /// \brief Return an iterator to the end of the string + /// + /// The end iterator refers to 1 position past the last character; + /// thus it represents an invalid character and should never be + /// accessed. + /// + /// \return Read-write iterator to the end of the string characters + /// + /// \see begin + /// + //////////////////////////////////////////////////////////// + Iterator end(); + + //////////////////////////////////////////////////////////// + /// \brief Return an iterator to the end of the string + /// + /// The end iterator refers to 1 position past the last character; + /// thus it represents an invalid character and should never be + /// accessed. + /// + /// \return Read-only iterator to the end of the string characters + /// + /// \see begin + /// + //////////////////////////////////////////////////////////// + ConstIterator end() const; + +private: + + friend SFML_SYSTEM_API bool operator ==(const String& left, const String& right); + friend SFML_SYSTEM_API bool operator <(const String& left, const String& right); + + //////////////////////////////////////////////////////////// + // Member data + //////////////////////////////////////////////////////////// + std::basic_string m_string; ///< Internal string of UTF-32 characters +}; + +//////////////////////////////////////////////////////////// +/// \relates String +/// \brief Overload of == operator to compare two UTF-32 strings +/// +/// \param left Left operand (a string) +/// \param right Right operand (a string) +/// +/// \return True if both strings are equal +/// +//////////////////////////////////////////////////////////// +SFML_SYSTEM_API bool operator ==(const String& left, const String& right); + +//////////////////////////////////////////////////////////// +/// \relates String +/// \brief Overload of != operator to compare two UTF-32 strings +/// +/// \param left Left operand (a string) +/// \param right Right operand (a string) +/// +/// \return True if both strings are different +/// +//////////////////////////////////////////////////////////// +SFML_SYSTEM_API bool operator !=(const String& left, const String& right); + +//////////////////////////////////////////////////////////// +/// \relates String +/// \brief Overload of < operator to compare two UTF-32 strings +/// +/// \param left Left operand (a string) +/// \param right Right operand (a string) +/// +/// \return True if \a left is lexicographically before \a right +/// +//////////////////////////////////////////////////////////// +SFML_SYSTEM_API bool operator <(const String& left, const String& right); + +//////////////////////////////////////////////////////////// +/// \relates String +/// \brief Overload of > operator to compare two UTF-32 strings +/// +/// \param left Left operand (a string) +/// \param right Right operand (a string) +/// +/// \return True if \a left is lexicographically after \a right +/// +//////////////////////////////////////////////////////////// +SFML_SYSTEM_API bool operator >(const String& left, const String& right); + +//////////////////////////////////////////////////////////// +/// \relates String +/// \brief Overload of <= operator to compare two UTF-32 strings +/// +/// \param left Left operand (a string) +/// \param right Right operand (a string) +/// +/// \return True if \a left is lexicographically before or equivalent to \a right +/// +//////////////////////////////////////////////////////////// +SFML_SYSTEM_API bool operator <=(const String& left, const String& right); + +//////////////////////////////////////////////////////////// +/// \relates String +/// \brief Overload of >= operator to compare two UTF-32 strings +/// +/// \param left Left operand (a string) +/// \param right Right operand (a string) +/// +/// \return True if \a left is lexicographically after or equivalent to \a right +/// +//////////////////////////////////////////////////////////// +SFML_SYSTEM_API bool operator >=(const String& left, const String& right); + +//////////////////////////////////////////////////////////// +/// \relates String +/// \brief Overload of binary + operator to concatenate two strings +/// +/// \param left Left operand (a string) +/// \param right Right operand (a string) +/// +/// \return Concatenated string +/// +//////////////////////////////////////////////////////////// +SFML_SYSTEM_API String operator +(const String& left, const String& right); + +#include + +} // namespace sf + + +#endif // SFML_STRING_HPP + + +//////////////////////////////////////////////////////////// +/// \class sf::String +/// \ingroup system +/// +/// sf::String is a utility string class defined mainly for +/// convenience. It is a Unicode string (implemented using +/// UTF-32), thus it can store any character in the world +/// (European, Chinese, Arabic, Hebrew, etc.). +/// +/// It automatically handles conversions from/to ANSI and +/// wide strings, so that you can work with standard string +/// classes and still be compatible with functions taking a +/// sf::String. +/// +/// \code +/// sf::String s; +/// +/// std::string s1 = s; // automatically converted to ANSI string +/// std::wstring s2 = s; // automatically converted to wide string +/// s = "hello"; // automatically converted from ANSI string +/// s = L"hello"; // automatically converted from wide string +/// s += 'a'; // automatically converted from ANSI string +/// s += L'a'; // automatically converted from wide string +/// \endcode +/// +/// Conversions involving ANSI strings use the default user locale. However +/// it is possible to use a custom locale if necessary: +/// \code +/// std::locale locale; +/// sf::String s; +/// ... +/// std::string s1 = s.toAnsiString(locale); +/// s = sf::String("hello", locale); +/// \endcode +/// +/// sf::String defines the most important functions of the +/// standard std::string class: removing, random access, iterating, +/// appending, comparing, etc. However it is a simple class +/// provided for convenience, and you may have to consider using +/// a more optimized class if your program requires complex string +/// handling. The automatic conversion functions will then take +/// care of converting your string to sf::String whenever SFML +/// requires it. +/// +/// Please note that SFML also defines a low-level, generic +/// interface for Unicode handling, see the sf::Utf classes. +/// +//////////////////////////////////////////////////////////// diff --git a/mcclone/external/sfml23/include/SFML/System/String.inl b/mcclone/external/sfml23/include/SFML/System/String.inl new file mode 100644 index 0000000..2b22efa --- /dev/null +++ b/mcclone/external/sfml23/include/SFML/System/String.inl @@ -0,0 +1,53 @@ +//////////////////////////////////////////////////////////// +// +// SFML - Simple and Fast Multimedia Library +// Copyright (C) 2007-2015 Laurent Gomila (laurent@sfml-dev.org) +// +// This software is provided 'as-is', without any express or implied warranty. +// In no event will the authors be held liable for any damages arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it freely, +// subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; +// you must not claim that you wrote the original software. +// If you use this software in a product, an acknowledgment +// in the product documentation would be appreciated but is not required. +// +// 2. Altered source versions must be plainly marked as such, +// and must not be misrepresented as being the original software. +// +// 3. This notice may not be removed or altered from any source distribution. +// +//////////////////////////////////////////////////////////// + + +//////////////////////////////////////////////////////////// +template +String String::fromUtf8(T begin, T end) +{ + String string; + Utf8::toUtf32(begin, end, std::back_inserter(string.m_string)); + return string; +} + + +//////////////////////////////////////////////////////////// +template +String String::fromUtf16(T begin, T end) +{ + String string; + Utf16::toUtf32(begin, end, std::back_inserter(string.m_string)); + return string; +} + + +//////////////////////////////////////////////////////////// +template +String String::fromUtf32(T begin, T end) +{ + String string; + string.m_string.assign(begin, end); + return string; +} diff --git a/mcclone/external/sfml23/include/SFML/System/Thread.hpp b/mcclone/external/sfml23/include/SFML/System/Thread.hpp new file mode 100644 index 0000000..3321615 --- /dev/null +++ b/mcclone/external/sfml23/include/SFML/System/Thread.hpp @@ -0,0 +1,282 @@ +//////////////////////////////////////////////////////////// +// +// SFML - Simple and Fast Multimedia Library +// Copyright (C) 2007-2015 Laurent Gomila (laurent@sfml-dev.org) +// +// This software is provided 'as-is', without any express or implied warranty. +// In no event will the authors be held liable for any damages arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it freely, +// subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; +// you must not claim that you wrote the original software. +// If you use this software in a product, an acknowledgment +// in the product documentation would be appreciated but is not required. +// +// 2. Altered source versions must be plainly marked as such, +// and must not be misrepresented as being the original software. +// +// 3. This notice may not be removed or altered from any source distribution. +// +//////////////////////////////////////////////////////////// + +#ifndef SFML_THREAD_HPP +#define SFML_THREAD_HPP + +//////////////////////////////////////////////////////////// +// Headers +//////////////////////////////////////////////////////////// +#include +#include +#include + + +namespace sf +{ +namespace priv +{ + class ThreadImpl; + struct ThreadFunc; +} + +//////////////////////////////////////////////////////////// +/// \brief Utility class to manipulate threads +/// +//////////////////////////////////////////////////////////// +class SFML_SYSTEM_API Thread : NonCopyable +{ +public: + + //////////////////////////////////////////////////////////// + /// \brief Construct the thread from a functor with no argument + /// + /// This constructor works for function objects, as well + /// as free functions. + /// + /// Use this constructor for this kind of function: + /// \code + /// void function(); + /// + /// // --- or ---- + /// + /// struct Functor + /// { + /// void operator()(); + /// }; + /// \endcode + /// Note: this does *not* run the thread, use launch(). + /// + /// \param function Functor or free function to use as the entry point of the thread + /// + //////////////////////////////////////////////////////////// + template + Thread(F function); + + //////////////////////////////////////////////////////////// + /// \brief Construct the thread from a functor with an argument + /// + /// This constructor works for function objects, as well + /// as free functions. + /// It is a template, which means that the argument can + /// have any type (int, std::string, void*, Toto, ...). + /// + /// Use this constructor for this kind of function: + /// \code + /// void function(int arg); + /// + /// // --- or ---- + /// + /// struct Functor + /// { + /// void operator()(std::string arg); + /// }; + /// \endcode + /// Note: this does *not* run the thread, use launch(). + /// + /// \param function Functor or free function to use as the entry point of the thread + /// \param argument argument to forward to the function + /// + //////////////////////////////////////////////////////////// + template + Thread(F function, A argument); + + //////////////////////////////////////////////////////////// + /// \brief Construct the thread from a member function and an object + /// + /// This constructor is a template, which means that you can + /// use it with any class. + /// Use this constructor for this kind of function: + /// \code + /// class MyClass + /// { + /// public: + /// + /// void function(); + /// }; + /// \endcode + /// Note: this does *not* run the thread, use launch(). + /// + /// \param function Entry point of the thread + /// \param object Pointer to the object to use + /// + //////////////////////////////////////////////////////////// + template + Thread(void(C::*function)(), C* object); + + //////////////////////////////////////////////////////////// + /// \brief Destructor + /// + /// This destructor calls wait(), so that the internal thread + /// cannot survive after its sf::Thread instance is destroyed. + /// + //////////////////////////////////////////////////////////// + ~Thread(); + + //////////////////////////////////////////////////////////// + /// \brief Run the thread + /// + /// This function starts the entry point passed to the + /// thread's constructor, and returns immediately. + /// After this function returns, the thread's function is + /// running in parallel to the calling code. + /// + //////////////////////////////////////////////////////////// + void launch(); + + //////////////////////////////////////////////////////////// + /// \brief Wait until the thread finishes + /// + /// This function will block the execution until the + /// thread's function ends. + /// Warning: if the thread function never ends, the calling + /// thread will block forever. + /// If this function is called from its owner thread, it + /// returns without doing anything. + /// + //////////////////////////////////////////////////////////// + void wait(); + + //////////////////////////////////////////////////////////// + /// \brief Terminate the thread + /// + /// This function immediately stops the thread, without waiting + /// for its function to finish. + /// Terminating a thread with this function is not safe, + /// and can lead to local variables not being destroyed + /// on some operating systems. You should rather try to make + /// the thread function terminate by itself. + /// + //////////////////////////////////////////////////////////// + void terminate(); + +private: + + friend class priv::ThreadImpl; + + //////////////////////////////////////////////////////////// + /// \brief Internal entry point of the thread + /// + /// This function is called by the thread implementation. + /// + //////////////////////////////////////////////////////////// + void run(); + + //////////////////////////////////////////////////////////// + // Member data + //////////////////////////////////////////////////////////// + priv::ThreadImpl* m_impl; ///< OS-specific implementation of the thread + priv::ThreadFunc* m_entryPoint; ///< Abstraction of the function to run +}; + +#include + +} // namespace sf + +#endif // SFML_THREAD_HPP + + +//////////////////////////////////////////////////////////// +/// \class sf::Thread +/// \ingroup system +/// +/// Threads provide a way to run multiple parts of the code +/// in parallel. When you launch a new thread, the execution +/// is split and both the new thread and the caller run +/// in parallel. +/// +/// To use a sf::Thread, you construct it directly with the +/// function to execute as the entry point of the thread. +/// sf::Thread has multiple template constructors, which means +/// that you can use several types of entry points: +/// \li non-member functions with no argument +/// \li non-member functions with one argument of any type +/// \li functors with no argument (this one is particularly useful for compatibility with boost/std::%bind) +/// \li functors with one argument of any type +/// \li member functions from any class with no argument +/// +/// The function argument, if any, is copied in the sf::Thread +/// instance, as well as the functor (if the corresponding +/// constructor is used). Class instances, however, are passed +/// by pointer so you must make sure that the object won't be +/// destroyed while the thread is still using it. +/// +/// The thread ends when its function is terminated. If the +/// owner sf::Thread instance is destroyed before the +/// thread is finished, the destructor will wait (see wait()) +/// +/// Usage examples: +/// \code +/// // example 1: non member function with one argument +/// +/// void threadFunc(int argument) +/// { +/// ... +/// } +/// +/// sf::Thread thread(&threadFunc, 5); +/// thread.launch(); // start the thread (internally calls threadFunc(5)) +/// \endcode +/// +/// \code +/// // example 2: member function +/// +/// class Task +/// { +/// public: +/// void run() +/// { +/// ... +/// } +/// }; +/// +/// Task task; +/// sf::Thread thread(&Task::run, &task); +/// thread.launch(); // start the thread (internally calls task.run()) +/// \endcode +/// +/// \code +/// // example 3: functor +/// +/// struct Task +/// { +/// void operator()() +/// { +/// ... +/// } +/// }; +/// +/// sf::Thread thread(Task()); +/// thread.launch(); // start the thread (internally calls operator() on the Task instance) +/// \endcode +/// +/// Creating parallel threads of execution can be dangerous: +/// all threads inside the same process share the same memory space, +/// which means that you may end up accessing the same variable +/// from multiple threads at the same time. To prevent this +/// kind of situations, you can use mutexes (see sf::Mutex). +/// +/// \see sf::Mutex +/// +//////////////////////////////////////////////////////////// diff --git a/mcclone/external/sfml23/include/SFML/System/Thread.inl b/mcclone/external/sfml23/include/SFML/System/Thread.inl new file mode 100644 index 0000000..8e0236f --- /dev/null +++ b/mcclone/external/sfml23/include/SFML/System/Thread.inl @@ -0,0 +1,90 @@ +//////////////////////////////////////////////////////////// +// +// SFML - Simple and Fast Multimedia Library +// Copyright (C) 2007-2015 Laurent Gomila (laurent@sfml-dev.org) +// +// This software is provided 'as-is', without any express or implied warranty. +// In no event will the authors be held liable for any damages arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it freely, +// subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; +// you must not claim that you wrote the original software. +// If you use this software in a product, an acknowledgment +// in the product documentation would be appreciated but is not required. +// +// 2. Altered source versions must be plainly marked as such, +// and must not be misrepresented as being the original software. +// +// 3. This notice may not be removed or altered from any source distribution. +// +//////////////////////////////////////////////////////////// + +namespace priv +{ +// Base class for abstract thread functions +struct ThreadFunc +{ + virtual ~ThreadFunc() {} + virtual void run() = 0; +}; + +// Specialization using a functor (including free functions) with no argument +template +struct ThreadFunctor : ThreadFunc +{ + ThreadFunctor(T functor) : m_functor(functor) {} + virtual void run() {m_functor();} + T m_functor; +}; + +// Specialization using a functor (including free functions) with one argument +template +struct ThreadFunctorWithArg : ThreadFunc +{ + ThreadFunctorWithArg(F function, A arg) : m_function(function), m_arg(arg) {} + virtual void run() {m_function(m_arg);} + F m_function; + A m_arg; +}; + +// Specialization using a member function +template +struct ThreadMemberFunc : ThreadFunc +{ + ThreadMemberFunc(void(C::*function)(), C* object) : m_function(function), m_object(object) {} + virtual void run() {(m_object->*m_function)();} + void(C::*m_function)(); + C* m_object; +}; + +} // namespace priv + + +//////////////////////////////////////////////////////////// +template +Thread::Thread(F functor) : +m_impl (NULL), +m_entryPoint(new priv::ThreadFunctor(functor)) +{ +} + + +//////////////////////////////////////////////////////////// +template +Thread::Thread(F function, A argument) : +m_impl (NULL), +m_entryPoint(new priv::ThreadFunctorWithArg(function, argument)) +{ +} + + +//////////////////////////////////////////////////////////// +template +Thread::Thread(void(C::*function)(), C* object) : +m_impl (NULL), +m_entryPoint(new priv::ThreadMemberFunc(function, object)) +{ +} diff --git a/mcclone/external/sfml23/include/SFML/System/ThreadLocal.hpp b/mcclone/external/sfml23/include/SFML/System/ThreadLocal.hpp new file mode 100644 index 0000000..d1f9e4f --- /dev/null +++ b/mcclone/external/sfml23/include/SFML/System/ThreadLocal.hpp @@ -0,0 +1,103 @@ +//////////////////////////////////////////////////////////// +// +// SFML - Simple and Fast Multimedia Library +// Copyright (C) 2007-2015 Laurent Gomila (laurent@sfml-dev.org) +// +// This software is provided 'as-is', without any express or implied warranty. +// In no event will the authors be held liable for any damages arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it freely, +// subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; +// you must not claim that you wrote the original software. +// If you use this software in a product, an acknowledgment +// in the product documentation would be appreciated but is not required. +// +// 2. Altered source versions must be plainly marked as such, +// and must not be misrepresented as being the original software. +// +// 3. This notice may not be removed or altered from any source distribution. +// +//////////////////////////////////////////////////////////// + +#ifndef SFML_THREADLOCAL_HPP +#define SFML_THREADLOCAL_HPP + +//////////////////////////////////////////////////////////// +// Headers +//////////////////////////////////////////////////////////// +#include +#include +#include + + +namespace sf +{ +namespace priv +{ + class ThreadLocalImpl; +} + +//////////////////////////////////////////////////////////// +/// \brief Defines variables with thread-local storage +/// +//////////////////////////////////////////////////////////// +class SFML_SYSTEM_API ThreadLocal : NonCopyable +{ +public: + + //////////////////////////////////////////////////////////// + /// \brief Default constructor + /// + /// \param value Optional value to initialize the variable + /// + //////////////////////////////////////////////////////////// + ThreadLocal(void* value = NULL); + + //////////////////////////////////////////////////////////// + /// \brief Destructor + /// + //////////////////////////////////////////////////////////// + ~ThreadLocal(); + + //////////////////////////////////////////////////////////// + /// \brief Set the thread-specific value of the variable + /// + /// \param value Value of the variable for the current thread + /// + //////////////////////////////////////////////////////////// + void setValue(void* value); + + //////////////////////////////////////////////////////////// + /// \brief Retrieve the thread-specific value of the variable + /// + /// \return Value of the variable for the current thread + /// + //////////////////////////////////////////////////////////// + void* getValue() const; + +private: + + //////////////////////////////////////////////////////////// + // Member data + //////////////////////////////////////////////////////////// + priv::ThreadLocalImpl* m_impl; ///< Pointer to the OS specific implementation +}; + +} // namespace sf + + +#endif // SFML_THREADLOCAL_HPP + + +//////////////////////////////////////////////////////////// +/// \class sf::ThreadLocal +/// \ingroup system +/// +/// This class manipulates void* parameters and thus is not +/// appropriate for strongly-typed variables. You should rather +/// use the sf::ThreadLocalPtr template class. +/// +//////////////////////////////////////////////////////////// diff --git a/mcclone/external/sfml23/include/SFML/System/ThreadLocalPtr.hpp b/mcclone/external/sfml23/include/SFML/System/ThreadLocalPtr.hpp new file mode 100644 index 0000000..3ee7abf --- /dev/null +++ b/mcclone/external/sfml23/include/SFML/System/ThreadLocalPtr.hpp @@ -0,0 +1,158 @@ +//////////////////////////////////////////////////////////// +// +// SFML - Simple and Fast Multimedia Library +// Copyright (C) 2007-2015 Laurent Gomila (laurent@sfml-dev.org) +// +// This software is provided 'as-is', without any express or implied warranty. +// In no event will the authors be held liable for any damages arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it freely, +// subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; +// you must not claim that you wrote the original software. +// If you use this software in a product, an acknowledgment +// in the product documentation would be appreciated but is not required. +// +// 2. Altered source versions must be plainly marked as such, +// and must not be misrepresented as being the original software. +// +// 3. This notice may not be removed or altered from any source distribution. +// +//////////////////////////////////////////////////////////// + +#ifndef SFML_THREADLOCALPTR_HPP +#define SFML_THREADLOCALPTR_HPP + +//////////////////////////////////////////////////////////// +// Headers +//////////////////////////////////////////////////////////// +#include + + +namespace sf +{ +//////////////////////////////////////////////////////////// +/// \brief Pointer to a thread-local variable +/// +//////////////////////////////////////////////////////////// +template +class ThreadLocalPtr : private ThreadLocal +{ +public: + + //////////////////////////////////////////////////////////// + /// \brief Default constructor + /// + /// \param value Optional value to initialize the variable + /// + //////////////////////////////////////////////////////////// + ThreadLocalPtr(T* value = NULL); + + //////////////////////////////////////////////////////////// + /// \brief Overload of unary operator * + /// + /// Like raw pointers, applying the * operator returns a + /// reference to the pointed-to object. + /// + /// \return Reference to the thread-local variable + /// + //////////////////////////////////////////////////////////// + T& operator *() const; + + //////////////////////////////////////////////////////////// + /// \brief Overload of operator -> + /// + /// Similarly to raw pointers, applying the -> operator + /// returns the pointed-to object. + /// + /// \return Pointer to the thread-local variable + /// + //////////////////////////////////////////////////////////// + T* operator ->() const; + + //////////////////////////////////////////////////////////// + /// \brief Conversion operator to implicitly convert the + /// pointer to its raw pointer type (T*) + /// + /// \return Pointer to the actual object + /// + //////////////////////////////////////////////////////////// + operator T*() const; + + //////////////////////////////////////////////////////////// + /// \brief Assignment operator for a raw pointer parameter + /// + /// \param value Pointer to assign + /// + /// \return Reference to self + /// + //////////////////////////////////////////////////////////// + ThreadLocalPtr& operator =(T* value); + + //////////////////////////////////////////////////////////// + /// \brief Assignment operator for a ThreadLocalPtr parameter + /// + /// \param right ThreadLocalPtr to assign + /// + /// \return Reference to self + /// + //////////////////////////////////////////////////////////// + ThreadLocalPtr& operator =(const ThreadLocalPtr& right); +}; + +} // namespace sf + +#include + + +#endif // SFML_THREADLOCALPTR_HPP + + +//////////////////////////////////////////////////////////// +/// \class sf::ThreadLocalPtr +/// \ingroup system +/// +/// sf::ThreadLocalPtr is a type-safe wrapper for storing +/// pointers to thread-local variables. A thread-local +/// variable holds a different value for each different +/// thread, unlike normal variables that are shared. +/// +/// Its usage is completely transparent, so that it is similar +/// to manipulating the raw pointer directly (like any smart pointer). +/// +/// Usage example: +/// \code +/// MyClass object1; +/// MyClass object2; +/// sf::ThreadLocalPtr objectPtr; +/// +/// void thread1() +/// { +/// objectPtr = &object1; // doesn't impact thread2 +/// ... +/// } +/// +/// void thread2() +/// { +/// objectPtr = &object2; // doesn't impact thread1 +/// ... +/// } +/// +/// int main() +/// { +/// // Create and launch the two threads +/// sf::Thread t1(&thread1); +/// sf::Thread t2(&thread2); +/// t1.launch(); +/// t2.launch(); +/// +/// return 0; +/// } +/// \endcode +/// +/// ThreadLocalPtr is designed for internal use; however you +/// can use it if you feel like it fits well your implementation. +/// +//////////////////////////////////////////////////////////// diff --git a/mcclone/external/sfml23/include/SFML/System/ThreadLocalPtr.inl b/mcclone/external/sfml23/include/SFML/System/ThreadLocalPtr.inl new file mode 100644 index 0000000..1d735bf --- /dev/null +++ b/mcclone/external/sfml23/include/SFML/System/ThreadLocalPtr.inl @@ -0,0 +1,77 @@ +//////////////////////////////////////////////////////////// +// +// SFML - Simple and Fast Multimedia Library +// Copyright (C) 2007-2015 Laurent Gomila (laurent@sfml-dev.org) +// +// This software is provided 'as-is', without any express or implied warranty. +// In no event will the authors be held liable for any damages arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it freely, +// subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; +// you must not claim that you wrote the original software. +// If you use this software in a product, an acknowledgment +// in the product documentation would be appreciated but is not required. +// +// 2. Altered source versions must be plainly marked as such, +// and must not be misrepresented as being the original software. +// +// 3. This notice may not be removed or altered from any source distribution. +// +//////////////////////////////////////////////////////////// + + +namespace sf +{ +//////////////////////////////////////////////////////////// +template +ThreadLocalPtr::ThreadLocalPtr(T* value) : +ThreadLocal(value) +{ +} + + +//////////////////////////////////////////////////////////// +template +T& ThreadLocalPtr::operator *() const +{ + return *static_cast(getValue()); +} + + +//////////////////////////////////////////////////////////// +template +T* ThreadLocalPtr::operator ->() const +{ + return static_cast(getValue()); +} + + +//////////////////////////////////////////////////////////// +template +ThreadLocalPtr::operator T*() const +{ + return static_cast(getValue()); +} + + +//////////////////////////////////////////////////////////// +template +ThreadLocalPtr& ThreadLocalPtr::operator =(T* value) +{ + setValue(value); + return *this; +} + + +//////////////////////////////////////////////////////////// +template +ThreadLocalPtr& ThreadLocalPtr::operator =(const ThreadLocalPtr& right) +{ + setValue(right.getValue()); + return *this; +} + +} // namespace sf diff --git a/mcclone/external/sfml23/include/SFML/System/Time.hpp b/mcclone/external/sfml23/include/SFML/System/Time.hpp new file mode 100644 index 0000000..95a0a35 --- /dev/null +++ b/mcclone/external/sfml23/include/SFML/System/Time.hpp @@ -0,0 +1,488 @@ +//////////////////////////////////////////////////////////// +// +// SFML - Simple and Fast Multimedia Library +// Copyright (C) 2007-2015 Laurent Gomila (laurent@sfml-dev.org) +// +// This software is provided 'as-is', without any express or implied warranty. +// In no event will the authors be held liable for any damages arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it freely, +// subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; +// you must not claim that you wrote the original software. +// If you use this software in a product, an acknowledgment +// in the product documentation would be appreciated but is not required. +// +// 2. Altered source versions must be plainly marked as such, +// and must not be misrepresented as being the original software. +// +// 3. This notice may not be removed or altered from any source distribution. +// +//////////////////////////////////////////////////////////// + +#ifndef SFML_TIME_HPP +#define SFML_TIME_HPP + +//////////////////////////////////////////////////////////// +// Headers +//////////////////////////////////////////////////////////// +#include + + +namespace sf +{ +//////////////////////////////////////////////////////////// +/// \brief Represents a time value +/// +//////////////////////////////////////////////////////////// +class SFML_SYSTEM_API Time +{ +public: + + //////////////////////////////////////////////////////////// + /// \brief Default constructor + /// + /// Sets the time value to zero. + /// + //////////////////////////////////////////////////////////// + Time(); + + //////////////////////////////////////////////////////////// + /// \brief Return the time value as a number of seconds + /// + /// \return Time in seconds + /// + /// \see asMilliseconds, asMicroseconds + /// + //////////////////////////////////////////////////////////// + float asSeconds() const; + + //////////////////////////////////////////////////////////// + /// \brief Return the time value as a number of milliseconds + /// + /// \return Time in milliseconds + /// + /// \see asSeconds, asMicroseconds + /// + //////////////////////////////////////////////////////////// + Int32 asMilliseconds() const; + + //////////////////////////////////////////////////////////// + /// \brief Return the time value as a number of microseconds + /// + /// \return Time in microseconds + /// + /// \see asSeconds, asMilliseconds + /// + //////////////////////////////////////////////////////////// + Int64 asMicroseconds() const; + + //////////////////////////////////////////////////////////// + // Static member data + //////////////////////////////////////////////////////////// + static const Time Zero; ///< Predefined "zero" time value + +private: + + friend SFML_SYSTEM_API Time seconds(float); + friend SFML_SYSTEM_API Time milliseconds(Int32); + friend SFML_SYSTEM_API Time microseconds(Int64); + + //////////////////////////////////////////////////////////// + /// \brief Construct from a number of microseconds + /// + /// This function is internal. To construct time values, + /// use sf::seconds, sf::milliseconds or sf::microseconds instead. + /// + /// \param microseconds Number of microseconds + /// + //////////////////////////////////////////////////////////// + explicit Time(Int64 microseconds); + +private: + + //////////////////////////////////////////////////////////// + // Member data + //////////////////////////////////////////////////////////// + Int64 m_microseconds; ///< Time value stored as microseconds +}; + +//////////////////////////////////////////////////////////// +/// \relates Time +/// \brief Construct a time value from a number of seconds +/// +/// \param amount Number of seconds +/// +/// \return Time value constructed from the amount of seconds +/// +/// \see milliseconds, microseconds +/// +//////////////////////////////////////////////////////////// +SFML_SYSTEM_API Time seconds(float amount); + +//////////////////////////////////////////////////////////// +/// \relates Time +/// \brief Construct a time value from a number of milliseconds +/// +/// \param amount Number of milliseconds +/// +/// \return Time value constructed from the amount of milliseconds +/// +/// \see seconds, microseconds +/// +//////////////////////////////////////////////////////////// +SFML_SYSTEM_API Time milliseconds(Int32 amount); + +//////////////////////////////////////////////////////////// +/// \relates Time +/// \brief Construct a time value from a number of microseconds +/// +/// \param amount Number of microseconds +/// +/// \return Time value constructed from the amount of microseconds +/// +/// \see seconds, milliseconds +/// +//////////////////////////////////////////////////////////// +SFML_SYSTEM_API Time microseconds(Int64 amount); + +//////////////////////////////////////////////////////////// +/// \relates Time +/// \brief Overload of == operator to compare two time values +/// +/// \param left Left operand (a time) +/// \param right Right operand (a time) +/// +/// \return True if both time values are equal +/// +//////////////////////////////////////////////////////////// +SFML_SYSTEM_API bool operator ==(Time left, Time right); + +//////////////////////////////////////////////////////////// +/// \relates Time +/// \brief Overload of != operator to compare two time values +/// +/// \param left Left operand (a time) +/// \param right Right operand (a time) +/// +/// \return True if both time values are different +/// +//////////////////////////////////////////////////////////// +SFML_SYSTEM_API bool operator !=(Time left, Time right); + +//////////////////////////////////////////////////////////// +/// \relates Time +/// \brief Overload of < operator to compare two time values +/// +/// \param left Left operand (a time) +/// \param right Right operand (a time) +/// +/// \return True if \a left is lesser than \a right +/// +//////////////////////////////////////////////////////////// +SFML_SYSTEM_API bool operator <(Time left, Time right); + +//////////////////////////////////////////////////////////// +/// \relates Time +/// \brief Overload of > operator to compare two time values +/// +/// \param left Left operand (a time) +/// \param right Right operand (a time) +/// +/// \return True if \a left is greater than \a right +/// +//////////////////////////////////////////////////////////// +SFML_SYSTEM_API bool operator >(Time left, Time right); + +//////////////////////////////////////////////////////////// +/// \relates Time +/// \brief Overload of <= operator to compare two time values +/// +/// \param left Left operand (a time) +/// \param right Right operand (a time) +/// +/// \return True if \a left is lesser or equal than \a right +/// +//////////////////////////////////////////////////////////// +SFML_SYSTEM_API bool operator <=(Time left, Time right); + +//////////////////////////////////////////////////////////// +/// \relates Time +/// \brief Overload of >= operator to compare two time values +/// +/// \param left Left operand (a time) +/// \param right Right operand (a time) +/// +/// \return True if \a left is greater or equal than \a right +/// +//////////////////////////////////////////////////////////// +SFML_SYSTEM_API bool operator >=(Time left, Time right); + +//////////////////////////////////////////////////////////// +/// \relates Time +/// \brief Overload of unary - operator to negate a time value +/// +/// \param right Right operand (a time) +/// +/// \return Opposite of the time value +/// +//////////////////////////////////////////////////////////// +SFML_SYSTEM_API Time operator -(Time right); + +//////////////////////////////////////////////////////////// +/// \relates Time +/// \brief Overload of binary + operator to add two time values +/// +/// \param left Left operand (a time) +/// \param right Right operand (a time) +/// +/// \return Sum of the two times values +/// +//////////////////////////////////////////////////////////// +SFML_SYSTEM_API Time operator +(Time left, Time right); + +//////////////////////////////////////////////////////////// +/// \relates Time +/// \brief Overload of binary += operator to add/assign two time values +/// +/// \param left Left operand (a time) +/// \param right Right operand (a time) +/// +/// \return Sum of the two times values +/// +//////////////////////////////////////////////////////////// +SFML_SYSTEM_API Time& operator +=(Time& left, Time right); + +//////////////////////////////////////////////////////////// +/// \relates Time +/// \brief Overload of binary - operator to subtract two time values +/// +/// \param left Left operand (a time) +/// \param right Right operand (a time) +/// +/// \return Difference of the two times values +/// +//////////////////////////////////////////////////////////// +SFML_SYSTEM_API Time operator -(Time left, Time right); + +//////////////////////////////////////////////////////////// +/// \relates Time +/// \brief Overload of binary -= operator to subtract/assign two time values +/// +/// \param left Left operand (a time) +/// \param right Right operand (a time) +/// +/// \return Difference of the two times values +/// +//////////////////////////////////////////////////////////// +SFML_SYSTEM_API Time& operator -=(Time& left, Time right); + +//////////////////////////////////////////////////////////// +/// \relates Time +/// \brief Overload of binary * operator to scale a time value +/// +/// \param left Left operand (a time) +/// \param right Right operand (a number) +/// +/// \return \a left multiplied by \a right +/// +//////////////////////////////////////////////////////////// +SFML_SYSTEM_API Time operator *(Time left, float right); + +//////////////////////////////////////////////////////////// +/// \relates Time +/// \brief Overload of binary * operator to scale a time value +/// +/// \param left Left operand (a time) +/// \param right Right operand (a number) +/// +/// \return \a left multiplied by \a right +/// +//////////////////////////////////////////////////////////// +SFML_SYSTEM_API Time operator *(Time left, Int64 right); + +//////////////////////////////////////////////////////////// +/// \relates Time +/// \brief Overload of binary * operator to scale a time value +/// +/// \param left Left operand (a number) +/// \param right Right operand (a time) +/// +/// \return \a left multiplied by \a right +/// +//////////////////////////////////////////////////////////// +SFML_SYSTEM_API Time operator *(float left, Time right); + +//////////////////////////////////////////////////////////// +/// \relates Time +/// \brief Overload of binary * operator to scale a time value +/// +/// \param left Left operand (a number) +/// \param right Right operand (a time) +/// +/// \return \a left multiplied by \a right +/// +//////////////////////////////////////////////////////////// +SFML_SYSTEM_API Time operator *(Int64 left, Time right); + +//////////////////////////////////////////////////////////// +/// \relates Time +/// \brief Overload of binary *= operator to scale/assign a time value +/// +/// \param left Left operand (a time) +/// \param right Right operand (a number) +/// +/// \return \a left multiplied by \a right +/// +//////////////////////////////////////////////////////////// +SFML_SYSTEM_API Time& operator *=(Time& left, float right); + +//////////////////////////////////////////////////////////// +/// \relates Time +/// \brief Overload of binary *= operator to scale/assign a time value +/// +/// \param left Left operand (a time) +/// \param right Right operand (a number) +/// +/// \return \a left multiplied by \a right +/// +//////////////////////////////////////////////////////////// +SFML_SYSTEM_API Time& operator *=(Time& left, Int64 right); + +//////////////////////////////////////////////////////////// +/// \relates Time +/// \brief Overload of binary / operator to scale a time value +/// +/// \param left Left operand (a time) +/// \param right Right operand (a number) +/// +/// \return \a left divided by \a right +/// +//////////////////////////////////////////////////////////// +SFML_SYSTEM_API Time operator /(Time left, float right); + +//////////////////////////////////////////////////////////// +/// \relates Time +/// \brief Overload of binary / operator to scale a time value +/// +/// \param left Left operand (a time) +/// \param right Right operand (a number) +/// +/// \return \a left divided by \a right +/// +//////////////////////////////////////////////////////////// +SFML_SYSTEM_API Time operator /(Time left, Int64 right); + +//////////////////////////////////////////////////////////// +/// \relates Time +/// \brief Overload of binary /= operator to scale/assign a time value +/// +/// \param left Left operand (a time) +/// \param right Right operand (a number) +/// +/// \return \a left divided by \a right +/// +//////////////////////////////////////////////////////////// +SFML_SYSTEM_API Time& operator /=(Time& left, float right); + +//////////////////////////////////////////////////////////// +/// \relates Time +/// \brief Overload of binary /= operator to scale/assign a time value +/// +/// \param left Left operand (a time) +/// \param right Right operand (a number) +/// +/// \return \a left divided by \a right +/// +//////////////////////////////////////////////////////////// +SFML_SYSTEM_API Time& operator /=(Time& left, Int64 right); + +//////////////////////////////////////////////////////////// +/// \relates Time +/// \brief Overload of binary / operator to compute the ratio of two time values +/// +/// \param left Left operand (a time) +/// \param right Right operand (a time) +/// +/// \return \a left divided by \a right +/// +//////////////////////////////////////////////////////////// +SFML_SYSTEM_API float operator /(Time left, Time right); + +//////////////////////////////////////////////////////////// +/// \relates Time +/// \brief Overload of binary % operator to compute remainder of a time value +/// +/// \param left Left operand (a time) +/// \param right Right operand (a time) +/// +/// \return \a left modulo \a right +/// +//////////////////////////////////////////////////////////// +SFML_SYSTEM_API Time operator %(Time left, Time right); + +//////////////////////////////////////////////////////////// +/// \relates Time +/// \brief Overload of binary %= operator to compute/assign remainder of a time value +/// +/// \param left Left operand (a time) +/// \param right Right operand (a time) +/// +/// \return \a left modulo \a right +/// +//////////////////////////////////////////////////////////// +SFML_SYSTEM_API Time& operator %=(Time& left, Time right); + +} // namespace sf + + +#endif // SFML_TIME_HPP + + +//////////////////////////////////////////////////////////// +/// \class sf::Time +/// \ingroup system +/// +/// sf::Time encapsulates a time value in a flexible way. +/// It allows to define a time value either as a number of +/// seconds, milliseconds or microseconds. It also works the +/// other way round: you can read a time value as either +/// a number of seconds, milliseconds or microseconds. +/// +/// By using such a flexible interface, the API doesn't +/// impose any fixed type or resolution for time values, +/// and let the user choose its own favorite representation. +/// +/// Time values support the usual mathematical operations: +/// you can add or subtract two times, multiply or divide +/// a time by a number, compare two times, etc. +/// +/// Since they represent a time span and not an absolute time +/// value, times can also be negative. +/// +/// Usage example: +/// \code +/// sf::Time t1 = sf::seconds(0.1f); +/// Int32 milli = t1.asMilliseconds(); // 100 +/// +/// sf::Time t2 = sf::milliseconds(30); +/// Int64 micro = t2.asMicroseconds(); // 30000 +/// +/// sf::Time t3 = sf::microseconds(-800000); +/// float sec = t3.asSeconds(); // -0.8 +/// \endcode +/// +/// \code +/// void update(sf::Time elapsed) +/// { +/// position += speed * elapsed.asSeconds(); +/// } +/// +/// update(sf::milliseconds(100)); +/// \endcode +/// +/// \see sf::Clock +/// +//////////////////////////////////////////////////////////// diff --git a/mcclone/external/sfml23/include/SFML/System/Utf.hpp b/mcclone/external/sfml23/include/SFML/System/Utf.hpp new file mode 100644 index 0000000..9e9d153 --- /dev/null +++ b/mcclone/external/sfml23/include/SFML/System/Utf.hpp @@ -0,0 +1,763 @@ +//////////////////////////////////////////////////////////// +// +// SFML - Simple and Fast Multimedia Library +// Copyright (C) 2007-2015 Laurent Gomila (laurent@sfml-dev.org) +// +// This software is provided 'as-is', without any express or implied warranty. +// In no event will the authors be held liable for any damages arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it freely, +// subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; +// you must not claim that you wrote the original software. +// If you use this software in a product, an acknowledgment +// in the product documentation would be appreciated but is not required. +// +// 2. Altered source versions must be plainly marked as such, +// and must not be misrepresented as being the original software. +// +// 3. This notice may not be removed or altered from any source distribution. +// +//////////////////////////////////////////////////////////// + +#ifndef SFML_UTF_HPP +#define SFML_UTF_HPP + +//////////////////////////////////////////////////////////// +// Headers +//////////////////////////////////////////////////////////// +#include +#include +#include +#include +#include + + +namespace sf +{ +template +class Utf; + +//////////////////////////////////////////////////////////// +/// \brief Specialization of the Utf template for UTF-8 +/// +//////////////////////////////////////////////////////////// +template <> +class Utf<8> +{ +public: + + //////////////////////////////////////////////////////////// + /// \brief Decode a single UTF-8 character + /// + /// Decoding a character means finding its unique 32-bits + /// code (called the codepoint) in the Unicode standard. + /// + /// \param begin Iterator pointing to the beginning of the input sequence + /// \param end Iterator pointing to the end of the input sequence + /// \param output Codepoint of the decoded UTF-8 character + /// \param replacement Replacement character to use in case the UTF-8 sequence is invalid + /// + /// \return Iterator pointing to one past the last read element of the input sequence + /// + //////////////////////////////////////////////////////////// + template + static In decode(In begin, In end, Uint32& output, Uint32 replacement = 0); + + //////////////////////////////////////////////////////////// + /// \brief Encode a single UTF-8 character + /// + /// Encoding a character means converting a unique 32-bits + /// code (called the codepoint) in the target encoding, UTF-8. + /// + /// \param input Codepoint to encode as UTF-8 + /// \param output Iterator pointing to the beginning of the output sequence + /// \param replacement Replacement for characters not convertible to UTF-8 (use 0 to skip them) + /// + /// \return Iterator to the end of the output sequence which has been written + /// + //////////////////////////////////////////////////////////// + template + static Out encode(Uint32 input, Out output, Uint8 replacement = 0); + + //////////////////////////////////////////////////////////// + /// \brief Advance to the next UTF-8 character + /// + /// This function is necessary for multi-elements encodings, as + /// a single character may use more than 1 storage element. + /// + /// \param begin Iterator pointing to the beginning of the input sequence + /// \param end Iterator pointing to the end of the input sequence + /// + /// \return Iterator pointing to one past the last read element of the input sequence + /// + //////////////////////////////////////////////////////////// + template + static In next(In begin, In end); + + //////////////////////////////////////////////////////////// + /// \brief Count the number of characters of a UTF-8 sequence + /// + /// This function is necessary for multi-elements encodings, as + /// a single character may use more than 1 storage element, thus the + /// total size can be different from (begin - end). + /// + /// \param begin Iterator pointing to the beginning of the input sequence + /// \param end Iterator pointing to the end of the input sequence + /// + /// \return Iterator pointing to one past the last read element of the input sequence + /// + //////////////////////////////////////////////////////////// + template + static std::size_t count(In begin, In end); + + //////////////////////////////////////////////////////////// + /// \brief Convert an ANSI characters range to UTF-8 + /// + /// The current global locale will be used by default, unless you + /// pass a custom one in the \a locale parameter. + /// + /// \param begin Iterator pointing to the beginning of the input sequence + /// \param end Iterator pointing to the end of the input sequence + /// \param output Iterator pointing to the beginning of the output sequence + /// \param locale Locale to use for conversion + /// + /// \return Iterator to the end of the output sequence which has been written + /// + //////////////////////////////////////////////////////////// + template + static Out fromAnsi(In begin, In end, Out output, const std::locale& locale = std::locale()); + + //////////////////////////////////////////////////////////// + /// \brief Convert a wide characters range to UTF-8 + /// + /// \param begin Iterator pointing to the beginning of the input sequence + /// \param end Iterator pointing to the end of the input sequence + /// \param output Iterator pointing to the beginning of the output sequence + /// + /// \return Iterator to the end of the output sequence which has been written + /// + //////////////////////////////////////////////////////////// + template + static Out fromWide(In begin, In end, Out output); + + //////////////////////////////////////////////////////////// + /// \brief Convert a latin-1 (ISO-5589-1) characters range to UTF-8 + /// + /// \param begin Iterator pointing to the beginning of the input sequence + /// \param end Iterator pointing to the end of the input sequence + /// \param output Iterator pointing to the beginning of the output sequence + /// + /// \return Iterator to the end of the output sequence which has been written + /// + //////////////////////////////////////////////////////////// + template + static Out fromLatin1(In begin, In end, Out output); + + //////////////////////////////////////////////////////////// + /// \brief Convert an UTF-8 characters range to ANSI characters + /// + /// The current global locale will be used by default, unless you + /// pass a custom one in the \a locale parameter. + /// + /// \param begin Iterator pointing to the beginning of the input sequence + /// \param end Iterator pointing to the end of the input sequence + /// \param output Iterator pointing to the beginning of the output sequence + /// \param replacement Replacement for characters not convertible to ANSI (use 0 to skip them) + /// \param locale Locale to use for conversion + /// + /// \return Iterator to the end of the output sequence which has been written + /// + //////////////////////////////////////////////////////////// + template + static Out toAnsi(In begin, In end, Out output, char replacement = 0, const std::locale& locale = std::locale()); + + //////////////////////////////////////////////////////////// + /// \brief Convert an UTF-8 characters range to wide characters + /// + /// \param begin Iterator pointing to the beginning of the input sequence + /// \param end Iterator pointing to the end of the input sequence + /// \param output Iterator pointing to the beginning of the output sequence + /// \param replacement Replacement for characters not convertible to wide (use 0 to skip them) + /// + /// \return Iterator to the end of the output sequence which has been written + /// + //////////////////////////////////////////////////////////// + template + static Out toWide(In begin, In end, Out output, wchar_t replacement = 0); + + //////////////////////////////////////////////////////////// + /// \brief Convert an UTF-8 characters range to latin-1 (ISO-5589-1) characters + /// + /// \param begin Iterator pointing to the beginning of the input sequence + /// \param end Iterator pointing to the end of the input sequence + /// \param output Iterator pointing to the beginning of the output sequence + /// \param replacement Replacement for characters not convertible to wide (use 0 to skip them) + /// + /// \return Iterator to the end of the output sequence which has been written + /// + //////////////////////////////////////////////////////////// + template + static Out toLatin1(In begin, In end, Out output, char replacement = 0); + + //////////////////////////////////////////////////////////// + /// \brief Convert a UTF-8 characters range to UTF-8 + /// + /// This functions does nothing more than a direct copy; + /// it is defined only to provide the same interface as other + /// specializations of the sf::Utf<> template, and allow + /// generic code to be written on top of it. + /// + /// \param begin Iterator pointing to the beginning of the input sequence + /// \param end Iterator pointing to the end of the input sequence + /// \param output Iterator pointing to the beginning of the output sequence + /// + /// \return Iterator to the end of the output sequence which has been written + /// + //////////////////////////////////////////////////////////// + template + static Out toUtf8(In begin, In end, Out output); + + //////////////////////////////////////////////////////////// + /// \brief Convert a UTF-8 characters range to UTF-16 + /// + /// \param begin Iterator pointing to the beginning of the input sequence + /// \param end Iterator pointing to the end of the input sequence + /// \param output Iterator pointing to the beginning of the output sequence + /// + /// \return Iterator to the end of the output sequence which has been written + /// + //////////////////////////////////////////////////////////// + template + static Out toUtf16(In begin, In end, Out output); + + //////////////////////////////////////////////////////////// + /// \brief Convert a UTF-8 characters range to UTF-32 + /// + /// \param begin Iterator pointing to the beginning of the input sequence + /// \param end Iterator pointing to the end of the input sequence + /// \param output Iterator pointing to the beginning of the output sequence + /// + /// \return Iterator to the end of the output sequence which has been written + /// + //////////////////////////////////////////////////////////// + template + static Out toUtf32(In begin, In end, Out output); +}; + +//////////////////////////////////////////////////////////// +/// \brief Specialization of the Utf template for UTF-16 +/// +//////////////////////////////////////////////////////////// +template <> +class Utf<16> +{ +public: + + //////////////////////////////////////////////////////////// + /// \brief Decode a single UTF-16 character + /// + /// Decoding a character means finding its unique 32-bits + /// code (called the codepoint) in the Unicode standard. + /// + /// \param begin Iterator pointing to the beginning of the input sequence + /// \param end Iterator pointing to the end of the input sequence + /// \param output Codepoint of the decoded UTF-16 character + /// \param replacement Replacement character to use in case the UTF-8 sequence is invalid + /// + /// \return Iterator pointing to one past the last read element of the input sequence + /// + //////////////////////////////////////////////////////////// + template + static In decode(In begin, In end, Uint32& output, Uint32 replacement = 0); + + //////////////////////////////////////////////////////////// + /// \brief Encode a single UTF-16 character + /// + /// Encoding a character means converting a unique 32-bits + /// code (called the codepoint) in the target encoding, UTF-16. + /// + /// \param input Codepoint to encode as UTF-16 + /// \param output Iterator pointing to the beginning of the output sequence + /// \param replacement Replacement for characters not convertible to UTF-16 (use 0 to skip them) + /// + /// \return Iterator to the end of the output sequence which has been written + /// + //////////////////////////////////////////////////////////// + template + static Out encode(Uint32 input, Out output, Uint16 replacement = 0); + + //////////////////////////////////////////////////////////// + /// \brief Advance to the next UTF-16 character + /// + /// This function is necessary for multi-elements encodings, as + /// a single character may use more than 1 storage element. + /// + /// \param begin Iterator pointing to the beginning of the input sequence + /// \param end Iterator pointing to the end of the input sequence + /// + /// \return Iterator pointing to one past the last read element of the input sequence + /// + //////////////////////////////////////////////////////////// + template + static In next(In begin, In end); + + //////////////////////////////////////////////////////////// + /// \brief Count the number of characters of a UTF-16 sequence + /// + /// This function is necessary for multi-elements encodings, as + /// a single character may use more than 1 storage element, thus the + /// total size can be different from (begin - end). + /// + /// \param begin Iterator pointing to the beginning of the input sequence + /// \param end Iterator pointing to the end of the input sequence + /// + /// \return Iterator pointing to one past the last read element of the input sequence + /// + //////////////////////////////////////////////////////////// + template + static std::size_t count(In begin, In end); + + //////////////////////////////////////////////////////////// + /// \brief Convert an ANSI characters range to UTF-16 + /// + /// The current global locale will be used by default, unless you + /// pass a custom one in the \a locale parameter. + /// + /// \param begin Iterator pointing to the beginning of the input sequence + /// \param end Iterator pointing to the end of the input sequence + /// \param output Iterator pointing to the beginning of the output sequence + /// \param locale Locale to use for conversion + /// + /// \return Iterator to the end of the output sequence which has been written + /// + //////////////////////////////////////////////////////////// + template + static Out fromAnsi(In begin, In end, Out output, const std::locale& locale = std::locale()); + + //////////////////////////////////////////////////////////// + /// \brief Convert a wide characters range to UTF-16 + /// + /// \param begin Iterator pointing to the beginning of the input sequence + /// \param end Iterator pointing to the end of the input sequence + /// \param output Iterator pointing to the beginning of the output sequence + /// + /// \return Iterator to the end of the output sequence which has been written + /// + //////////////////////////////////////////////////////////// + template + static Out fromWide(In begin, In end, Out output); + + //////////////////////////////////////////////////////////// + /// \brief Convert a latin-1 (ISO-5589-1) characters range to UTF-16 + /// + /// \param begin Iterator pointing to the beginning of the input sequence + /// \param end Iterator pointing to the end of the input sequence + /// \param output Iterator pointing to the beginning of the output sequence + /// + /// \return Iterator to the end of the output sequence which has been written + /// + //////////////////////////////////////////////////////////// + template + static Out fromLatin1(In begin, In end, Out output); + + //////////////////////////////////////////////////////////// + /// \brief Convert an UTF-16 characters range to ANSI characters + /// + /// The current global locale will be used by default, unless you + /// pass a custom one in the \a locale parameter. + /// + /// \param begin Iterator pointing to the beginning of the input sequence + /// \param end Iterator pointing to the end of the input sequence + /// \param output Iterator pointing to the beginning of the output sequence + /// \param replacement Replacement for characters not convertible to ANSI (use 0 to skip them) + /// \param locale Locale to use for conversion + /// + /// \return Iterator to the end of the output sequence which has been written + /// + //////////////////////////////////////////////////////////// + template + static Out toAnsi(In begin, In end, Out output, char replacement = 0, const std::locale& locale = std::locale()); + + //////////////////////////////////////////////////////////// + /// \brief Convert an UTF-16 characters range to wide characters + /// + /// \param begin Iterator pointing to the beginning of the input sequence + /// \param end Iterator pointing to the end of the input sequence + /// \param output Iterator pointing to the beginning of the output sequence + /// \param replacement Replacement for characters not convertible to wide (use 0 to skip them) + /// + /// \return Iterator to the end of the output sequence which has been written + /// + //////////////////////////////////////////////////////////// + template + static Out toWide(In begin, In end, Out output, wchar_t replacement = 0); + + //////////////////////////////////////////////////////////// + /// \brief Convert an UTF-16 characters range to latin-1 (ISO-5589-1) characters + /// + /// \param begin Iterator pointing to the beginning of the input sequence + /// \param end Iterator pointing to the end of the input sequence + /// \param output Iterator pointing to the beginning of the output sequence + /// \param replacement Replacement for characters not convertible to wide (use 0 to skip them) + /// + /// \return Iterator to the end of the output sequence which has been written + /// + //////////////////////////////////////////////////////////// + template + static Out toLatin1(In begin, In end, Out output, char replacement = 0); + + //////////////////////////////////////////////////////////// + /// \brief Convert a UTF-16 characters range to UTF-8 + /// + /// \param begin Iterator pointing to the beginning of the input sequence + /// \param end Iterator pointing to the end of the input sequence + /// \param output Iterator pointing to the beginning of the output sequence + /// + /// \return Iterator to the end of the output sequence which has been written + /// + //////////////////////////////////////////////////////////// + template + static Out toUtf8(In begin, In end, Out output); + + //////////////////////////////////////////////////////////// + /// \brief Convert a UTF-16 characters range to UTF-16 + /// + /// This functions does nothing more than a direct copy; + /// it is defined only to provide the same interface as other + /// specializations of the sf::Utf<> template, and allow + /// generic code to be written on top of it. + /// + /// \param begin Iterator pointing to the beginning of the input sequence + /// \param end Iterator pointing to the end of the input sequence + /// \param output Iterator pointing to the beginning of the output sequence + /// + /// \return Iterator to the end of the output sequence which has been written + /// + //////////////////////////////////////////////////////////// + template + static Out toUtf16(In begin, In end, Out output); + + //////////////////////////////////////////////////////////// + /// \brief Convert a UTF-16 characters range to UTF-32 + /// + /// \param begin Iterator pointing to the beginning of the input sequence + /// \param end Iterator pointing to the end of the input sequence + /// \param output Iterator pointing to the beginning of the output sequence + /// + /// \return Iterator to the end of the output sequence which has been written + /// + //////////////////////////////////////////////////////////// + template + static Out toUtf32(In begin, In end, Out output); +}; + +//////////////////////////////////////////////////////////// +/// \brief Specialization of the Utf template for UTF-32 +/// +//////////////////////////////////////////////////////////// +template <> +class Utf<32> +{ +public: + + //////////////////////////////////////////////////////////// + /// \brief Decode a single UTF-32 character + /// + /// Decoding a character means finding its unique 32-bits + /// code (called the codepoint) in the Unicode standard. + /// For UTF-32, the character value is the same as the codepoint. + /// + /// \param begin Iterator pointing to the beginning of the input sequence + /// \param end Iterator pointing to the end of the input sequence + /// \param output Codepoint of the decoded UTF-32 character + /// \param replacement Replacement character to use in case the UTF-8 sequence is invalid + /// + /// \return Iterator pointing to one past the last read element of the input sequence + /// + //////////////////////////////////////////////////////////// + template + static In decode(In begin, In end, Uint32& output, Uint32 replacement = 0); + + //////////////////////////////////////////////////////////// + /// \brief Encode a single UTF-32 character + /// + /// Encoding a character means converting a unique 32-bits + /// code (called the codepoint) in the target encoding, UTF-32. + /// For UTF-32, the codepoint is the same as the character value. + /// + /// \param input Codepoint to encode as UTF-32 + /// \param output Iterator pointing to the beginning of the output sequence + /// \param replacement Replacement for characters not convertible to UTF-32 (use 0 to skip them) + /// + /// \return Iterator to the end of the output sequence which has been written + /// + //////////////////////////////////////////////////////////// + template + static Out encode(Uint32 input, Out output, Uint32 replacement = 0); + + //////////////////////////////////////////////////////////// + /// \brief Advance to the next UTF-32 character + /// + /// This function is trivial for UTF-32, which can store + /// every character in a single storage element. + /// + /// \param begin Iterator pointing to the beginning of the input sequence + /// \param end Iterator pointing to the end of the input sequence + /// + /// \return Iterator pointing to one past the last read element of the input sequence + /// + //////////////////////////////////////////////////////////// + template + static In next(In begin, In end); + + //////////////////////////////////////////////////////////// + /// \brief Count the number of characters of a UTF-32 sequence + /// + /// This function is trivial for UTF-32, which can store + /// every character in a single storage element. + /// + /// \param begin Iterator pointing to the beginning of the input sequence + /// \param end Iterator pointing to the end of the input sequence + /// + /// \return Iterator pointing to one past the last read element of the input sequence + /// + //////////////////////////////////////////////////////////// + template + static std::size_t count(In begin, In end); + + //////////////////////////////////////////////////////////// + /// \brief Convert an ANSI characters range to UTF-32 + /// + /// The current global locale will be used by default, unless you + /// pass a custom one in the \a locale parameter. + /// + /// \param begin Iterator pointing to the beginning of the input sequence + /// \param end Iterator pointing to the end of the input sequence + /// \param output Iterator pointing to the beginning of the output sequence + /// \param locale Locale to use for conversion + /// + /// \return Iterator to the end of the output sequence which has been written + /// + //////////////////////////////////////////////////////////// + template + static Out fromAnsi(In begin, In end, Out output, const std::locale& locale = std::locale()); + + //////////////////////////////////////////////////////////// + /// \brief Convert a wide characters range to UTF-32 + /// + /// \param begin Iterator pointing to the beginning of the input sequence + /// \param end Iterator pointing to the end of the input sequence + /// \param output Iterator pointing to the beginning of the output sequence + /// + /// \return Iterator to the end of the output sequence which has been written + /// + //////////////////////////////////////////////////////////// + template + static Out fromWide(In begin, In end, Out output); + + //////////////////////////////////////////////////////////// + /// \brief Convert a latin-1 (ISO-5589-1) characters range to UTF-32 + /// + /// \param begin Iterator pointing to the beginning of the input sequence + /// \param end Iterator pointing to the end of the input sequence + /// \param output Iterator pointing to the beginning of the output sequence + /// + /// \return Iterator to the end of the output sequence which has been written + /// + //////////////////////////////////////////////////////////// + template + static Out fromLatin1(In begin, In end, Out output); + + //////////////////////////////////////////////////////////// + /// \brief Convert an UTF-32 characters range to ANSI characters + /// + /// The current global locale will be used by default, unless you + /// pass a custom one in the \a locale parameter. + /// + /// \param begin Iterator pointing to the beginning of the input sequence + /// \param end Iterator pointing to the end of the input sequence + /// \param output Iterator pointing to the beginning of the output sequence + /// \param replacement Replacement for characters not convertible to ANSI (use 0 to skip them) + /// \param locale Locale to use for conversion + /// + /// \return Iterator to the end of the output sequence which has been written + /// + //////////////////////////////////////////////////////////// + template + static Out toAnsi(In begin, In end, Out output, char replacement = 0, const std::locale& locale = std::locale()); + + //////////////////////////////////////////////////////////// + /// \brief Convert an UTF-32 characters range to wide characters + /// + /// \param begin Iterator pointing to the beginning of the input sequence + /// \param end Iterator pointing to the end of the input sequence + /// \param output Iterator pointing to the beginning of the output sequence + /// \param replacement Replacement for characters not convertible to wide (use 0 to skip them) + /// + /// \return Iterator to the end of the output sequence which has been written + /// + //////////////////////////////////////////////////////////// + template + static Out toWide(In begin, In end, Out output, wchar_t replacement = 0); + + //////////////////////////////////////////////////////////// + /// \brief Convert an UTF-16 characters range to latin-1 (ISO-5589-1) characters + /// + /// \param begin Iterator pointing to the beginning of the input sequence + /// \param end Iterator pointing to the end of the input sequence + /// \param output Iterator pointing to the beginning of the output sequence + /// \param replacement Replacement for characters not convertible to wide (use 0 to skip them) + /// + /// \return Iterator to the end of the output sequence which has been written + /// + //////////////////////////////////////////////////////////// + template + static Out toLatin1(In begin, In end, Out output, char replacement = 0); + + //////////////////////////////////////////////////////////// + /// \brief Convert a UTF-32 characters range to UTF-8 + /// + /// \param begin Iterator pointing to the beginning of the input sequence + /// \param end Iterator pointing to the end of the input sequence + /// \param output Iterator pointing to the beginning of the output sequence + /// + /// \return Iterator to the end of the output sequence which has been written + /// + //////////////////////////////////////////////////////////// + template + static Out toUtf8(In begin, In end, Out output); + + //////////////////////////////////////////////////////////// + /// \brief Convert a UTF-32 characters range to UTF-16 + /// + /// \param begin Iterator pointing to the beginning of the input sequence + /// \param end Iterator pointing to the end of the input sequence + /// \param output Iterator pointing to the beginning of the output sequence + /// + /// \return Iterator to the end of the output sequence which has been written + /// + //////////////////////////////////////////////////////////// + template + static Out toUtf16(In begin, In end, Out output); + + //////////////////////////////////////////////////////////// + /// \brief Convert a UTF-32 characters range to UTF-32 + /// + /// This functions does nothing more than a direct copy; + /// it is defined only to provide the same interface as other + /// specializations of the sf::Utf<> template, and allow + /// generic code to be written on top of it. + /// + /// \param begin Iterator pointing to the beginning of the input sequence + /// \param end Iterator pointing to the end of the input sequence + /// \param output Iterator pointing to the beginning of the output sequence + /// + /// \return Iterator to the end of the output sequence which has been written + /// + //////////////////////////////////////////////////////////// + template + static Out toUtf32(In begin, In end, Out output); + + //////////////////////////////////////////////////////////// + /// \brief Decode a single ANSI character to UTF-32 + /// + /// This function does not exist in other specializations + /// of sf::Utf<>, it is defined for convenience (it is used by + /// several other conversion functions). + /// + /// \param input Input ANSI character + /// \param locale Locale to use for conversion + /// + /// \return Converted character + /// + //////////////////////////////////////////////////////////// + template + static Uint32 decodeAnsi(In input, const std::locale& locale = std::locale()); + + //////////////////////////////////////////////////////////// + /// \brief Decode a single wide character to UTF-32 + /// + /// This function does not exist in other specializations + /// of sf::Utf<>, it is defined for convenience (it is used by + /// several other conversion functions). + /// + /// \param input Input wide character + /// + /// \return Converted character + /// + //////////////////////////////////////////////////////////// + template + static Uint32 decodeWide(In input); + + //////////////////////////////////////////////////////////// + /// \brief Encode a single UTF-32 character to ANSI + /// + /// This function does not exist in other specializations + /// of sf::Utf<>, it is defined for convenience (it is used by + /// several other conversion functions). + /// + /// \param codepoint Iterator pointing to the beginning of the input sequence + /// \param output Iterator pointing to the beginning of the output sequence + /// \param replacement Replacement if the input character is not convertible to ANSI (use 0 to skip it) + /// \param locale Locale to use for conversion + /// + /// \return Iterator to the end of the output sequence which has been written + /// + //////////////////////////////////////////////////////////// + template + static Out encodeAnsi(Uint32 codepoint, Out output, char replacement = 0, const std::locale& locale = std::locale()); + + //////////////////////////////////////////////////////////// + /// \brief Encode a single UTF-32 character to wide + /// + /// This function does not exist in other specializations + /// of sf::Utf<>, it is defined for convenience (it is used by + /// several other conversion functions). + /// + /// \param codepoint Iterator pointing to the beginning of the input sequence + /// \param output Iterator pointing to the beginning of the output sequence + /// \param replacement Replacement if the input character is not convertible to wide (use 0 to skip it) + /// + /// \return Iterator to the end of the output sequence which has been written + /// + //////////////////////////////////////////////////////////// + template + static Out encodeWide(Uint32 codepoint, Out output, wchar_t replacement = 0); +}; + +#include + +// Make typedefs to get rid of the template syntax +typedef Utf<8> Utf8; +typedef Utf<16> Utf16; +typedef Utf<32> Utf32; + +} // namespace sf + + +#endif // SFML_UTF_HPP + + +//////////////////////////////////////////////////////////// +/// \class sf::Utf +/// \ingroup system +/// +/// Utility class providing generic functions for UTF conversions. +/// +/// sf::Utf is a low-level, generic interface for counting, iterating, +/// encoding and decoding Unicode characters and strings. It is able +/// to handle ANSI, wide, latin-1, UTF-8, UTF-16 and UTF-32 encodings. +/// +/// sf::Utf functions are all static, these classes are not meant to +/// be instantiated. All the functions are template, so that you +/// can use any character / string type for a given encoding. +/// +/// It has 3 specializations: +/// \li sf::Utf<8> (typedef'd to sf::Utf8) +/// \li sf::Utf<16> (typedef'd to sf::Utf16) +/// \li sf::Utf<32> (typedef'd to sf::Utf32) +/// +//////////////////////////////////////////////////////////// diff --git a/mcclone/external/sfml23/include/SFML/System/Utf.inl b/mcclone/external/sfml23/include/SFML/System/Utf.inl new file mode 100644 index 0000000..a69ca07 --- /dev/null +++ b/mcclone/external/sfml23/include/SFML/System/Utf.inl @@ -0,0 +1,752 @@ +//////////////////////////////////////////////////////////// +// +// SFML - Simple and Fast Multimedia Library +// Copyright (C) 2007-2015 Laurent Gomila (laurent@sfml-dev.org) +// +// This software is provided 'as-is', without any express or implied warranty. +// In no event will the authors be held liable for any damages arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it freely, +// subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; +// you must not claim that you wrote the original software. +// If you use this software in a product, an acknowledgment +// in the product documentation would be appreciated but is not required. +// +// 2. Altered source versions must be plainly marked as such, +// and must not be misrepresented as being the original software. +// +// 3. This notice may not be removed or altered from any source distribution. +// +//////////////////////////////////////////////////////////// + + +//////////////////////////////////////////////////////////// +// References: +// +// http://www.unicode.org/ +// http://www.unicode.org/Public/PROGRAMS/CVTUTF/ConvertUTF.c +// http://www.unicode.org/Public/PROGRAMS/CVTUTF/ConvertUTF.h +// http://people.w3.org/rishida/scripts/uniview/conversion +// +//////////////////////////////////////////////////////////// + + +//////////////////////////////////////////////////////////// +template +In Utf<8>::decode(In begin, In end, Uint32& output, Uint32 replacement) +{ + // Some useful precomputed data + static const int trailing[256] = + { + 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, + 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, + 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, + 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, + 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, + 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, + 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, + 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 3, 3, 3, 3, 3, 3, 3, 3, 4, 4, 4, 4, 5, 5, 5, 5 + }; + static const Uint32 offsets[6] = + { + 0x00000000, 0x00003080, 0x000E2080, 0x03C82080, 0xFA082080, 0x82082080 + }; + + // decode the character + int trailingBytes = trailing[static_cast(*begin)]; + if (begin + trailingBytes < end) + { + output = 0; + switch (trailingBytes) + { + case 5: output += static_cast(*begin++); output <<= 6; + case 4: output += static_cast(*begin++); output <<= 6; + case 3: output += static_cast(*begin++); output <<= 6; + case 2: output += static_cast(*begin++); output <<= 6; + case 1: output += static_cast(*begin++); output <<= 6; + case 0: output += static_cast(*begin++); + } + output -= offsets[trailingBytes]; + } + else + { + // Incomplete character + begin = end; + output = replacement; + } + + return begin; +} + + +//////////////////////////////////////////////////////////// +template +Out Utf<8>::encode(Uint32 input, Out output, Uint8 replacement) +{ + // Some useful precomputed data + static const Uint8 firstBytes[7] = + { + 0x00, 0x00, 0xC0, 0xE0, 0xF0, 0xF8, 0xFC + }; + + // encode the character + if ((input > 0x0010FFFF) || ((input >= 0xD800) && (input <= 0xDBFF))) + { + // Invalid character + if (replacement) + *output++ = replacement; + } + else + { + // Valid character + + // Get the number of bytes to write + std::size_t bytestoWrite = 1; + if (input < 0x80) bytestoWrite = 1; + else if (input < 0x800) bytestoWrite = 2; + else if (input < 0x10000) bytestoWrite = 3; + else if (input <= 0x0010FFFF) bytestoWrite = 4; + + // Extract the bytes to write + Uint8 bytes[4]; + switch (bytestoWrite) + { + case 4: bytes[3] = static_cast((input | 0x80) & 0xBF); input >>= 6; + case 3: bytes[2] = static_cast((input | 0x80) & 0xBF); input >>= 6; + case 2: bytes[1] = static_cast((input | 0x80) & 0xBF); input >>= 6; + case 1: bytes[0] = static_cast (input | firstBytes[bytestoWrite]); + } + + // Add them to the output + output = std::copy(bytes, bytes + bytestoWrite, output); + } + + return output; +} + + +//////////////////////////////////////////////////////////// +template +In Utf<8>::next(In begin, In end) +{ + Uint32 codepoint; + return decode(begin, end, codepoint); +} + + +//////////////////////////////////////////////////////////// +template +std::size_t Utf<8>::count(In begin, In end) +{ + std::size_t length = 0; + while (begin < end) + { + begin = next(begin, end); + ++length; + } + + return length; +} + + +//////////////////////////////////////////////////////////// +template +Out Utf<8>::fromAnsi(In begin, In end, Out output, const std::locale& locale) +{ + while (begin < end) + { + Uint32 codepoint = Utf<32>::decodeAnsi(*begin++, locale); + output = encode(codepoint, output); + } + + return output; +} + + +//////////////////////////////////////////////////////////// +template +Out Utf<8>::fromWide(In begin, In end, Out output) +{ + while (begin < end) + { + Uint32 codepoint = Utf<32>::decodeWide(*begin++); + output = encode(codepoint, output); + } + + return output; +} + + +//////////////////////////////////////////////////////////// +template +Out Utf<8>::fromLatin1(In begin, In end, Out output) +{ + // Latin-1 is directly compatible with Unicode encodings, + // and can thus be treated as (a sub-range of) UTF-32 + while (begin < end) + output = encode(*begin++, output); + + return output; +} + + +//////////////////////////////////////////////////////////// +template +Out Utf<8>::toAnsi(In begin, In end, Out output, char replacement, const std::locale& locale) +{ + while (begin < end) + { + Uint32 codepoint; + begin = decode(begin, end, codepoint); + output = Utf<32>::encodeAnsi(codepoint, output, replacement, locale); + } + + return output; +} + + +//////////////////////////////////////////////////////////// +template +Out Utf<8>::toWide(In begin, In end, Out output, wchar_t replacement) +{ + while (begin < end) + { + Uint32 codepoint; + begin = decode(begin, end, codepoint); + output = Utf<32>::encodeWide(codepoint, output, replacement); + } + + return output; +} + + +//////////////////////////////////////////////////////////// +template +Out Utf<8>::toLatin1(In begin, In end, Out output, char replacement) +{ + // Latin-1 is directly compatible with Unicode encodings, + // and can thus be treated as (a sub-range of) UTF-32 + while (begin < end) + { + Uint32 codepoint; + begin = decode(begin, end, codepoint); + *output++ = codepoint < 256 ? static_cast(codepoint) : replacement; + } + + return output; +} + + +//////////////////////////////////////////////////////////// +template +Out Utf<8>::toUtf8(In begin, In end, Out output) +{ + return std::copy(begin, end, output); +} + + +//////////////////////////////////////////////////////////// +template +Out Utf<8>::toUtf16(In begin, In end, Out output) +{ + while (begin < end) + { + Uint32 codepoint; + begin = decode(begin, end, codepoint); + output = Utf<16>::encode(codepoint, output); + } + + return output; +} + + +//////////////////////////////////////////////////////////// +template +Out Utf<8>::toUtf32(In begin, In end, Out output) +{ + while (begin < end) + { + Uint32 codepoint; + begin = decode(begin, end, codepoint); + *output++ = codepoint; + } + + return output; +} + + +//////////////////////////////////////////////////////////// +template +In Utf<16>::decode(In begin, In end, Uint32& output, Uint32 replacement) +{ + Uint16 first = *begin++; + + // If it's a surrogate pair, first convert to a single UTF-32 character + if ((first >= 0xD800) && (first <= 0xDBFF)) + { + if (begin < end) + { + Uint32 second = *begin++; + if ((second >= 0xDC00) && (second <= 0xDFFF)) + { + // The second element is valid: convert the two elements to a UTF-32 character + output = static_cast(((first - 0xD800) << 10) + (second - 0xDC00) + 0x0010000); + } + else + { + // Invalid character + output = replacement; + } + } + else + { + // Invalid character + begin = end; + output = replacement; + } + } + else + { + // We can make a direct copy + output = first; + } + + return begin; +} + + +//////////////////////////////////////////////////////////// +template +Out Utf<16>::encode(Uint32 input, Out output, Uint16 replacement) +{ + if (input < 0xFFFF) + { + // The character can be copied directly, we just need to check if it's in the valid range + if ((input >= 0xD800) && (input <= 0xDFFF)) + { + // Invalid character (this range is reserved) + if (replacement) + *output++ = replacement; + } + else + { + // Valid character directly convertible to a single UTF-16 character + *output++ = static_cast(input); + } + } + else if (input > 0x0010FFFF) + { + // Invalid character (greater than the maximum Unicode value) + if (replacement) + *output++ = replacement; + } + else + { + // The input character will be converted to two UTF-16 elements + input -= 0x0010000; + *output++ = static_cast((input >> 10) + 0xD800); + *output++ = static_cast((input & 0x3FFUL) + 0xDC00); + } + + return output; +} + + +//////////////////////////////////////////////////////////// +template +In Utf<16>::next(In begin, In end) +{ + Uint32 codepoint; + return decode(begin, end, codepoint); +} + + +//////////////////////////////////////////////////////////// +template +std::size_t Utf<16>::count(In begin, In end) +{ + std::size_t length = 0; + while (begin < end) + { + begin = next(begin, end); + ++length; + } + + return length; +} + + +//////////////////////////////////////////////////////////// +template +Out Utf<16>::fromAnsi(In begin, In end, Out output, const std::locale& locale) +{ + while (begin < end) + { + Uint32 codepoint = Utf<32>::decodeAnsi(*begin++, locale); + output = encode(codepoint, output); + } + + return output; +} + + +//////////////////////////////////////////////////////////// +template +Out Utf<16>::fromWide(In begin, In end, Out output) +{ + while (begin < end) + { + Uint32 codepoint = Utf<32>::decodeWide(*begin++); + output = encode(codepoint, output); + } + + return output; +} + + +//////////////////////////////////////////////////////////// +template +Out Utf<16>::fromLatin1(In begin, In end, Out output) +{ + // Latin-1 is directly compatible with Unicode encodings, + // and can thus be treated as (a sub-range of) UTF-32 + return std::copy(begin, end, output); +} + + +//////////////////////////////////////////////////////////// +template +Out Utf<16>::toAnsi(In begin, In end, Out output, char replacement, const std::locale& locale) +{ + while (begin < end) + { + Uint32 codepoint; + begin = decode(begin, end, codepoint); + output = Utf<32>::encodeAnsi(codepoint, output, replacement, locale); + } + + return output; +} + + +//////////////////////////////////////////////////////////// +template +Out Utf<16>::toWide(In begin, In end, Out output, wchar_t replacement) +{ + while (begin < end) + { + Uint32 codepoint; + begin = decode(begin, end, codepoint); + output = Utf<32>::encodeWide(codepoint, output, replacement); + } + + return output; +} + + +//////////////////////////////////////////////////////////// +template +Out Utf<16>::toLatin1(In begin, In end, Out output, char replacement) +{ + // Latin-1 is directly compatible with Unicode encodings, + // and can thus be treated as (a sub-range of) UTF-32 + while (begin < end) + { + *output++ = *begin < 256 ? static_cast(*begin) : replacement; + begin++; + } + + return output; +} + + +//////////////////////////////////////////////////////////// +template +Out Utf<16>::toUtf8(In begin, In end, Out output) +{ + while (begin < end) + { + Uint32 codepoint; + begin = decode(begin, end, codepoint); + output = Utf<8>::encode(codepoint, output); + } + + return output; +} + + +//////////////////////////////////////////////////////////// +template +Out Utf<16>::toUtf16(In begin, In end, Out output) +{ + return std::copy(begin, end, output); +} + + +//////////////////////////////////////////////////////////// +template +Out Utf<16>::toUtf32(In begin, In end, Out output) +{ + while (begin < end) + { + Uint32 codepoint; + begin = decode(begin, end, codepoint); + *output++ = codepoint; + } + + return output; +} + + +//////////////////////////////////////////////////////////// +template +In Utf<32>::decode(In begin, In /*end*/, Uint32& output, Uint32 /*replacement*/) +{ + output = *begin++; + return begin; +} + + +//////////////////////////////////////////////////////////// +template +Out Utf<32>::encode(Uint32 input, Out output, Uint32 /*replacement*/) +{ + *output++ = input; + return output; +} + + +//////////////////////////////////////////////////////////// +template +In Utf<32>::next(In begin, In /*end*/) +{ + return ++begin; +} + + +//////////////////////////////////////////////////////////// +template +std::size_t Utf<32>::count(In begin, In end) +{ + return begin - end; +} + + +//////////////////////////////////////////////////////////// +template +Out Utf<32>::fromAnsi(In begin, In end, Out output, const std::locale& locale) +{ + while (begin < end) + *output++ = decodeAnsi(*begin++, locale); + + return output; +} + + +//////////////////////////////////////////////////////////// +template +Out Utf<32>::fromWide(In begin, In end, Out output) +{ + while (begin < end) + *output++ = decodeWide(*begin++); + + return output; +} + + +//////////////////////////////////////////////////////////// +template +Out Utf<32>::fromLatin1(In begin, In end, Out output) +{ + // Latin-1 is directly compatible with Unicode encodings, + // and can thus be treated as (a sub-range of) UTF-32 + return std::copy(begin, end, output); +} + + +//////////////////////////////////////////////////////////// +template +Out Utf<32>::toAnsi(In begin, In end, Out output, char replacement, const std::locale& locale) +{ + while (begin < end) + output = encodeAnsi(*begin++, output, replacement, locale); + + return output; +} + + +//////////////////////////////////////////////////////////// +template +Out Utf<32>::toWide(In begin, In end, Out output, wchar_t replacement) +{ + while (begin < end) + output = encodeWide(*begin++, output, replacement); + + return output; +} + + +//////////////////////////////////////////////////////////// +template +Out Utf<32>::toLatin1(In begin, In end, Out output, char replacement) +{ + // Latin-1 is directly compatible with Unicode encodings, + // and can thus be treated as (a sub-range of) UTF-32 + while (begin < end) + { + *output++ = *begin < 256 ? static_cast(*begin) : replacement; + begin++; + } + + return output; +} + + +//////////////////////////////////////////////////////////// +template +Out Utf<32>::toUtf8(In begin, In end, Out output) +{ + while (begin < end) + output = Utf<8>::encode(*begin++, output); + + return output; +} + +//////////////////////////////////////////////////////////// +template +Out Utf<32>::toUtf16(In begin, In end, Out output) +{ + while (begin < end) + output = Utf<16>::encode(*begin++, output); + + return output; +} + + +//////////////////////////////////////////////////////////// +template +Out Utf<32>::toUtf32(In begin, In end, Out output) +{ + return std::copy(begin, end, output); +} + + +//////////////////////////////////////////////////////////// +template +Uint32 Utf<32>::decodeAnsi(In input, const std::locale& locale) +{ + // On Windows, GCC's standard library (glibc++) has almost + // no support for Unicode stuff. As a consequence, in this + // context we can only use the default locale and ignore + // the one passed as parameter. + + #if defined(SFML_SYSTEM_WINDOWS) && /* if Windows ... */ \ + (defined(__GLIBCPP__) || defined (__GLIBCXX__)) && /* ... and standard library is glibc++ ... */ \ + !(defined(__SGI_STL_PORT) || defined(_STLPORT_VERSION)) /* ... and STLPort is not used on top of it */ + + (void)locale; // to avoid warnings + + wchar_t character = 0; + mbtowc(&character, &input, 1); + return static_cast(character); + + #else + + // Get the facet of the locale which deals with character conversion + const std::ctype& facet = std::use_facet< std::ctype >(locale); + + // Use the facet to convert each character of the input string + return static_cast(facet.widen(input)); + + #endif +} + + +//////////////////////////////////////////////////////////// +template +Uint32 Utf<32>::decodeWide(In input) +{ + // The encoding of wide characters is not well defined and is left to the system; + // however we can safely assume that it is UCS-2 on Windows and + // UCS-4 on Unix systems. + // In both cases, a simple copy is enough (UCS-2 is a subset of UCS-4, + // and UCS-4 *is* UTF-32). + + return input; +} + + +//////////////////////////////////////////////////////////// +template +Out Utf<32>::encodeAnsi(Uint32 codepoint, Out output, char replacement, const std::locale& locale) +{ + // On Windows, gcc's standard library (glibc++) has almost + // no support for Unicode stuff. As a consequence, in this + // context we can only use the default locale and ignore + // the one passed as parameter. + + #if defined(SFML_SYSTEM_WINDOWS) && /* if Windows ... */ \ + (defined(__GLIBCPP__) || defined (__GLIBCXX__)) && /* ... and standard library is glibc++ ... */ \ + !(defined(__SGI_STL_PORT) || defined(_STLPORT_VERSION)) /* ... and STLPort is not used on top of it */ + + (void)locale; // to avoid warnings + + char character = 0; + if (wctomb(&character, static_cast(codepoint)) >= 0) + *output++ = character; + else if (replacement) + *output++ = replacement; + + return output; + + #else + + // Get the facet of the locale which deals with character conversion + const std::ctype& facet = std::use_facet< std::ctype >(locale); + + // Use the facet to convert each character of the input string + *output++ = facet.narrow(static_cast(codepoint), replacement); + + return output; + + #endif +} + + +//////////////////////////////////////////////////////////// +template +Out Utf<32>::encodeWide(Uint32 codepoint, Out output, wchar_t replacement) +{ + // The encoding of wide characters is not well defined and is left to the system; + // however we can safely assume that it is UCS-2 on Windows and + // UCS-4 on Unix systems. + // For UCS-2 we need to check if the source characters fits in (UCS-2 is a subset of UCS-4). + // For UCS-4 we can do a direct copy (UCS-4 *is* UTF-32). + + switch (sizeof(wchar_t)) + { + case 4: + { + *output++ = static_cast(codepoint); + break; + } + + default: + { + if ((codepoint <= 0xFFFF) && ((codepoint < 0xD800) || (codepoint > 0xDFFF))) + { + *output++ = static_cast(codepoint); + } + else if (replacement) + { + *output++ = replacement; + } + break; + } + } + + return output; +} diff --git a/mcclone/external/sfml23/include/SFML/System/Vector2.hpp b/mcclone/external/sfml23/include/SFML/System/Vector2.hpp new file mode 100644 index 0000000..6284026 --- /dev/null +++ b/mcclone/external/sfml23/include/SFML/System/Vector2.hpp @@ -0,0 +1,301 @@ +//////////////////////////////////////////////////////////// +// +// SFML - Simple and Fast Multimedia Library +// Copyright (C) 2007-2015 Laurent Gomila (laurent@sfml-dev.org) +// +// This software is provided 'as-is', without any express or implied warranty. +// In no event will the authors be held liable for any damages arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it freely, +// subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; +// you must not claim that you wrote the original software. +// If you use this software in a product, an acknowledgment +// in the product documentation would be appreciated but is not required. +// +// 2. Altered source versions must be plainly marked as such, +// and must not be misrepresented as being the original software. +// +// 3. This notice may not be removed or altered from any source distribution. +// +//////////////////////////////////////////////////////////// + +#ifndef SFML_VECTOR2_HPP +#define SFML_VECTOR2_HPP + + +namespace sf +{ +//////////////////////////////////////////////////////////// +/// \brief Utility template class for manipulating +/// 2-dimensional vectors +/// +//////////////////////////////////////////////////////////// +template +class Vector2 +{ +public: + + //////////////////////////////////////////////////////////// + /// \brief Default constructor + /// + /// Creates a Vector2(0, 0). + /// + //////////////////////////////////////////////////////////// + Vector2(); + + //////////////////////////////////////////////////////////// + /// \brief Construct the vector from its coordinates + /// + /// \param X X coordinate + /// \param Y Y coordinate + /// + //////////////////////////////////////////////////////////// + Vector2(T X, T Y); + + //////////////////////////////////////////////////////////// + /// \brief Construct the vector from another type of vector + /// + /// This constructor doesn't replace the copy constructor, + /// it's called only when U != T. + /// A call to this constructor will fail to compile if U + /// is not convertible to T. + /// + /// \param vector Vector to convert + /// + //////////////////////////////////////////////////////////// + template + explicit Vector2(const Vector2& vector); + + //////////////////////////////////////////////////////////// + // Member data + //////////////////////////////////////////////////////////// + T x; ///< X coordinate of the vector + T y; ///< Y coordinate of the vector +}; + +//////////////////////////////////////////////////////////// +/// \relates Vector2 +/// \brief Overload of unary operator - +/// +/// \param right Vector to negate +/// +/// \return Memberwise opposite of the vector +/// +//////////////////////////////////////////////////////////// +template +Vector2 operator -(const Vector2& right); + +//////////////////////////////////////////////////////////// +/// \relates Vector2 +/// \brief Overload of binary operator += +/// +/// This operator performs a memberwise addition of both vectors, +/// and assigns the result to \a left. +/// +/// \param left Left operand (a vector) +/// \param right Right operand (a vector) +/// +/// \return Reference to \a left +/// +//////////////////////////////////////////////////////////// +template +Vector2& operator +=(Vector2& left, const Vector2& right); + +//////////////////////////////////////////////////////////// +/// \relates Vector2 +/// \brief Overload of binary operator -= +/// +/// This operator performs a memberwise subtraction of both vectors, +/// and assigns the result to \a left. +/// +/// \param left Left operand (a vector) +/// \param right Right operand (a vector) +/// +/// \return Reference to \a left +/// +//////////////////////////////////////////////////////////// +template +Vector2& operator -=(Vector2& left, const Vector2& right); + +//////////////////////////////////////////////////////////// +/// \relates Vector2 +/// \brief Overload of binary operator + +/// +/// \param left Left operand (a vector) +/// \param right Right operand (a vector) +/// +/// \return Memberwise addition of both vectors +/// +//////////////////////////////////////////////////////////// +template +Vector2 operator +(const Vector2& left, const Vector2& right); + +//////////////////////////////////////////////////////////// +/// \relates Vector2 +/// \brief Overload of binary operator - +/// +/// \param left Left operand (a vector) +/// \param right Right operand (a vector) +/// +/// \return Memberwise subtraction of both vectors +/// +//////////////////////////////////////////////////////////// +template +Vector2 operator -(const Vector2& left, const Vector2& right); + +//////////////////////////////////////////////////////////// +/// \relates Vector2 +/// \brief Overload of binary operator * +/// +/// \param left Left operand (a vector) +/// \param right Right operand (a scalar value) +/// +/// \return Memberwise multiplication by \a right +/// +//////////////////////////////////////////////////////////// +template +Vector2 operator *(const Vector2& left, T right); + +//////////////////////////////////////////////////////////// +/// \relates Vector2 +/// \brief Overload of binary operator * +/// +/// \param left Left operand (a scalar value) +/// \param right Right operand (a vector) +/// +/// \return Memberwise multiplication by \a left +/// +//////////////////////////////////////////////////////////// +template +Vector2 operator *(T left, const Vector2& right); + +//////////////////////////////////////////////////////////// +/// \relates Vector2 +/// \brief Overload of binary operator *= +/// +/// This operator performs a memberwise multiplication by \a right, +/// and assigns the result to \a left. +/// +/// \param left Left operand (a vector) +/// \param right Right operand (a scalar value) +/// +/// \return Reference to \a left +/// +//////////////////////////////////////////////////////////// +template +Vector2& operator *=(Vector2& left, T right); + +//////////////////////////////////////////////////////////// +/// \relates Vector2 +/// \brief Overload of binary operator / +/// +/// \param left Left operand (a vector) +/// \param right Right operand (a scalar value) +/// +/// \return Memberwise division by \a right +/// +//////////////////////////////////////////////////////////// +template +Vector2 operator /(const Vector2& left, T right); + +//////////////////////////////////////////////////////////// +/// \relates Vector2 +/// \brief Overload of binary operator /= +/// +/// This operator performs a memberwise division by \a right, +/// and assigns the result to \a left. +/// +/// \param left Left operand (a vector) +/// \param right Right operand (a scalar value) +/// +/// \return Reference to \a left +/// +//////////////////////////////////////////////////////////// +template +Vector2& operator /=(Vector2& left, T right); + +//////////////////////////////////////////////////////////// +/// \relates Vector2 +/// \brief Overload of binary operator == +/// +/// This operator compares strict equality between two vectors. +/// +/// \param left Left operand (a vector) +/// \param right Right operand (a vector) +/// +/// \return True if \a left is equal to \a right +/// +//////////////////////////////////////////////////////////// +template +bool operator ==(const Vector2& left, const Vector2& right); + +//////////////////////////////////////////////////////////// +/// \relates Vector2 +/// \brief Overload of binary operator != +/// +/// This operator compares strict difference between two vectors. +/// +/// \param left Left operand (a vector) +/// \param right Right operand (a vector) +/// +/// \return True if \a left is not equal to \a right +/// +//////////////////////////////////////////////////////////// +template +bool operator !=(const Vector2& left, const Vector2& right); + +#include + +// Define the most common types +typedef Vector2 Vector2i; +typedef Vector2 Vector2u; +typedef Vector2 Vector2f; + +} // namespace sf + + +#endif // SFML_VECTOR2_HPP + + +//////////////////////////////////////////////////////////// +/// \class sf::Vector2 +/// \ingroup system +/// +/// sf::Vector2 is a simple class that defines a mathematical +/// vector with two coordinates (x and y). It can be used to +/// represent anything that has two dimensions: a size, a point, +/// a velocity, etc. +/// +/// The template parameter T is the type of the coordinates. It +/// can be any type that supports arithmetic operations (+, -, /, *) +/// and comparisons (==, !=), for example int or float. +/// +/// You generally don't have to care about the templated form (sf::Vector2), +/// the most common specializations have special typedefs: +/// \li sf::Vector2 is sf::Vector2f +/// \li sf::Vector2 is sf::Vector2i +/// \li sf::Vector2 is sf::Vector2u +/// +/// The sf::Vector2 class has a small and simple interface, its x and y members +/// can be accessed directly (there are no accessors like setX(), getX()) and it +/// contains no mathematical function like dot product, cross product, length, etc. +/// +/// Usage example: +/// \code +/// sf::Vector2f v1(16.5f, 24.f); +/// v1.x = 18.2f; +/// float y = v1.y; +/// +/// sf::Vector2f v2 = v1 * 5.f; +/// sf::Vector2f v3; +/// v3 = v1 + v2; +/// +/// bool different = (v2 != v3); +/// \endcode +/// +/// Note: for 3-dimensional vectors, see sf::Vector3. +/// +//////////////////////////////////////////////////////////// diff --git a/mcclone/external/sfml23/include/SFML/System/Vector2.inl b/mcclone/external/sfml23/include/SFML/System/Vector2.inl new file mode 100644 index 0000000..5cc67ca --- /dev/null +++ b/mcclone/external/sfml23/include/SFML/System/Vector2.inl @@ -0,0 +1,161 @@ +//////////////////////////////////////////////////////////// +// +// SFML - Simple and Fast Multimedia Library +// Copyright (C) 2007-2015 Laurent Gomila (laurent@sfml-dev.org) +// +// This software is provided 'as-is', without any express or implied warranty. +// In no event will the authors be held liable for any damages arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it freely, +// subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; +// you must not claim that you wrote the original software. +// If you use this software in a product, an acknowledgment +// in the product documentation would be appreciated but is not required. +// +// 2. Altered source versions must be plainly marked as such, +// and must not be misrepresented as being the original software. +// +// 3. This notice may not be removed or altered from any source distribution. +// +//////////////////////////////////////////////////////////// + + +//////////////////////////////////////////////////////////// +template +inline Vector2::Vector2() : +x(0), +y(0) +{ + +} + + +//////////////////////////////////////////////////////////// +template +inline Vector2::Vector2(T X, T Y) : +x(X), +y(Y) +{ + +} + + +//////////////////////////////////////////////////////////// +template +template +inline Vector2::Vector2(const Vector2& vector) : +x(static_cast(vector.x)), +y(static_cast(vector.y)) +{ +} + + +//////////////////////////////////////////////////////////// +template +inline Vector2 operator -(const Vector2& right) +{ + return Vector2(-right.x, -right.y); +} + + +//////////////////////////////////////////////////////////// +template +inline Vector2& operator +=(Vector2& left, const Vector2& right) +{ + left.x += right.x; + left.y += right.y; + + return left; +} + + +//////////////////////////////////////////////////////////// +template +inline Vector2& operator -=(Vector2& left, const Vector2& right) +{ + left.x -= right.x; + left.y -= right.y; + + return left; +} + + +//////////////////////////////////////////////////////////// +template +inline Vector2 operator +(const Vector2& left, const Vector2& right) +{ + return Vector2(left.x + right.x, left.y + right.y); +} + + +//////////////////////////////////////////////////////////// +template +inline Vector2 operator -(const Vector2& left, const Vector2& right) +{ + return Vector2(left.x - right.x, left.y - right.y); +} + + +//////////////////////////////////////////////////////////// +template +inline Vector2 operator *(const Vector2& left, T right) +{ + return Vector2(left.x * right, left.y * right); +} + + +//////////////////////////////////////////////////////////// +template +inline Vector2 operator *(T left, const Vector2& right) +{ + return Vector2(right.x * left, right.y * left); +} + + +//////////////////////////////////////////////////////////// +template +inline Vector2& operator *=(Vector2& left, T right) +{ + left.x *= right; + left.y *= right; + + return left; +} + + +//////////////////////////////////////////////////////////// +template +inline Vector2 operator /(const Vector2& left, T right) +{ + return Vector2(left.x / right, left.y / right); +} + + +//////////////////////////////////////////////////////////// +template +inline Vector2& operator /=(Vector2& left, T right) +{ + left.x /= right; + left.y /= right; + + return left; +} + + +//////////////////////////////////////////////////////////// +template +inline bool operator ==(const Vector2& left, const Vector2& right) +{ + return (left.x == right.x) && (left.y == right.y); +} + + +//////////////////////////////////////////////////////////// +template +inline bool operator !=(const Vector2& left, const Vector2& right) +{ + return (left.x != right.x) || (left.y != right.y); +} diff --git a/mcclone/external/sfml23/include/SFML/System/Vector3.hpp b/mcclone/external/sfml23/include/SFML/System/Vector3.hpp new file mode 100644 index 0000000..51704b8 --- /dev/null +++ b/mcclone/external/sfml23/include/SFML/System/Vector3.hpp @@ -0,0 +1,302 @@ +//////////////////////////////////////////////////////////// +// +// SFML - Simple and Fast Multimedia Library +// Copyright (C) 2007-2015 Laurent Gomila (laurent@sfml-dev.org) +// +// This software is provided 'as-is', without any express or implied warranty. +// In no event will the authors be held liable for any damages arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it freely, +// subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; +// you must not claim that you wrote the original software. +// If you use this software in a product, an acknowledgment +// in the product documentation would be appreciated but is not required. +// +// 2. Altered source versions must be plainly marked as such, +// and must not be misrepresented as being the original software. +// +// 3. This notice may not be removed or altered from any source distribution. +// +//////////////////////////////////////////////////////////// + +#ifndef SFML_VECTOR3_HPP +#define SFML_VECTOR3_HPP + + +namespace sf +{ +//////////////////////////////////////////////////////////// +/// \brief Utility template class for manipulating +/// 3-dimensional vectors +/// +//////////////////////////////////////////////////////////// +template +class Vector3 +{ +public: + + //////////////////////////////////////////////////////////// + /// \brief Default constructor + /// + /// Creates a Vector3(0, 0, 0). + /// + //////////////////////////////////////////////////////////// + Vector3(); + + //////////////////////////////////////////////////////////// + /// \brief Construct the vector from its coordinates + /// + /// \param X X coordinate + /// \param Y Y coordinate + /// \param Z Z coordinate + /// + //////////////////////////////////////////////////////////// + Vector3(T X, T Y, T Z); + + //////////////////////////////////////////////////////////// + /// \brief Construct the vector from another type of vector + /// + /// This constructor doesn't replace the copy constructor, + /// it's called only when U != T. + /// A call to this constructor will fail to compile if U + /// is not convertible to T. + /// + /// \param vector Vector to convert + /// + //////////////////////////////////////////////////////////// + template + explicit Vector3(const Vector3& vector); + + //////////////////////////////////////////////////////////// + // Member data + //////////////////////////////////////////////////////////// + T x; ///< X coordinate of the vector + T y; ///< Y coordinate of the vector + T z; ///< Z coordinate of the vector +}; + +//////////////////////////////////////////////////////////// +/// \relates Vector3 +/// \brief Overload of unary operator - +/// +/// \param left Vector to negate +/// +/// \return Memberwise opposite of the vector +/// +//////////////////////////////////////////////////////////// +template +Vector3 operator -(const Vector3& left); + +//////////////////////////////////////////////////////////// +/// \relates Vector3 +/// \brief Overload of binary operator += +/// +/// This operator performs a memberwise addition of both vectors, +/// and assigns the result to \a left. +/// +/// \param left Left operand (a vector) +/// \param right Right operand (a vector) +/// +/// \return Reference to \a left +/// +//////////////////////////////////////////////////////////// +template +Vector3& operator +=(Vector3& left, const Vector3& right); + +//////////////////////////////////////////////////////////// +/// \relates Vector3 +/// \brief Overload of binary operator -= +/// +/// This operator performs a memberwise subtraction of both vectors, +/// and assigns the result to \a left. +/// +/// \param left Left operand (a vector) +/// \param right Right operand (a vector) +/// +/// \return Reference to \a left +/// +//////////////////////////////////////////////////////////// +template +Vector3& operator -=(Vector3& left, const Vector3& right); + +//////////////////////////////////////////////////////////// +/// \relates Vector3 +/// \brief Overload of binary operator + +/// +/// \param left Left operand (a vector) +/// \param right Right operand (a vector) +/// +/// \return Memberwise addition of both vectors +/// +//////////////////////////////////////////////////////////// +template +Vector3 operator +(const Vector3& left, const Vector3& right); + +//////////////////////////////////////////////////////////// +/// \relates Vector3 +/// \brief Overload of binary operator - +/// +/// \param left Left operand (a vector) +/// \param right Right operand (a vector) +/// +/// \return Memberwise subtraction of both vectors +/// +//////////////////////////////////////////////////////////// +template +Vector3 operator -(const Vector3& left, const Vector3& right); + +//////////////////////////////////////////////////////////// +/// \relates Vector3 +/// \brief Overload of binary operator * +/// +/// \param left Left operand (a vector) +/// \param right Right operand (a scalar value) +/// +/// \return Memberwise multiplication by \a right +/// +//////////////////////////////////////////////////////////// +template +Vector3 operator *(const Vector3& left, T right); + +//////////////////////////////////////////////////////////// +/// \relates Vector3 +/// \brief Overload of binary operator * +/// +/// \param left Left operand (a scalar value) +/// \param right Right operand (a vector) +/// +/// \return Memberwise multiplication by \a left +/// +//////////////////////////////////////////////////////////// +template +Vector3 operator *(T left, const Vector3& right); + +//////////////////////////////////////////////////////////// +/// \relates Vector3 +/// \brief Overload of binary operator *= +/// +/// This operator performs a memberwise multiplication by \a right, +/// and assigns the result to \a left. +/// +/// \param left Left operand (a vector) +/// \param right Right operand (a scalar value) +/// +/// \return Reference to \a left +/// +//////////////////////////////////////////////////////////// +template +Vector3& operator *=(Vector3& left, T right); + +//////////////////////////////////////////////////////////// +/// \relates Vector3 +/// \brief Overload of binary operator / +/// +/// \param left Left operand (a vector) +/// \param right Right operand (a scalar value) +/// +/// \return Memberwise division by \a right +/// +//////////////////////////////////////////////////////////// +template +Vector3 operator /(const Vector3& left, T right); + +//////////////////////////////////////////////////////////// +/// \relates Vector3 +/// \brief Overload of binary operator /= +/// +/// This operator performs a memberwise division by \a right, +/// and assigns the result to \a left. +/// +/// \param left Left operand (a vector) +/// \param right Right operand (a scalar value) +/// +/// \return Reference to \a left +/// +//////////////////////////////////////////////////////////// +template +Vector3& operator /=(Vector3& left, T right); + +//////////////////////////////////////////////////////////// +/// \relates Vector3 +/// \brief Overload of binary operator == +/// +/// This operator compares strict equality between two vectors. +/// +/// \param left Left operand (a vector) +/// \param right Right operand (a vector) +/// +/// \return True if \a left is equal to \a right +/// +//////////////////////////////////////////////////////////// +template +bool operator ==(const Vector3& left, const Vector3& right); + +//////////////////////////////////////////////////////////// +/// \relates Vector3 +/// \brief Overload of binary operator != +/// +/// This operator compares strict difference between two vectors. +/// +/// \param left Left operand (a vector) +/// \param right Right operand (a vector) +/// +/// \return True if \a left is not equal to \a right +/// +//////////////////////////////////////////////////////////// +template +bool operator !=(const Vector3& left, const Vector3& right); + +#include + +// Define the most common types +typedef Vector3 Vector3i; +typedef Vector3 Vector3f; + +} // namespace sf + + +#endif // SFML_VECTOR3_HPP + + +//////////////////////////////////////////////////////////// +/// \class sf::Vector3 +/// \ingroup system +/// +/// sf::Vector3 is a simple class that defines a mathematical +/// vector with three coordinates (x, y and z). It can be used to +/// represent anything that has three dimensions: a size, a point, +/// a velocity, etc. +/// +/// The template parameter T is the type of the coordinates. It +/// can be any type that supports arithmetic operations (+, -, /, *) +/// and comparisons (==, !=), for example int or float. +/// +/// You generally don't have to care about the templated form (sf::Vector3), +/// the most common specializations have special typedefs: +/// \li sf::Vector3 is sf::Vector3f +/// \li sf::Vector3 is sf::Vector3i +/// +/// The sf::Vector3 class has a small and simple interface, its x and y members +/// can be accessed directly (there are no accessors like setX(), getX()) and it +/// contains no mathematical function like dot product, cross product, length, etc. +/// +/// Usage example: +/// \code +/// sf::Vector3f v1(16.5f, 24.f, -8.2f); +/// v1.x = 18.2f; +/// float y = v1.y; +/// float z = v1.z; +/// +/// sf::Vector3f v2 = v1 * 5.f; +/// sf::Vector3f v3; +/// v3 = v1 + v2; +/// +/// bool different = (v2 != v3); +/// \endcode +/// +/// Note: for 2-dimensional vectors, see sf::Vector2. +/// +//////////////////////////////////////////////////////////// diff --git a/mcclone/external/sfml23/include/SFML/System/Vector3.inl b/mcclone/external/sfml23/include/SFML/System/Vector3.inl new file mode 100644 index 0000000..3c69f2c --- /dev/null +++ b/mcclone/external/sfml23/include/SFML/System/Vector3.inl @@ -0,0 +1,168 @@ +//////////////////////////////////////////////////////////// +// +// SFML - Simple and Fast Multimedia Library +// Copyright (C) 2007-2015 Laurent Gomila (laurent@sfml-dev.org) +// +// This software is provided 'as-is', without any express or implied warranty. +// In no event will the authors be held liable for any damages arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it freely, +// subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; +// you must not claim that you wrote the original software. +// If you use this software in a product, an acknowledgment +// in the product documentation would be appreciated but is not required. +// +// 2. Altered source versions must be plainly marked as such, +// and must not be misrepresented as being the original software. +// +// 3. This notice may not be removed or altered from any source distribution. +// +//////////////////////////////////////////////////////////// + + +//////////////////////////////////////////////////////////// +template +inline Vector3::Vector3() : +x(0), +y(0), +z(0) +{ + +} + + +//////////////////////////////////////////////////////////// +template +inline Vector3::Vector3(T X, T Y, T Z) : +x(X), +y(Y), +z(Z) +{ + +} + + +//////////////////////////////////////////////////////////// +template +template +inline Vector3::Vector3(const Vector3& vector) : +x(static_cast(vector.x)), +y(static_cast(vector.y)), +z(static_cast(vector.z)) +{ +} + + +//////////////////////////////////////////////////////////// +template +inline Vector3 operator -(const Vector3& left) +{ + return Vector3(-left.x, -left.y, -left.z); +} + + +//////////////////////////////////////////////////////////// +template +inline Vector3& operator +=(Vector3& left, const Vector3& right) +{ + left.x += right.x; + left.y += right.y; + left.z += right.z; + + return left; +} + + +//////////////////////////////////////////////////////////// +template +inline Vector3& operator -=(Vector3& left, const Vector3& right) +{ + left.x -= right.x; + left.y -= right.y; + left.z -= right.z; + + return left; +} + + +//////////////////////////////////////////////////////////// +template +inline Vector3 operator +(const Vector3& left, const Vector3& right) +{ + return Vector3(left.x + right.x, left.y + right.y, left.z + right.z); +} + + +//////////////////////////////////////////////////////////// +template +inline Vector3 operator -(const Vector3& left, const Vector3& right) +{ + return Vector3(left.x - right.x, left.y - right.y, left.z - right.z); +} + + +//////////////////////////////////////////////////////////// +template +inline Vector3 operator *(const Vector3& left, T right) +{ + return Vector3(left.x * right, left.y * right, left.z * right); +} + + +//////////////////////////////////////////////////////////// +template +inline Vector3 operator *(T left, const Vector3& right) +{ + return Vector3(right.x * left, right.y * left, right.z * left); +} + + +//////////////////////////////////////////////////////////// +template +inline Vector3& operator *=(Vector3& left, T right) +{ + left.x *= right; + left.y *= right; + left.z *= right; + + return left; +} + + +//////////////////////////////////////////////////////////// +template +inline Vector3 operator /(const Vector3& left, T right) +{ + return Vector3(left.x / right, left.y / right, left.z / right); +} + + +//////////////////////////////////////////////////////////// +template +inline Vector3& operator /=(Vector3& left, T right) +{ + left.x /= right; + left.y /= right; + left.z /= right; + + return left; +} + + +//////////////////////////////////////////////////////////// +template +inline bool operator ==(const Vector3& left, const Vector3& right) +{ + return (left.x == right.x) && (left.y == right.y) && (left.z == right.z); +} + + +//////////////////////////////////////////////////////////// +template +inline bool operator !=(const Vector3& left, const Vector3& right) +{ + return (left.x != right.x) || (left.y != right.y) || (left.z != right.z); +} diff --git a/mcclone/external/sfml23/include/SFML/Window.hpp b/mcclone/external/sfml23/include/SFML/Window.hpp new file mode 100644 index 0000000..103f888 --- /dev/null +++ b/mcclone/external/sfml23/include/SFML/Window.hpp @@ -0,0 +1,56 @@ +//////////////////////////////////////////////////////////// +// +// SFML - Simple and Fast Multimedia Library +// Copyright (C) 2007-2015 Laurent Gomila (laurent@sfml-dev.org) +// +// This software is provided 'as-is', without any express or implied warranty. +// In no event will the authors be held liable for any damages arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it freely, +// subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; +// you must not claim that you wrote the original software. +// If you use this software in a product, an acknowledgment +// in the product documentation would be appreciated but is not required. +// +// 2. Altered source versions must be plainly marked as such, +// and must not be misrepresented as being the original software. +// +// 3. This notice may not be removed or altered from any source distribution. +// +//////////////////////////////////////////////////////////// + +#ifndef SFML_SFML_WINDOW_HPP +#define SFML_SFML_WINDOW_HPP + +//////////////////////////////////////////////////////////// +// Headers +//////////////////////////////////////////////////////////// + +#include +#include +#include +#include +#include +#include +#include +#include +#include +#include +#include +#include +#include + + + +#endif // SFML_SFML_WINDOW_HPP + +//////////////////////////////////////////////////////////// +/// \defgroup window Window module +/// +/// Provides OpenGL-based windows, and abstractions for +/// events and input handling. +/// +//////////////////////////////////////////////////////////// diff --git a/mcclone/external/sfml23/include/SFML/Window/Context.hpp b/mcclone/external/sfml23/include/SFML/Window/Context.hpp new file mode 100644 index 0000000..29df67c --- /dev/null +++ b/mcclone/external/sfml23/include/SFML/Window/Context.hpp @@ -0,0 +1,151 @@ +//////////////////////////////////////////////////////////// +// +// SFML - Simple and Fast Multimedia Library +// Copyright (C) 2007-2015 Laurent Gomila (laurent@sfml-dev.org) +// +// This software is provided 'as-is', without any express or implied warranty. +// In no event will the authors be held liable for any damages arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it freely, +// subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; +// you must not claim that you wrote the original software. +// If you use this software in a product, an acknowledgment +// in the product documentation would be appreciated but is not required. +// +// 2. Altered source versions must be plainly marked as such, +// and must not be misrepresented as being the original software. +// +// 3. This notice may not be removed or altered from any source distribution. +// +//////////////////////////////////////////////////////////// + +#ifndef SFML_CONTEXT_HPP +#define SFML_CONTEXT_HPP + +//////////////////////////////////////////////////////////// +// Headers +//////////////////////////////////////////////////////////// +#include +#include +#include +#include + + +namespace sf +{ +namespace priv +{ + class GlContext; +} + +typedef void (*GlFunctionPointer)(); + +//////////////////////////////////////////////////////////// +/// \brief Class holding a valid drawing context +/// +//////////////////////////////////////////////////////////// +class SFML_WINDOW_API Context : GlResource, NonCopyable +{ +public: + + //////////////////////////////////////////////////////////// + /// \brief Default constructor + /// + /// The constructor creates and activates the context + /// + //////////////////////////////////////////////////////////// + Context(); + + //////////////////////////////////////////////////////////// + /// \brief Destructor + /// + /// The destructor deactivates and destroys the context + /// + //////////////////////////////////////////////////////////// + ~Context(); + + //////////////////////////////////////////////////////////// + /// \brief Activate or deactivate explicitly the context + /// + /// \param active True to activate, false to deactivate + /// + /// \return True on success, false on failure + /// + //////////////////////////////////////////////////////////// + bool setActive(bool active); + +public: + //////////////////////////////////////////////////////////// + /// \brief Get the address of an OpenGL function + /// + /// \param name Name of the function to get the address of + /// + /// \return Address of the OpenGL function, 0 on failure + /// + //////////////////////////////////////////////////////////// + static GlFunctionPointer getFunction(const char* name); + + //////////////////////////////////////////////////////////// + /// \brief Construct a in-memory context + /// + /// This constructor is for internal use, you don't need + /// to bother with it. + /// + /// \param settings Creation parameters + /// \param width Back buffer width + /// \param height Back buffer height + /// + //////////////////////////////////////////////////////////// + Context(const ContextSettings& settings, unsigned int width, unsigned int height); + +private: + + //////////////////////////////////////////////////////////// + // Member data + //////////////////////////////////////////////////////////// + priv::GlContext* m_context; ///< Internal OpenGL context +}; + +} // namespace sf + + +#endif // SFML_CONTEXT_HPP + +//////////////////////////////////////////////////////////// +/// \class sf::Context +/// \ingroup window +/// +/// If you need to make OpenGL calls without having an +/// active window (like in a thread), you can use an +/// instance of this class to get a valid context. +/// +/// Having a valid context is necessary for *every* OpenGL call. +/// +/// Note that a context is only active in its current thread, +/// if you create a new thread it will have no valid context +/// by default. +/// +/// To use a sf::Context instance, just construct it and let it +/// live as long as you need a valid context. No explicit activation +/// is needed, all it has to do is to exist. Its destructor +/// will take care of deactivating and freeing all the attached +/// resources. +/// +/// Usage example: +/// \code +/// void threadFunction(void*) +/// { +/// sf::Context context; +/// // from now on, you have a valid context +/// +/// // you can make OpenGL calls +/// glClear(GL_DEPTH_BUFFER_BIT); +/// } +/// // the context is automatically deactivated and destroyed +/// // by the sf::Context destructor +/// \endcode +/// +//////////////////////////////////////////////////////////// diff --git a/mcclone/external/sfml23/include/SFML/Window/ContextSettings.hpp b/mcclone/external/sfml23/include/SFML/Window/ContextSettings.hpp new file mode 100644 index 0000000..26ea910 --- /dev/null +++ b/mcclone/external/sfml23/include/SFML/Window/ContextSettings.hpp @@ -0,0 +1,145 @@ +//////////////////////////////////////////////////////////// +// +// SFML - Simple and Fast Multimedia Library +// Copyright (C) 2007-2015 Laurent Gomila (laurent@sfml-dev.org) +// +// This software is provided 'as-is', without any express or implied warranty. +// In no event will the authors be held liable for any damages arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it freely, +// subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; +// you must not claim that you wrote the original software. +// If you use this software in a product, an acknowledgment +// in the product documentation would be appreciated but is not required. +// +// 2. Altered source versions must be plainly marked as such, +// and must not be misrepresented as being the original software. +// +// 3. This notice may not be removed or altered from any source distribution. +// +//////////////////////////////////////////////////////////// + +#ifndef SFML_CONTEXTSETTINGS_HPP +#define SFML_CONTEXTSETTINGS_HPP + + +namespace sf +{ +//////////////////////////////////////////////////////////// +/// \brief Structure defining the settings of the OpenGL +/// context attached to a window +/// +//////////////////////////////////////////////////////////// +struct ContextSettings +{ + //////////////////////////////////////////////////////////// + /// \brief Enumeration of the context attribute flags + /// + //////////////////////////////////////////////////////////// + enum Attribute + { + Default = 0, ///< Non-debug, compatibility context (this and the core attribute are mutually exclusive) + Core = 1 << 0, ///< Core attribute + Debug = 1 << 2 ///< Debug attribute + }; + + //////////////////////////////////////////////////////////// + /// \brief Default constructor + /// + /// \param depth Depth buffer bits + /// \param stencil Stencil buffer bits + /// \param antialiasing Antialiasing level + /// \param major Major number of the context version + /// \param minor Minor number of the context version + /// \param attributes Attribute flags of the context + /// + //////////////////////////////////////////////////////////// + explicit ContextSettings(unsigned int depth = 0, unsigned int stencil = 0, unsigned int antialiasing = 0, unsigned int major = 1, unsigned int minor = 1, unsigned int attributes = Default) : + depthBits (depth), + stencilBits (stencil), + antialiasingLevel(antialiasing), + majorVersion (major), + minorVersion (minor), + attributeFlags (attributes) + { + } + + //////////////////////////////////////////////////////////// + // Member data + //////////////////////////////////////////////////////////// + unsigned int depthBits; ///< Bits of the depth buffer + unsigned int stencilBits; ///< Bits of the stencil buffer + unsigned int antialiasingLevel; ///< Level of antialiasing + unsigned int majorVersion; ///< Major number of the context version to create + unsigned int minorVersion; ///< Minor number of the context version to create + Uint32 attributeFlags; ///< The attribute flags to create the context with +}; + +} // namespace sf + + +#endif // SFML_CONTEXTSETTINGS_HPP + + +//////////////////////////////////////////////////////////// +/// \class sf::ContextSettings +/// \ingroup window +/// +/// ContextSettings allows to define several advanced settings +/// of the OpenGL context attached to a window. All these +/// settings with the exception of the compatibility flag +/// and anti-aliasing level have no impact on the regular +/// SFML rendering (graphics module), so you may need to use +/// this structure only if you're using SFML as a windowing +/// system for custom OpenGL rendering. +/// +/// The depthBits and stencilBits members define the number +/// of bits per pixel requested for the (respectively) depth +/// and stencil buffers. +/// +/// antialiasingLevel represents the requested number of +/// multisampling levels for anti-aliasing. +/// +/// majorVersion and minorVersion define the version of the +/// OpenGL context that you want. Only versions greater or +/// equal to 3.0 are relevant; versions lesser than 3.0 are +/// all handled the same way (i.e. you can use any version +/// < 3.0 if you don't want an OpenGL 3 context). +/// +/// When requesting a context with a version greater or equal +/// to 3.2, you have the option of specifying whether the +/// context should follow the core or compatibility profile +/// of all newer (>= 3.2) OpenGL specifications. For versions +/// 3.0 and 3.1 there is only the core profile. By default +/// a compatibility context is created. You only need to specify +/// the core flag if you want a core profile context to use with +/// your own OpenGL rendering. +/// Warning: The graphics module will not function if you +/// request a core profile context. Make sure the attributes are +/// set to Default if you want to use the graphics module. +/// +/// Setting the debug attribute flag will request a context with +/// additional debugging features enabled. Depending on the +/// system, this might be required for advanced OpenGL debugging. +/// OpenGL debugging is disabled by default. +/// +/// Special Note for OS X: +/// Apple only supports choosing between either a legacy context +/// (OpenGL 2.1) or a core context (OpenGL version depends on the +/// operating system version but is at least 3.2). Compatibility +/// contexts are not supported. Further information is available on the +/// +/// OpenGL Capabilities Tables page. OS X also currently does +/// not support debug contexts. +/// +/// Please note that these values are only a hint. +/// No failure will be reported if one or more of these values +/// are not supported by the system; instead, SFML will try to +/// find the closest valid match. You can then retrieve the +/// settings that the window actually used to create its context, +/// with Window::getSettings(). +/// +//////////////////////////////////////////////////////////// diff --git a/mcclone/external/sfml23/include/SFML/Window/Event.hpp b/mcclone/external/sfml23/include/SFML/Window/Event.hpp new file mode 100644 index 0000000..5fc9a10 --- /dev/null +++ b/mcclone/external/sfml23/include/SFML/Window/Event.hpp @@ -0,0 +1,284 @@ +//////////////////////////////////////////////////////////// +// +// SFML - Simple and Fast Multimedia Library +// Copyright (C) 2007-2015 Laurent Gomila (laurent@sfml-dev.org) +// +// This software is provided 'as-is', without any express or implied warranty. +// In no event will the authors be held liable for any damages arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it freely, +// subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; +// you must not claim that you wrote the original software. +// If you use this software in a product, an acknowledgment +// in the product documentation would be appreciated but is not required. +// +// 2. Altered source versions must be plainly marked as such, +// and must not be misrepresented as being the original software. +// +// 3. This notice may not be removed or altered from any source distribution. +// +//////////////////////////////////////////////////////////// + +#ifndef SFML_EVENT_HPP +#define SFML_EVENT_HPP + +//////////////////////////////////////////////////////////// +// Headers +//////////////////////////////////////////////////////////// +#include +#include +#include +#include +#include + + +namespace sf +{ +//////////////////////////////////////////////////////////// +/// \brief Defines a system event and its parameters +/// +//////////////////////////////////////////////////////////// +class Event +{ +public: + + //////////////////////////////////////////////////////////// + /// \brief Size events parameters (Resized) + /// + //////////////////////////////////////////////////////////// + struct SizeEvent + { + unsigned int width; ///< New width, in pixels + unsigned int height; ///< New height, in pixels + }; + + //////////////////////////////////////////////////////////// + /// \brief Keyboard event parameters (KeyPressed, KeyReleased) + /// + //////////////////////////////////////////////////////////// + struct KeyEvent + { + Keyboard::Key code; ///< Code of the key that has been pressed + bool alt; ///< Is the Alt key pressed? + bool control; ///< Is the Control key pressed? + bool shift; ///< Is the Shift key pressed? + bool system; ///< Is the System key pressed? + }; + + //////////////////////////////////////////////////////////// + /// \brief Text event parameters (TextEntered) + /// + //////////////////////////////////////////////////////////// + struct TextEvent + { + Uint32 unicode; ///< UTF-32 Unicode value of the character + }; + + //////////////////////////////////////////////////////////// + /// \brief Mouse move event parameters (MouseMoved) + /// + //////////////////////////////////////////////////////////// + struct MouseMoveEvent + { + int x; ///< X position of the mouse pointer, relative to the left of the owner window + int y; ///< Y position of the mouse pointer, relative to the top of the owner window + }; + + //////////////////////////////////////////////////////////// + /// \brief Mouse buttons events parameters + /// (MouseButtonPressed, MouseButtonReleased) + /// + //////////////////////////////////////////////////////////// + struct MouseButtonEvent + { + Mouse::Button button; ///< Code of the button that has been pressed + int x; ///< X position of the mouse pointer, relative to the left of the owner window + int y; ///< Y position of the mouse pointer, relative to the top of the owner window + }; + + //////////////////////////////////////////////////////////// + /// \brief Mouse wheel events parameters (MouseWheelMoved) + /// + /// \deprecated This event is deprecated and potentially inaccurate. + /// Use MouseWheelScrollEvent instead. + /// + //////////////////////////////////////////////////////////// + struct MouseWheelEvent + { + int delta; ///< Number of ticks the wheel has moved (positive is up, negative is down) + int x; ///< X position of the mouse pointer, relative to the left of the owner window + int y; ///< Y position of the mouse pointer, relative to the top of the owner window + }; + + //////////////////////////////////////////////////////////// + /// \brief Mouse wheel events parameters (MouseWheelScrolled) + /// + //////////////////////////////////////////////////////////// + struct MouseWheelScrollEvent + { + Mouse::Wheel wheel; ///< Which wheel (for mice with multiple ones) + float delta; ///< Wheel offset (positive is up/left, negative is down/right). High-precision mice may use non-integral offsets. + int x; ///< X position of the mouse pointer, relative to the left of the owner window + int y; ///< Y position of the mouse pointer, relative to the top of the owner window + }; + + //////////////////////////////////////////////////////////// + /// \brief Joystick connection events parameters + /// (JoystickConnected, JoystickDisconnected) + /// + //////////////////////////////////////////////////////////// + struct JoystickConnectEvent + { + unsigned int joystickId; ///< Index of the joystick (in range [0 .. Joystick::Count - 1]) + }; + + //////////////////////////////////////////////////////////// + /// \brief Joystick axis move event parameters (JoystickMoved) + /// + //////////////////////////////////////////////////////////// + struct JoystickMoveEvent + { + unsigned int joystickId; ///< Index of the joystick (in range [0 .. Joystick::Count - 1]) + Joystick::Axis axis; ///< Axis on which the joystick moved + float position; ///< New position on the axis (in range [-100 .. 100]) + }; + + //////////////////////////////////////////////////////////// + /// \brief Joystick buttons events parameters + /// (JoystickButtonPressed, JoystickButtonReleased) + /// + //////////////////////////////////////////////////////////// + struct JoystickButtonEvent + { + unsigned int joystickId; ///< Index of the joystick (in range [0 .. Joystick::Count - 1]) + unsigned int button; ///< Index of the button that has been pressed (in range [0 .. Joystick::ButtonCount - 1]) + }; + + //////////////////////////////////////////////////////////// + /// \brief Touch events parameters (TouchBegan, TouchMoved, TouchEnded) + /// + //////////////////////////////////////////////////////////// + struct TouchEvent + { + unsigned int finger; ///< Index of the finger in case of multi-touch events + int x; ///< X position of the touch, relative to the left of the owner window + int y; ///< Y position of the touch, relative to the top of the owner window + }; + + //////////////////////////////////////////////////////////// + /// \brief Sensor event parameters (SensorChanged) + /// + //////////////////////////////////////////////////////////// + struct SensorEvent + { + Sensor::Type type; ///< Type of the sensor + float x; ///< Current value of the sensor on X axis + float y; ///< Current value of the sensor on Y axis + float z; ///< Current value of the sensor on Z axis + }; + + //////////////////////////////////////////////////////////// + /// \brief Enumeration of the different types of events + /// + //////////////////////////////////////////////////////////// + enum EventType + { + Closed, ///< The window requested to be closed (no data) + Resized, ///< The window was resized (data in event.size) + LostFocus, ///< The window lost the focus (no data) + GainedFocus, ///< The window gained the focus (no data) + TextEntered, ///< A character was entered (data in event.text) + KeyPressed, ///< A key was pressed (data in event.key) + KeyReleased, ///< A key was released (data in event.key) + MouseWheelMoved, ///< The mouse wheel was scrolled (data in event.mouseWheel) (deprecated) + MouseWheelScrolled, ///< The mouse wheel was scrolled (data in event.mouseWheelScroll) + MouseButtonPressed, ///< A mouse button was pressed (data in event.mouseButton) + MouseButtonReleased, ///< A mouse button was released (data in event.mouseButton) + MouseMoved, ///< The mouse cursor moved (data in event.mouseMove) + MouseEntered, ///< The mouse cursor entered the area of the window (no data) + MouseLeft, ///< The mouse cursor left the area of the window (no data) + JoystickButtonPressed, ///< A joystick button was pressed (data in event.joystickButton) + JoystickButtonReleased, ///< A joystick button was released (data in event.joystickButton) + JoystickMoved, ///< The joystick moved along an axis (data in event.joystickMove) + JoystickConnected, ///< A joystick was connected (data in event.joystickConnect) + JoystickDisconnected, ///< A joystick was disconnected (data in event.joystickConnect) + TouchBegan, ///< A touch event began (data in event.touch) + TouchMoved, ///< A touch moved (data in event.touch) + TouchEnded, ///< A touch event ended (data in event.touch) + SensorChanged, ///< A sensor value changed (data in event.sensor) + + Count ///< Keep last -- the total number of event types + }; + + //////////////////////////////////////////////////////////// + // Member data + //////////////////////////////////////////////////////////// + EventType type; ///< Type of the event + + union + { + SizeEvent size; ///< Size event parameters (Event::Resized) + KeyEvent key; ///< Key event parameters (Event::KeyPressed, Event::KeyReleased) + TextEvent text; ///< Text event parameters (Event::TextEntered) + MouseMoveEvent mouseMove; ///< Mouse move event parameters (Event::MouseMoved) + MouseButtonEvent mouseButton; ///< Mouse button event parameters (Event::MouseButtonPressed, Event::MouseButtonReleased) + MouseWheelEvent mouseWheel; ///< Mouse wheel event parameters (Event::MouseWheelMoved) (deprecated) + MouseWheelScrollEvent mouseWheelScroll; ///< Mouse wheel event parameters (Event::MouseWheelScrolled) + JoystickMoveEvent joystickMove; ///< Joystick move event parameters (Event::JoystickMoved) + JoystickButtonEvent joystickButton; ///< Joystick button event parameters (Event::JoystickButtonPressed, Event::JoystickButtonReleased) + JoystickConnectEvent joystickConnect; ///< Joystick (dis)connect event parameters (Event::JoystickConnected, Event::JoystickDisconnected) + TouchEvent touch; ///< Touch events parameters (Event::TouchBegan, Event::TouchMoved, Event::TouchEnded) + SensorEvent sensor; ///< Sensor event parameters (Event::SensorChanged) + }; +}; + +} // namespace sf + + +#endif // SFML_EVENT_HPP + + +//////////////////////////////////////////////////////////// +/// \class sf::Event +/// \ingroup window +/// +/// sf::Event holds all the informations about a system event +/// that just happened. Events are retrieved using the +/// sf::Window::pollEvent and sf::Window::waitEvent functions. +/// +/// A sf::Event instance contains the type of the event +/// (mouse moved, key pressed, window closed, ...) as well +/// as the details about this particular event. Please note that +/// the event parameters are defined in a union, which means that +/// only the member matching the type of the event will be properly +/// filled; all other members will have undefined values and must not +/// be read if the type of the event doesn't match. For example, +/// if you received a KeyPressed event, then you must read the +/// event.key member, all other members such as event.MouseMove +/// or event.text will have undefined values. +/// +/// Usage example: +/// \code +/// sf::Event event; +/// while (window.pollEvent(event)) +/// { +/// // Request for closing the window +/// if (event.type == sf::Event::Closed) +/// window.close(); +/// +/// // The escape key was pressed +/// if ((event.type == sf::Event::KeyPressed) && (event.key.code == sf::Keyboard::Escape)) +/// window.close(); +/// +/// // The window was resized +/// if (event.type == sf::Event::Resized) +/// doSomethingWithTheNewSize(event.size.width, event.size.height); +/// +/// // etc ... +/// } +/// \endcode +/// +//////////////////////////////////////////////////////////// diff --git a/mcclone/external/sfml23/include/SFML/Window/Export.hpp b/mcclone/external/sfml23/include/SFML/Window/Export.hpp new file mode 100644 index 0000000..4a708ec --- /dev/null +++ b/mcclone/external/sfml23/include/SFML/Window/Export.hpp @@ -0,0 +1,48 @@ +//////////////////////////////////////////////////////////// +// +// SFML - Simple and Fast Multimedia Library +// Copyright (C) 2007-2015 Laurent Gomila (laurent@sfml-dev.org) +// +// This software is provided 'as-is', without any express or implied warranty. +// In no event will the authors be held liable for any damages arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it freely, +// subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; +// you must not claim that you wrote the original software. +// If you use this software in a product, an acknowledgment +// in the product documentation would be appreciated but is not required. +// +// 2. Altered source versions must be plainly marked as such, +// and must not be misrepresented as being the original software. +// +// 3. This notice may not be removed or altered from any source distribution. +// +//////////////////////////////////////////////////////////// + +#ifndef SFML_WINDOW_EXPORT_HPP +#define SFML_WINDOW_EXPORT_HPP + +//////////////////////////////////////////////////////////// +// Headers +//////////////////////////////////////////////////////////// +#include + + +//////////////////////////////////////////////////////////// +// Define portable import / export macros +//////////////////////////////////////////////////////////// +#if defined(SFML_WINDOW_EXPORTS) + + #define SFML_WINDOW_API SFML_API_EXPORT + +#else + + #define SFML_WINDOW_API SFML_API_IMPORT + +#endif + + +#endif // SFML_WINDOW_EXPORT_HPP diff --git a/mcclone/external/sfml23/include/SFML/Window/GlResource.hpp b/mcclone/external/sfml23/include/SFML/Window/GlResource.hpp new file mode 100644 index 0000000..a341f64 --- /dev/null +++ b/mcclone/external/sfml23/include/SFML/Window/GlResource.hpp @@ -0,0 +1,76 @@ +//////////////////////////////////////////////////////////// +// +// SFML - Simple and Fast Multimedia Library +// Copyright (C) 2007-2015 Laurent Gomila (laurent@sfml-dev.org) +// +// This software is provided 'as-is', without any express or implied warranty. +// In no event will the authors be held liable for any damages arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it freely, +// subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; +// you must not claim that you wrote the original software. +// If you use this software in a product, an acknowledgment +// in the product documentation would be appreciated but is not required. +// +// 2. Altered source versions must be plainly marked as such, +// and must not be misrepresented as being the original software. +// +// 3. This notice may not be removed or altered from any source distribution. +// +//////////////////////////////////////////////////////////// + +#ifndef SFML_GLRESOURCE_HPP +#define SFML_GLRESOURCE_HPP + +//////////////////////////////////////////////////////////// +// Headers +//////////////////////////////////////////////////////////// +#include + + +namespace sf +{ +//////////////////////////////////////////////////////////// +/// \brief Base class for classes that require an OpenGL context +/// +//////////////////////////////////////////////////////////// +class SFML_WINDOW_API GlResource +{ +protected: + + //////////////////////////////////////////////////////////// + /// \brief Default constructor + /// + //////////////////////////////////////////////////////////// + GlResource(); + + //////////////////////////////////////////////////////////// + /// \brief Destructor + /// + //////////////////////////////////////////////////////////// + ~GlResource(); + + //////////////////////////////////////////////////////////// + /// \brief Make sure that a valid OpenGL context exists in the current thread + /// + //////////////////////////////////////////////////////////// + static void ensureGlContext(); +}; + +} // namespace sf + + +#endif // SFML_GLRESOURCE_HPP + +//////////////////////////////////////////////////////////// +/// \class sf::GlResource +/// \ingroup window +/// +/// This class is for internal use only, it must be the base +/// of every class that requires a valid OpenGL context in +/// order to work. +/// +//////////////////////////////////////////////////////////// diff --git a/mcclone/external/sfml23/include/SFML/Window/Joystick.hpp b/mcclone/external/sfml23/include/SFML/Window/Joystick.hpp new file mode 100644 index 0000000..27f6291 --- /dev/null +++ b/mcclone/external/sfml23/include/SFML/Window/Joystick.hpp @@ -0,0 +1,227 @@ +//////////////////////////////////////////////////////////// +// +// SFML - Simple and Fast Multimedia Library +// Copyright (C) 2007-2015 Laurent Gomila (laurent@sfml-dev.org) +// +// This software is provided 'as-is', without any express or implied warranty. +// In no event will the authors be held liable for any damages arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it freely, +// subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; +// you must not claim that you wrote the original software. +// If you use this software in a product, an acknowledgment +// in the product documentation would be appreciated but is not required. +// +// 2. Altered source versions must be plainly marked as such, +// and must not be misrepresented as being the original software. +// +// 3. This notice may not be removed or altered from any source distribution. +// +//////////////////////////////////////////////////////////// + +#ifndef SFML_JOYSTICK_HPP +#define SFML_JOYSTICK_HPP + +//////////////////////////////////////////////////////////// +// Headers +//////////////////////////////////////////////////////////// +#include +#include + + +namespace sf +{ +//////////////////////////////////////////////////////////// +/// \brief Give access to the real-time state of the joysticks +/// +//////////////////////////////////////////////////////////// +class SFML_WINDOW_API Joystick +{ +public: + + //////////////////////////////////////////////////////////// + /// \brief Constants related to joysticks capabilities + /// + //////////////////////////////////////////////////////////// + enum + { + Count = 8, ///< Maximum number of supported joysticks + ButtonCount = 32, ///< Maximum number of supported buttons + AxisCount = 8 ///< Maximum number of supported axes + }; + + //////////////////////////////////////////////////////////// + /// \brief Axes supported by SFML joysticks + /// + //////////////////////////////////////////////////////////// + enum Axis + { + X, ///< The X axis + Y, ///< The Y axis + Z, ///< The Z axis + R, ///< The R axis + U, ///< The U axis + V, ///< The V axis + PovX, ///< The X axis of the point-of-view hat + PovY ///< The Y axis of the point-of-view hat + }; + + //////////////////////////////////////////////////////////// + /// \brief Structure holding a joystick's identification + /// + //////////////////////////////////////////////////////////// + struct SFML_WINDOW_API Identification + { + Identification(); + + String name; ///< Name of the joystick + unsigned int vendorId; ///< Manufacturer identifier + unsigned int productId; ///< Product identifier + }; + + //////////////////////////////////////////////////////////// + /// \brief Check if a joystick is connected + /// + /// \param joystick Index of the joystick to check + /// + /// \return True if the joystick is connected, false otherwise + /// + //////////////////////////////////////////////////////////// + static bool isConnected(unsigned int joystick); + + //////////////////////////////////////////////////////////// + /// \brief Return the number of buttons supported by a joystick + /// + /// If the joystick is not connected, this function returns 0. + /// + /// \param joystick Index of the joystick + /// + /// \return Number of buttons supported by the joystick + /// + //////////////////////////////////////////////////////////// + static unsigned int getButtonCount(unsigned int joystick); + + //////////////////////////////////////////////////////////// + /// \brief Check if a joystick supports a given axis + /// + /// If the joystick is not connected, this function returns false. + /// + /// \param joystick Index of the joystick + /// \param axis Axis to check + /// + /// \return True if the joystick supports the axis, false otherwise + /// + //////////////////////////////////////////////////////////// + static bool hasAxis(unsigned int joystick, Axis axis); + + //////////////////////////////////////////////////////////// + /// \brief Check if a joystick button is pressed + /// + /// If the joystick is not connected, this function returns false. + /// + /// \param joystick Index of the joystick + /// \param button Button to check + /// + /// \return True if the button is pressed, false otherwise + /// + //////////////////////////////////////////////////////////// + static bool isButtonPressed(unsigned int joystick, unsigned int button); + + //////////////////////////////////////////////////////////// + /// \brief Get the current position of a joystick axis + /// + /// If the joystick is not connected, this function returns 0. + /// + /// \param joystick Index of the joystick + /// \param axis Axis to check + /// + /// \return Current position of the axis, in range [-100 .. 100] + /// + //////////////////////////////////////////////////////////// + static float getAxisPosition(unsigned int joystick, Axis axis); + + //////////////////////////////////////////////////////////// + /// \brief Get the joystick information + /// + /// \param joystick Index of the joystick + /// + /// \return Structure containing joystick information. + /// + //////////////////////////////////////////////////////////// + static Identification getIdentification(unsigned int joystick); + + //////////////////////////////////////////////////////////// + /// \brief Update the states of all joysticks + /// + /// This function is used internally by SFML, so you normally + /// don't have to call it explicitly. However, you may need to + /// call it if you have no window yet (or no window at all): + /// in this case the joystick states are not updated automatically. + /// + //////////////////////////////////////////////////////////// + static void update(); +}; + +} // namespace sf + + +#endif // SFML_JOYSTICK_HPP + + +//////////////////////////////////////////////////////////// +/// \class sf::Joystick +/// \ingroup window +/// +/// sf::Joystick provides an interface to the state of the +/// joysticks. It only contains static functions, so it's not +/// meant to be instantiated. Instead, each joystick is identified +/// by an index that is passed to the functions of this class. +/// +/// This class allows users to query the state of joysticks at any +/// time and directly, without having to deal with a window and +/// its events. Compared to the JoystickMoved, JoystickButtonPressed +/// and JoystickButtonReleased events, sf::Joystick can retrieve the +/// state of axes and buttons of joysticks at any time +/// (you don't need to store and update a boolean on your side +/// in order to know if a button is pressed or released), and you +/// always get the real state of joysticks, even if they are +/// moved, pressed or released when your window is out of focus +/// and no event is triggered. +/// +/// SFML supports: +/// \li 8 joysticks (sf::Joystick::Count) +/// \li 32 buttons per joystick (sf::Joystick::ButtonCount) +/// \li 8 axes per joystick (sf::Joystick::AxisCount) +/// +/// Unlike the keyboard or mouse, the state of joysticks is sometimes +/// not directly available (depending on the OS), therefore an update() +/// function must be called in order to update the current state of +/// joysticks. When you have a window with event handling, this is done +/// automatically, you don't need to call anything. But if you have no +/// window, or if you want to check joysticks state before creating one, +/// you must call sf::Joystick::update explicitly. +/// +/// Usage example: +/// \code +/// // Is joystick #0 connected? +/// bool connected = sf::Joystick::isConnected(0); +/// +/// // How many buttons does joystick #0 support? +/// unsigned int buttons = sf::Joystick::getButtonCount(0); +/// +/// // Does joystick #0 define a X axis? +/// bool hasX = sf::Joystick::hasAxis(0, sf::Joystick::X); +/// +/// // Is button #2 pressed on joystick #0? +/// bool pressed = sf::Joystick::isButtonPressed(0, 2); +/// +/// // What's the current position of the Y axis on joystick #0? +/// float position = sf::Joystick::getAxisPosition(0, sf::Joystick::Y); +/// \endcode +/// +/// \see sf::Keyboard, sf::Mouse +/// +//////////////////////////////////////////////////////////// diff --git a/mcclone/external/sfml23/include/SFML/Window/Keyboard.hpp b/mcclone/external/sfml23/include/SFML/Window/Keyboard.hpp new file mode 100644 index 0000000..b3186e9 --- /dev/null +++ b/mcclone/external/sfml23/include/SFML/Window/Keyboard.hpp @@ -0,0 +1,224 @@ +//////////////////////////////////////////////////////////// +// +// SFML - Simple and Fast Multimedia Library +// Copyright (C) 2007-2015 Laurent Gomila (laurent@sfml-dev.org) +// +// This software is provided 'as-is', without any express or implied warranty. +// In no event will the authors be held liable for any damages arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it freely, +// subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; +// you must not claim that you wrote the original software. +// If you use this software in a product, an acknowledgment +// in the product documentation would be appreciated but is not required. +// +// 2. Altered source versions must be plainly marked as such, +// and must not be misrepresented as being the original software. +// +// 3. This notice may not be removed or altered from any source distribution. +// +//////////////////////////////////////////////////////////// + +#ifndef SFML_KEYBOARD_HPP +#define SFML_KEYBOARD_HPP + +//////////////////////////////////////////////////////////// +// Headers +//////////////////////////////////////////////////////////// +#include + + +namespace sf +{ +//////////////////////////////////////////////////////////// +/// \brief Give access to the real-time state of the keyboard +/// +//////////////////////////////////////////////////////////// +class SFML_WINDOW_API Keyboard +{ +public: + + //////////////////////////////////////////////////////////// + /// \brief Key codes + /// + //////////////////////////////////////////////////////////// + enum Key + { + Unknown = -1, ///< Unhandled key + A = 0, ///< The A key + B, ///< The B key + C, ///< The C key + D, ///< The D key + E, ///< The E key + F, ///< The F key + G, ///< The G key + H, ///< The H key + I, ///< The I key + J, ///< The J key + K, ///< The K key + L, ///< The L key + M, ///< The M key + N, ///< The N key + O, ///< The O key + P, ///< The P key + Q, ///< The Q key + R, ///< The R key + S, ///< The S key + T, ///< The T key + U, ///< The U key + V, ///< The V key + W, ///< The W key + X, ///< The X key + Y, ///< The Y key + Z, ///< The Z key + Num0, ///< The 0 key + Num1, ///< The 1 key + Num2, ///< The 2 key + Num3, ///< The 3 key + Num4, ///< The 4 key + Num5, ///< The 5 key + Num6, ///< The 6 key + Num7, ///< The 7 key + Num8, ///< The 8 key + Num9, ///< The 9 key + Escape, ///< The Escape key + LControl, ///< The left Control key + LShift, ///< The left Shift key + LAlt, ///< The left Alt key + LSystem, ///< The left OS specific key: window (Windows and Linux), apple (MacOS X), ... + RControl, ///< The right Control key + RShift, ///< The right Shift key + RAlt, ///< The right Alt key + RSystem, ///< The right OS specific key: window (Windows and Linux), apple (MacOS X), ... + Menu, ///< The Menu key + LBracket, ///< The [ key + RBracket, ///< The ] key + SemiColon, ///< The ; key + Comma, ///< The , key + Period, ///< The . key + Quote, ///< The ' key + Slash, ///< The / key + BackSlash, ///< The \ key + Tilde, ///< The ~ key + Equal, ///< The = key + Dash, ///< The - key + Space, ///< The Space key + Return, ///< The Return key + BackSpace, ///< The Backspace key + Tab, ///< The Tabulation key + PageUp, ///< The Page up key + PageDown, ///< The Page down key + End, ///< The End key + Home, ///< The Home key + Insert, ///< The Insert key + Delete, ///< The Delete key + Add, ///< The + key + Subtract, ///< The - key + Multiply, ///< The * key + Divide, ///< The / key + Left, ///< Left arrow + Right, ///< Right arrow + Up, ///< Up arrow + Down, ///< Down arrow + Numpad0, ///< The numpad 0 key + Numpad1, ///< The numpad 1 key + Numpad2, ///< The numpad 2 key + Numpad3, ///< The numpad 3 key + Numpad4, ///< The numpad 4 key + Numpad5, ///< The numpad 5 key + Numpad6, ///< The numpad 6 key + Numpad7, ///< The numpad 7 key + Numpad8, ///< The numpad 8 key + Numpad9, ///< The numpad 9 key + F1, ///< The F1 key + F2, ///< The F2 key + F3, ///< The F3 key + F4, ///< The F4 key + F5, ///< The F5 key + F6, ///< The F6 key + F7, ///< The F7 key + F8, ///< The F8 key + F9, ///< The F9 key + F10, ///< The F10 key + F11, ///< The F11 key + F12, ///< The F12 key + F13, ///< The F13 key + F14, ///< The F14 key + F15, ///< The F15 key + Pause, ///< The Pause key + + KeyCount ///< Keep last -- the total number of keyboard keys + }; + + //////////////////////////////////////////////////////////// + /// \brief Check if a key is pressed + /// + /// \param key Key to check + /// + /// \return True if the key is pressed, false otherwise + /// + //////////////////////////////////////////////////////////// + static bool isKeyPressed(Key key); + + //////////////////////////////////////////////////////////// + /// \brief Show or hide the virtual keyboard + /// + /// Warning: the virtual keyboard is not supported on all + /// systems. It will typically be implemented on mobile OSes + /// (Android, iOS) but not on desktop OSes (Windows, Linux, ...). + /// + /// If the virtual keyboard is not available, this function does + /// nothing. + /// + /// \param visible True to show, false to hide + /// + //////////////////////////////////////////////////////////// + static void setVirtualKeyboardVisible(bool visible); +}; + +} // namespace sf + + +#endif // SFML_KEYBOARD_HPP + + +//////////////////////////////////////////////////////////// +/// \class sf::Keyboard +/// \ingroup window +/// +/// sf::Keyboard provides an interface to the state of the +/// keyboard. It only contains static functions (a single +/// keyboard is assumed), so it's not meant to be instantiated. +/// +/// This class allows users to query the keyboard state at any +/// time and directly, without having to deal with a window and +/// its events. Compared to the KeyPressed and KeyReleased events, +/// sf::Keyboard can retrieve the state of a key at any time +/// (you don't need to store and update a boolean on your side +/// in order to know if a key is pressed or released), and you +/// always get the real state of the keyboard, even if keys are +/// pressed or released when your window is out of focus and no +/// event is triggered. +/// +/// Usage example: +/// \code +/// if (sf::Keyboard::isKeyPressed(sf::Keyboard::Left)) +/// { +/// // move left... +/// } +/// else if (sf::Keyboard::isKeyPressed(sf::Keyboard::Right)) +/// { +/// // move right... +/// } +/// else if (sf::Keyboard::isKeyPressed(sf::Keyboard::Escape)) +/// { +/// // quit... +/// } +/// \endcode +/// +/// \see sf::Joystick, sf::Mouse, sf::Touch +/// +//////////////////////////////////////////////////////////// diff --git a/mcclone/external/sfml23/include/SFML/Window/Mouse.hpp b/mcclone/external/sfml23/include/SFML/Window/Mouse.hpp new file mode 100644 index 0000000..0056f8c --- /dev/null +++ b/mcclone/external/sfml23/include/SFML/Window/Mouse.hpp @@ -0,0 +1,177 @@ +//////////////////////////////////////////////////////////// +// +// SFML - Simple and Fast Multimedia Library +// Copyright (C) 2007-2015 Laurent Gomila (laurent@sfml-dev.org) +// +// This software is provided 'as-is', without any express or implied warranty. +// In no event will the authors be held liable for any damages arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it freely, +// subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; +// you must not claim that you wrote the original software. +// If you use this software in a product, an acknowledgment +// in the product documentation would be appreciated but is not required. +// +// 2. Altered source versions must be plainly marked as such, +// and must not be misrepresented as being the original software. +// +// 3. This notice may not be removed or altered from any source distribution. +// +//////////////////////////////////////////////////////////// + +#ifndef SFML_MOUSE_HPP +#define SFML_MOUSE_HPP + +//////////////////////////////////////////////////////////// +// Headers +//////////////////////////////////////////////////////////// +#include +#include + + +namespace sf +{ +class Window; + +//////////////////////////////////////////////////////////// +/// \brief Give access to the real-time state of the mouse +/// +//////////////////////////////////////////////////////////// +class SFML_WINDOW_API Mouse +{ +public: + + //////////////////////////////////////////////////////////// + /// \brief Mouse buttons + /// + //////////////////////////////////////////////////////////// + enum Button + { + Left, ///< The left mouse button + Right, ///< The right mouse button + Middle, ///< The middle (wheel) mouse button + XButton1, ///< The first extra mouse button + XButton2, ///< The second extra mouse button + + ButtonCount ///< Keep last -- the total number of mouse buttons + }; + + //////////////////////////////////////////////////////////// + /// \brief Mouse wheels + /// + //////////////////////////////////////////////////////////// + enum Wheel + { + VerticalWheel, ///< The vertical mouse wheel + HorizontalWheel ///< The horizontal mouse wheel + }; + + //////////////////////////////////////////////////////////// + /// \brief Check if a mouse button is pressed + /// + /// \param button Button to check + /// + /// \return True if the button is pressed, false otherwise + /// + //////////////////////////////////////////////////////////// + static bool isButtonPressed(Button button); + + //////////////////////////////////////////////////////////// + /// \brief Get the current position of the mouse in desktop coordinates + /// + /// This function returns the global position of the mouse + /// cursor on the desktop. + /// + /// \return Current position of the mouse + /// + //////////////////////////////////////////////////////////// + static Vector2i getPosition(); + + //////////////////////////////////////////////////////////// + /// \brief Get the current position of the mouse in window coordinates + /// + /// This function returns the current position of the mouse + /// cursor, relative to the given window. + /// + /// \param relativeTo Reference window + /// + /// \return Current position of the mouse + /// + //////////////////////////////////////////////////////////// + static Vector2i getPosition(const Window& relativeTo); + + //////////////////////////////////////////////////////////// + /// \brief Set the current position of the mouse in desktop coordinates + /// + /// This function sets the global position of the mouse + /// cursor on the desktop. + /// + /// \param position New position of the mouse + /// + //////////////////////////////////////////////////////////// + static void setPosition(const Vector2i& position); + + //////////////////////////////////////////////////////////// + /// \brief Set the current position of the mouse in window coordinates + /// + /// This function sets the current position of the mouse + /// cursor, relative to the given window. + /// + /// \param position New position of the mouse + /// \param relativeTo Reference window + /// + //////////////////////////////////////////////////////////// + static void setPosition(const Vector2i& position, const Window& relativeTo); +}; + +} // namespace sf + + +#endif // SFML_MOUSE_HPP + + +//////////////////////////////////////////////////////////// +/// \class sf::Mouse +/// \ingroup window +/// +/// sf::Mouse provides an interface to the state of the +/// mouse. It only contains static functions (a single +/// mouse is assumed), so it's not meant to be instantiated. +/// +/// This class allows users to query the mouse state at any +/// time and directly, without having to deal with a window and +/// its events. Compared to the MouseMoved, MouseButtonPressed +/// and MouseButtonReleased events, sf::Mouse can retrieve the +/// state of the cursor and the buttons at any time +/// (you don't need to store and update a boolean on your side +/// in order to know if a button is pressed or released), and you +/// always get the real state of the mouse, even if it is +/// moved, pressed or released when your window is out of focus +/// and no event is triggered. +/// +/// The setPosition and getPosition functions can be used to change +/// or retrieve the current position of the mouse pointer. There are +/// two versions: one that operates in global coordinates (relative +/// to the desktop) and one that operates in window coordinates +/// (relative to a specific window). +/// +/// Usage example: +/// \code +/// if (sf::Mouse::isButtonPressed(sf::Mouse::Left)) +/// { +/// // left click... +/// } +/// +/// // get global mouse position +/// sf::Vector2i position = sf::Mouse::getPosition(); +/// +/// // set mouse position relative to a window +/// sf::Mouse::setPosition(sf::Vector2i(100, 200), window); +/// \endcode +/// +/// \see sf::Joystick, sf::Keyboard, sf::Touch +/// +//////////////////////////////////////////////////////////// diff --git a/mcclone/external/sfml23/include/SFML/Window/Sensor.hpp b/mcclone/external/sfml23/include/SFML/Window/Sensor.hpp new file mode 100644 index 0000000..6078881 --- /dev/null +++ b/mcclone/external/sfml23/include/SFML/Window/Sensor.hpp @@ -0,0 +1,150 @@ +//////////////////////////////////////////////////////////// +// +// SFML - Simple and Fast Multimedia Library +// Copyright (C) 2007-2015 Laurent Gomila (laurent@sfml-dev.org) +// +// This software is provided 'as-is', without any express or implied warranty. +// In no event will the authors be held liable for any damages arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it freely, +// subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; +// you must not claim that you wrote the original software. +// If you use this software in a product, an acknowledgment +// in the product documentation would be appreciated but is not required. +// +// 2. Altered source versions must be plainly marked as such, +// and must not be misrepresented as being the original software. +// +// 3. This notice may not be removed or altered from any source distribution. +// +//////////////////////////////////////////////////////////// + +#ifndef SFML_SENSOR_HPP +#define SFML_SENSOR_HPP + +//////////////////////////////////////////////////////////// +// Headers +//////////////////////////////////////////////////////////// +#include +#include +#include + + +namespace sf +{ +//////////////////////////////////////////////////////////// +/// \brief Give access to the real-time state of the sensors +/// +//////////////////////////////////////////////////////////// +class SFML_WINDOW_API Sensor +{ +public: + + //////////////////////////////////////////////////////////// + /// \brief Sensor type + /// + //////////////////////////////////////////////////////////// + enum Type + { + Accelerometer, ///< Measures the raw acceleration (m/s^2) + Gyroscope, ///< Measures the raw rotation rates (degrees/s) + Magnetometer, ///< Measures the ambient magnetic field (micro-teslas) + Gravity, ///< Measures the direction and intensity of gravity, independent of device acceleration (m/s^2) + UserAcceleration, ///< Measures the direction and intensity of device acceleration, independent of the gravity (m/s^2) + Orientation, ///< Measures the absolute 3D orientation (degrees) + + Count ///< Keep last -- the total number of sensor types + }; + + //////////////////////////////////////////////////////////// + /// \brief Check if a sensor is available on the underlying platform + /// + /// \param sensor Sensor to check + /// + /// \return True if the sensor is available, false otherwise + /// + //////////////////////////////////////////////////////////// + static bool isAvailable(Type sensor); + + //////////////////////////////////////////////////////////// + /// \brief Enable or disable a sensor + /// + /// All sensors are disabled by default, to avoid consuming too + /// much battery power. Once a sensor is enabled, it starts + /// sending events of the corresponding type. + /// + /// This function does nothing if the sensor is unavailable. + /// + /// \param sensor Sensor to enable + /// \param enabled True to enable, false to disable + /// + //////////////////////////////////////////////////////////// + static void setEnabled(Type sensor, bool enabled); + + //////////////////////////////////////////////////////////// + /// \brief Get the current sensor value + /// + /// \param sensor Sensor to read + /// + /// \return The current sensor value + /// + //////////////////////////////////////////////////////////// + static Vector3f getValue(Type sensor); +}; + +} // namespace sf + + +#endif // SFML_SENSOR_HPP + + +//////////////////////////////////////////////////////////// +/// \class sf::Sensor +/// \ingroup window +/// +/// sf::Sensor provides an interface to the state of the +/// various sensors that a device provides. It only contains static +/// functions, so it's not meant to be instantiated. +/// +/// This class allows users to query the sensors values at any +/// time and directly, without having to deal with a window and +/// its events. Compared to the SensorChanged event, sf::Sensor +/// can retrieve the state of a sensor at any time (you don't need to +/// store and update its current value on your side). +/// +/// Depending on the OS and hardware of the device (phone, tablet, ...), +/// some sensor types may not be available. You should always check +/// the availability of a sensor before trying to read it, with the +/// sf::Sensor::isAvailable function. +/// +/// You may wonder why some sensor types look so similar, for example +/// Accelerometer and Gravity / UserAcceleration. The first one +/// is the raw measurement of the acceleration, and takes into account +/// both the earth gravity and the user movement. The others are +/// more precise: they provide these components separately, which is +/// usually more useful. In fact they are not direct sensors, they +/// are computed internally based on the raw acceleration and other sensors. +/// This is exactly the same for Gyroscope vs Orientation. +/// +/// Because sensors consume a non-negligible amount of current, they are +/// all disabled by default. You must call sf::Sensor::setEnabled for each +/// sensor in which you are interested. +/// +/// Usage example: +/// \code +/// if (sf::Sensor::isAvailable(sf::Sensor::Gravity)) +/// { +/// // gravity sensor is available +/// } +/// +/// // enable the gravity sensor +/// sf::Sensor::setEnabled(sf::Sensor::Gravity, true); +/// +/// // get the current value of gravity +/// sf::Vector3f gravity = sf::Sensor::getValue(sf::Sensor::Gravity); +/// \endcode +/// +//////////////////////////////////////////////////////////// diff --git a/mcclone/external/sfml23/include/SFML/Window/Touch.hpp b/mcclone/external/sfml23/include/SFML/Window/Touch.hpp new file mode 100644 index 0000000..bf44f43 --- /dev/null +++ b/mcclone/external/sfml23/include/SFML/Window/Touch.hpp @@ -0,0 +1,137 @@ +//////////////////////////////////////////////////////////// +// +// SFML - Simple and Fast Multimedia Library +// Copyright (C) 2007-2015 Laurent Gomila (laurent@sfml-dev.org) +// +// This software is provided 'as-is', without any express or implied warranty. +// In no event will the authors be held liable for any damages arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it freely, +// subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; +// you must not claim that you wrote the original software. +// If you use this software in a product, an acknowledgment +// in the product documentation would be appreciated but is not required. +// +// 2. Altered source versions must be plainly marked as such, +// and must not be misrepresented as being the original software. +// +// 3. This notice may not be removed or altered from any source distribution. +// +//////////////////////////////////////////////////////////// + +#ifndef SFML_TOUCH_HPP +#define SFML_TOUCH_HPP + +//////////////////////////////////////////////////////////// +// Headers +//////////////////////////////////////////////////////////// +#include +#include + + +namespace sf +{ +class Window; + +//////////////////////////////////////////////////////////// +/// \brief Give access to the real-time state of the touches +/// +//////////////////////////////////////////////////////////// +class SFML_WINDOW_API Touch +{ +public: + + //////////////////////////////////////////////////////////// + /// \brief Check if a touch event is currently down + /// + /// \param finger Finger index + /// + /// \return True if \a finger is currently touching the screen, false otherwise + /// + //////////////////////////////////////////////////////////// + static bool isDown(unsigned int finger); + + //////////////////////////////////////////////////////////// + /// \brief Get the current position of a touch in desktop coordinates + /// + /// This function returns the current touch position + /// in global (desktop) coordinates. + /// + /// \param finger Finger index + /// + /// \return Current position of \a finger, or undefined if it's not down + /// + //////////////////////////////////////////////////////////// + static Vector2i getPosition(unsigned int finger); + + //////////////////////////////////////////////////////////// + /// \brief Get the current position of a touch in window coordinates + /// + /// This function returns the current touch position + /// in global (desktop) coordinates. + /// + /// \param finger Finger index + /// \param relativeTo Reference window + /// + /// \return Current position of \a finger, or undefined if it's not down + /// + //////////////////////////////////////////////////////////// + static Vector2i getPosition(unsigned int finger, const Window& relativeTo); +}; + +} // namespace sf + + +#endif // SFML_TOUCH_HPP + + +//////////////////////////////////////////////////////////// +/// \class sf::Touch +/// \ingroup window +/// +/// sf::Touch provides an interface to the state of the +/// touches. It only contains static functions, so it's not +/// meant to be instantiated. +/// +/// This class allows users to query the touches state at any +/// time and directly, without having to deal with a window and +/// its events. Compared to the TouchBegan, TouchMoved +/// and TouchEnded events, sf::Touch can retrieve the +/// state of the touches at any time (you don't need to store and +/// update a boolean on your side in order to know if a touch is down), +/// and you always get the real state of the touches, even if they +/// happen when your window is out of focus and no event is triggered. +/// +/// The getPosition function can be used to retrieve the current +/// position of a touch. There are two versions: one that operates +/// in global coordinates (relative to the desktop) and one that +/// operates in window coordinates (relative to a specific window). +/// +/// Touches are identified by an index (the "finger"), so that in +/// multi-touch events, individual touches can be tracked correctly. +/// As long as a finger touches the screen, it will keep the same index +/// even if other fingers start or stop touching the screen in the +/// meantime. As a consequence, active touch indices may not always be +/// sequential (i.e. touch number 0 may be released while touch number 1 +/// is still down). +/// +/// Usage example: +/// \code +/// if (sf::Touch::isDown(0)) +/// { +/// // touch 0 is down +/// } +/// +/// // get global position of touch 1 +/// sf::Vector2i globalPos = sf::Touch::getPosition(1); +/// +/// // get position of touch 1 relative to a window +/// sf::Vector2i relativePos = sf::Touch::getPosition(1, window); +/// \endcode +/// +/// \see sf::Joystick, sf::Keyboard, sf::Mouse +/// +//////////////////////////////////////////////////////////// diff --git a/mcclone/external/sfml23/include/SFML/Window/VideoMode.hpp b/mcclone/external/sfml23/include/SFML/Window/VideoMode.hpp new file mode 100644 index 0000000..5eb268c --- /dev/null +++ b/mcclone/external/sfml23/include/SFML/Window/VideoMode.hpp @@ -0,0 +1,228 @@ +//////////////////////////////////////////////////////////// +// +// SFML - Simple and Fast Multimedia Library +// Copyright (C) 2007-2015 Laurent Gomila (laurent@sfml-dev.org) +// +// This software is provided 'as-is', without any express or implied warranty. +// In no event will the authors be held liable for any damages arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it freely, +// subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; +// you must not claim that you wrote the original software. +// If you use this software in a product, an acknowledgment +// in the product documentation would be appreciated but is not required. +// +// 2. Altered source versions must be plainly marked as such, +// and must not be misrepresented as being the original software. +// +// 3. This notice may not be removed or altered from any source distribution. +// +//////////////////////////////////////////////////////////// + +#ifndef SFML_VIDEOMODE_HPP +#define SFML_VIDEOMODE_HPP + +//////////////////////////////////////////////////////////// +// Headers +//////////////////////////////////////////////////////////// +#include +#include + + +namespace sf +{ +//////////////////////////////////////////////////////////// +/// \brief VideoMode defines a video mode (width, height, bpp) +/// +//////////////////////////////////////////////////////////// +class SFML_WINDOW_API VideoMode +{ +public: + + //////////////////////////////////////////////////////////// + /// \brief Default constructor + /// + /// This constructors initializes all members to 0. + /// + //////////////////////////////////////////////////////////// + VideoMode(); + + //////////////////////////////////////////////////////////// + /// \brief Construct the video mode with its attributes + /// + /// \param modeWidth Width in pixels + /// \param modeHeight Height in pixels + /// \param modeBitsPerPixel Pixel depths in bits per pixel + /// + //////////////////////////////////////////////////////////// + VideoMode(unsigned int modeWidth, unsigned int modeHeight, unsigned int modeBitsPerPixel = 32); + + //////////////////////////////////////////////////////////// + /// \brief Get the current desktop video mode + /// + /// \return Current desktop video mode + /// + //////////////////////////////////////////////////////////// + static VideoMode getDesktopMode(); + + //////////////////////////////////////////////////////////// + /// \brief Retrieve all the video modes supported in fullscreen mode + /// + /// When creating a fullscreen window, the video mode is restricted + /// to be compatible with what the graphics driver and monitor + /// support. This function returns the complete list of all video + /// modes that can be used in fullscreen mode. + /// The returned array is sorted from best to worst, so that + /// the first element will always give the best mode (higher + /// width, height and bits-per-pixel). + /// + /// \return Array containing all the supported fullscreen modes + /// + //////////////////////////////////////////////////////////// + static const std::vector& getFullscreenModes(); + + //////////////////////////////////////////////////////////// + /// \brief Tell whether or not the video mode is valid + /// + /// The validity of video modes is only relevant when using + /// fullscreen windows; otherwise any video mode can be used + /// with no restriction. + /// + /// \return True if the video mode is valid for fullscreen mode + /// + //////////////////////////////////////////////////////////// + bool isValid() const; + + //////////////////////////////////////////////////////////// + // Member data + //////////////////////////////////////////////////////////// + unsigned int width; ///< Video mode width, in pixels + unsigned int height; ///< Video mode height, in pixels + unsigned int bitsPerPixel; ///< Video mode pixel depth, in bits per pixels +}; + +//////////////////////////////////////////////////////////// +/// \relates VideoMode +/// \brief Overload of == operator to compare two video modes +/// +/// \param left Left operand (a video mode) +/// \param right Right operand (a video mode) +/// +/// \return True if modes are equal +/// +//////////////////////////////////////////////////////////// +SFML_WINDOW_API bool operator ==(const VideoMode& left, const VideoMode& right); + +//////////////////////////////////////////////////////////// +/// \relates VideoMode +/// \brief Overload of != operator to compare two video modes +/// +/// \param left Left operand (a video mode) +/// \param right Right operand (a video mode) +/// +/// \return True if modes are different +/// +//////////////////////////////////////////////////////////// +SFML_WINDOW_API bool operator !=(const VideoMode& left, const VideoMode& right); + +//////////////////////////////////////////////////////////// +/// \relates VideoMode +/// \brief Overload of < operator to compare video modes +/// +/// \param left Left operand (a video mode) +/// \param right Right operand (a video mode) +/// +/// \return True if \a left is lesser than \a right +/// +//////////////////////////////////////////////////////////// +SFML_WINDOW_API bool operator <(const VideoMode& left, const VideoMode& right); + +//////////////////////////////////////////////////////////// +/// \relates VideoMode +/// \brief Overload of > operator to compare video modes +/// +/// \param left Left operand (a video mode) +/// \param right Right operand (a video mode) +/// +/// \return True if \a left is greater than \a right +/// +//////////////////////////////////////////////////////////// +SFML_WINDOW_API bool operator >(const VideoMode& left, const VideoMode& right); + +//////////////////////////////////////////////////////////// +/// \relates VideoMode +/// \brief Overload of <= operator to compare video modes +/// +/// \param left Left operand (a video mode) +/// \param right Right operand (a video mode) +/// +/// \return True if \a left is lesser or equal than \a right +/// +//////////////////////////////////////////////////////////// +SFML_WINDOW_API bool operator <=(const VideoMode& left, const VideoMode& right); + +//////////////////////////////////////////////////////////// +/// \relates VideoMode +/// \brief Overload of >= operator to compare video modes +/// +/// \param left Left operand (a video mode) +/// \param right Right operand (a video mode) +/// +/// \return True if \a left is greater or equal than \a right +/// +//////////////////////////////////////////////////////////// +SFML_WINDOW_API bool operator >=(const VideoMode& left, const VideoMode& right); + +} // namespace sf + + +#endif // SFML_VIDEOMODE_HPP + + +//////////////////////////////////////////////////////////// +/// \class sf::VideoMode +/// \ingroup window +/// +/// A video mode is defined by a width and a height (in pixels) +/// and a depth (in bits per pixel). Video modes are used to +/// setup windows (sf::Window) at creation time. +/// +/// The main usage of video modes is for fullscreen mode: +/// indeed you must use one of the valid video modes +/// allowed by the OS (which are defined by what the monitor +/// and the graphics card support), otherwise your window +/// creation will just fail. +/// +/// sf::VideoMode provides a static function for retrieving +/// the list of all the video modes supported by the system: +/// getFullscreenModes(). +/// +/// A custom video mode can also be checked directly for +/// fullscreen compatibility with its isValid() function. +/// +/// Additionally, sf::VideoMode provides a static function +/// to get the mode currently used by the desktop: getDesktopMode(). +/// This allows to build windows with the same size or pixel +/// depth as the current resolution. +/// +/// Usage example: +/// \code +/// // Display the list of all the video modes available for fullscreen +/// std::vector modes = sf::VideoMode::getFullscreenModes(); +/// for (std::size_t i = 0; i < modes.size(); ++i) +/// { +/// sf::VideoMode mode = modes[i]; +/// std::cout << "Mode #" << i << ": " +/// << mode.width << "x" << mode.height << " - " +/// << mode.bitsPerPixel << " bpp" << std::endl; +/// } +/// +/// // Create a window with the same pixel depth as the desktop +/// sf::VideoMode desktop = sf::VideoMode::getDesktopMode(); +/// window.create(sf::VideoMode(1024, 768, desktop.bitsPerPixel), "SFML window"); +/// \endcode +/// +//////////////////////////////////////////////////////////// diff --git a/mcclone/external/sfml23/include/SFML/Window/Window.hpp b/mcclone/external/sfml23/include/SFML/Window/Window.hpp new file mode 100644 index 0000000..44f0752 --- /dev/null +++ b/mcclone/external/sfml23/include/SFML/Window/Window.hpp @@ -0,0 +1,585 @@ +//////////////////////////////////////////////////////////// +// +// SFML - Simple and Fast Multimedia Library +// Copyright (C) 2007-2015 Laurent Gomila (laurent@sfml-dev.org) +// +// This software is provided 'as-is', without any express or implied warranty. +// In no event will the authors be held liable for any damages arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it freely, +// subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; +// you must not claim that you wrote the original software. +// If you use this software in a product, an acknowledgment +// in the product documentation would be appreciated but is not required. +// +// 2. Altered source versions must be plainly marked as such, +// and must not be misrepresented as being the original software. +// +// 3. This notice may not be removed or altered from any source distribution. +// +//////////////////////////////////////////////////////////// + +#ifndef SFML_WINDOW_HPP +#define SFML_WINDOW_HPP + +//////////////////////////////////////////////////////////// +// Headers +//////////////////////////////////////////////////////////// +#include +#include +#include +#include +#include +#include +#include +#include +#include +#include + + +namespace sf +{ +namespace priv +{ + class GlContext; + class WindowImpl; +} + +class Event; + +//////////////////////////////////////////////////////////// +/// \brief Window that serves as a target for OpenGL rendering +/// +//////////////////////////////////////////////////////////// +class SFML_WINDOW_API Window : GlResource, NonCopyable +{ +public: + + //////////////////////////////////////////////////////////// + /// \brief Default constructor + /// + /// This constructor doesn't actually create the window, + /// use the other constructors or call create() to do so. + /// + //////////////////////////////////////////////////////////// + Window(); + + //////////////////////////////////////////////////////////// + /// \brief Construct a new window + /// + /// This constructor creates the window with the size and pixel + /// depth defined in \a mode. An optional style can be passed to + /// customize the look and behavior of the window (borders, + /// title bar, resizable, closable, ...). If \a style contains + /// Style::Fullscreen, then \a mode must be a valid video mode. + /// + /// The fourth parameter is an optional structure specifying + /// advanced OpenGL context settings such as antialiasing, + /// depth-buffer bits, etc. + /// + /// \param mode Video mode to use (defines the width, height and depth of the rendering area of the window) + /// \param title Title of the window + /// \param style %Window style, a bitwise OR combination of sf::Style enumerators + /// \param settings Additional settings for the underlying OpenGL context + /// + //////////////////////////////////////////////////////////// + Window(VideoMode mode, const String& title, Uint32 style = Style::Default, const ContextSettings& settings = ContextSettings()); + + //////////////////////////////////////////////////////////// + /// \brief Construct the window from an existing control + /// + /// Use this constructor if you want to create an OpenGL + /// rendering area into an already existing control. + /// + /// The second parameter is an optional structure specifying + /// advanced OpenGL context settings such as antialiasing, + /// depth-buffer bits, etc. + /// + /// \param handle Platform-specific handle of the control (\a HWND on + /// Windows, \a %Window on Linux/FreeBSD, \a NSWindow on OS X) + /// \param settings Additional settings for the underlying OpenGL context + /// + //////////////////////////////////////////////////////////// + explicit Window(WindowHandle handle, const ContextSettings& settings = ContextSettings()); + + //////////////////////////////////////////////////////////// + /// \brief Destructor + /// + /// Closes the window and frees all the resources attached to it. + /// + //////////////////////////////////////////////////////////// + virtual ~Window(); + + //////////////////////////////////////////////////////////// + /// \brief Create (or recreate) the window + /// + /// If the window was already created, it closes it first. + /// If \a style contains Style::Fullscreen, then \a mode + /// must be a valid video mode. + /// + /// The fourth parameter is an optional structure specifying + /// advanced OpenGL context settings such as antialiasing, + /// depth-buffer bits, etc. + /// + /// \param mode Video mode to use (defines the width, height and depth of the rendering area of the window) + /// \param title Title of the window + /// \param style %Window style, a bitwise OR combination of sf::Style enumerators + /// \param settings Additional settings for the underlying OpenGL context + /// + //////////////////////////////////////////////////////////// + void create(VideoMode mode, const String& title, Uint32 style = Style::Default, const ContextSettings& settings = ContextSettings()); + + //////////////////////////////////////////////////////////// + /// \brief Create (or recreate) the window from an existing control + /// + /// Use this function if you want to create an OpenGL + /// rendering area into an already existing control. + /// If the window was already created, it closes it first. + /// + /// The second parameter is an optional structure specifying + /// advanced OpenGL context settings such as antialiasing, + /// depth-buffer bits, etc. + /// + /// \param handle Platform-specific handle of the control (\a HWND on + /// Windows, \a %Window on Linux/FreeBSD, \a NSWindow on OS X) + /// \param settings Additional settings for the underlying OpenGL context + /// + //////////////////////////////////////////////////////////// + void create(WindowHandle handle, const ContextSettings& settings = ContextSettings()); + + //////////////////////////////////////////////////////////// + /// \brief Close the window and destroy all the attached resources + /// + /// After calling this function, the sf::Window instance remains + /// valid and you can call create() to recreate the window. + /// All other functions such as pollEvent() or display() will + /// still work (i.e. you don't have to test isOpen() every time), + /// and will have no effect on closed windows. + /// + //////////////////////////////////////////////////////////// + void close(); + + //////////////////////////////////////////////////////////// + /// \brief Tell whether or not the window is open + /// + /// This function returns whether or not the window exists. + /// Note that a hidden window (setVisible(false)) is open + /// (therefore this function would return true). + /// + /// \return True if the window is open, false if it has been closed + /// + //////////////////////////////////////////////////////////// + bool isOpen() const; + + //////////////////////////////////////////////////////////// + /// \brief Get the settings of the OpenGL context of the window + /// + /// Note that these settings may be different from what was + /// passed to the constructor or the create() function, + /// if one or more settings were not supported. In this case, + /// SFML chose the closest match. + /// + /// \return Structure containing the OpenGL context settings + /// + //////////////////////////////////////////////////////////// + const ContextSettings& getSettings() const; + + //////////////////////////////////////////////////////////// + /// \brief Pop the event on top of the event queue, if any, and return it + /// + /// This function is not blocking: if there's no pending event then + /// it will return false and leave \a event unmodified. + /// Note that more than one event may be present in the event queue, + /// thus you should always call this function in a loop + /// to make sure that you process every pending event. + /// \code + /// sf::Event event; + /// while (window.pollEvent(event)) + /// { + /// // process event... + /// } + /// \endcode + /// + /// \param event Event to be returned + /// + /// \return True if an event was returned, or false if the event queue was empty + /// + /// \see waitEvent + /// + //////////////////////////////////////////////////////////// + bool pollEvent(Event& event); + + //////////////////////////////////////////////////////////// + /// \brief Wait for an event and return it + /// + /// This function is blocking: if there's no pending event then + /// it will wait until an event is received. + /// After this function returns (and no error occurred), + /// the \a event object is always valid and filled properly. + /// This function is typically used when you have a thread that + /// is dedicated to events handling: you want to make this thread + /// sleep as long as no new event is received. + /// \code + /// sf::Event event; + /// if (window.waitEvent(event)) + /// { + /// // process event... + /// } + /// \endcode + /// + /// \param event Event to be returned + /// + /// \return False if any error occurred + /// + /// \see pollEvent + /// + //////////////////////////////////////////////////////////// + bool waitEvent(Event& event); + + //////////////////////////////////////////////////////////// + /// \brief Get the position of the window + /// + /// \return Position of the window, in pixels + /// + /// \see setPosition + /// + //////////////////////////////////////////////////////////// + Vector2i getPosition() const; + + //////////////////////////////////////////////////////////// + /// \brief Change the position of the window on screen + /// + /// This function only works for top-level windows + /// (i.e. it will be ignored for windows created from + /// the handle of a child window/control). + /// + /// \param position New position, in pixels + /// + /// \see getPosition + /// + //////////////////////////////////////////////////////////// + void setPosition(const Vector2i& position); + + //////////////////////////////////////////////////////////// + /// \brief Get the size of the rendering region of the window + /// + /// The size doesn't include the titlebar and borders + /// of the window. + /// + /// \return Size in pixels + /// + /// \see setSize + /// + //////////////////////////////////////////////////////////// + Vector2u getSize() const; + + //////////////////////////////////////////////////////////// + /// \brief Change the size of the rendering region of the window + /// + /// \param size New size, in pixels + /// + /// \see getSize + /// + //////////////////////////////////////////////////////////// + void setSize(const Vector2u& size); + + //////////////////////////////////////////////////////////// + /// \brief Change the title of the window + /// + /// \param title New title + /// + /// \see setIcon + /// + //////////////////////////////////////////////////////////// + void setTitle(const String& title); + + //////////////////////////////////////////////////////////// + /// \brief Change the window's icon + /// + /// \a pixels must be an array of \a width x \a height pixels + /// in 32-bits RGBA format. + /// + /// The OS default icon is used by default. + /// + /// \param width Icon's width, in pixels + /// \param height Icon's height, in pixels + /// \param pixels Pointer to the array of pixels in memory. The + /// pixels are copied, so you need not keep the + /// source alive after calling this function. + /// + /// \see setTitle + /// + //////////////////////////////////////////////////////////// + void setIcon(unsigned int width, unsigned int height, const Uint8* pixels); + + //////////////////////////////////////////////////////////// + /// \brief Show or hide the window + /// + /// The window is shown by default. + /// + /// \param visible True to show the window, false to hide it + /// + //////////////////////////////////////////////////////////// + void setVisible(bool visible); + + //////////////////////////////////////////////////////////// + /// \brief Enable or disable vertical synchronization + /// + /// Activating vertical synchronization will limit the number + /// of frames displayed to the refresh rate of the monitor. + /// This can avoid some visual artifacts, and limit the framerate + /// to a good value (but not constant across different computers). + /// + /// Vertical synchronization is disabled by default. + /// + /// \param enabled True to enable v-sync, false to deactivate it + /// + //////////////////////////////////////////////////////////// + void setVerticalSyncEnabled(bool enabled); + + //////////////////////////////////////////////////////////// + /// \brief Show or hide the mouse cursor + /// + /// The mouse cursor is visible by default. + /// + /// \param visible True to show the mouse cursor, false to hide it + /// + //////////////////////////////////////////////////////////// + void setMouseCursorVisible(bool visible); + + //////////////////////////////////////////////////////////// + /// \brief Enable or disable automatic key-repeat + /// + /// If key repeat is enabled, you will receive repeated + /// KeyPressed events while keeping a key pressed. If it is disabled, + /// you will only get a single event when the key is pressed. + /// + /// Key repeat is enabled by default. + /// + /// \param enabled True to enable, false to disable + /// + //////////////////////////////////////////////////////////// + void setKeyRepeatEnabled(bool enabled); + + //////////////////////////////////////////////////////////// + /// \brief Limit the framerate to a maximum fixed frequency + /// + /// If a limit is set, the window will use a small delay after + /// each call to display() to ensure that the current frame + /// lasted long enough to match the framerate limit. + /// SFML will try to match the given limit as much as it can, + /// but since it internally uses sf::sleep, whose precision + /// depends on the underlying OS, the results may be a little + /// unprecise as well (for example, you can get 65 FPS when + /// requesting 60). + /// + /// \param limit Framerate limit, in frames per seconds (use 0 to disable limit) + /// + //////////////////////////////////////////////////////////// + void setFramerateLimit(unsigned int limit); + + //////////////////////////////////////////////////////////// + /// \brief Change the joystick threshold + /// + /// The joystick threshold is the value below which + /// no JoystickMoved event will be generated. + /// + /// The threshold value is 0.1 by default. + /// + /// \param threshold New threshold, in the range [0, 100] + /// + //////////////////////////////////////////////////////////// + void setJoystickThreshold(float threshold); + + //////////////////////////////////////////////////////////// + /// \brief Activate or deactivate the window as the current target + /// for OpenGL rendering + /// + /// A window is active only on the current thread, if you want to + /// make it active on another thread you have to deactivate it + /// on the previous thread first if it was active. + /// Only one window can be active on a thread at a time, thus + /// the window previously active (if any) automatically gets deactivated. + /// This is not to be confused with requestFocus(). + /// + /// \param active True to activate, false to deactivate + /// + /// \return True if operation was successful, false otherwise + /// + //////////////////////////////////////////////////////////// + bool setActive(bool active = true) const; + + //////////////////////////////////////////////////////////// + /// \brief Request the current window to be made the active + /// foreground window + /// + /// At any given time, only one window may have the input focus + /// to receive input events such as keystrokes or mouse events. + /// If a window requests focus, it only hints to the operating + /// system, that it would like to be focused. The operating system + /// is free to deny the request. + /// This is not to be confused with setActive(). + /// + /// \see hasFocus + /// + //////////////////////////////////////////////////////////// + void requestFocus(); + + //////////////////////////////////////////////////////////// + /// \brief Check whether the window has the input focus + /// + /// At any given time, only one window may have the input focus + /// to receive input events such as keystrokes or most mouse + /// events. + /// + /// \return True if window has focus, false otherwise + /// \see requestFocus + /// + //////////////////////////////////////////////////////////// + bool hasFocus() const; + + //////////////////////////////////////////////////////////// + /// \brief Display on screen what has been rendered to the window so far + /// + /// This function is typically called after all OpenGL rendering + /// has been done for the current frame, in order to show + /// it on screen. + /// + //////////////////////////////////////////////////////////// + void display(); + + //////////////////////////////////////////////////////////// + /// \brief Get the OS-specific handle of the window + /// + /// The type of the returned handle is sf::WindowHandle, + /// which is a typedef to the handle type defined by the OS. + /// You shouldn't need to use this function, unless you have + /// very specific stuff to implement that SFML doesn't support, + /// or implement a temporary workaround until a bug is fixed. + /// The type is \a HWND on Windows, \a %Window on Linux/FreeBSD + /// and \a NSWindow on OS X. + /// + /// \return System handle of the window + /// + //////////////////////////////////////////////////////////// + WindowHandle getSystemHandle() const; + +protected: + + //////////////////////////////////////////////////////////// + /// \brief Function called after the window has been created + /// + /// This function is called so that derived classes can + /// perform their own specific initialization as soon as + /// the window is created. + /// + //////////////////////////////////////////////////////////// + virtual void onCreate(); + + //////////////////////////////////////////////////////////// + /// \brief Function called after the window has been resized + /// + /// This function is called so that derived classes can + /// perform custom actions when the size of the window changes. + /// + //////////////////////////////////////////////////////////// + virtual void onResize(); + +private: + + //////////////////////////////////////////////////////////// + /// \brief Processes an event before it is sent to the user + /// + /// This function is called every time an event is received + /// from the internal window (through pollEvent or waitEvent). + /// It filters out unwanted events, and performs whatever internal + /// stuff the window needs before the event is returned to the + /// user. + /// + /// \param event Event to filter + /// + //////////////////////////////////////////////////////////// + bool filterEvent(const Event& event); + + //////////////////////////////////////////////////////////// + /// \brief Perform some common internal initializations + /// + //////////////////////////////////////////////////////////// + void initialize(); + + //////////////////////////////////////////////////////////// + // Member data + //////////////////////////////////////////////////////////// + priv::WindowImpl* m_impl; ///< Platform-specific implementation of the window + priv::GlContext* m_context; ///< Platform-specific implementation of the OpenGL context + Clock m_clock; ///< Clock for measuring the elapsed time between frames + Time m_frameTimeLimit; ///< Current framerate limit + Vector2u m_size; ///< Current size of the window +}; + +} // namespace sf + + +#endif // SFML_WINDOW_HPP + + +//////////////////////////////////////////////////////////// +/// \class sf::Window +/// \ingroup window +/// +/// sf::Window is the main class of the Window module. It defines +/// an OS window that is able to receive an OpenGL rendering. +/// +/// A sf::Window can create its own new window, or be embedded into +/// an already existing control using the create(handle) function. +/// This can be useful for embedding an OpenGL rendering area into +/// a view which is part of a bigger GUI with existing windows, +/// controls, etc. It can also serve as embedding an OpenGL rendering +/// area into a window created by another (probably richer) GUI library +/// like Qt or wxWidgets. +/// +/// The sf::Window class provides a simple interface for manipulating +/// the window: move, resize, show/hide, control mouse cursor, etc. +/// It also provides event handling through its pollEvent() and waitEvent() +/// functions. +/// +/// Note that OpenGL experts can pass their own parameters (antialiasing +/// level, bits for the depth and stencil buffers, etc.) to the +/// OpenGL context attached to the window, with the sf::ContextSettings +/// structure which is passed as an optional argument when creating the +/// window. +/// +/// Usage example: +/// \code +/// // Declare and create a new window +/// sf::Window window(sf::VideoMode(800, 600), "SFML window"); +/// +/// // Limit the framerate to 60 frames per second (this step is optional) +/// window.setFramerateLimit(60); +/// +/// // The main loop - ends as soon as the window is closed +/// while (window.isOpen()) +/// { +/// // Event processing +/// sf::Event event; +/// while (window.pollEvent(event)) +/// { +/// // Request for closing the window +/// if (event.type == sf::Event::Closed) +/// window.close(); +/// } +/// +/// // Activate the window for OpenGL rendering +/// window.setActive(); +/// +/// // OpenGL drawing commands go here... +/// +/// // End the current frame and display its contents on screen +/// window.display(); +/// } +/// \endcode +/// +//////////////////////////////////////////////////////////// diff --git a/mcclone/external/sfml23/include/SFML/Window/WindowHandle.hpp b/mcclone/external/sfml23/include/SFML/Window/WindowHandle.hpp new file mode 100644 index 0000000..9da3042 --- /dev/null +++ b/mcclone/external/sfml23/include/SFML/Window/WindowHandle.hpp @@ -0,0 +1,74 @@ +//////////////////////////////////////////////////////////// +// +// SFML - Simple and Fast Multimedia Library +// Copyright (C) 2007-2015 Laurent Gomila (laurent@sfml-dev.org) +// +// This software is provided 'as-is', without any express or implied warranty. +// In no event will the authors be held liable for any damages arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it freely, +// subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; +// you must not claim that you wrote the original software. +// If you use this software in a product, an acknowledgment +// in the product documentation would be appreciated but is not required. +// +// 2. Altered source versions must be plainly marked as such, +// and must not be misrepresented as being the original software. +// +// 3. This notice may not be removed or altered from any source distribution. +// +//////////////////////////////////////////////////////////// + +#ifndef SFML_WINDOWHANDLE_HPP +#define SFML_WINDOWHANDLE_HPP + +//////////////////////////////////////////////////////////// +// Headers +//////////////////////////////////////////////////////////// +#include + +// Windows' HWND is a typedef on struct HWND__* +#if defined(SFML_SYSTEM_WINDOWS) + struct HWND__; +#endif + +namespace sf +{ +//////////////////////////////////////////////////////////// +/// Define a low-level window handle type, specific to +/// each platform +//////////////////////////////////////////////////////////// +#if defined(SFML_SYSTEM_WINDOWS) + + // Window handle is HWND (HWND__*) on Windows + typedef HWND__* WindowHandle; + +#elif defined(SFML_SYSTEM_LINUX) || defined(SFML_SYSTEM_FREEBSD) + + // Window handle is Window (unsigned long) on Unix - X11 + typedef unsigned long WindowHandle; + +#elif defined(SFML_SYSTEM_MACOS) + + // Window handle is NSWindow (void*) on Mac OS X - Cocoa + typedef void* WindowHandle; + +#elif defined(SFML_SYSTEM_IOS) + + // Window handle is UIWindow (void*) on iOS - UIKit + typedef void* WindowHandle; + +#elif defined(SFML_SYSTEM_ANDROID) + + // Window handle is ANativeWindow (void*) on Android + typedef void* WindowHandle; + +#endif + +} // namespace sf + + +#endif // SFML_WINDOWHANDLE_HPP diff --git a/mcclone/external/sfml23/include/SFML/Window/WindowStyle.hpp b/mcclone/external/sfml23/include/SFML/Window/WindowStyle.hpp new file mode 100644 index 0000000..b9253db --- /dev/null +++ b/mcclone/external/sfml23/include/SFML/Window/WindowStyle.hpp @@ -0,0 +1,53 @@ +//////////////////////////////////////////////////////////// +// +// SFML - Simple and Fast Multimedia Library +// Copyright (C) 2007-2015 Laurent Gomila (laurent@sfml-dev.org) +// +// This software is provided 'as-is', without any express or implied warranty. +// In no event will the authors be held liable for any damages arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it freely, +// subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; +// you must not claim that you wrote the original software. +// If you use this software in a product, an acknowledgment +// in the product documentation would be appreciated but is not required. +// +// 2. Altered source versions must be plainly marked as such, +// and must not be misrepresented as being the original software. +// +// 3. This notice may not be removed or altered from any source distribution. +// +//////////////////////////////////////////////////////////// + +#ifndef SFML_WINDOWSTYLE_HPP +#define SFML_WINDOWSTYLE_HPP + + +namespace sf +{ +namespace Style +{ + //////////////////////////////////////////////////////////// + /// \ingroup window + /// \brief Enumeration of the window styles + /// + //////////////////////////////////////////////////////////// + enum + { + None = 0, ///< No border / title bar (this flag and all others are mutually exclusive) + Titlebar = 1 << 0, ///< Title bar + fixed border + Resize = 1 << 1, ///< Title bar + resizable border + maximize button + Close = 1 << 2, ///< Title bar + close button + Fullscreen = 1 << 3, ///< Fullscreen mode (this flag and all others are mutually exclusive) + + Default = Titlebar | Resize | Close ///< Default window style + }; +} + +} // namespace sf + + +#endif // SFML_WINDOWSTYLE_HPP diff --git a/mcclone/external/sfml23/lib/flac.lib b/mcclone/external/sfml23/lib/flac.lib new file mode 100644 index 0000000..fd29aca Binary files /dev/null and b/mcclone/external/sfml23/lib/flac.lib differ diff --git a/mcclone/external/sfml23/lib/freetype.lib b/mcclone/external/sfml23/lib/freetype.lib new file mode 100644 index 0000000..6e57b1e Binary files /dev/null and b/mcclone/external/sfml23/lib/freetype.lib differ diff --git a/mcclone/external/sfml23/lib/jpeg.lib b/mcclone/external/sfml23/lib/jpeg.lib new file mode 100644 index 0000000..04c8129 Binary files /dev/null and b/mcclone/external/sfml23/lib/jpeg.lib differ diff --git a/mcclone/external/sfml23/lib/ogg.lib b/mcclone/external/sfml23/lib/ogg.lib new file mode 100644 index 0000000..39b2f92 Binary files /dev/null and b/mcclone/external/sfml23/lib/ogg.lib differ diff --git a/mcclone/external/sfml23/lib/openal32.lib b/mcclone/external/sfml23/lib/openal32.lib new file mode 100644 index 0000000..e466abd Binary files /dev/null and b/mcclone/external/sfml23/lib/openal32.lib differ diff --git a/mcclone/external/sfml23/lib/sfml-audio-d.lib b/mcclone/external/sfml23/lib/sfml-audio-d.lib new file mode 100644 index 0000000..d457ce4 Binary files /dev/null and b/mcclone/external/sfml23/lib/sfml-audio-d.lib differ diff --git a/mcclone/external/sfml23/lib/sfml-audio-s-d.lib b/mcclone/external/sfml23/lib/sfml-audio-s-d.lib new file mode 100644 index 0000000..f758f4d Binary files /dev/null and b/mcclone/external/sfml23/lib/sfml-audio-s-d.lib differ diff --git a/mcclone/external/sfml23/lib/sfml-audio-s.lib b/mcclone/external/sfml23/lib/sfml-audio-s.lib new file mode 100644 index 0000000..d8f85a1 Binary files /dev/null and b/mcclone/external/sfml23/lib/sfml-audio-s.lib differ diff --git a/mcclone/external/sfml23/lib/sfml-audio.lib b/mcclone/external/sfml23/lib/sfml-audio.lib new file mode 100644 index 0000000..3b95168 Binary files /dev/null and b/mcclone/external/sfml23/lib/sfml-audio.lib differ diff --git a/mcclone/external/sfml23/lib/sfml-graphics-d.lib b/mcclone/external/sfml23/lib/sfml-graphics-d.lib new file mode 100644 index 0000000..4601a92 Binary files /dev/null and b/mcclone/external/sfml23/lib/sfml-graphics-d.lib differ diff --git a/mcclone/external/sfml23/lib/sfml-graphics-s-d.lib b/mcclone/external/sfml23/lib/sfml-graphics-s-d.lib new file mode 100644 index 0000000..06d1e2b Binary files /dev/null and b/mcclone/external/sfml23/lib/sfml-graphics-s-d.lib differ diff --git a/mcclone/external/sfml23/lib/sfml-graphics-s.lib b/mcclone/external/sfml23/lib/sfml-graphics-s.lib new file mode 100644 index 0000000..f89db5c Binary files /dev/null and b/mcclone/external/sfml23/lib/sfml-graphics-s.lib differ diff --git a/mcclone/external/sfml23/lib/sfml-graphics.lib b/mcclone/external/sfml23/lib/sfml-graphics.lib new file mode 100644 index 0000000..eaa3e24 Binary files /dev/null and b/mcclone/external/sfml23/lib/sfml-graphics.lib differ diff --git a/mcclone/external/sfml23/lib/sfml-main-d.lib b/mcclone/external/sfml23/lib/sfml-main-d.lib new file mode 100644 index 0000000..0f30cc7 Binary files /dev/null and b/mcclone/external/sfml23/lib/sfml-main-d.lib differ diff --git a/mcclone/external/sfml23/lib/sfml-main.lib b/mcclone/external/sfml23/lib/sfml-main.lib new file mode 100644 index 0000000..3c4fc39 Binary files /dev/null and b/mcclone/external/sfml23/lib/sfml-main.lib differ diff --git a/mcclone/external/sfml23/lib/sfml-network-d.lib b/mcclone/external/sfml23/lib/sfml-network-d.lib new file mode 100644 index 0000000..d4c3872 Binary files /dev/null and b/mcclone/external/sfml23/lib/sfml-network-d.lib differ diff --git a/mcclone/external/sfml23/lib/sfml-network-s-d.lib b/mcclone/external/sfml23/lib/sfml-network-s-d.lib new file mode 100644 index 0000000..44aa3b4 Binary files /dev/null and b/mcclone/external/sfml23/lib/sfml-network-s-d.lib differ diff --git a/mcclone/external/sfml23/lib/sfml-network-s.lib b/mcclone/external/sfml23/lib/sfml-network-s.lib new file mode 100644 index 0000000..fc216c8 Binary files /dev/null and b/mcclone/external/sfml23/lib/sfml-network-s.lib differ diff --git a/mcclone/external/sfml23/lib/sfml-network.lib b/mcclone/external/sfml23/lib/sfml-network.lib new file mode 100644 index 0000000..6c58474 Binary files /dev/null and b/mcclone/external/sfml23/lib/sfml-network.lib differ diff --git a/mcclone/external/sfml23/lib/sfml-system-d.lib b/mcclone/external/sfml23/lib/sfml-system-d.lib new file mode 100644 index 0000000..22276ef Binary files /dev/null and b/mcclone/external/sfml23/lib/sfml-system-d.lib differ diff --git a/mcclone/external/sfml23/lib/sfml-system-s-d.lib b/mcclone/external/sfml23/lib/sfml-system-s-d.lib new file mode 100644 index 0000000..4467f5f Binary files /dev/null and b/mcclone/external/sfml23/lib/sfml-system-s-d.lib differ diff --git a/mcclone/external/sfml23/lib/sfml-system-s.lib b/mcclone/external/sfml23/lib/sfml-system-s.lib new file mode 100644 index 0000000..3d41c3b Binary files /dev/null and b/mcclone/external/sfml23/lib/sfml-system-s.lib differ diff --git a/mcclone/external/sfml23/lib/sfml-system.lib b/mcclone/external/sfml23/lib/sfml-system.lib new file mode 100644 index 0000000..6f458f7 Binary files /dev/null and b/mcclone/external/sfml23/lib/sfml-system.lib differ diff --git a/mcclone/external/sfml23/lib/sfml-window-d.lib b/mcclone/external/sfml23/lib/sfml-window-d.lib new file mode 100644 index 0000000..d6b3a38 Binary files /dev/null and b/mcclone/external/sfml23/lib/sfml-window-d.lib differ diff --git a/mcclone/external/sfml23/lib/sfml-window-s-d.lib b/mcclone/external/sfml23/lib/sfml-window-s-d.lib new file mode 100644 index 0000000..c01b5f2 Binary files /dev/null and b/mcclone/external/sfml23/lib/sfml-window-s-d.lib differ diff --git a/mcclone/external/sfml23/lib/sfml-window-s.lib b/mcclone/external/sfml23/lib/sfml-window-s.lib new file mode 100644 index 0000000..ea66f41 Binary files /dev/null and b/mcclone/external/sfml23/lib/sfml-window-s.lib differ diff --git a/mcclone/external/sfml23/lib/sfml-window.lib b/mcclone/external/sfml23/lib/sfml-window.lib new file mode 100644 index 0000000..fb3c96a Binary files /dev/null and b/mcclone/external/sfml23/lib/sfml-window.lib differ diff --git a/mcclone/external/sfml23/lib/vorbis.lib b/mcclone/external/sfml23/lib/vorbis.lib new file mode 100644 index 0000000..754a65f Binary files /dev/null and b/mcclone/external/sfml23/lib/vorbis.lib differ diff --git a/mcclone/external/sfml23/lib/vorbisenc.lib b/mcclone/external/sfml23/lib/vorbisenc.lib new file mode 100644 index 0000000..02446e4 Binary files /dev/null and b/mcclone/external/sfml23/lib/vorbisenc.lib differ diff --git a/mcclone/external/sfml23/lib/vorbisfile.lib b/mcclone/external/sfml23/lib/vorbisfile.lib new file mode 100644 index 0000000..8cce75d Binary files /dev/null and b/mcclone/external/sfml23/lib/vorbisfile.lib differ diff --git a/mcclone/main.cpp b/mcclone/main.cpp new file mode 100644 index 0000000..c88e99a --- /dev/null +++ b/mcclone/main.cpp @@ -0,0 +1,9 @@ +#include +#include +#include "engine.h" + +int main() { + Engine engine; + engine.SetMaxFps(60); + engine.Start("Syndicat Quebecois de la Construction Simulator 2021", 640, 480, false); +} diff --git a/mcclone/matrix4.h b/mcclone/matrix4.h new file mode 100644 index 0000000..a0d911a --- /dev/null +++ b/mcclone/matrix4.h @@ -0,0 +1,571 @@ +#ifndef MATRIX4_H__ +#define MATRIX4_H__ + +#include +#include +#include + +#include "define.h" +#include "vector3.h" + +#ifndef M_PI +#define M_PI 3.14159265f +#endif + +#define DEGTORAD(x) ((x * M_PI) / 180.f) +#define RADTODEG(x) ((180.f * x) / M_PI) + +template +class Matrix4 +{ + public: + typedef T Type; + + public: + static const Matrix4 ZERO; + static const Matrix4 IDENTITY; + + public: + Matrix4(); + Matrix4(const T& v); + Matrix4(const Matrix4& m); + Matrix4(const T& m_11, const T& m_12, const T& m_13, const T& m_14, + const T& m_21, const T& m_22, const T& m_23, const T& m_24, + const T& m_31, const T& m_32, const T& m_33, const T& m_34, + const T& m_41, const T& m_42, const T& m_43, const T& m_44); + + const T& Get11() const; + const T& Get12() const; + const T& Get13() const; + const T& Get14() const; + const T& Get21() const; + const T& Get22() const; + const T& Get23() const; + const T& Get24() const; + const T& Get31() const; + const T& Get32() const; + const T& Get33() const; + const T& Get34() const; + const T& Get41() const; + const T& Get42() const; + const T& Get43() const; + const T& Get44() const; + + Matrix4& operator=(const Matrix4& m); + + Matrix4 operator+(const Matrix4& m) const; + const Matrix4& operator+=(const Matrix4& m); + + Matrix4 operator-(const Matrix4& m) const; + Matrix4 operator-() const; + const Matrix4& operator-=(const Matrix4& m); + + Matrix4 operator*(const Matrix4& m) const; + Matrix4 operator*(const T& v) const; + const Matrix4& operator*=(const Matrix4& m); + const Matrix4& operator*=(const T& v); + + Matrix4 operator/(const T& v) const; + const Matrix4& operator/=(const T& v); + + bool operator==(const Matrix4& m) const; + bool operator!=(const Matrix4& m) const; + + void SetZero(); + void SetIdentity(); + void SetPerspectiveProjection(const T& fov, const T& aspect, const T& nearPlane, const T& farPlane); + void SetOrthographicProjection(const T& left, const T& right, const T& bottom, const T& top, const T& nearPlane, const T& farPlane); + + void SetLookAt(const Vector3& eyePosition, const Vector3& lookAtPosition, Vector3 upVector = Vector3(T(0), T(1), T(0))); + + bool IsZero() const; + bool IsIdentity() const; + + void ApplyTranslation(const T& x, const T& y, const T& z); + void ApplyRotation(const T& angle, const T& x, const T& y, const T& z); + void ApplyScale(const T& x, const T& y, const T& z); + + Vector3 GetTranslation() const; + + const T* GetInternalValues() const; + T* GetInternalValues(); + std::string ToString(const std::string& lineBegin = "|", const std::string& lineEnd = "|\n") const; + + private: + union { + // column-major matrix + struct + { + T m_11, m_21, m_31, m_41, m_12, m_22, m_32, m_42, m_13, m_23, m_33, m_43, m_14, m_24, m_34, m_44; + }; + T m_values[16]; + }; +}; + +typedef Matrix4 Matrix4i; +typedef Matrix4 Matrix4f; +typedef Matrix4 Matrix4d; + +template +const Matrix4 Matrix4::ZERO = Matrix4(0); + +template +const Matrix4 Matrix4::IDENTITY = Matrix4( + 1, 0, 0, 0, + 0, 1, 0, 0, + 0, 0, 1, 0, + 0, 0, 0, 1); + + template +std::ostream& operator<<(std::ostream& out, const Matrix4& m) +{ + out << m.ToString(); + return out; +} + + template +Matrix4::Matrix4() +{ + // Leave matrix uninitialized +} + + template +Matrix4::Matrix4(const T& v) +{ + for(int i = 0; i < 16; ++i) + m_values[i] = v; +} + + template +Matrix4::Matrix4(const Matrix4& m) +{ + for(int i = 0; i < 16; ++i) + m_values[i] = m.m_values[i]; +} + + template +Matrix4::Matrix4(const T& m_11, const T& m_12, const T& m_13, const T& m_14, + const T& m_21, const T& m_22, const T& m_23, const T& m_24, + const T& m_31, const T& m_32, const T& m_33, const T& m_34, + const T& m_41, const T& m_42, const T& m_43, const T& m_44) +{ + this->m_11 = m_11; + this->m_12 = m_12; + this->m_13 = m_13; + this->m_14 = m_14; + this->m_21 = m_21; + this->m_22 = m_22; + this->m_23 = m_23; + this->m_24 = m_24; + this->m_31 = m_31; + this->m_32 = m_32; + this->m_33 = m_33; + this->m_34 = m_34; + this->m_41 = m_41; + this->m_42 = m_42; + this->m_43 = m_43; + this->m_44 = m_44; +} + +template +const T& Matrix4::Get11() const +{ + return m_11; +} + +template +const T& Matrix4::Get12() const +{ + return m_12; +} + +template +const T& Matrix4::Get13() const +{ + return m_13; +} + +template +const T& Matrix4::Get14() const +{ + return m_14; +} + +template +const T& Matrix4::Get21() const +{ + return m_21; +} + +template +const T& Matrix4::Get22() const +{ + return m_22; +} + +template +const T& Matrix4::Get23() const +{ + return m_23; +} + +template +const T& Matrix4::Get24() const +{ + return m_24; +} + +template +const T& Matrix4::Get31() const +{ + return m_31; +} + +template +const T& Matrix4::Get32() const +{ + return m_32; +} + +template +const T& Matrix4::Get33() const +{ + return m_33; +} + +template +const T& Matrix4::Get34() const +{ + return m_34; +} + +template +const T& Matrix4::Get41() const +{ + return m_41; +} + +template +const T& Matrix4::Get42() const +{ + return m_42; +} + +template +const T& Matrix4::Get43() const +{ + return m_43; +} + +template +const T& Matrix4::Get44() const +{ + return m_44; +} + + template +Matrix4& Matrix4::operator=(const Matrix4& m) +{ + if(this != &m) + { + for(int i = 0; i < 16; ++i) + m_values[i] = m.m_values[i]; + } + + return *this; +} + +template +Matrix4 Matrix4::operator+(const Matrix4& m) const +{ + return Matrix4( + m_11 + m.m_11, m_12 + m.m_12, m_13 + m.m_13, m_14 + m.m_14, + m_21 + m.m_21, m_22 + m.m_22, m_23 + m.m_23, m_24 + m.m_24, + m_31 + m.m_31, m_32 + m.m_32, m_33 + m.m_33, m_34 + m.m_34, + m_41 + m.m_41, m_42 + m.m_42, m_43 + m.m_43, m_44 + m.m_44); +} + + template +const Matrix4& Matrix4::operator+=(const Matrix4& m) +{ + *this = *this + m; + return *this; +} + +template +Matrix4 Matrix4::operator-(const Matrix4& m) const +{ + return Matrix4( + m_11 - m.m_11, m_12 - m.m_12, m_13 - m.m_13, m_14 - m.m_14, + m_21 - m.m_21, m_22 - m.m_22, m_23 - m.m_23, m_24 - m.m_24, + m_31 - m.m_31, m_32 - m.m_32, m_33 - m.m_33, m_34 - m.m_34, + m_41 - m.m_41, m_42 - m.m_42, m_43 - m.m_43, m_44 - m.m_44); +} + +template +Matrix4 Matrix4::operator-() const +{ + return Matrix4( + -m_11, -m_12, -m_13, -m_14, + -m_21, -m_22, -m_23, -m_24, + -m_31, -m_32, -m_33, -m_34, + -m_41, -m_42, -m_43, -m_44); +} + + template +const Matrix4& Matrix4::operator-=(const Matrix4& m) +{ + *this = *this - m; + return *this; +} + +template +Matrix4 Matrix4::operator*(const Matrix4& m) const +{ + return Matrix4( + m_11 * m.m_11 + m_12 * m.m_21 + m_13 * m.m_31 + m_14 * m.m_41, + m_11 * m.m_12 + m_12 * m.m_22 + m_13 * m.m_32 + m_14 * m.m_42, + m_11 * m.m_13 + m_12 * m.m_23 + m_13 * m.m_33 + m_14 * m.m_43, + m_11 * m.m_14 + m_12 * m.m_24 + m_13 * m.m_34 + m_14 * m.m_44, + + m_21 * m.m_11 + m_22 * m.m_21 + m_23 * m.m_31 + m_24 * m.m_41, + m_21 * m.m_12 + m_22 * m.m_22 + m_23 * m.m_32 + m_24 * m.m_42, + m_21 * m.m_13 + m_22 * m.m_23 + m_23 * m.m_33 + m_24 * m.m_43, + m_21 * m.m_14 + m_22 * m.m_24 + m_23 * m.m_34 + m_24 * m.m_44, + + m_31 * m.m_11 + m_32 * m.m_21 + m_33 * m.m_31 + m_34 * m.m_41, + m_31 * m.m_12 + m_32 * m.m_22 + m_33 * m.m_32 + m_34 * m.m_42, + m_31 * m.m_13 + m_32 * m.m_23 + m_33 * m.m_33 + m_34 * m.m_43, + m_31 * m.m_14 + m_32 * m.m_24 + m_33 * m.m_34 + m_34 * m.m_44, + + m_41 * m.m_11 + m_42 * m.m_21 + m_43 * m.m_31 + m_44 * m.m_41, + m_41 * m.m_12 + m_42 * m.m_22 + m_43 * m.m_32 + m_44 * m.m_42, + m_41 * m.m_13 + m_42 * m.m_23 + m_43 * m.m_33 + m_44 * m.m_43, + m_41 * m.m_14 + m_42 * m.m_24 + m_43 * m.m_34 + m_44 * m.m_44); +} + +template +Matrix4 Matrix4::operator*(const T& v) const +{ + return Matrix4( + m_11 * v, m_12 * v, m_13 * v, m_14 * v, + m_21 * v, m_22 * v, m_23 * v, m_24 * v, + m_31 * v, m_32 * v, m_33 * v, m_34 * v, + m_41 * v, m_42 * v, m_43 * v, m_44 * v); +} + + template +const Matrix4& Matrix4::operator*=(const Matrix4& m) +{ + *this = *this * m; + return *this; +} + + template +const Matrix4& Matrix4::operator*=(const T& v) +{ + *this = *this * v; + return *this; +} + +template +Matrix4 Matrix4::operator/(const T& v) const +{ + return Matrix4( + m_11 / v, m_12 / v, m_13 / v, m_14 / v, + m_21 / v, m_22 / v, m_23 / v, m_24 / v, + m_31 / v, m_32 / v, m_33 / v, m_34 / v, + m_41 / v, m_42 / v, m_43 / v, m_44 / v); +} + + template +const Matrix4& Matrix4::operator/=(const T& v) +{ + *this = *this / v; + return *this; +} + +template +bool Matrix4::operator==(const Matrix4& m) const +{ + for(int i = 0; i < 16; ++i) + if(m_values[i] != m.m_values[i]) + return false; + + return true; +} + +template +bool Matrix4::operator!=(const Matrix4& m) const +{ + return !(*this == m); +} + + template +void Matrix4::SetZero() +{ + *this = ZERO; +} + + template +void Matrix4::SetIdentity() +{ + *this = IDENTITY; +} + + template +void Matrix4::SetPerspectiveProjection(const T& fov, const T& aspect, const T& nearPlane, const T& farPlane) +{ + const float h = T(1) / tan(fov * T(M_PI / 360.f)); + T negDepth = nearPlane - farPlane; + + SetZero(); + + m_11 = h / aspect; + m_22 = h; + m_33 = (farPlane + nearPlane) / negDepth; + m_34 = T(2) * (nearPlane * farPlane) / negDepth; + m_43 = -T(1); +} + + template +void Matrix4::SetOrthographicProjection(const T& left, const T& right, const T& bottom, const T& top, const T& nearPlane, const T& farPlane) +{ + m_11 = T(2) / (right - left); + m_12 = T(0); + m_13 = T(0); + m_14 = -(right + left) / (right - left); + + m_21 = T(0); + m_22 = T(2) / (top - bottom); + m_23 = T(0); + m_24 = -(top + bottom) / (top - bottom); + + m_31 = T(0); + m_32 = T(0); + m_33 = -T(2) / (farPlane - nearPlane); + m_34 = -(farPlane + nearPlane) / (farPlane - nearPlane); + + m_41 = T(0); + m_42 = T(0); + m_43 = T(0); + m_44 = T(1); +} + + template +void Matrix4::SetLookAt(const Vector3& eyePosition, const Vector3& lookAtPosition, Vector3 upVector) +{ + Vector3f L = lookAtPosition - eyePosition; + L.Normalize(); + + upVector.Normalize(); + Vector3f S = L.Cross(upVector); + S.Normalize(); + + Vector3f U = S.Cross(L); + + Matrix4 M; + M.m_11 = S.x; + M.m_12 = S.y; + M.m_13 = S.z; + M.m_14 = 0; + + M.m_21 = U.x; + M.m_22 = U.y; + M.m_23 = U.z; + M.m_24 = 0; + + M.m_31 = -L.x; + M.m_32 = -L.y; + M.m_33 = -L.z; + M.m_34 = 0; + + M.m_41 = 0; + M.m_42 = 0; + M.m_43 = 0; + M.m_44 = 1.f; + + SetIdentity(); + *this *= M; + ApplyTranslation(-eyePosition.x, -eyePosition.y, -eyePosition.z); +} + + template +void Matrix4::ApplyTranslation(const T& x, const T& y, const T& z) +{ + Matrix4 tmp( + 1, 0, 0, x, + 0, 1, 0, y, + 0, 0, 1, z, + 0, 0, 0, 1); + + *this *= tmp; +} + + template +void Matrix4::ApplyRotation(const T& angle, const T& x, const T& y, const T& z) +{ + // TODO axis (x, y, z) must be normalized... + + T s = sin(DEGTORAD(angle)); + T c = cos(DEGTORAD(angle)); + T ic = T(1) - c; + + Matrix4 tmp( + x * x * ic + c, y * x * ic + (z * s), z * x * ic - (y * s), 0, + x * y * ic - (z * s), y * y * ic + c, z * y * ic + (x * s), 0, + x * z * ic + (y * s), y * z * ic - (x * s), z * z * ic + c, 0, + 0, 0, 0, 1); + + *this *= tmp; +} + + template +void Matrix4::ApplyScale(const T& x, const T& y, const T& z) +{ + Matrix4 tmp( + x, 0, 0, 0, + 0, y, 0, 0, + 0, 0, z, 0, + 0, 0, 0, 1); + + *this *= tmp; +} + +template +Vector3 Matrix4::GetTranslation() const +{ + // NOTE: Works only if the matrix doesn't contains scale information (only rotation and translation) + // Reference: http://www.gamedev.net/topic/397751-how-to-get-camera-position/ + T x = -(m_11 * m_14 + m_21 * m_24 + m_31 * m_34); + T y = -(m_12 * m_14 + m_22 * m_24 + m_32 * m_34); + T z = -(m_13 * m_14 + m_23 * m_24 + m_33 * m_34); + + return Vector3(x, y, z); +} + + template +T* Matrix4::GetInternalValues() +{ + return m_values; +} + +template +const T* Matrix4::GetInternalValues() const +{ + return m_values; +} + +template +std::string Matrix4::ToString(const std::string& lineBegin, const std::string& lineEnd) const +{ + std::ostringstream ss; + ss << lineBegin << m_11 << " " << m_12 << " " << m_13 << " " << m_14 << lineEnd; + ss << lineBegin << m_21 << " " << m_22 << " " << m_23 << " " << m_24 << lineEnd; + ss << lineBegin << m_31 << " " << m_32 << " " << m_33 << " " << m_34 << lineEnd; + ss << lineBegin << m_41 << " " << m_42 << " " << m_43 << " " << m_44 << lineEnd; + + return ss.str(); +} + +#endif // MATRIX4_H__ diff --git a/mcclone/mcclone.vcxproj b/mcclone/mcclone.vcxproj new file mode 100644 index 0000000..ed5fe7b --- /dev/null +++ b/mcclone/mcclone.vcxproj @@ -0,0 +1,114 @@ + + + + + Debug + Win32 + + + Release + Win32 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + {A21FD938-1FEA-4687-AB86-0EABAC30877B} + Win32Proj + mcclone + 10.0 + SQCSim2021 + + + + Application + true + Unicode + v142 + + + Application + false + true + Unicode + v142 + + + + + + + + + + + + + true + external\devil178\include;external\sfml23\include;$(IncludePath) + external\devil178\lib;external\sfml23\lib;$(LibraryPath) + + + false + external\sfml23\include;external\devil178\include;external\glew170\include;$(IncludePath) + external\sfml23\lib;external\devil178\lib;external\glew170\lib;$(LibraryPath) + + + + + + Level3 + Disabled + WIN32;_DEBUG;_CONSOLE;NOMINMAX;%(PreprocessorDefinitions) + + + Console + true + sfml-main-d.lib;sfml-system-d.lib;sfml-window-d.lib;sfml-graphics-d.lib;GlU32.Lib;OpenGL32.Lib;DevIL.lib;ILU.lib;ILUT.lib;%(AdditionalDependencies) + + + + + Level3 + + + MaxSpeed + true + true + WIN32;NDEBUG;_CONSOLE;NOMINMAX;%(PreprocessorDefinitions) + + + Console + true + true + true + sfml-main.lib;sfml-system.lib;sfml-window.lib;sfml-graphics.lib;GlU32.Lib;OpenGL32.Lib;DevIL.lib;ILU.lib;ILUT.lib;%(AdditionalDependencies) + + + + + + \ No newline at end of file diff --git a/mcclone/mcclone.vcxproj.filters b/mcclone/mcclone.vcxproj.filters new file mode 100644 index 0000000..5ae06f2 --- /dev/null +++ b/mcclone/mcclone.vcxproj.filters @@ -0,0 +1,74 @@ + + + + + {4FC737F1-C7A5-4376-A066-2A32D752A2FF} + cpp;c;cc;cxx;def;odl;idl;hpj;bat;asm;asmx + + + {93995380-89BD-4b04-88EB-625FBE52EBFB} + h;hpp;hxx;hm;inl;inc;xsd + + + + + Fichiers d%27en-tête + + + Fichiers d%27en-tête + + + Fichiers d%27en-tête + + + Fichiers d%27en-tête + + + Fichiers d%27en-tête + + + Fichiers d%27en-tête + + + Fichiers d%27en-tête + + + Fichiers d%27en-tête + + + Fichiers d%27en-tête + + + Fichiers d%27en-tête + + + + + Fichiers sources + + + Fichiers sources + + + Fichiers sources + + + Fichiers sources + + + Fichiers sources + + + Fichiers sources + + + Fichiers sources + + + Fichiers sources + + + + + + \ No newline at end of file diff --git a/mcclone/media/textures/checker.png b/mcclone/media/textures/checker.png new file mode 100644 index 0000000..d3f5383 Binary files /dev/null and b/mcclone/media/textures/checker.png differ diff --git a/mcclone/notes.txt b/mcclone/notes.txt new file mode 100644 index 0000000..e1cd57c --- /dev/null +++ b/mcclone/notes.txt @@ -0,0 +1,5 @@ +Keycodes: +W 22 +A 0 +S 18 +D 3 \ No newline at end of file diff --git a/mcclone/openglcontext.cpp b/mcclone/openglcontext.cpp new file mode 100644 index 0000000..356d22e --- /dev/null +++ b/mcclone/openglcontext.cpp @@ -0,0 +1,172 @@ +#include "openglcontext.h" +#include "define.h" + +OpenglContext::OpenglContext() : m_maxFps(999999), m_fullscreen(false), m_title(""), m_lastFrameTime(0) +{ +} + +OpenglContext::~OpenglContext() +{ +} + +bool OpenglContext::Start(const std::string& title, int width, int height, bool fullscreen) +{ + m_title = title; + m_fullscreen = fullscreen; + InitWindow(width, height); + + Init(); + LoadResource(); + + sf::Clock clock; + + while (m_app.isOpen()) + { + clock.restart(); + + sf::Event Event; + while (m_app.pollEvent(Event)) + { + switch(Event.type) + { + case sf::Event::Closed: + m_app.close(); + break; + case sf::Event::Resized: + glViewport(0, 0, Event.size.width, Event.size.height); + break; + case sf::Event::KeyPressed: + KeyPressEvent(Event.key.code); + break; + case sf::Event::KeyReleased: + KeyReleaseEvent(Event.key.code); + break; + case sf::Event::MouseMoved: + MouseMoveEvent(Event.mouseMove.x, Event.mouseMove.y); + break; + case sf::Event::MouseButtonPressed: + MousePressEvent(ConvertMouseButton(Event.mouseButton.button), Event.mouseButton.x, Event.mouseButton.y); + break; + case sf::Event::MouseButtonReleased: + MouseReleaseEvent(ConvertMouseButton(Event.mouseButton.button), Event.mouseButton.x, Event.mouseButton.y); + break; + case sf::Event::MouseWheelMoved: + if(Event.mouseWheel.delta > 0) + MousePressEvent(MOUSE_BUTTON_WHEEL_UP, Event.mouseButton.x, Event.mouseButton.y); + else + MousePressEvent(MOUSE_BUTTON_WHEEL_DOWN, Event.mouseButton.x, Event.mouseButton.y); + break; + } + } + + m_app.setActive(); + Render(m_lastFrameTime); + m_app.display(); + + m_lastFrameTime = clock.getElapsedTime().asSeconds(); + + // Handle ourself frame rate limit, sf::Window::setFramerateLimit doesn't seems to work + float waitTime = (1.f / m_maxFps) - m_lastFrameTime; + if(waitTime > 0) + { + sf::sleep(sf::seconds(waitTime)); + + m_lastFrameTime = clock.getElapsedTime().asSeconds(); + } + } + + UnloadResource(); + DeInit(); + + return true; +} + +bool OpenglContext::Stop() +{ + m_app.close(); + return true; +} + +void OpenglContext::CenterMouse() +{ + sf::Mouse::setPosition(sf::Vector2i(Width() / 2, Height() / 2), m_app); +} + +int OpenglContext::Width() const +{ + return m_app.getSize().x; +} + +int OpenglContext::Height() const +{ + return m_app.getSize().y; +} + +void OpenglContext::SetMaxFps(int maxFps) +{ + m_maxFps = maxFps; + m_app.setFramerateLimit(maxFps); +} + +int OpenglContext::GetMaxFps() const +{ + return m_maxFps; +} + +void OpenglContext::SetFullscreen(bool fullscreen) +{ + if(m_fullscreen == fullscreen) + return; + + m_fullscreen = !m_fullscreen; + + DeInit(); + InitWindow(Width(), Height()); + Init(); +} + +bool OpenglContext::IsFullscreen() const +{ + return m_fullscreen; +} + +void OpenglContext::MakeRelativeToCenter(int& x, int& y) const +{ + x = x - (Width() / 2); + y = y - (Height() / 2); +} + +void OpenglContext::ShowCursor() +{ + m_app.setMouseCursorVisible(true); +} + +void OpenglContext::HideCursor() +{ + m_app.setMouseCursorVisible(false); +} + +void OpenglContext::ShowCrossCursor() const +{ +} + +void OpenglContext::InitWindow(int width, int height) +{ + m_app.create(sf::VideoMode(width, height, 32), m_title.c_str(), m_fullscreen ? sf::Style::Fullscreen : (sf::Style::Resize|sf::Style::Close), sf::ContextSettings(32, 8, 0)); +} + +OpenglContext::MOUSE_BUTTON OpenglContext::ConvertMouseButton(sf::Mouse::Button button) const +{ + switch(button) + { + case sf::Mouse::Left: + return MOUSE_BUTTON_LEFT; + case sf::Mouse::Middle: + return MOUSE_BUTTON_MIDDLE; + case sf::Mouse::Right: + return MOUSE_BUTTON_RIGHT; + default: + return MOUSE_BUTTON_NONE; + } +} + diff --git a/mcclone/openglcontext.h b/mcclone/openglcontext.h new file mode 100644 index 0000000..5b116f4 --- /dev/null +++ b/mcclone/openglcontext.h @@ -0,0 +1,68 @@ +#ifndef OPENGLCONTEXT_H__ +#define OPENGLCONTEXT_H__ + +#include "define.h" + +#include +#include + +// Documentation de SFML: http://www.sfml-dev.org/documentation/index-fr.php +class OpenglContext +{ +public: + enum MOUSE_BUTTON { + MOUSE_BUTTON_NONE = 0x00, + MOUSE_BUTTON_LEFT = 0x01, + MOUSE_BUTTON_MIDDLE = 0x02, + MOUSE_BUTTON_RIGHT = 0x04, + MOUSE_BUTTON_WHEEL_UP = 0x08, + MOUSE_BUTTON_WHEEL_DOWN = 0x10 + }; + OpenglContext(); + virtual ~OpenglContext(); + + virtual void Init() = 0; + virtual void DeInit() = 0; + virtual void LoadResource() = 0; + virtual void UnloadResource() = 0; + virtual void Render(float elapsedTime) = 0; + virtual void KeyPressEvent(unsigned char key) = 0; + virtual void KeyReleaseEvent(unsigned char key) = 0; + virtual void MouseMoveEvent(int x, int y) = 0; + virtual void MousePressEvent(const MOUSE_BUTTON &button, int x, int y) = 0; + virtual void MouseReleaseEvent(const MOUSE_BUTTON &button, int x, int y) = 0; + + + bool Start(const std::string& title, int width, int height, bool fullscreen); + bool Stop(); + + int Width() const; + int Height() const; + + void SetMaxFps(int maxFps); + int GetMaxFps() const; + + void SetFullscreen(bool fullscreen); + bool IsFullscreen() const; + +protected: + void CenterMouse(); + void MakeRelativeToCenter(int& x, int& y) const; + + void ShowCursor(); + void HideCursor(); + void ShowCrossCursor() const; + +private: + void InitWindow(int width, int height); + MOUSE_BUTTON ConvertMouseButton(sf::Mouse::Button button) const; + +private: + sf::Window m_app; + int m_maxFps; + bool m_fullscreen; + std::string m_title; + float m_lastFrameTime; +}; + +#endif // OPENGLCONTEXT_H__ diff --git a/mcclone/texture.cpp b/mcclone/texture.cpp new file mode 100644 index 0000000..f7d98b5 --- /dev/null +++ b/mcclone/texture.cpp @@ -0,0 +1,64 @@ +#include "texture.h" +#include + +Texture::Texture(const std::string& filename) : m_isValid(false) +{ + if(filename != "") + Load(filename); +} + +Texture::~Texture() +{ + if(IsValid()) + glDeleteTextures(1, &m_textureId); +} + + +bool Texture::Load(const std::string& filename) +{ + // Initialize Devil only once: + static bool alreadyInitialized = false; + if(!alreadyInitialized) + { + ilInit(); + alreadyInitialized = true; + } + + // Use Devil library to load image data in memory + ILuint texid; + ilGenImages(1, &texid); + ilBindImage(texid); + + ilOriginFunc(IL_ORIGIN_LOWER_LEFT); + ilEnable(IL_ORIGIN_SET); + + if (!ilLoadImage((const ILstring)filename.c_str())) + return false; + + if (!ilConvertImage(IL_RGBA, IL_UNSIGNED_BYTE)) + return false; + + // Create mipmapped opengl texture from image data + glGenTextures(1, &m_textureId); + glBindTexture(GL_TEXTURE_2D, m_textureId); + + gluBuild2DMipmaps(GL_TEXTURE_2D, 4, ilGetInteger(IL_IMAGE_WIDTH), ilGetInteger(IL_IMAGE_HEIGHT), ilGetInteger(IL_IMAGE_FORMAT), GL_UNSIGNED_BYTE, ilGetData()); + glTexParameteri(GL_TEXTURE_2D, GL_TEXTURE_MIN_FILTER, GL_LINEAR_MIPMAP_LINEAR); + glTexParameteri(GL_TEXTURE_2D, GL_TEXTURE_MAG_FILTER, GL_LINEAR); + ilDeleteImages(1, &texid); + + m_isValid = true; + return true; +} + +bool Texture::IsValid() const +{ + return m_isValid; +} + +void Texture::Bind() const +{ + assert(IsValid()); + glBindTexture(GL_TEXTURE_2D, m_textureId); +} + diff --git a/mcclone/texture.h b/mcclone/texture.h new file mode 100644 index 0000000..6e88180 --- /dev/null +++ b/mcclone/texture.h @@ -0,0 +1,23 @@ +#ifndef TEXTURE_H__ +#define TEXTURE_H__ + +#include "define.h" +#include +#include + +class Texture +{ +public: + Texture(const std::string& filename = ""); + ~Texture(); + + bool Load(const std::string& filename); + bool IsValid() const; + void Bind() const; + +private: + GLuint m_textureId; + bool m_isValid; +}; + +#endif // TEXTURE_H__ diff --git a/mcclone/transformation.cpp b/mcclone/transformation.cpp new file mode 100644 index 0000000..7629f52 --- /dev/null +++ b/mcclone/transformation.cpp @@ -0,0 +1,63 @@ +#include "transformation.h" + +Transformation::Transformation() +{ + m_stack.push(Matrix4f::IDENTITY); +} + +void Transformation::SetIdentity() +{ + m_stack.top().SetIdentity(); +} + +void Transformation::Push() +{ + m_stack.push(m_stack.top()); +} + +void Transformation::Pop() +{ + m_stack.pop(); +} + +void Transformation::ApplyTranslation(float x, float y, float z) +{ + m_stack.top().ApplyTranslation(x, y, z); +} + +void Transformation::ApplyTranslation(const Vector3f& v) +{ + ApplyTranslation(v.x, v.y, v.z); +} + + +void Transformation::ApplyRotation(float angle, float x, float y, float z) +{ + m_stack.top().ApplyRotation(angle, x, y, z); +} + +void Transformation::ApplyRotation(float angle, const Vector3f& v) +{ + ApplyRotation(angle, v.x, v.y, v.z); +} + +void Transformation::ApplyScale(float x, float y, float z) +{ + m_stack.top().ApplyScale(x, y, z); +} + +void Transformation::ApplyScale(const Vector3f& v) +{ + ApplyScale(v.x, v.y, v.z); +} + +void Transformation::Use() const +{ + glLoadMatrixf(m_stack.top().GetInternalValues()); +} + +const Matrix4f& Transformation::GetMatrix() const +{ + return m_stack.top(); +} + diff --git a/mcclone/transformation.h b/mcclone/transformation.h new file mode 100644 index 0000000..d147a58 --- /dev/null +++ b/mcclone/transformation.h @@ -0,0 +1,35 @@ +#ifndef TRANSFORMATION_H__ +#define TRANSFORMATION_H__ + +#include "matrix4.h" +#include "vector3.h" +#include + +class Transformation +{ + public: + Transformation(); + + void SetIdentity(); + + void Push(); + void Pop(); + + void ApplyTranslation(float x, float y, float z); + void ApplyTranslation(const Vector3f& v); + + void ApplyRotation(float angle, float x, float y, float z); + void ApplyRotation(float angle, const Vector3f& v); + + void ApplyScale(float x, float y, float z); + void ApplyScale(const Vector3f& v); + + void Use() const; + + const Matrix4f& GetMatrix() const; + + private: + std::stack m_stack; +}; + +#endif // TRANSFORMATION_H__ diff --git a/mcclone/vector3.h b/mcclone/vector3.h new file mode 100644 index 0000000..b191681 --- /dev/null +++ b/mcclone/vector3.h @@ -0,0 +1,219 @@ +#ifndef VECTOR3_H__ +#define VECTOR3_H__ + +#include +#include + +template +class Vector3 +{ +public: + Vector3(); + Vector3(const T& x, const T& y, const T& z); + ~Vector3(); + + T Length() const; + void Normalize(); + void Zero(); + + T Dot(const Vector3& v) const; + Vector3 Cross(const Vector3& v) const; + + Vector3 operator+(const Vector3& v) const; + Vector3 operator-(const Vector3& v) const; + Vector3 operator-() const; + Vector3 operator+(const T& v) const; + Vector3 operator-(const T& v) const; + Vector3 operator/(const T& v) const; + Vector3 operator*(const T& v) const; + + Vector3& operator=(const Vector3& v); + + Vector3& operator+=(const Vector3& v); + Vector3& operator-=(const Vector3& v); + Vector3& operator+=(const T& v); + Vector3& operator-=(const T& v); + Vector3& operator/=(const T& v); + Vector3& operator*=(const T& v); + + bool operator==(const Vector3& v) const; + bool operator!=(const Vector3& v) const; + + void Afficher() const; + +public: + T x, y, z; +}; + +typedef Vector3 Vector3i; +typedef Vector3 Vector3f; + +template +inline std::ostream& operator<<(std::ostream& out, const Vector3& v) +{ + out << "[" << v.x << ", " << v.y << ", " << v.z << "]"; + return out; +} + + +template +Vector3::Vector3() +{ +} + +template +Vector3::Vector3(const T& x, const T& y, const T& z) : x(x), y(y), z(z) +{ +} + +template +Vector3::~Vector3() +{ +} + +template +T Vector3::Length() const +{ + return sqrt(x*x + y*y + z*z); +} + +template +void Vector3::Normalize() +{ + T len = Length(); + if (len != 0) + { + x /= len; + y /= len; + z /= len; + } +} + +template +void Vector3::Zero() +{ + x = y = z = 0; +} + +template +T Vector3::Dot(const Vector3& v) const +{ + return (x * v.x) + (y * v.y) + (z * v.z); +} + +template +Vector3 Vector3::Cross(const Vector3& v) const +{ + return Vector3( + y * v.z - v.y * z, + z * v.x - v.z * x, + x * v.y - v.x * y); +} + +template +Vector3 Vector3::operator+(const Vector3& v) const +{ + return Vector3(x + v.x, y + v.y, z + v.z); +} + +template +Vector3 Vector3::operator-(const Vector3& v) const +{ + return Vector3(x - v.x, y - v.y, z - v.z); +} + +template +Vector3 Vector3::operator-() const +{ + return Vector3(-x, -y, -z); +} + +template +Vector3 Vector3::operator+(const T& v) const +{ + return Vector3(x + v, y + v, z + v); +} + +template +Vector3 Vector3::operator-(const T& v) const +{ + return Vector3(x - v, y - v, z - v); +} + +template +Vector3 Vector3::operator/(const T& v) const +{ + return Vector3(x / v, y / v, z / v); +} + +template +Vector3 Vector3::operator*(const T& v) const +{ + return Vector3(x * v, y * v, z * v); +} + +template +Vector3& Vector3::operator=(const Vector3& v) +{ + x = v.x; + y = v.y; + z = v.z; + return *this; +} + +template +Vector3& Vector3::operator+=(const Vector3& v) +{ + return (*this = *this + v); +} + +template +Vector3& Vector3::operator-=(const Vector3& v) +{ + return (*this = *this - v); +} + +template +Vector3& Vector3::operator+=(const T& v) +{ + return (*this = *this + v); +} + +template +Vector3& Vector3::operator-=(const T& v) +{ + return (*this = *this - v); +} + +template +Vector3& Vector3::operator/=(const T& v) +{ + return (*this = *this / v); +} + +template +Vector3& Vector3::operator*=(const T& v) +{ + return (*this = *this * v); +} + +template +bool Vector3::operator==(const Vector3& v) const +{ + return (x == v.x && y == v.y && z == v.z); +} + +template +bool Vector3::operator!=(const Vector3& v) const +{ + return !(*this == v); +} + +template +void Vector3::Afficher() const +{ + std::cout << "[" << x << ", " << y << ", " << z << "]" << std::endl; +} + + +#endif // VECTOR3_H__